mirror of
https://github.com/haproxy/haproxy.git
synced 2026-06-10 17:32:03 -04:00
7810 lines
236 KiB
C
7810 lines
236 KiB
C
/*
|
|
* HA-Proxy : High Availability-enabled HTTP/TCP proxy
|
|
* 2000-2005 - Willy Tarreau - willy AT meta-x DOT org.
|
|
*
|
|
* This program is free software; you can redistribute it and/or
|
|
* modify it under the terms of the GNU General Public License
|
|
* as published by the Free Software Foundation; either version
|
|
* 2 of the License, or (at your option) any later version.
|
|
*
|
|
* Please refer to RFC2068 or RFC2616 for informations about HTTP protocol, and
|
|
* RFC2965 for informations about cookies usage. More generally, the IETF HTTP
|
|
* Working Group's web site should be consulted for protocol related changes :
|
|
*
|
|
* http://ftp.ics.uci.edu/pub/ietf/http/
|
|
*
|
|
* Pending bugs (may be not fixed because never reproduced) :
|
|
* - solaris only : sometimes, an HTTP proxy with only a dispatch address causes
|
|
* the proxy to terminate (no core) if the client breaks the connection during
|
|
* the response. Seen on 1.1.8pre4, but never reproduced. May not be related to
|
|
* the snprintf() bug since requests were simple (GET / HTTP/1.0), but may be
|
|
* related to missing setsid() (fixed in 1.1.15)
|
|
* - a proxy with an invalid config will prevent the startup even if disabled.
|
|
*
|
|
* ChangeLog has moved to the CHANGELOG file.
|
|
*
|
|
* TODO:
|
|
* - handle properly intermediate incomplete server headers. Done ?
|
|
* - handle hot-reconfiguration
|
|
* - fix client/server state transition when server is in connect or headers state
|
|
* and client suddenly disconnects. The server *should* switch to SHUT_WR, but
|
|
* still handle HTTP headers.
|
|
* - remove MAX_NEWHDR
|
|
* - cut this huge file into several ones
|
|
*
|
|
*/
|
|
|
|
#include <stdio.h>
|
|
#include <stdlib.h>
|
|
#include <unistd.h>
|
|
#include <string.h>
|
|
#include <ctype.h>
|
|
#include <sys/time.h>
|
|
#include <sys/types.h>
|
|
#include <sys/socket.h>
|
|
#include <netinet/tcp.h>
|
|
#include <netinet/in.h>
|
|
#include <arpa/inet.h>
|
|
#include <netdb.h>
|
|
#include <fcntl.h>
|
|
#include <errno.h>
|
|
#include <signal.h>
|
|
#include <stdarg.h>
|
|
#include <sys/resource.h>
|
|
#include <time.h>
|
|
#include <regex.h>
|
|
#include <syslog.h>
|
|
#if defined(TPROXY) && defined(NETFILTER)
|
|
#include <linux/netfilter_ipv4.h>
|
|
#endif
|
|
|
|
#if defined(__dietlibc__)
|
|
#include <strings.h>
|
|
#endif
|
|
|
|
#if defined(ENABLE_POLL)
|
|
#include <sys/poll.h>
|
|
#endif
|
|
|
|
#if defined(ENABLE_EPOLL)
|
|
#if !defined(USE_MY_EPOLL)
|
|
#include <sys/epoll.h>
|
|
#else
|
|
#include "include/epoll.h"
|
|
#endif
|
|
#endif
|
|
|
|
#include "include/appsession.h"
|
|
|
|
#define HAPROXY_VERSION "1.2.5.2"
|
|
#define HAPROXY_DATE "2005/06/21"
|
|
|
|
/* this is for libc5 for example */
|
|
#ifndef TCP_NODELAY
|
|
#define TCP_NODELAY 1
|
|
#endif
|
|
|
|
#ifndef SHUT_RD
|
|
#define SHUT_RD 0
|
|
#endif
|
|
|
|
#ifndef SHUT_WR
|
|
#define SHUT_WR 1
|
|
#endif
|
|
|
|
/*
|
|
* BUFSIZE defines the size of a read and write buffer. It is the maximum
|
|
* amount of bytes which can be stored by the proxy for each session. However,
|
|
* when reading HTTP headers, the proxy needs some spare space to add or rewrite
|
|
* headers if needed. The size of this spare is defined with MAXREWRITE. So it
|
|
* is not possible to process headers longer than BUFSIZE-MAXREWRITE bytes. By
|
|
* default, BUFSIZE=16384 bytes and MAXREWRITE=BUFSIZE/2, so the maximum length
|
|
* of headers accepted is 8192 bytes, which is in line with Apache's limits.
|
|
*/
|
|
#ifndef BUFSIZE
|
|
#define BUFSIZE 16384
|
|
#endif
|
|
|
|
// reserved buffer space for header rewriting
|
|
#ifndef MAXREWRITE
|
|
#define MAXREWRITE (BUFSIZE / 2)
|
|
#endif
|
|
|
|
#define REQURI_LEN 1024
|
|
#define CAPTURE_LEN 64
|
|
|
|
// max # args on a configuration line
|
|
#define MAX_LINE_ARGS 40
|
|
|
|
// max # of added headers per request
|
|
#define MAX_NEWHDR 10
|
|
|
|
// max # of matches per regexp
|
|
#define MAX_MATCH 10
|
|
|
|
// cookie delimitor in "prefix" mode. This character is inserted between the
|
|
// persistence cookie and the original value. The '~' is allowed by RFC2965,
|
|
// and should not be too common in server names.
|
|
#ifndef COOKIE_DELIM
|
|
#define COOKIE_DELIM '~'
|
|
#endif
|
|
|
|
#define CONN_RETRIES 3
|
|
|
|
#define CHK_CONNTIME 2000
|
|
#define DEF_CHKINTR 2000
|
|
#define DEF_FALLTIME 3
|
|
#define DEF_RISETIME 2
|
|
#define DEF_CHECK_REQ "OPTIONS / HTTP/1.0\r\n\r\n"
|
|
|
|
/* default connections limit */
|
|
#define DEFAULT_MAXCONN 2000
|
|
|
|
/* how many bits are needed to code the size of an int (eg: 32bits -> 5) */
|
|
#define INTBITS 5
|
|
|
|
/* show stats this every millisecond, 0 to disable */
|
|
#ifndef STATTIME
|
|
#define STATTIME 2000
|
|
#endif
|
|
|
|
/* this reduces the number of calls to select() by choosing appropriate
|
|
* sheduler precision in milliseconds. It should be near the minimum
|
|
* time that is needed by select() to collect all events. All timeouts
|
|
* are rounded up by adding this value prior to pass it to select().
|
|
*/
|
|
#define SCHEDULER_RESOLUTION 9
|
|
|
|
#define MINTIME(old, new) (((new)<0)?(old):(((old)<0||(new)<(old))?(new):(old)))
|
|
#define SETNOW(a) (*a=now)
|
|
|
|
/****** string-specific macros and functions ******/
|
|
/* if a > max, then bound <a> to <max>. The macro returns the new <a> */
|
|
#define UBOUND(a, max) ({ typeof(a) b = (max); if ((a) > b) (a) = b; (a); })
|
|
|
|
/* if a < min, then bound <a> to <min>. The macro returns the new <a> */
|
|
#define LBOUND(a, min) ({ typeof(a) b = (min); if ((a) < b) (a) = b; (a); })
|
|
|
|
/* returns 1 only if only zero or one bit is set in X, which means that X is a
|
|
* power of 2, and 0 otherwise */
|
|
#define POWEROF2(x) (((x) & ((x)-1)) == 0)
|
|
/*
|
|
* copies at most <size-1> chars from <src> to <dst>. Last char is always
|
|
* set to 0, unless <size> is 0. The number of chars copied is returned
|
|
* (excluding the terminating zero).
|
|
* This code has been optimized for size and speed : on x86, it's 45 bytes
|
|
* long, uses only registers, and consumes only 4 cycles per char.
|
|
*/
|
|
int strlcpy2(char *dst, const char *src, int size) {
|
|
char *orig = dst;
|
|
if (size) {
|
|
while (--size && (*dst = *src)) {
|
|
src++; dst++;
|
|
}
|
|
*dst = 0;
|
|
}
|
|
return dst - orig;
|
|
}
|
|
|
|
/*
|
|
* Returns a pointer to an area of <__len> bytes taken from the pool <pool> or
|
|
* dynamically allocated. In the first case, <__pool> is updated to point to
|
|
* the next element in the list.
|
|
*/
|
|
#define pool_alloc_from(__pool, __len) ({ \
|
|
void *__p; \
|
|
if ((__p = (__pool)) == NULL) \
|
|
__p = malloc(((__len) >= sizeof (void *)) ? (__len) : sizeof(void *)); \
|
|
else { \
|
|
__pool = *(void **)(__pool); \
|
|
} \
|
|
__p; \
|
|
})
|
|
|
|
/*
|
|
* Puts a memory area back to the corresponding pool.
|
|
* Items are chained directly through a pointer that
|
|
* is written in the beginning of the memory area, so
|
|
* there's no need for any carrier cell. This implies
|
|
* that each memory area is at least as big as one
|
|
* pointer.
|
|
*/
|
|
#define pool_free_to(__pool, __ptr) ({ \
|
|
*(void **)(__ptr) = (void *)(__pool); \
|
|
__pool = (void *)(__ptr); \
|
|
})
|
|
|
|
|
|
#define MEM_OPTIM
|
|
#ifdef MEM_OPTIM
|
|
/*
|
|
* Returns a pointer to type <type> taken from the
|
|
* pool <pool_type> or dynamically allocated. In the
|
|
* first case, <pool_type> is updated to point to the
|
|
* next element in the list.
|
|
*/
|
|
#define pool_alloc(type) ({ \
|
|
void *__p; \
|
|
if ((__p = pool_##type) == NULL) \
|
|
__p = malloc(sizeof_##type); \
|
|
else { \
|
|
pool_##type = *(void **)pool_##type; \
|
|
} \
|
|
__p; \
|
|
})
|
|
|
|
/*
|
|
* Puts a memory area back to the corresponding pool.
|
|
* Items are chained directly through a pointer that
|
|
* is written in the beginning of the memory area, so
|
|
* there's no need for any carrier cell. This implies
|
|
* that each memory area is at least as big as one
|
|
* pointer.
|
|
*/
|
|
#define pool_free(type, ptr) ({ \
|
|
*(void **)ptr = (void *)pool_##type; \
|
|
pool_##type = (void *)ptr; \
|
|
})
|
|
|
|
#else
|
|
#define pool_alloc(type) (calloc(1,sizeof_##type));
|
|
#define pool_free(type, ptr) (free(ptr));
|
|
#endif /* MEM_OPTIM */
|
|
|
|
#define sizeof_task sizeof(struct task)
|
|
#define sizeof_session sizeof(struct session)
|
|
#define sizeof_buffer sizeof(struct buffer)
|
|
#define sizeof_fdtab sizeof(struct fdtab)
|
|
#define sizeof_requri REQURI_LEN
|
|
#define sizeof_capture CAPTURE_LEN
|
|
#define sizeof_curappsession CAPTURE_LEN /* current_session pool */
|
|
#define sizeof_appsess sizeof(struct appsessions)
|
|
|
|
/* different possible states for the sockets */
|
|
#define FD_STCLOSE 0
|
|
#define FD_STLISTEN 1
|
|
#define FD_STCONN 2
|
|
#define FD_STREADY 3
|
|
#define FD_STERROR 4
|
|
|
|
/* values for task->state */
|
|
#define TASK_IDLE 0
|
|
#define TASK_RUNNING 1
|
|
|
|
/* values for proxy->state */
|
|
#define PR_STNEW 0
|
|
#define PR_STIDLE 1
|
|
#define PR_STRUN 2
|
|
#define PR_STDISABLED 3
|
|
|
|
/* values for proxy->mode */
|
|
#define PR_MODE_TCP 0
|
|
#define PR_MODE_HTTP 1
|
|
#define PR_MODE_HEALTH 2
|
|
|
|
/* possible actions for the *poll() loops */
|
|
#define POLL_LOOP_ACTION_INIT 0
|
|
#define POLL_LOOP_ACTION_RUN 1
|
|
#define POLL_LOOP_ACTION_CLEAN 2
|
|
|
|
/* poll mechanisms available */
|
|
#define POLL_USE_SELECT (1<<0)
|
|
#define POLL_USE_POLL (1<<1)
|
|
#define POLL_USE_EPOLL (1<<2)
|
|
|
|
/* bits for proxy->options */
|
|
#define PR_O_REDISP 0x00000001 /* allow reconnection to dispatch in case of errors */
|
|
#define PR_O_TRANSP 0x00000002 /* transparent mode : use original DEST as dispatch */
|
|
#define PR_O_COOK_RW 0x00000004 /* rewrite all direct cookies with the right serverid */
|
|
#define PR_O_COOK_IND 0x00000008 /* keep only indirect cookies */
|
|
#define PR_O_COOK_INS 0x00000010 /* insert cookies when not accessing a server directly */
|
|
#define PR_O_COOK_PFX 0x00000020 /* rewrite all cookies by prefixing the right serverid */
|
|
#define PR_O_COOK_ANY (PR_O_COOK_RW | PR_O_COOK_IND | PR_O_COOK_INS | PR_O_COOK_PFX)
|
|
#define PR_O_BALANCE_RR 0x00000040 /* balance in round-robin mode */
|
|
#define PR_O_BALANCE (PR_O_BALANCE_RR)
|
|
#define PR_O_KEEPALIVE 0x00000080 /* follow keep-alive sessions */
|
|
#define PR_O_FWDFOR 0x00000100 /* insert x-forwarded-for with client address */
|
|
#define PR_O_BIND_SRC 0x00000200 /* bind to a specific source address when connect()ing */
|
|
#define PR_O_NULLNOLOG 0x00000400 /* a connect without request will not be logged */
|
|
#define PR_O_COOK_NOC 0x00000800 /* add a 'Cache-control' header with the cookie */
|
|
#define PR_O_COOK_POST 0x00001000 /* don't insert cookies for requests other than a POST */
|
|
#define PR_O_HTTP_CHK 0x00002000 /* use HTTP 'OPTIONS' method to check server health */
|
|
#define PR_O_PERSIST 0x00004000 /* server persistence stays effective even when server is down */
|
|
#define PR_O_LOGASAP 0x00008000 /* log as soon as possible, without waiting for the session to complete */
|
|
#define PR_O_HTTP_CLOSE 0x00010000 /* force 'connection: close' in both directions */
|
|
#define PR_O_CHK_CACHE 0x00020000 /* require examination of cacheability of the 'set-cookie' field */
|
|
|
|
/* various session flags */
|
|
#define SN_DIRECT 0x00000001 /* connection made on the server matching the client cookie */
|
|
#define SN_CLDENY 0x00000002 /* a client header matches a deny regex */
|
|
#define SN_CLALLOW 0x00000004 /* a client header matches an allow regex */
|
|
#define SN_SVDENY 0x00000008 /* a server header matches a deny regex */
|
|
#define SN_SVALLOW 0x00000010 /* a server header matches an allow regex */
|
|
#define SN_POST 0x00000020 /* the request was an HTTP POST */
|
|
|
|
#define SN_CK_NONE 0x00000000 /* this session had no cookie */
|
|
#define SN_CK_INVALID 0x00000040 /* this session had a cookie which matches no server */
|
|
#define SN_CK_DOWN 0x00000080 /* this session had cookie matching a down server */
|
|
#define SN_CK_VALID 0x000000C0 /* this session had cookie matching a valid server */
|
|
#define SN_CK_MASK 0x000000C0 /* mask to get this session's cookie flags */
|
|
#define SN_CK_SHIFT 6 /* bit shift */
|
|
|
|
#define SN_ERR_CLITO 0x00000100 /* client time-out */
|
|
#define SN_ERR_CLICL 0x00000200 /* client closed (read/write error) */
|
|
#define SN_ERR_SRVTO 0x00000300 /* server time-out, connect time-out */
|
|
#define SN_ERR_SRVCL 0x00000400 /* server closed (connect/read/write error) */
|
|
#define SN_ERR_PRXCOND 0x00000500 /* the proxy decided to close (deny...) */
|
|
#define SN_ERR_MASK 0x00000700 /* mask to get only session error flags */
|
|
#define SN_ERR_SHIFT 8 /* bit shift */
|
|
|
|
#define SN_FINST_R 0x00001000 /* session ended during client request */
|
|
#define SN_FINST_C 0x00002000 /* session ended during server connect */
|
|
#define SN_FINST_H 0x00003000 /* session ended during server headers */
|
|
#define SN_FINST_D 0x00004000 /* session ended during data phase */
|
|
#define SN_FINST_L 0x00005000 /* session ended while pushing last data to client */
|
|
#define SN_FINST_MASK 0x00007000 /* mask to get only final session state flags */
|
|
#define SN_FINST_SHIFT 12 /* bit shift */
|
|
|
|
#define SN_SCK_NONE 0x00000000 /* no set-cookie seen for the server cookie */
|
|
#define SN_SCK_DELETED 0x00010000 /* existing set-cookie deleted or changed */
|
|
#define SN_SCK_INSERTED 0x00020000 /* new set-cookie inserted or changed existing one */
|
|
#define SN_SCK_SEEN 0x00040000 /* set-cookie seen for the server cookie */
|
|
#define SN_SCK_MASK 0x00070000 /* mask to get the set-cookie field */
|
|
#define SN_SCK_ANY 0x00080000 /* at least one set-cookie seen (not to be counted) */
|
|
#define SN_SCK_SHIFT 16 /* bit shift */
|
|
|
|
#define SN_CACHEABLE 0x00100000 /* at least part of the response is cacheable */
|
|
#define SN_CACHE_COOK 0x00200000 /* a cookie in the response is cacheable */
|
|
#define SN_CACHE_SHIFT 20 /* bit shift */
|
|
|
|
/* different possible states for the client side */
|
|
#define CL_STHEADERS 0
|
|
#define CL_STDATA 1
|
|
#define CL_STSHUTR 2
|
|
#define CL_STSHUTW 3
|
|
#define CL_STCLOSE 4
|
|
|
|
/* different possible states for the server side */
|
|
#define SV_STIDLE 0
|
|
#define SV_STCONN 1
|
|
#define SV_STHEADERS 2
|
|
#define SV_STDATA 3
|
|
#define SV_STSHUTR 4
|
|
#define SV_STSHUTW 5
|
|
#define SV_STCLOSE 6
|
|
|
|
/* result of an I/O event */
|
|
#define RES_SILENT 0 /* didn't happen */
|
|
#define RES_DATA 1 /* data were sent or received */
|
|
#define RES_NULL 2 /* result is 0 (read == 0), or connect without need for writing */
|
|
#define RES_ERROR 3 /* result -1 or error on the socket (eg: connect()) */
|
|
|
|
/* modes of operation (global.mode) */
|
|
#define MODE_DEBUG 1
|
|
#define MODE_STATS 2
|
|
#define MODE_LOG 4
|
|
#define MODE_DAEMON 8
|
|
#define MODE_QUIET 16
|
|
#define MODE_CHECK 32
|
|
#define MODE_VERBOSE 64
|
|
|
|
/* server flags */
|
|
#define SRV_RUNNING 1 /* the server is UP */
|
|
#define SRV_BACKUP 2 /* this server is a backup server */
|
|
#define SRV_MAPPORTS 4 /* this server uses mapped ports */
|
|
#define SRV_BIND_SRC 8 /* this server uses a specific source address */
|
|
|
|
/* what to do when a header matches a regex */
|
|
#define ACT_ALLOW 0 /* allow the request */
|
|
#define ACT_REPLACE 1 /* replace the matching header */
|
|
#define ACT_REMOVE 2 /* remove the matching header */
|
|
#define ACT_DENY 3 /* deny the request */
|
|
#define ACT_PASS 4 /* pass this header without allowing or denying the request */
|
|
|
|
/* configuration sections */
|
|
#define CFG_NONE 0
|
|
#define CFG_GLOBAL 1
|
|
#define CFG_LISTEN 2
|
|
|
|
/* fields that need to be logged. They appear as flags in session->logs.logwait */
|
|
#define LW_DATE 1 /* date */
|
|
#define LW_CLIP 2 /* CLient IP */
|
|
#define LW_SVIP 4 /* SerVer IP */
|
|
#define LW_SVID 8 /* server ID */
|
|
#define LW_REQ 16 /* http REQuest */
|
|
#define LW_RESP 32 /* http RESPonse */
|
|
#define LW_PXIP 64 /* proxy IP */
|
|
#define LW_PXID 128 /* proxy ID */
|
|
#define LW_BYTES 256 /* bytes read from server */
|
|
#define LW_COOKIE 512 /* captured cookie */
|
|
#define LW_REQHDR 1024 /* request header(s) */
|
|
#define LW_RSPHDR 2048 /* response header(s) */
|
|
|
|
/*********************************************************************/
|
|
|
|
#define LIST_HEAD(a) ((void *)(&(a)))
|
|
|
|
/*********************************************************************/
|
|
|
|
struct cap_hdr {
|
|
struct cap_hdr *next;
|
|
char *name; /* header name, case insensitive */
|
|
int namelen; /* length of the header name, to speed-up lookups */
|
|
int len; /* capture length, not including terminal zero */
|
|
int index; /* index in the output array */
|
|
void *pool; /* pool of pre-allocated memory area of (len+1) bytes */
|
|
};
|
|
|
|
struct hdr_exp {
|
|
struct hdr_exp *next;
|
|
regex_t *preg; /* expression to look for */
|
|
int action; /* ACT_ALLOW, ACT_REPLACE, ACT_REMOVE, ACT_DENY */
|
|
char *replace; /* expression to set instead */
|
|
};
|
|
|
|
struct buffer {
|
|
unsigned int l; /* data length */
|
|
char *r, *w, *h, *lr; /* read ptr, write ptr, last header ptr, last read */
|
|
char *rlim; /* read limit, used for header rewriting */
|
|
unsigned long long total; /* total data read */
|
|
char data[BUFSIZE];
|
|
};
|
|
|
|
struct server {
|
|
struct server *next;
|
|
int state; /* server state (SRV_*) */
|
|
int cklen; /* the len of the cookie, to speed up checks */
|
|
char *cookie; /* the id set in the cookie */
|
|
char *id; /* just for identification */
|
|
struct sockaddr_in addr; /* the address to connect to */
|
|
struct sockaddr_in source_addr; /* the address to which we want to bind for connect() */
|
|
short check_port; /* the port to use for the health checks */
|
|
int health; /* 0->rise-1 = bad; rise->rise+fall-1 = good */
|
|
int rise, fall; /* time in iterations */
|
|
int inter; /* time in milliseconds */
|
|
int result; /* 0 = connect OK, -1 = connect KO */
|
|
int curfd; /* file desc used for current test, or -1 if not in test */
|
|
struct proxy *proxy; /* the proxy this server belongs to */
|
|
};
|
|
|
|
/* The base for all tasks */
|
|
struct task {
|
|
struct task *next, *prev; /* chaining ... */
|
|
struct task *rqnext; /* chaining in run queue ... */
|
|
struct task *wq; /* the wait queue this task is in */
|
|
int state; /* task state : IDLE or RUNNING */
|
|
struct timeval expire; /* next expiration time for this task, use only for fast sorting */
|
|
int (*process)(struct task *t); /* the function which processes the task */
|
|
void *context; /* the task's context */
|
|
};
|
|
|
|
/* WARNING: if new fields are added, they must be initialized in event_accept() */
|
|
struct session {
|
|
struct task *task; /* the task associated with this session */
|
|
/* application specific below */
|
|
struct timeval crexpire; /* expiration date for a client read */
|
|
struct timeval cwexpire; /* expiration date for a client write */
|
|
struct timeval srexpire; /* expiration date for a server read */
|
|
struct timeval swexpire; /* expiration date for a server write */
|
|
struct timeval cnexpire; /* expiration date for a connect */
|
|
char res_cr, res_cw, res_sr, res_sw;/* results of some events */
|
|
struct proxy *proxy; /* the proxy this socket belongs to */
|
|
int cli_fd; /* the client side fd */
|
|
int srv_fd; /* the server side fd */
|
|
int cli_state; /* state of the client side */
|
|
int srv_state; /* state of the server side */
|
|
int conn_retries; /* number of connect retries left */
|
|
int flags; /* some flags describing the session */
|
|
struct buffer *req; /* request buffer */
|
|
struct buffer *rep; /* response buffer */
|
|
struct sockaddr_storage cli_addr; /* the client address */
|
|
struct sockaddr_in srv_addr; /* the address to connect to */
|
|
struct server *srv; /* the server being used */
|
|
char **req_cap; /* array of captured request headers (may be NULL) */
|
|
char **rsp_cap; /* array of captured response headers (may be NULL) */
|
|
struct {
|
|
int logwait; /* log fields waiting to be collected : LW_* */
|
|
struct timeval tv_accept; /* date of the accept() (beginning of the session) */
|
|
long t_request; /* delay before the end of the request arrives, -1 if never occurs */
|
|
long t_connect; /* delay before the connect() to the server succeeds, -1 if never occurs */
|
|
long t_data; /* delay before the first data byte from the server ... */
|
|
unsigned long t_close; /* total session duration */
|
|
char *uri; /* first line if log needed, NULL otherwise */
|
|
char *cli_cookie; /* cookie presented by the client, in capture mode */
|
|
char *srv_cookie; /* cookie presented by the server, in capture mode */
|
|
int status; /* HTTP status from the server, negative if from proxy */
|
|
long long bytes; /* number of bytes transferred from the server */
|
|
} logs;
|
|
unsigned int uniq_id; /* unique ID used for the traces */
|
|
};
|
|
|
|
struct listener {
|
|
int fd; /* the listen socket */
|
|
struct sockaddr_storage addr; /* the address we listen to */
|
|
struct listener *next; /* next address or NULL */
|
|
};
|
|
|
|
|
|
struct proxy {
|
|
struct listener *listen; /* the listen addresses and sockets */
|
|
int state; /* proxy state */
|
|
struct sockaddr_in dispatch_addr; /* the default address to connect to */
|
|
struct server *srv, *cursrv; /* known servers, current server */
|
|
int nbservers; /* # of servers */
|
|
char *cookie_name; /* name of the cookie to look for */
|
|
int cookie_len; /* strlen(cookie_name), computed only once */
|
|
char *appsession_name; /* name of the cookie to look for */
|
|
int appsession_name_len; /* strlen(appsession_name), computed only once */
|
|
int appsession_len; /* length of the appsession cookie value to be used */
|
|
int appsession_timeout;
|
|
CHTbl htbl_proxy; /* Per Proxy hashtable */
|
|
char *capture_name; /* beginning of the name of the cookie to capture */
|
|
int capture_namelen; /* length of the cookie name to match */
|
|
int capture_len; /* length of the string to be captured */
|
|
int clitimeout; /* client I/O timeout (in milliseconds) */
|
|
int srvtimeout; /* server I/O timeout (in milliseconds) */
|
|
int contimeout; /* connect timeout (in milliseconds) */
|
|
char *id; /* proxy id */
|
|
int nbconn; /* # of active sessions */
|
|
int maxconn; /* max # of active sessions */
|
|
int conn_retries; /* maximum number of connect retries */
|
|
int options; /* PR_O_REDISP, PR_O_TRANSP */
|
|
int mode; /* mode = PR_MODE_TCP, PR_MODE_HTTP or PR_MODE_HEALTH */
|
|
struct sockaddr_in source_addr; /* the address to which we want to bind for connect() */
|
|
struct proxy *next;
|
|
struct sockaddr_in logsrv1, logsrv2; /* 2 syslog servers */
|
|
signed char logfac1, logfac2; /* log facility for both servers. -1 = disabled */
|
|
int loglev1, loglev2; /* log level for each server, 7 by default */
|
|
int to_log; /* things to be logged (LW_*) */
|
|
struct timeval stop_time; /* date to stop listening, when stopping != 0 */
|
|
int nb_reqadd, nb_rspadd;
|
|
struct hdr_exp *req_exp; /* regular expressions for request headers */
|
|
struct hdr_exp *rsp_exp; /* regular expressions for response headers */
|
|
int nb_req_cap, nb_rsp_cap; /* # of headers to be captured */
|
|
struct cap_hdr *req_cap; /* chained list of request headers to be captured */
|
|
struct cap_hdr *rsp_cap; /* chained list of response headers to be captured */
|
|
void *req_cap_pool, *rsp_cap_pool; /* pools of pre-allocated char ** used to build the sessions */
|
|
char *req_add[MAX_NEWHDR], *rsp_add[MAX_NEWHDR]; /* headers to be added */
|
|
int grace; /* grace time after stop request */
|
|
char *check_req; /* HTTP request to use if PR_O_HTTP_CHK is set, else NULL */
|
|
int check_len; /* Length of the HTTP request */
|
|
struct {
|
|
char *msg400; /* message for error 400 */
|
|
int len400; /* message length for error 400 */
|
|
char *msg403; /* message for error 403 */
|
|
int len403; /* message length for error 403 */
|
|
char *msg408; /* message for error 408 */
|
|
int len408; /* message length for error 408 */
|
|
char *msg500; /* message for error 500 */
|
|
int len500; /* message length for error 500 */
|
|
char *msg502; /* message for error 502 */
|
|
int len502; /* message length for error 502 */
|
|
char *msg503; /* message for error 503 */
|
|
int len503; /* message length for error 503 */
|
|
char *msg504; /* message for error 504 */
|
|
int len504; /* message length for error 504 */
|
|
} errmsg;
|
|
};
|
|
|
|
/* info about one given fd */
|
|
struct fdtab {
|
|
int (*read)(int fd); /* read function */
|
|
int (*write)(int fd); /* write function */
|
|
struct task *owner; /* the session (or proxy) associated with this fd */
|
|
int state; /* the state of this fd */
|
|
};
|
|
|
|
/*********************************************************************/
|
|
|
|
int cfg_maxpconn = 2000; /* # of simultaneous connections per proxy (-N) */
|
|
char *cfg_cfgfile = NULL; /* configuration file */
|
|
char *progname = NULL; /* program name */
|
|
int pid; /* current process id */
|
|
|
|
/* global options */
|
|
static struct {
|
|
int uid;
|
|
int gid;
|
|
int nbproc;
|
|
int maxconn;
|
|
int maxsock; /* max # of sockets */
|
|
int mode;
|
|
char *chroot;
|
|
char *pidfile;
|
|
int logfac1, logfac2;
|
|
int loglev1, loglev2;
|
|
struct sockaddr_in logsrv1, logsrv2;
|
|
} global = {
|
|
logfac1 : -1,
|
|
logfac2 : -1,
|
|
loglev1 : 7, /* max syslog level : debug */
|
|
loglev2 : 7,
|
|
/* others NULL OK */
|
|
};
|
|
|
|
/*********************************************************************/
|
|
|
|
fd_set *StaticReadEvent,
|
|
*StaticWriteEvent;
|
|
|
|
int cfg_polling_mechanism = 0; /* POLL_USE_{SELECT|POLL|EPOLL} */
|
|
|
|
void **pool_session = NULL,
|
|
**pool_buffer = NULL,
|
|
**pool_fdtab = NULL,
|
|
**pool_requri = NULL,
|
|
**pool_task = NULL,
|
|
**pool_capture = NULL,
|
|
**pool_appsess = NULL;
|
|
|
|
struct proxy *proxy = NULL; /* list of all existing proxies */
|
|
struct fdtab *fdtab = NULL; /* array of all the file descriptors */
|
|
struct task *rq = NULL; /* global run queue */
|
|
struct task wait_queue = { /* global wait queue */
|
|
prev:LIST_HEAD(wait_queue),
|
|
next:LIST_HEAD(wait_queue)
|
|
};
|
|
|
|
static int totalconn = 0; /* total # of terminated sessions */
|
|
static int actconn = 0; /* # of active sessions */
|
|
static int maxfd = 0; /* # of the highest fd + 1 */
|
|
static int listeners = 0; /* # of listeners */
|
|
static int stopping = 0; /* non zero means stopping in progress */
|
|
static struct timeval now = {0,0}; /* the current date at any moment */
|
|
static struct proxy defproxy; /* fake proxy used to assign default values on all instances */
|
|
|
|
#if defined(ENABLE_EPOLL)
|
|
/* FIXME: this is dirty, but at the moment, there's no other solution to remove
|
|
* the old FDs from outside the loop. Perhaps we should export a global 'poll'
|
|
* structure with pointers to functions such as init_fd() and close_fd(), plus
|
|
* a private structure with several pointers to places such as below.
|
|
*/
|
|
|
|
static fd_set *PrevReadEvent = NULL, *PrevWriteEvent = NULL;
|
|
#endif
|
|
|
|
static regmatch_t pmatch[MAX_MATCH]; /* rm_so, rm_eo for regular expressions */
|
|
/* this is used to drain data, and as a temporary buffer for sprintf()... */
|
|
static char trash[BUFSIZE];
|
|
|
|
const int zero = 0;
|
|
const int one = 1;
|
|
|
|
/*
|
|
* Syslog facilities and levels. Conforming to RFC3164.
|
|
*/
|
|
|
|
#define MAX_SYSLOG_LEN 1024
|
|
#define NB_LOG_FACILITIES 24
|
|
const char *log_facilities[NB_LOG_FACILITIES] = {
|
|
"kern", "user", "mail", "daemon",
|
|
"auth", "syslog", "lpr", "news",
|
|
"uucp", "cron", "auth2", "ftp",
|
|
"ntp", "audit", "alert", "cron2",
|
|
"local0", "local1", "local2", "local3",
|
|
"local4", "local5", "local6", "local7"
|
|
};
|
|
|
|
|
|
#define NB_LOG_LEVELS 8
|
|
const char *log_levels[NB_LOG_LEVELS] = {
|
|
"emerg", "alert", "crit", "err",
|
|
"warning", "notice", "info", "debug"
|
|
};
|
|
|
|
#define SYSLOG_PORT 514
|
|
|
|
const char *monthname[12] = {"Jan", "Feb", "Mar", "Apr", "May", "Jun",
|
|
"Jul", "Aug", "Sep", "Oct", "Nov", "Dec" };
|
|
|
|
const char sess_term_cond[8] = "-cCsSP67"; /* normal, CliTo, CliErr, SrvTo, SrvErr, PxErr, unknown */
|
|
const char sess_fin_state[8] = "-RCHDL67"; /* cliRequest, srvConnect, srvHeader, Data, Last, unknown */
|
|
const char sess_cookie[4] = "NIDV"; /* No cookie, Invalid cookie, cookie for a Down server, Valid cookie */
|
|
const char sess_set_cookie[8] = "N1I3PD5R"; /* No set-cookie, unknown, Set-Cookie Inserted, unknown,
|
|
Set-cookie seen and left unchanged (passive), Set-cookie Deleted,
|
|
unknown, Set-cookie Rewritten */
|
|
|
|
#define MAX_HOSTNAME_LEN 32
|
|
static char hostname[MAX_HOSTNAME_LEN] = "";
|
|
|
|
const char *HTTP_302 =
|
|
"HTTP/1.0 302 Found\r\n"
|
|
"Cache-Control: no-cache\r\n"
|
|
"Connection: close\r\n"
|
|
"Location: "; /* not terminated since it will be concatenated with the URL */
|
|
|
|
/* same as 302 except that the browser MUST retry with the GET method */
|
|
const char *HTTP_303 =
|
|
"HTTP/1.0 303 See Other\r\n"
|
|
"Cache-Control: no-cache\r\n"
|
|
"Connection: close\r\n"
|
|
"Location: "; /* not terminated since it will be concatenated with the URL */
|
|
|
|
const char *HTTP_400 =
|
|
"HTTP/1.0 400 Bad request\r\n"
|
|
"Cache-Control: no-cache\r\n"
|
|
"Connection: close\r\n"
|
|
"\r\n"
|
|
"<html><body><h1>400 Bad request</h1>\nYour browser sent an invalid request.\n</body></html>\n";
|
|
|
|
const char *HTTP_403 =
|
|
"HTTP/1.0 403 Forbidden\r\n"
|
|
"Cache-Control: no-cache\r\n"
|
|
"Connection: close\r\n"
|
|
"\r\n"
|
|
"<html><body><h1>403 Forbidden</h1>\nRequest forbidden by administrative rules.\n</body></html>\n";
|
|
|
|
const char *HTTP_408 =
|
|
"HTTP/1.0 408 Request Time-out\r\n"
|
|
"Cache-Control: no-cache\r\n"
|
|
"Connection: close\r\n"
|
|
"\r\n"
|
|
"<html><body><h1>408 Request Time-out</h1>\nYour browser didn't send a complete request in time.\n</body></html>\n";
|
|
|
|
const char *HTTP_500 =
|
|
"HTTP/1.0 500 Server Error\r\n"
|
|
"Cache-Control: no-cache\r\n"
|
|
"Connection: close\r\n"
|
|
"\r\n"
|
|
"<html><body><h1>500 Server Error</h1>\nAn internal server error occured.\n</body></html>\n";
|
|
|
|
const char *HTTP_502 =
|
|
"HTTP/1.0 502 Bad Gateway\r\n"
|
|
"Cache-Control: no-cache\r\n"
|
|
"Connection: close\r\n"
|
|
"\r\n"
|
|
"<html><body><h1>502 Bad Gateway</h1>\nThe server returned an invalid or incomplete response.\n</body></html>\n";
|
|
|
|
const char *HTTP_503 =
|
|
"HTTP/1.0 503 Service Unavailable\r\n"
|
|
"Cache-Control: no-cache\r\n"
|
|
"Connection: close\r\n"
|
|
"\r\n"
|
|
"<html><body><h1>503 Service Unavailable</h1>\nNo server is available to handle this request.\n</body></html>\n";
|
|
|
|
const char *HTTP_504 =
|
|
"HTTP/1.0 504 Gateway Time-out\r\n"
|
|
"Cache-Control: no-cache\r\n"
|
|
"Connection: close\r\n"
|
|
"\r\n"
|
|
"<html><body><h1>504 Gateway Time-out</h1>\nThe server didn't respond in time.\n</body></html>\n";
|
|
|
|
/*********************************************************************/
|
|
/* statistics ******************************************************/
|
|
/*********************************************************************/
|
|
|
|
#if STATTIME > 0
|
|
static int stats_tsk_lsrch, stats_tsk_rsrch,
|
|
stats_tsk_good, stats_tsk_right, stats_tsk_left,
|
|
stats_tsk_new, stats_tsk_nsrch;
|
|
#endif
|
|
|
|
|
|
/*********************************************************************/
|
|
/* debugging *******************************************************/
|
|
/*********************************************************************/
|
|
#ifdef DEBUG_FULL
|
|
static char *cli_stnames[5] = {"HDR", "DAT", "SHR", "SHW", "CLS" };
|
|
static char *srv_stnames[7] = {"IDL", "CON", "HDR", "DAT", "SHR", "SHW", "CLS" };
|
|
#endif
|
|
|
|
/*********************************************************************/
|
|
/* function prototypes *********************************************/
|
|
/*********************************************************************/
|
|
|
|
int event_accept(int fd);
|
|
int event_cli_read(int fd);
|
|
int event_cli_write(int fd);
|
|
int event_srv_read(int fd);
|
|
int event_srv_write(int fd);
|
|
int process_session(struct task *t);
|
|
|
|
static int appsession_task_init(void);
|
|
static int appsession_init(void);
|
|
static int appsession_refresh(struct task *t);
|
|
|
|
/*********************************************************************/
|
|
/* general purpose functions ***************************************/
|
|
/*********************************************************************/
|
|
|
|
void display_version() {
|
|
printf("HA-Proxy version " HAPROXY_VERSION " " HAPROXY_DATE"\n");
|
|
printf("Copyright 2000-2005 Willy Tarreau <w@w.ods.org>\n\n");
|
|
}
|
|
|
|
/*
|
|
* This function prints the command line usage and exits
|
|
*/
|
|
void usage(char *name) {
|
|
display_version();
|
|
fprintf(stderr,
|
|
"Usage : %s -f <cfgfile> [ -vdV"
|
|
#if STATTIME > 0
|
|
"sl"
|
|
#endif
|
|
"D ] [ -n <maxconn> ] [ -N <maxpconn> ] [ -p <pidfile> ]\n"
|
|
" -v displays version\n"
|
|
" -d enters debug mode\n"
|
|
" -V enters verbose mode (disables quiet mode)\n"
|
|
#if STATTIME > 0
|
|
" -s enables statistics output\n"
|
|
" -l enables long statistics format\n"
|
|
#endif
|
|
" -D goes daemon ; implies -q\n"
|
|
" -q quiet mode : don't display messages\n"
|
|
" -c check mode : only check config file and exit\n"
|
|
" -n sets the maximum total # of connections (%d)\n"
|
|
" -N sets the default, per-proxy maximum # of connections (%d)\n"
|
|
" -p writes pids of all children to this file\n"
|
|
#if defined(ENABLE_EPOLL)
|
|
" -de disables epoll() usage even when available\n"
|
|
#endif
|
|
#if defined(ENABLE_POLL)
|
|
" -dp disables poll() usage even when available\n"
|
|
#endif
|
|
"\n",
|
|
name, DEFAULT_MAXCONN, cfg_maxpconn);
|
|
exit(1);
|
|
}
|
|
|
|
|
|
/*
|
|
* Displays the message on stderr with the date and pid.
|
|
*/
|
|
void Alert(char *fmt, ...) {
|
|
va_list argp;
|
|
struct timeval tv;
|
|
struct tm *tm;
|
|
|
|
if (!(global.mode & MODE_QUIET) || (global.mode & MODE_VERBOSE)) {
|
|
va_start(argp, fmt);
|
|
|
|
gettimeofday(&tv, NULL);
|
|
tm=localtime(&tv.tv_sec);
|
|
fprintf(stderr, "[ALERT] %03d/%02d%02d%02d (%d) : ",
|
|
tm->tm_yday, tm->tm_hour, tm->tm_min, tm->tm_sec, (int)getpid());
|
|
vfprintf(stderr, fmt, argp);
|
|
fflush(stderr);
|
|
va_end(argp);
|
|
}
|
|
}
|
|
|
|
|
|
/*
|
|
* Displays the message on stderr with the date and pid.
|
|
*/
|
|
void Warning(char *fmt, ...) {
|
|
va_list argp;
|
|
struct timeval tv;
|
|
struct tm *tm;
|
|
|
|
if (!(global.mode & MODE_QUIET) || (global.mode & MODE_VERBOSE)) {
|
|
va_start(argp, fmt);
|
|
|
|
gettimeofday(&tv, NULL);
|
|
tm=localtime(&tv.tv_sec);
|
|
fprintf(stderr, "[WARNING] %03d/%02d%02d%02d (%d) : ",
|
|
tm->tm_yday, tm->tm_hour, tm->tm_min, tm->tm_sec, (int)getpid());
|
|
vfprintf(stderr, fmt, argp);
|
|
fflush(stderr);
|
|
va_end(argp);
|
|
}
|
|
}
|
|
|
|
/*
|
|
* Displays the message on <out> only if quiet mode is not set.
|
|
*/
|
|
void qfprintf(FILE *out, char *fmt, ...) {
|
|
va_list argp;
|
|
|
|
if (!(global.mode & MODE_QUIET) || (global.mode & MODE_VERBOSE)) {
|
|
va_start(argp, fmt);
|
|
vfprintf(out, fmt, argp);
|
|
fflush(out);
|
|
va_end(argp);
|
|
}
|
|
}
|
|
|
|
|
|
/*
|
|
* converts <str> to a struct sockaddr_in* which is locally allocated.
|
|
* The format is "addr:port", where "addr" can be empty or "*" to indicate
|
|
* INADDR_ANY.
|
|
*/
|
|
struct sockaddr_in *str2sa(char *str) {
|
|
static struct sockaddr_in sa;
|
|
char *c;
|
|
int port;
|
|
|
|
memset(&sa, 0, sizeof(sa));
|
|
str=strdup(str);
|
|
|
|
if ((c=strrchr(str,':')) != NULL) {
|
|
*c++=0;
|
|
port=atol(c);
|
|
}
|
|
else
|
|
port=0;
|
|
|
|
if (*str == '*' || *str == '\0') { /* INADDR_ANY */
|
|
sa.sin_addr.s_addr = INADDR_ANY;
|
|
}
|
|
else if (!inet_pton(AF_INET, str, &sa.sin_addr)) {
|
|
struct hostent *he;
|
|
|
|
if ((he = gethostbyname(str)) == NULL) {
|
|
Alert("Invalid server name: '%s'\n", str);
|
|
}
|
|
else
|
|
sa.sin_addr = *(struct in_addr *) *(he->h_addr_list);
|
|
}
|
|
sa.sin_port=htons(port);
|
|
sa.sin_family=AF_INET;
|
|
|
|
free(str);
|
|
return &sa;
|
|
}
|
|
|
|
|
|
/*
|
|
* converts <str> to a list of listeners which are dynamically allocated.
|
|
* The format is "{addr|'*'}:port[-end][,{addr|'*'}:port[-end]]*", where :
|
|
* - <addr> can be empty or "*" to indicate INADDR_ANY ;
|
|
* - <port> is a numerical port from 1 to 65535 ;
|
|
* - <end> indicates to use the range from <port> to <end> instead (inclusive).
|
|
* This can be repeated as many times as necessary, separated by a coma.
|
|
* The <tail> argument is a pointer to a current list which should be appended
|
|
* to the tail of the new list. The pointer to the new list is returned.
|
|
*/
|
|
struct listener *str2listener(char *str, struct listener *tail) {
|
|
struct listener *l;
|
|
char *c, *next, *range, *dupstr;
|
|
int port, end;
|
|
|
|
next = dupstr = strdup(str);
|
|
|
|
while (next && *next) {
|
|
struct sockaddr_storage ss;
|
|
|
|
str = next;
|
|
/* 1) look for the end of the first address */
|
|
if ((next = strrchr(str, ',')) != NULL) {
|
|
*next++ = 0;
|
|
}
|
|
|
|
/* 2) look for the addr/port delimiter, it's the last colon. */
|
|
if ((range = strrchr(str, ':')) == NULL) {
|
|
Alert("Missing port number: '%s'\n", str);
|
|
}
|
|
|
|
*range++ = 0;
|
|
|
|
if (strrchr(str, ':') != NULL) {
|
|
/* IPv6 address contains ':' */
|
|
memset(&ss, 0, sizeof(ss));
|
|
ss.ss_family = AF_INET6;
|
|
|
|
if (!inet_pton(ss.ss_family, str, &((struct sockaddr_in6 *)&ss)->sin6_addr)) {
|
|
Alert("Invalid server address: '%s'\n", str);
|
|
}
|
|
}
|
|
else {
|
|
memset(&ss, 0, sizeof(ss));
|
|
ss.ss_family = AF_INET;
|
|
|
|
if (*str == '*' || *str == '\0') { /* INADDR_ANY */
|
|
((struct sockaddr_in *)&ss)->sin_addr.s_addr = INADDR_ANY;
|
|
}
|
|
else if (!inet_pton(ss.ss_family, str, &((struct sockaddr_in *)&ss)->sin_addr)) {
|
|
struct hostent *he;
|
|
|
|
if ((he = gethostbyname(str)) == NULL) {
|
|
Alert("Invalid server name: '%s'\n", str);
|
|
}
|
|
else
|
|
((struct sockaddr_in *)&ss)->sin_addr =
|
|
*(struct in_addr *) *(he->h_addr_list);
|
|
}
|
|
}
|
|
|
|
/* 3) look for the port-end delimiter */
|
|
if ((c = strchr(range, '-')) != NULL) {
|
|
*c++ = 0;
|
|
end = atol(c);
|
|
}
|
|
else {
|
|
end = atol(range);
|
|
}
|
|
|
|
for (port = atol(range); port <= end; port++) {
|
|
l = (struct listener *)calloc(1, sizeof(struct listener));
|
|
l->next = tail;
|
|
tail = l;
|
|
|
|
l->addr = ss;
|
|
if (ss.ss_family == AF_INET6)
|
|
((struct sockaddr_in6 *)(&l->addr))->sin6_port = htons(port);
|
|
else
|
|
((struct sockaddr_in *)(&l->addr))->sin_port = htons(port);
|
|
|
|
} /* end for(port) */
|
|
} /* end while(next) */
|
|
free(dupstr);
|
|
return tail;
|
|
}
|
|
|
|
|
|
#define FD_SETS_ARE_BITFIELDS
|
|
#ifdef FD_SETS_ARE_BITFIELDS
|
|
/*
|
|
* This map is used with all the FD_* macros to check whether a particular bit
|
|
* is set or not. Each bit represents an ACSII code. FD_SET() sets those bytes
|
|
* which should be encoded. When FD_ISSET() returns non-zero, it means that the
|
|
* byte should be encoded. Be careful to always pass bytes from 0 to 255
|
|
* exclusively to the macros.
|
|
*/
|
|
fd_set hdr_encode_map[(sizeof(fd_set) > (256/8)) ? 1 : ((256/8) / sizeof(fd_set))];
|
|
fd_set url_encode_map[(sizeof(fd_set) > (256/8)) ? 1 : ((256/8) / sizeof(fd_set))];
|
|
|
|
#else
|
|
#error "Check if your OS uses bitfields for fd_sets"
|
|
#endif
|
|
|
|
/* will try to encode the string <string> replacing all characters tagged in
|
|
* <map> with the hexadecimal representation of their ASCII-code (2 digits)
|
|
* prefixed by <escape>, and will store the result between <start> (included
|
|
*) and <stop> (excluded), and will always terminate the string with a '\0'
|
|
* before <stop>. The position of the '\0' is returned if the conversion
|
|
* completes. If bytes are missing between <start> and <stop>, then the
|
|
* conversion will be incomplete and truncated. If <stop> <= <start>, the '\0'
|
|
* cannot even be stored so we return <start> without writing the 0.
|
|
* The input string must also be zero-terminated.
|
|
*/
|
|
char hextab[16] = "0123456789ABCDEF";
|
|
char *encode_string(char *start, char *stop,
|
|
const char escape, const fd_set *map,
|
|
const char *string)
|
|
{
|
|
if (start < stop) {
|
|
stop--; /* reserve one byte for the final '\0' */
|
|
while (start < stop && *string != 0) {
|
|
if (!FD_ISSET((unsigned char)(*string), map))
|
|
*start++ = *string;
|
|
else {
|
|
if (start + 3 >= stop)
|
|
break;
|
|
*start++ = escape;
|
|
*start++ = hextab[(*string >> 4) & 15];
|
|
*start++ = hextab[*string & 15];
|
|
}
|
|
string++;
|
|
}
|
|
*start = '\0';
|
|
}
|
|
return start;
|
|
}
|
|
|
|
/*
|
|
* This function sends a syslog message to both log servers of a proxy,
|
|
* or to global log servers if the proxy is NULL.
|
|
* It also tries not to waste too much time computing the message header.
|
|
* It doesn't care about errors nor does it report them.
|
|
*/
|
|
void send_log(struct proxy *p, int level, char *message, ...) {
|
|
static int logfd = -1; /* syslog UDP socket */
|
|
static long tvsec = -1; /* to force the string to be initialized */
|
|
struct timeval tv;
|
|
va_list argp;
|
|
static char logmsg[MAX_SYSLOG_LEN];
|
|
static char *dataptr = NULL;
|
|
int fac_level;
|
|
int hdr_len, data_len;
|
|
struct sockaddr_in *sa[2];
|
|
int facilities[2], loglevel[2];
|
|
int nbloggers = 0;
|
|
char *log_ptr;
|
|
|
|
if (logfd < 0) {
|
|
if ((logfd = socket(AF_INET, SOCK_DGRAM, IPPROTO_UDP)) < 0)
|
|
return;
|
|
}
|
|
|
|
if (level < 0 || progname == NULL || message == NULL)
|
|
return;
|
|
|
|
gettimeofday(&tv, NULL);
|
|
if (tv.tv_sec != tvsec || dataptr == NULL) {
|
|
/* this string is rebuild only once a second */
|
|
struct tm *tm = localtime(&tv.tv_sec);
|
|
tvsec = tv.tv_sec;
|
|
|
|
hdr_len = snprintf(logmsg, sizeof(logmsg),
|
|
"<<<<>%s %2d %02d:%02d:%02d %s[%d]: ",
|
|
monthname[tm->tm_mon],
|
|
tm->tm_mday, tm->tm_hour, tm->tm_min, tm->tm_sec,
|
|
progname, pid);
|
|
/* WARNING: depending upon implementations, snprintf may return
|
|
* either -1 or the number of bytes that would be needed to store
|
|
* the total message. In both cases, we must adjust it.
|
|
*/
|
|
if (hdr_len < 0 || hdr_len > sizeof(logmsg))
|
|
hdr_len = sizeof(logmsg);
|
|
|
|
dataptr = logmsg + hdr_len;
|
|
}
|
|
|
|
va_start(argp, message);
|
|
data_len = vsnprintf(dataptr, logmsg + sizeof(logmsg) - dataptr, message, argp);
|
|
if (data_len < 0 || data_len > (logmsg + sizeof(logmsg) - dataptr))
|
|
data_len = logmsg + sizeof(logmsg) - dataptr;
|
|
va_end(argp);
|
|
dataptr[data_len - 1] = '\n'; /* force a break on ultra-long lines */
|
|
|
|
if (p == NULL) {
|
|
if (global.logfac1 >= 0) {
|
|
sa[nbloggers] = &global.logsrv1;
|
|
facilities[nbloggers] = global.logfac1;
|
|
loglevel[nbloggers] = global.loglev1;
|
|
nbloggers++;
|
|
}
|
|
if (global.logfac2 >= 0) {
|
|
sa[nbloggers] = &global.logsrv2;
|
|
facilities[nbloggers] = global.logfac2;
|
|
loglevel[nbloggers] = global.loglev2;
|
|
nbloggers++;
|
|
}
|
|
} else {
|
|
if (p->logfac1 >= 0) {
|
|
sa[nbloggers] = &p->logsrv1;
|
|
facilities[nbloggers] = p->logfac1;
|
|
loglevel[nbloggers] = p->loglev1;
|
|
nbloggers++;
|
|
}
|
|
if (p->logfac2 >= 0) {
|
|
sa[nbloggers] = &p->logsrv2;
|
|
facilities[nbloggers] = p->logfac2;
|
|
loglevel[nbloggers] = p->loglev2;
|
|
nbloggers++;
|
|
}
|
|
}
|
|
|
|
while (nbloggers-- > 0) {
|
|
/* we can filter the level of the messages that are sent to each logger */
|
|
if (level > loglevel[nbloggers])
|
|
continue;
|
|
|
|
/* For each target, we may have a different facility.
|
|
* We can also have a different log level for each message.
|
|
* This induces variations in the message header length.
|
|
* Since we don't want to recompute it each time, nor copy it every
|
|
* time, we only change the facility in the pre-computed header,
|
|
* and we change the pointer to the header accordingly.
|
|
*/
|
|
fac_level = (facilities[nbloggers] << 3) + level;
|
|
log_ptr = logmsg + 3; /* last digit of the log level */
|
|
do {
|
|
*log_ptr = '0' + fac_level % 10;
|
|
fac_level /= 10;
|
|
log_ptr--;
|
|
} while (fac_level && log_ptr > logmsg);
|
|
*log_ptr = '<';
|
|
|
|
/* the total syslog message now starts at logptr, for dataptr+data_len-logptr */
|
|
|
|
#ifndef MSG_NOSIGNAL
|
|
sendto(logfd, log_ptr, dataptr + data_len - log_ptr, MSG_DONTWAIT,
|
|
(struct sockaddr *)sa[nbloggers], sizeof(**sa));
|
|
#else
|
|
sendto(logfd, log_ptr, dataptr + data_len - log_ptr, MSG_DONTWAIT | MSG_NOSIGNAL,
|
|
(struct sockaddr *)sa[nbloggers], sizeof(**sa));
|
|
#endif
|
|
}
|
|
}
|
|
|
|
|
|
/* sets <tv> to the current time */
|
|
static inline struct timeval *tv_now(struct timeval *tv) {
|
|
if (tv)
|
|
gettimeofday(tv, NULL);
|
|
return tv;
|
|
}
|
|
|
|
/*
|
|
* adds <ms> ms to <from>, set the result to <tv> and returns a pointer <tv>
|
|
*/
|
|
static inline struct timeval *tv_delayfrom(struct timeval *tv, struct timeval *from, int ms) {
|
|
if (!tv || !from)
|
|
return NULL;
|
|
tv->tv_usec = from->tv_usec + (ms%1000)*1000;
|
|
tv->tv_sec = from->tv_sec + (ms/1000);
|
|
while (tv->tv_usec >= 1000000) {
|
|
tv->tv_usec -= 1000000;
|
|
tv->tv_sec++;
|
|
}
|
|
return tv;
|
|
}
|
|
|
|
/*
|
|
* compares <tv1> and <tv2> : returns 0 if equal, -1 if tv1 < tv2, 1 if tv1 > tv2
|
|
*/
|
|
static inline int tv_cmp(struct timeval *tv1, struct timeval *tv2) {
|
|
if (tv1->tv_sec < tv2->tv_sec)
|
|
return -1;
|
|
else if (tv1->tv_sec > tv2->tv_sec)
|
|
return 1;
|
|
else if (tv1->tv_usec < tv2->tv_usec)
|
|
return -1;
|
|
else if (tv1->tv_usec > tv2->tv_usec)
|
|
return 1;
|
|
else
|
|
return 0;
|
|
}
|
|
|
|
/*
|
|
* returns the absolute difference, in ms, between tv1 and tv2
|
|
*/
|
|
unsigned long tv_delta(struct timeval *tv1, struct timeval *tv2) {
|
|
int cmp;
|
|
unsigned long ret;
|
|
|
|
|
|
cmp = tv_cmp(tv1, tv2);
|
|
if (!cmp)
|
|
return 0; /* same dates, null diff */
|
|
else if (cmp < 0) {
|
|
struct timeval *tmp = tv1;
|
|
tv1 = tv2;
|
|
tv2 = tmp;
|
|
}
|
|
ret = (tv1->tv_sec - tv2->tv_sec) * 1000;
|
|
if (tv1->tv_usec > tv2->tv_usec)
|
|
ret += (tv1->tv_usec - tv2->tv_usec) / 1000;
|
|
else
|
|
ret -= (tv2->tv_usec - tv1->tv_usec) / 1000;
|
|
return (unsigned long) ret;
|
|
}
|
|
|
|
/*
|
|
* returns the difference, in ms, between tv1 and tv2
|
|
*/
|
|
static inline unsigned long tv_diff(struct timeval *tv1, struct timeval *tv2) {
|
|
unsigned long ret;
|
|
|
|
ret = (tv2->tv_sec - tv1->tv_sec) * 1000;
|
|
if (tv2->tv_usec > tv1->tv_usec)
|
|
ret += (tv2->tv_usec - tv1->tv_usec) / 1000;
|
|
else
|
|
ret -= (tv1->tv_usec - tv2->tv_usec) / 1000;
|
|
return (unsigned long) ret;
|
|
}
|
|
|
|
/*
|
|
* compares <tv1> and <tv2> modulo 1ms: returns 0 if equal, -1 if tv1 < tv2, 1 if tv1 > tv2
|
|
*/
|
|
static inline int tv_cmp_ms(struct timeval *tv1, struct timeval *tv2) {
|
|
if (tv1->tv_sec == tv2->tv_sec) {
|
|
if (tv2->tv_usec > tv1->tv_usec + 1000)
|
|
return -1;
|
|
else if (tv1->tv_usec > tv2->tv_usec + 1000)
|
|
return 1;
|
|
else
|
|
return 0;
|
|
}
|
|
else if ((tv2->tv_sec > tv1->tv_sec + 1) ||
|
|
((tv2->tv_sec == tv1->tv_sec + 1) && (tv2->tv_usec + 1000000 > tv1->tv_usec + 1000)))
|
|
return -1;
|
|
else if ((tv1->tv_sec > tv2->tv_sec + 1) ||
|
|
((tv1->tv_sec == tv2->tv_sec + 1) && (tv1->tv_usec + 1000000 > tv2->tv_usec + 1000)))
|
|
return 1;
|
|
else
|
|
return 0;
|
|
}
|
|
|
|
/*
|
|
* returns the remaining time between tv1=now and event=tv2
|
|
* if tv2 is passed, 0 is returned.
|
|
*/
|
|
static inline unsigned long tv_remain(struct timeval *tv1, struct timeval *tv2) {
|
|
unsigned long ret;
|
|
|
|
if (tv_cmp_ms(tv1, tv2) >= 0)
|
|
return 0; /* event elapsed */
|
|
|
|
ret = (tv2->tv_sec - tv1->tv_sec) * 1000;
|
|
if (tv2->tv_usec > tv1->tv_usec)
|
|
ret += (tv2->tv_usec - tv1->tv_usec) / 1000;
|
|
else
|
|
ret -= (tv1->tv_usec - tv2->tv_usec) / 1000;
|
|
return (unsigned long) ret;
|
|
}
|
|
|
|
|
|
/*
|
|
* zeroes a struct timeval
|
|
*/
|
|
|
|
static inline struct timeval *tv_eternity(struct timeval *tv) {
|
|
tv->tv_sec = tv->tv_usec = 0;
|
|
return tv;
|
|
}
|
|
|
|
/*
|
|
* returns 1 if tv is null, else 0
|
|
*/
|
|
static inline int tv_iseternity(struct timeval *tv) {
|
|
if (tv->tv_sec == 0 && tv->tv_usec == 0)
|
|
return 1;
|
|
else
|
|
return 0;
|
|
}
|
|
|
|
/*
|
|
* compares <tv1> and <tv2> : returns 0 if equal, -1 if tv1 < tv2, 1 if tv1 > tv2,
|
|
* considering that 0 is the eternity.
|
|
*/
|
|
static inline int tv_cmp2(struct timeval *tv1, struct timeval *tv2) {
|
|
if (tv_iseternity(tv1))
|
|
if (tv_iseternity(tv2))
|
|
return 0; /* same */
|
|
else
|
|
return 1; /* tv1 later than tv2 */
|
|
else if (tv_iseternity(tv2))
|
|
return -1; /* tv2 later than tv1 */
|
|
|
|
if (tv1->tv_sec > tv2->tv_sec)
|
|
return 1;
|
|
else if (tv1->tv_sec < tv2->tv_sec)
|
|
return -1;
|
|
else if (tv1->tv_usec > tv2->tv_usec)
|
|
return 1;
|
|
else if (tv1->tv_usec < tv2->tv_usec)
|
|
return -1;
|
|
else
|
|
return 0;
|
|
}
|
|
|
|
/*
|
|
* compares <tv1> and <tv2> modulo 1 ms: returns 0 if equal, -1 if tv1 < tv2, 1 if tv1 > tv2,
|
|
* considering that 0 is the eternity.
|
|
*/
|
|
static inline int tv_cmp2_ms(struct timeval *tv1, struct timeval *tv2) {
|
|
if (tv_iseternity(tv1))
|
|
if (tv_iseternity(tv2))
|
|
return 0; /* same */
|
|
else
|
|
return 1; /* tv1 later than tv2 */
|
|
else if (tv_iseternity(tv2))
|
|
return -1; /* tv2 later than tv1 */
|
|
|
|
if (tv1->tv_sec == tv2->tv_sec) {
|
|
if (tv1->tv_usec > tv2->tv_usec + 1000)
|
|
return 1;
|
|
else if (tv2->tv_usec > tv1->tv_usec + 1000)
|
|
return -1;
|
|
else
|
|
return 0;
|
|
}
|
|
else if ((tv1->tv_sec > tv2->tv_sec + 1) ||
|
|
((tv1->tv_sec == tv2->tv_sec + 1) && (tv1->tv_usec + 1000000 > tv2->tv_usec + 1000)))
|
|
return 1;
|
|
else if ((tv2->tv_sec > tv1->tv_sec + 1) ||
|
|
((tv2->tv_sec == tv1->tv_sec + 1) && (tv2->tv_usec + 1000000 > tv1->tv_usec + 1000)))
|
|
return -1;
|
|
else
|
|
return 0;
|
|
}
|
|
|
|
/*
|
|
* returns the first event between tv1 and tv2 into tvmin.
|
|
* a zero tv is ignored. tvmin is returned.
|
|
*/
|
|
static inline struct timeval *tv_min(struct timeval *tvmin,
|
|
struct timeval *tv1, struct timeval *tv2) {
|
|
|
|
if (tv_cmp2(tv1, tv2) <= 0)
|
|
*tvmin = *tv1;
|
|
else
|
|
*tvmin = *tv2;
|
|
|
|
return tvmin;
|
|
}
|
|
|
|
|
|
|
|
/***********************************************************/
|
|
/* fd management ***************************************/
|
|
/***********************************************************/
|
|
|
|
|
|
|
|
/* Deletes an FD from the fdsets, and recomputes the maxfd limit.
|
|
* The file descriptor is also closed.
|
|
*/
|
|
static inline void fd_delete(int fd) {
|
|
FD_CLR(fd, StaticReadEvent);
|
|
FD_CLR(fd, StaticWriteEvent);
|
|
#if defined(ENABLE_EPOLL)
|
|
if (PrevReadEvent) {
|
|
FD_CLR(fd, PrevReadEvent);
|
|
FD_CLR(fd, PrevWriteEvent);
|
|
}
|
|
#endif
|
|
|
|
close(fd);
|
|
fdtab[fd].state = FD_STCLOSE;
|
|
|
|
while ((maxfd-1 >= 0) && (fdtab[maxfd-1].state == FD_STCLOSE))
|
|
maxfd--;
|
|
}
|
|
|
|
/* recomputes the maxfd limit from the fd */
|
|
static inline void fd_insert(int fd) {
|
|
if (fd+1 > maxfd)
|
|
maxfd = fd+1;
|
|
}
|
|
|
|
/*************************************************************/
|
|
/* task management ***************************************/
|
|
/*************************************************************/
|
|
|
|
/* puts the task <t> in run queue <q>, and returns <t> */
|
|
static inline struct task *task_wakeup(struct task **q, struct task *t) {
|
|
if (t->state == TASK_RUNNING)
|
|
return t;
|
|
else {
|
|
t->rqnext = *q;
|
|
t->state = TASK_RUNNING;
|
|
return *q = t;
|
|
}
|
|
}
|
|
|
|
/* removes the task <t> from the queue <q>
|
|
* <s> MUST be <q>'s first task.
|
|
* set the run queue to point to the next one, and return it
|
|
*/
|
|
static inline struct task *task_sleep(struct task **q, struct task *t) {
|
|
if (t->state == TASK_RUNNING) {
|
|
*q = t->rqnext;
|
|
t->state = TASK_IDLE; /* tell that s has left the run queue */
|
|
}
|
|
return *q; /* return next running task */
|
|
}
|
|
|
|
/*
|
|
* removes the task <t> from its wait queue. It must have already been removed
|
|
* from the run queue. A pointer to the task itself is returned.
|
|
*/
|
|
static inline struct task *task_delete(struct task *t) {
|
|
t->prev->next = t->next;
|
|
t->next->prev = t->prev;
|
|
return t;
|
|
}
|
|
|
|
/*
|
|
* frees a task. Its context must have been freed since it will be lost.
|
|
*/
|
|
static inline void task_free(struct task *t) {
|
|
pool_free(task, t);
|
|
}
|
|
|
|
/* inserts <task> into its assigned wait queue, where it may already be. In this case, it
|
|
* may be only moved or left where it was, depending on its timing requirements.
|
|
* <task> is returned.
|
|
*/
|
|
struct task *task_queue(struct task *task) {
|
|
struct task *list = task->wq;
|
|
struct task *start_from;
|
|
|
|
/* first, test if the task was already in a list */
|
|
if (task->prev == NULL) {
|
|
// start_from = list;
|
|
start_from = list->prev;
|
|
#if STATTIME > 0
|
|
stats_tsk_new++;
|
|
#endif
|
|
/* insert the unlinked <task> into the list, searching back from the last entry */
|
|
while (start_from != list && tv_cmp2(&task->expire, &start_from->expire) < 0) {
|
|
start_from = start_from->prev;
|
|
#if STATTIME > 0
|
|
stats_tsk_nsrch++;
|
|
#endif
|
|
}
|
|
|
|
// while (start_from->next != list && tv_cmp2(&task->expire, &start_from->next->expire) > 0) {
|
|
// start_from = start_from->next;
|
|
// stats_tsk_nsrch++;
|
|
// }
|
|
}
|
|
else if (task->prev == list ||
|
|
tv_cmp2(&task->expire, &task->prev->expire) >= 0) { /* walk right */
|
|
start_from = task->next;
|
|
if (start_from == list || tv_cmp2(&task->expire, &start_from->expire) <= 0) {
|
|
#if STATTIME > 0
|
|
stats_tsk_good++;
|
|
#endif
|
|
return task; /* it's already in the right place */
|
|
}
|
|
|
|
#if STATTIME > 0
|
|
stats_tsk_right++;
|
|
#endif
|
|
|
|
/* if the task is not at the right place, there's little chance that
|
|
* it has only shifted a bit, and it will nearly always be queued
|
|
* at the end of the list because of constant timeouts
|
|
* (observed in real case).
|
|
*/
|
|
#ifndef WE_REALLY_THINK_THAT_THIS_TASK_MAY_HAVE_SHIFTED
|
|
start_from = list->prev; /* assume we'll queue to the end of the list */
|
|
while (start_from != list && tv_cmp2(&task->expire, &start_from->expire) < 0) {
|
|
start_from = start_from->prev;
|
|
#if STATTIME > 0
|
|
stats_tsk_lsrch++;
|
|
#endif
|
|
}
|
|
#else /* WE_REALLY_... */
|
|
/* insert the unlinked <task> into the list, searching after position <start_from> */
|
|
while (start_from->next != list && tv_cmp2(&task->expire, &start_from->next->expire) > 0) {
|
|
start_from = start_from->next;
|
|
#if STATTIME > 0
|
|
stats_tsk_rsrch++;
|
|
#endif
|
|
}
|
|
#endif /* WE_REALLY_... */
|
|
|
|
/* we need to unlink it now */
|
|
task_delete(task);
|
|
}
|
|
else { /* walk left. */
|
|
#if STATTIME > 0
|
|
stats_tsk_left++;
|
|
#endif
|
|
#ifdef LEFT_TO_TOP /* not very good */
|
|
start_from = list;
|
|
while (start_from->next != list && tv_cmp2(&task->expire, &start_from->next->expire) > 0) {
|
|
start_from = start_from->next;
|
|
#if STATTIME > 0
|
|
stats_tsk_lsrch++;
|
|
#endif
|
|
}
|
|
#else
|
|
start_from = task->prev->prev; /* valid because of the previous test above */
|
|
while (start_from != list && tv_cmp2(&task->expire, &start_from->expire) < 0) {
|
|
start_from = start_from->prev;
|
|
#if STATTIME > 0
|
|
stats_tsk_lsrch++;
|
|
#endif
|
|
}
|
|
#endif
|
|
/* we need to unlink it now */
|
|
task_delete(task);
|
|
}
|
|
task->prev = start_from;
|
|
task->next = start_from->next;
|
|
task->next->prev = task;
|
|
start_from->next = task;
|
|
return task;
|
|
}
|
|
|
|
|
|
/*********************************************************************/
|
|
/* more specific functions ***************************************/
|
|
/*********************************************************************/
|
|
|
|
/* some prototypes */
|
|
static int maintain_proxies(void);
|
|
|
|
/* this either returns the sockname or the original destination address. Code
|
|
* inspired from Patrick Schaaf's example of nf_getsockname() implementation.
|
|
*/
|
|
static int get_original_dst(int fd, struct sockaddr_in *sa, int *salen) {
|
|
#if defined(TPROXY) && defined(SO_ORIGINAL_DST)
|
|
return getsockopt(fd, SOL_IP, SO_ORIGINAL_DST, (void *)sa, salen);
|
|
#else
|
|
#if defined(TPROXY) && defined(USE_GETSOCKNAME)
|
|
return getsockname(fd, (struct sockaddr *)sa, salen);
|
|
#else
|
|
return -1;
|
|
#endif
|
|
#endif
|
|
}
|
|
|
|
/*
|
|
* frees the context associated to a session. It must have been removed first.
|
|
*/
|
|
static inline void session_free(struct session *s) {
|
|
if (s->req)
|
|
pool_free(buffer, s->req);
|
|
if (s->rep)
|
|
pool_free(buffer, s->rep);
|
|
|
|
if (s->rsp_cap != NULL) {
|
|
struct cap_hdr *h;
|
|
for (h = s->proxy->rsp_cap; h; h = h->next) {
|
|
if (s->rsp_cap[h->index] != NULL)
|
|
pool_free_to(h->pool, s->rsp_cap[h->index]);
|
|
}
|
|
pool_free_to(s->proxy->rsp_cap_pool, s->rsp_cap);
|
|
}
|
|
if (s->req_cap != NULL) {
|
|
struct cap_hdr *h;
|
|
for (h = s->proxy->req_cap; h; h = h->next) {
|
|
if (s->req_cap[h->index] != NULL)
|
|
pool_free_to(h->pool, s->req_cap[h->index]);
|
|
}
|
|
pool_free_to(s->proxy->req_cap_pool, s->req_cap);
|
|
}
|
|
|
|
if (s->logs.uri)
|
|
pool_free(requri, s->logs.uri);
|
|
if (s->logs.cli_cookie)
|
|
pool_free(capture, s->logs.cli_cookie);
|
|
if (s->logs.srv_cookie)
|
|
pool_free(capture, s->logs.srv_cookie);
|
|
|
|
pool_free(session, s);
|
|
}
|
|
|
|
|
|
/*
|
|
* This function tries to find a running server for the proxy <px>. A first
|
|
* pass looks for active servers, and if none is found, a second pass also
|
|
* looks for backup servers.
|
|
* If no valid server is found, NULL is returned and px->cursrv is left undefined.
|
|
*/
|
|
static inline struct server *find_server(struct proxy *px) {
|
|
struct server *srv = px->cursrv;
|
|
int ignore_backup = 1;
|
|
|
|
do {
|
|
do {
|
|
if (srv == NULL)
|
|
srv = px->srv;
|
|
if (srv->state & SRV_RUNNING
|
|
&& !((srv->state & SRV_BACKUP) && ignore_backup))
|
|
return srv;
|
|
srv = srv->next;
|
|
} while (srv != px->cursrv);
|
|
} while (ignore_backup--);
|
|
return NULL;
|
|
}
|
|
|
|
/*
|
|
* This function initiates a connection to the current server (s->srv) if (s->direct)
|
|
* is set, or to the dispatch server if (s->direct) is 0. It returns 0 if
|
|
* it's OK, -1 if it's impossible.
|
|
*/
|
|
int connect_server(struct session *s) {
|
|
int fd;
|
|
|
|
#ifdef DEBUG_FULL
|
|
fprintf(stderr,"connect_server : s=%p\n",s);
|
|
#endif
|
|
|
|
if (s->flags & SN_DIRECT) { /* srv cannot be null */
|
|
s->srv_addr = s->srv->addr;
|
|
}
|
|
else if (s->proxy->options & PR_O_BALANCE) {
|
|
if (s->proxy->options & PR_O_BALANCE_RR) {
|
|
struct server *srv;
|
|
|
|
srv = find_server(s->proxy);
|
|
|
|
if (srv == NULL) /* no server left */
|
|
return -1;
|
|
|
|
s->srv_addr = srv->addr;
|
|
s->srv = srv;
|
|
s->proxy->cursrv = srv->next;
|
|
}
|
|
else /* unknown balancing algorithm */
|
|
return -1;
|
|
}
|
|
else if (*(int *)&s->proxy->dispatch_addr.sin_addr) {
|
|
/* connect to the defined dispatch addr */
|
|
s->srv_addr = s->proxy->dispatch_addr;
|
|
}
|
|
else if (s->proxy->options & PR_O_TRANSP) {
|
|
/* in transparent mode, use the original dest addr if no dispatch specified */
|
|
int salen = sizeof(struct sockaddr_in);
|
|
if (get_original_dst(s->cli_fd, &s->srv_addr, &salen) == -1) {
|
|
qfprintf(stderr, "Cannot get original server address.\n");
|
|
return -1;
|
|
}
|
|
}
|
|
|
|
/* if this server remaps proxied ports, we'll use
|
|
* the port the client connected to with an offset. */
|
|
if (s->srv != NULL && s->srv->state & SRV_MAPPORTS) {
|
|
struct sockaddr_in sockname;
|
|
int namelen;
|
|
|
|
namelen = sizeof(sockname);
|
|
if (get_original_dst(s->cli_fd, (struct sockaddr_in *)&sockname, &namelen) == -1)
|
|
getsockname(s->cli_fd, (struct sockaddr *)&sockname, &namelen);
|
|
s->srv_addr.sin_port = htons(ntohs(s->srv_addr.sin_port) + ntohs(sockname.sin_port));
|
|
}
|
|
|
|
if ((fd = s->srv_fd = socket(AF_INET, SOCK_STREAM, IPPROTO_TCP)) == -1) {
|
|
qfprintf(stderr, "Cannot get a server socket.\n");
|
|
return -1;
|
|
}
|
|
|
|
if (fd >= global.maxsock) {
|
|
Alert("socket(): not enough free sockets. Raise -n argument. Giving up.\n");
|
|
close(fd);
|
|
return -1;
|
|
}
|
|
|
|
if ((fcntl(fd, F_SETFL, O_NONBLOCK)==-1) ||
|
|
(setsockopt(fd, IPPROTO_TCP, TCP_NODELAY, (char *) &one, sizeof(one)) == -1)) {
|
|
qfprintf(stderr,"Cannot set client socket to non blocking mode.\n");
|
|
close(fd);
|
|
return -1;
|
|
}
|
|
|
|
/* allow specific binding :
|
|
* - server-specific at first
|
|
* - proxy-specific next
|
|
*/
|
|
if (s->srv != NULL && s->srv->state & SRV_BIND_SRC) {
|
|
setsockopt(fd, SOL_SOCKET, SO_REUSEADDR, (char *) &one, sizeof(one));
|
|
if (bind(fd, (struct sockaddr *)&s->srv->source_addr, sizeof(s->srv->source_addr)) == -1) {
|
|
Alert("Cannot bind to source address before connect() for server %s/%s. Aborting.\n",
|
|
s->proxy->id, s->srv->id);
|
|
close(fd);
|
|
return -1;
|
|
}
|
|
}
|
|
else if (s->proxy->options & PR_O_BIND_SRC) {
|
|
setsockopt(fd, SOL_SOCKET, SO_REUSEADDR, (char *) &one, sizeof(one));
|
|
if (bind(fd, (struct sockaddr *)&s->proxy->source_addr, sizeof(s->proxy->source_addr)) == -1) {
|
|
Alert("Cannot bind to source address before connect() for proxy %s. Aborting.\n", s->proxy->id);
|
|
close(fd);
|
|
return -1;
|
|
}
|
|
}
|
|
|
|
if ((connect(fd, (struct sockaddr *)&s->srv_addr, sizeof(s->srv_addr)) == -1) && (errno != EINPROGRESS)) {
|
|
if (errno == EAGAIN) { /* no free ports left, try again later */
|
|
qfprintf(stderr,"Cannot connect, no free ports.\n");
|
|
close(fd);
|
|
return -1;
|
|
}
|
|
else if (errno != EALREADY && errno != EISCONN) {
|
|
close(fd);
|
|
return -1;
|
|
}
|
|
}
|
|
|
|
fdtab[fd].owner = s->task;
|
|
fdtab[fd].read = &event_srv_read;
|
|
fdtab[fd].write = &event_srv_write;
|
|
fdtab[fd].state = FD_STCONN; /* connection in progress */
|
|
|
|
FD_SET(fd, StaticWriteEvent); /* for connect status */
|
|
|
|
fd_insert(fd);
|
|
|
|
if (s->proxy->contimeout)
|
|
tv_delayfrom(&s->cnexpire, &now, s->proxy->contimeout);
|
|
else
|
|
tv_eternity(&s->cnexpire);
|
|
return 0;
|
|
}
|
|
|
|
/*
|
|
* this function is called on a read event from a client socket.
|
|
* It returns 0.
|
|
*/
|
|
int event_cli_read(int fd) {
|
|
struct task *t = fdtab[fd].owner;
|
|
struct session *s = t->context;
|
|
struct buffer *b = s->req;
|
|
int ret, max;
|
|
|
|
#ifdef DEBUG_FULL
|
|
fprintf(stderr,"event_cli_read : fd=%d, s=%p\n", fd, s);
|
|
#endif
|
|
|
|
if (fdtab[fd].state != FD_STERROR) {
|
|
#ifdef FILL_BUFFERS
|
|
while (1)
|
|
#else
|
|
do
|
|
#endif
|
|
{
|
|
if (b->l == 0) { /* let's realign the buffer to optimize I/O */
|
|
b->r = b->w = b->h = b->lr = b->data;
|
|
max = b->rlim - b->data;
|
|
}
|
|
else if (b->r > b->w) {
|
|
max = b->rlim - b->r;
|
|
}
|
|
else {
|
|
max = b->w - b->r;
|
|
/* FIXME: theorically, if w>0, we shouldn't have rlim < data+size anymore
|
|
* since it means that the rewrite protection has been removed. This
|
|
* implies that the if statement can be removed.
|
|
*/
|
|
if (max > b->rlim - b->data)
|
|
max = b->rlim - b->data;
|
|
}
|
|
|
|
if (max == 0) { /* not anymore room to store data */
|
|
FD_CLR(fd, StaticReadEvent);
|
|
break;
|
|
}
|
|
|
|
#ifndef MSG_NOSIGNAL
|
|
{
|
|
int skerr, lskerr;
|
|
|
|
lskerr = sizeof(skerr);
|
|
getsockopt(fd, SOL_SOCKET, SO_ERROR, &skerr, &lskerr);
|
|
if (skerr)
|
|
ret = -1;
|
|
else
|
|
ret = recv(fd, b->r, max, 0);
|
|
}
|
|
#else
|
|
ret = recv(fd, b->r, max, MSG_NOSIGNAL);
|
|
#endif
|
|
if (ret > 0) {
|
|
b->r += ret;
|
|
b->l += ret;
|
|
s->res_cr = RES_DATA;
|
|
|
|
if (b->r == b->data + BUFSIZE) {
|
|
b->r = b->data; /* wrap around the buffer */
|
|
}
|
|
|
|
b->total += ret;
|
|
/* we hope to read more data or to get a close on next round */
|
|
continue;
|
|
}
|
|
else if (ret == 0) {
|
|
s->res_cr = RES_NULL;
|
|
break;
|
|
}
|
|
else if (errno == EAGAIN) {/* ignore EAGAIN */
|
|
break;
|
|
}
|
|
else {
|
|
s->res_cr = RES_ERROR;
|
|
fdtab[fd].state = FD_STERROR;
|
|
break;
|
|
}
|
|
} /* while(1) */
|
|
#ifndef FILL_BUFFERS
|
|
while (0);
|
|
#endif
|
|
}
|
|
else {
|
|
s->res_cr = RES_ERROR;
|
|
fdtab[fd].state = FD_STERROR;
|
|
}
|
|
|
|
if (s->res_cr != RES_SILENT) {
|
|
if (s->proxy->clitimeout && FD_ISSET(fd, StaticReadEvent))
|
|
tv_delayfrom(&s->crexpire, &now, s->proxy->clitimeout);
|
|
else
|
|
tv_eternity(&s->crexpire);
|
|
|
|
task_wakeup(&rq, t);
|
|
}
|
|
|
|
return 0;
|
|
}
|
|
|
|
|
|
/*
|
|
* this function is called on a read event from a server socket.
|
|
* It returns 0.
|
|
*/
|
|
int event_srv_read(int fd) {
|
|
struct task *t = fdtab[fd].owner;
|
|
struct session *s = t->context;
|
|
struct buffer *b = s->rep;
|
|
int ret, max;
|
|
|
|
#ifdef DEBUG_FULL
|
|
fprintf(stderr,"event_srv_read : fd=%d, s=%p\n", fd, s);
|
|
#endif
|
|
|
|
if (fdtab[fd].state != FD_STERROR) {
|
|
#ifdef FILL_BUFFERS
|
|
while (1)
|
|
#else
|
|
do
|
|
#endif
|
|
{
|
|
if (b->l == 0) { /* let's realign the buffer to optimize I/O */
|
|
b->r = b->w = b->h = b->lr = b->data;
|
|
max = b->rlim - b->data;
|
|
}
|
|
else if (b->r > b->w) {
|
|
max = b->rlim - b->r;
|
|
}
|
|
else {
|
|
max = b->w - b->r;
|
|
/* FIXME: theorically, if w>0, we shouldn't have rlim < data+size anymore
|
|
* since it means that the rewrite protection has been removed. This
|
|
* implies that the if statement can be removed.
|
|
*/
|
|
if (max > b->rlim - b->data)
|
|
max = b->rlim - b->data;
|
|
}
|
|
|
|
if (max == 0) { /* not anymore room to store data */
|
|
FD_CLR(fd, StaticReadEvent);
|
|
break;
|
|
}
|
|
|
|
#ifndef MSG_NOSIGNAL
|
|
{
|
|
int skerr, lskerr;
|
|
|
|
lskerr = sizeof(skerr);
|
|
getsockopt(fd, SOL_SOCKET, SO_ERROR, &skerr, &lskerr);
|
|
if (skerr)
|
|
ret = -1;
|
|
else
|
|
ret = recv(fd, b->r, max, 0);
|
|
}
|
|
#else
|
|
ret = recv(fd, b->r, max, MSG_NOSIGNAL);
|
|
#endif
|
|
if (ret > 0) {
|
|
b->r += ret;
|
|
b->l += ret;
|
|
s->res_sr = RES_DATA;
|
|
|
|
if (b->r == b->data + BUFSIZE) {
|
|
b->r = b->data; /* wrap around the buffer */
|
|
}
|
|
|
|
b->total += ret;
|
|
/* we hope to read more data or to get a close on next round */
|
|
continue;
|
|
}
|
|
else if (ret == 0) {
|
|
s->res_sr = RES_NULL;
|
|
break;
|
|
}
|
|
else if (errno == EAGAIN) {/* ignore EAGAIN */
|
|
break;
|
|
}
|
|
else {
|
|
s->res_sr = RES_ERROR;
|
|
fdtab[fd].state = FD_STERROR;
|
|
break;
|
|
}
|
|
} /* while(1) */
|
|
#ifndef FILL_BUFFERS
|
|
while (0);
|
|
#endif
|
|
}
|
|
else {
|
|
s->res_sr = RES_ERROR;
|
|
fdtab[fd].state = FD_STERROR;
|
|
}
|
|
|
|
if (s->res_sr != RES_SILENT) {
|
|
if (s->proxy->srvtimeout && FD_ISSET(fd, StaticReadEvent))
|
|
tv_delayfrom(&s->srexpire, &now, s->proxy->srvtimeout);
|
|
else
|
|
tv_eternity(&s->srexpire);
|
|
|
|
task_wakeup(&rq, t);
|
|
}
|
|
|
|
return 0;
|
|
}
|
|
|
|
/*
|
|
* this function is called on a write event from a client socket.
|
|
* It returns 0.
|
|
*/
|
|
int event_cli_write(int fd) {
|
|
struct task *t = fdtab[fd].owner;
|
|
struct session *s = t->context;
|
|
struct buffer *b = s->rep;
|
|
int ret, max;
|
|
|
|
#ifdef DEBUG_FULL
|
|
fprintf(stderr,"event_cli_write : fd=%d, s=%p\n", fd, s);
|
|
#endif
|
|
|
|
if (b->l == 0) { /* let's realign the buffer to optimize I/O */
|
|
b->r = b->w = b->h = b->lr = b->data;
|
|
// max = BUFSIZE; BUG !!!!
|
|
max = 0;
|
|
}
|
|
else if (b->r > b->w) {
|
|
max = b->r - b->w;
|
|
}
|
|
else
|
|
max = b->data + BUFSIZE - b->w;
|
|
|
|
if (fdtab[fd].state != FD_STERROR) {
|
|
#ifndef MSG_NOSIGNAL
|
|
int skerr, lskerr;
|
|
#endif
|
|
|
|
if (max == 0) {
|
|
s->res_cw = RES_NULL;
|
|
task_wakeup(&rq, t);
|
|
tv_eternity(&s->cwexpire);
|
|
FD_CLR(fd, StaticWriteEvent);
|
|
return 0;
|
|
}
|
|
|
|
#ifndef MSG_NOSIGNAL
|
|
lskerr=sizeof(skerr);
|
|
getsockopt(fd, SOL_SOCKET, SO_ERROR, &skerr, &lskerr);
|
|
if (skerr)
|
|
ret = -1;
|
|
else
|
|
ret = send(fd, b->w, max, MSG_DONTWAIT);
|
|
#else
|
|
ret = send(fd, b->w, max, MSG_DONTWAIT | MSG_NOSIGNAL);
|
|
#endif
|
|
|
|
if (ret > 0) {
|
|
b->l -= ret;
|
|
b->w += ret;
|
|
|
|
s->res_cw = RES_DATA;
|
|
|
|
if (b->w == b->data + BUFSIZE) {
|
|
b->w = b->data; /* wrap around the buffer */
|
|
}
|
|
}
|
|
else if (ret == 0) {
|
|
/* nothing written, just make as if we were never called */
|
|
// s->res_cw = RES_NULL;
|
|
return 0;
|
|
}
|
|
else if (errno == EAGAIN) /* ignore EAGAIN */
|
|
return 0;
|
|
else {
|
|
s->res_cw = RES_ERROR;
|
|
fdtab[fd].state = FD_STERROR;
|
|
}
|
|
}
|
|
else {
|
|
s->res_cw = RES_ERROR;
|
|
fdtab[fd].state = FD_STERROR;
|
|
}
|
|
|
|
if (s->proxy->clitimeout) {
|
|
tv_delayfrom(&s->cwexpire, &now, s->proxy->clitimeout);
|
|
/* FIXME: to avoid the client to read-time-out during writes, we refresh it */
|
|
s->crexpire = s->cwexpire;
|
|
}
|
|
else
|
|
tv_eternity(&s->cwexpire);
|
|
|
|
task_wakeup(&rq, t);
|
|
return 0;
|
|
}
|
|
|
|
|
|
/*
|
|
* this function is called on a write event from a server socket.
|
|
* It returns 0.
|
|
*/
|
|
int event_srv_write(int fd) {
|
|
struct task *t = fdtab[fd].owner;
|
|
struct session *s = t->context;
|
|
struct buffer *b = s->req;
|
|
int ret, max;
|
|
|
|
#ifdef DEBUG_FULL
|
|
fprintf(stderr,"event_srv_write : fd=%d, s=%p\n", fd, s);
|
|
#endif
|
|
|
|
if (b->l == 0) { /* let's realign the buffer to optimize I/O */
|
|
b->r = b->w = b->h = b->lr = b->data;
|
|
// max = BUFSIZE; BUG !!!!
|
|
max = 0;
|
|
}
|
|
else if (b->r > b->w) {
|
|
max = b->r - b->w;
|
|
}
|
|
else
|
|
max = b->data + BUFSIZE - b->w;
|
|
|
|
if (fdtab[fd].state != FD_STERROR) {
|
|
#ifndef MSG_NOSIGNAL
|
|
int skerr, lskerr;
|
|
#endif
|
|
if (max == 0) {
|
|
/* may be we have received a connection acknowledgement in TCP mode without data */
|
|
s->res_sw = RES_NULL;
|
|
task_wakeup(&rq, t);
|
|
fdtab[fd].state = FD_STREADY;
|
|
tv_eternity(&s->swexpire);
|
|
FD_CLR(fd, StaticWriteEvent);
|
|
return 0;
|
|
}
|
|
|
|
|
|
#ifndef MSG_NOSIGNAL
|
|
lskerr=sizeof(skerr);
|
|
getsockopt(fd, SOL_SOCKET, SO_ERROR, &skerr, &lskerr);
|
|
if (skerr)
|
|
ret = -1;
|
|
else
|
|
ret = send(fd, b->w, max, MSG_DONTWAIT);
|
|
#else
|
|
ret = send(fd, b->w, max, MSG_DONTWAIT | MSG_NOSIGNAL);
|
|
#endif
|
|
fdtab[fd].state = FD_STREADY;
|
|
if (ret > 0) {
|
|
b->l -= ret;
|
|
b->w += ret;
|
|
|
|
s->res_sw = RES_DATA;
|
|
|
|
if (b->w == b->data + BUFSIZE) {
|
|
b->w = b->data; /* wrap around the buffer */
|
|
}
|
|
}
|
|
else if (ret == 0) {
|
|
/* nothing written, just make as if we were never called */
|
|
// s->res_sw = RES_NULL;
|
|
return 0;
|
|
}
|
|
else if (errno == EAGAIN) /* ignore EAGAIN */
|
|
return 0;
|
|
else {
|
|
s->res_sw = RES_ERROR;
|
|
fdtab[fd].state = FD_STERROR;
|
|
}
|
|
}
|
|
else {
|
|
s->res_sw = RES_ERROR;
|
|
fdtab[fd].state = FD_STERROR;
|
|
}
|
|
|
|
if (s->proxy->srvtimeout) {
|
|
tv_delayfrom(&s->swexpire, &now, s->proxy->srvtimeout);
|
|
/* FIXME: to avoid the server to read-time-out during writes, we refresh it */
|
|
s->srexpire = s->swexpire;
|
|
}
|
|
else
|
|
tv_eternity(&s->swexpire);
|
|
|
|
task_wakeup(&rq, t);
|
|
return 0;
|
|
}
|
|
|
|
|
|
/*
|
|
* returns a message to the client ; the connection is shut down for read,
|
|
* and the request is cleared so that no server connection can be initiated.
|
|
* The client must be in a valid state for this (HEADER, DATA ...).
|
|
* Nothing is performed on the server side.
|
|
* The reply buffer doesn't need to be empty before this.
|
|
*/
|
|
void client_retnclose(struct session *s, int len, const char *msg) {
|
|
FD_CLR(s->cli_fd, StaticReadEvent);
|
|
FD_SET(s->cli_fd, StaticWriteEvent);
|
|
tv_eternity(&s->crexpire);
|
|
shutdown(s->cli_fd, SHUT_RD);
|
|
s->cli_state = CL_STSHUTR;
|
|
strcpy(s->rep->data, msg);
|
|
s->rep->l = len;
|
|
s->rep->r = s->rep->h = s->rep->lr = s->rep->w = s->rep->data;
|
|
s->rep->r += len;
|
|
s->req->l = 0;
|
|
}
|
|
|
|
|
|
/*
|
|
* returns a message into the rep buffer, and flushes the req buffer.
|
|
* The reply buffer doesn't need to be empty before this.
|
|
*/
|
|
void client_return(struct session *s, int len, const char *msg) {
|
|
strcpy(s->rep->data, msg);
|
|
s->rep->l = len;
|
|
s->rep->r = s->rep->h = s->rep->lr = s->rep->w = s->rep->data;
|
|
s->rep->r += len;
|
|
s->req->l = 0;
|
|
}
|
|
|
|
/*
|
|
* send a log for the session when we have enough info about it
|
|
*/
|
|
void sess_log(struct session *s) {
|
|
char pn[INET6_ADDRSTRLEN + strlen(":65535")];
|
|
struct proxy *p = s->proxy;
|
|
int log;
|
|
char *uri;
|
|
char *pxid;
|
|
char *srv;
|
|
struct tm *tm;
|
|
|
|
/* This is a first attempt at a better logging system.
|
|
* For now, we rely on send_log() to provide the date, although it obviously
|
|
* is the date of the log and not of the request, and most fields are not
|
|
* computed.
|
|
*/
|
|
|
|
log = p->to_log & ~s->logs.logwait;
|
|
|
|
if (s->cli_addr.ss_family == AF_INET)
|
|
inet_ntop(AF_INET,
|
|
(const void *)&((struct sockaddr_in *)&s->cli_addr)->sin_addr,
|
|
pn, sizeof(pn));
|
|
else
|
|
inet_ntop(AF_INET6,
|
|
(const void *)&((struct sockaddr_in6 *)(&s->cli_addr))->sin6_addr,
|
|
pn, sizeof(pn));
|
|
|
|
uri = (log & LW_REQ) ? s->logs.uri ? s->logs.uri : "<BADREQ>" : "";
|
|
pxid = p->id;
|
|
srv = (p->to_log & LW_SVID) ? (s->srv != NULL) ? s->srv->id : "<NOSRV>" : "-";
|
|
|
|
tm = localtime(&s->logs.tv_accept.tv_sec);
|
|
if (p->to_log & LW_REQ) {
|
|
char tmpline[MAX_SYSLOG_LEN], *h;
|
|
int hdr;
|
|
|
|
h = tmpline;
|
|
if (p->to_log & LW_REQHDR && (h < tmpline + sizeof(tmpline) - 10)) {
|
|
*(h++) = ' ';
|
|
*(h++) = '{';
|
|
for (hdr = 0; hdr < p->nb_req_cap; hdr++) {
|
|
if (hdr)
|
|
*(h++) = '|';
|
|
if (s->req_cap[hdr] != NULL)
|
|
h = encode_string(h, tmpline + sizeof(tmpline) - 7, '#', hdr_encode_map, s->req_cap[hdr]);
|
|
}
|
|
*(h++) = '}';
|
|
}
|
|
|
|
if (p->to_log & LW_RSPHDR && (h < tmpline + sizeof(tmpline) - 7)) {
|
|
*(h++) = ' ';
|
|
*(h++) = '{';
|
|
for (hdr = 0; hdr < p->nb_rsp_cap; hdr++) {
|
|
if (hdr)
|
|
*(h++) = '|';
|
|
if (s->rsp_cap[hdr] != NULL)
|
|
h = encode_string(h, tmpline + sizeof(tmpline) - 4, '#', hdr_encode_map, s->rsp_cap[hdr]);
|
|
}
|
|
*(h++) = '}';
|
|
}
|
|
|
|
if (h < tmpline + sizeof(tmpline) - 4) {
|
|
*(h++) = ' ';
|
|
*(h++) = '"';
|
|
h = encode_string(h, tmpline + sizeof(tmpline) - 1, '#', url_encode_map, uri);
|
|
*(h++) = '"';
|
|
}
|
|
*h = '\0';
|
|
|
|
send_log(p, LOG_INFO, "%s:%d [%02d/%s/%04d:%02d:%02d:%02d] %s %s %d/%d/%d/%s%d %d %s%lld %s %s %c%c%c%c%s\n",
|
|
pn,
|
|
(s->cli_addr.ss_family == AF_INET) ?
|
|
ntohs(((struct sockaddr_in *)&s->cli_addr)->sin_port) :
|
|
ntohs(((struct sockaddr_in6 *)&s->cli_addr)->sin6_port),
|
|
tm->tm_mday, monthname[tm->tm_mon], tm->tm_year+1900,
|
|
tm->tm_hour, tm->tm_min, tm->tm_sec,
|
|
pxid, srv,
|
|
s->logs.t_request,
|
|
(s->logs.t_connect >= 0) ? s->logs.t_connect - s->logs.t_request : -1,
|
|
(s->logs.t_data >= 0) ? s->logs.t_data - s->logs.t_connect : -1,
|
|
(p->to_log & LW_BYTES) ? "" : "+", s->logs.t_close,
|
|
s->logs.status,
|
|
(p->to_log & LW_BYTES) ? "" : "+", s->logs.bytes,
|
|
s->logs.cli_cookie ? s->logs.cli_cookie : "-",
|
|
s->logs.srv_cookie ? s->logs.srv_cookie : "-",
|
|
sess_term_cond[(s->flags & SN_ERR_MASK) >> SN_ERR_SHIFT],
|
|
sess_fin_state[(s->flags & SN_FINST_MASK) >> SN_FINST_SHIFT],
|
|
(p->options & PR_O_COOK_ANY) ? sess_cookie[(s->flags & SN_CK_MASK) >> SN_CK_SHIFT] : '-',
|
|
(p->options & PR_O_COOK_ANY) ? sess_set_cookie[(s->flags & SN_SCK_MASK) >> SN_SCK_SHIFT] : '-',
|
|
tmpline);
|
|
}
|
|
else {
|
|
send_log(p, LOG_INFO, "%s:%d [%02d/%s/%04d:%02d:%02d:%02d] %s %s %d/%s%d %s%lld %c%c\n",
|
|
pn,
|
|
(s->cli_addr.ss_family == AF_INET) ?
|
|
ntohs(((struct sockaddr_in *)&s->cli_addr)->sin_port) :
|
|
ntohs(((struct sockaddr_in6 *)&s->cli_addr)->sin6_port),
|
|
tm->tm_mday, monthname[tm->tm_mon], tm->tm_year+1900,
|
|
tm->tm_hour, tm->tm_min, tm->tm_sec,
|
|
pxid, srv,
|
|
(s->logs.t_connect >= 0) ? s->logs.t_connect : -1,
|
|
(p->to_log & LW_BYTES) ? "" : "+", s->logs.t_close,
|
|
(p->to_log & LW_BYTES) ? "" : "+", s->logs.bytes,
|
|
sess_term_cond[(s->flags & SN_ERR_MASK) >> SN_ERR_SHIFT],
|
|
sess_fin_state[(s->flags & SN_FINST_MASK) >> SN_FINST_SHIFT]);
|
|
}
|
|
|
|
s->logs.logwait = 0;
|
|
}
|
|
|
|
|
|
/*
|
|
* this function is called on a read event from a listen socket, corresponding
|
|
* to an accept. It tries to accept as many connections as possible.
|
|
* It returns 0.
|
|
*/
|
|
int event_accept(int fd) {
|
|
struct proxy *p = (struct proxy *)fdtab[fd].owner;
|
|
struct session *s;
|
|
struct task *t;
|
|
int cfd;
|
|
|
|
while (p->nbconn < p->maxconn) {
|
|
struct sockaddr_storage addr;
|
|
int laddr = sizeof(addr);
|
|
if ((cfd = accept(fd, (struct sockaddr *)&addr, &laddr)) == -1)
|
|
return 0; /* nothing more to accept */
|
|
|
|
if ((s = pool_alloc(session)) == NULL) { /* disable this proxy for a while */
|
|
Alert("out of memory in event_accept().\n");
|
|
FD_CLR(fd, StaticReadEvent);
|
|
p->state = PR_STIDLE;
|
|
close(cfd);
|
|
return 0;
|
|
}
|
|
|
|
if ((t = pool_alloc(task)) == NULL) { /* disable this proxy for a while */
|
|
Alert("out of memory in event_accept().\n");
|
|
FD_CLR(fd, StaticReadEvent);
|
|
p->state = PR_STIDLE;
|
|
close(cfd);
|
|
pool_free(session, s);
|
|
return 0;
|
|
}
|
|
|
|
s->cli_addr = addr;
|
|
if (cfd >= global.maxsock) {
|
|
Alert("accept(): not enough free sockets. Raise -n argument. Giving up.\n");
|
|
close(cfd);
|
|
pool_free(task, t);
|
|
pool_free(session, s);
|
|
return 0;
|
|
}
|
|
|
|
if ((fcntl(cfd, F_SETFL, O_NONBLOCK) == -1) ||
|
|
(setsockopt(cfd, IPPROTO_TCP, TCP_NODELAY,
|
|
(char *) &one, sizeof(one)) == -1)) {
|
|
Alert("accept(): cannot set the socket in non blocking mode. Giving up\n");
|
|
close(cfd);
|
|
pool_free(task, t);
|
|
pool_free(session, s);
|
|
return 0;
|
|
}
|
|
|
|
t->next = t->prev = t->rqnext = NULL; /* task not in run queue yet */
|
|
t->wq = LIST_HEAD(wait_queue); /* but already has a wait queue assigned */
|
|
t->state = TASK_IDLE;
|
|
t->process = process_session;
|
|
t->context = s;
|
|
|
|
s->task = t;
|
|
s->proxy = p;
|
|
s->cli_state = (p->mode == PR_MODE_HTTP) ? CL_STHEADERS : CL_STDATA; /* no HTTP headers for non-HTTP proxies */
|
|
s->srv_state = SV_STIDLE;
|
|
s->req = s->rep = NULL; /* will be allocated later */
|
|
s->flags = 0;
|
|
|
|
s->res_cr = s->res_cw = s->res_sr = s->res_sw = RES_SILENT;
|
|
s->cli_fd = cfd;
|
|
s->srv_fd = -1;
|
|
s->srv = NULL;
|
|
s->conn_retries = p->conn_retries;
|
|
|
|
s->logs.logwait = p->to_log;
|
|
s->logs.tv_accept = now;
|
|
s->logs.t_request = -1;
|
|
s->logs.t_connect = -1;
|
|
s->logs.t_data = -1;
|
|
s->logs.t_close = 0;
|
|
s->logs.uri = NULL;
|
|
s->logs.cli_cookie = NULL;
|
|
s->logs.srv_cookie = NULL;
|
|
s->logs.status = -1;
|
|
s->logs.bytes = 0;
|
|
|
|
s->uniq_id = totalconn;
|
|
|
|
if (p->nb_req_cap > 0) {
|
|
if ((s->req_cap =
|
|
pool_alloc_from(p->req_cap_pool, p->nb_req_cap*sizeof(char *)))
|
|
== NULL) { /* no memory */
|
|
close(cfd); /* nothing can be done for this fd without memory */
|
|
pool_free(task, t);
|
|
pool_free(session, s);
|
|
return 0;
|
|
}
|
|
memset(s->req_cap, 0, p->nb_req_cap*sizeof(char *));
|
|
}
|
|
else
|
|
s->req_cap = NULL;
|
|
|
|
if (p->nb_rsp_cap > 0) {
|
|
if ((s->rsp_cap =
|
|
pool_alloc_from(p->rsp_cap_pool, p->nb_rsp_cap*sizeof(char *)))
|
|
== NULL) { /* no memory */
|
|
if (s->req_cap != NULL)
|
|
pool_free_to(p->req_cap_pool, s->req_cap);
|
|
close(cfd); /* nothing can be done for this fd without memory */
|
|
pool_free(task, t);
|
|
pool_free(session, s);
|
|
return 0;
|
|
}
|
|
memset(s->rsp_cap, 0, p->nb_rsp_cap*sizeof(char *));
|
|
}
|
|
else
|
|
s->rsp_cap = NULL;
|
|
|
|
if ((p->mode == PR_MODE_TCP || p->mode == PR_MODE_HTTP)
|
|
&& (p->logfac1 >= 0 || p->logfac2 >= 0)) {
|
|
struct sockaddr_storage sockname;
|
|
int namelen;
|
|
|
|
namelen = sizeof(sockname);
|
|
if (addr.ss_family != AF_INET ||
|
|
get_original_dst(cfd, (struct sockaddr_in *)&sockname, &namelen) == -1)
|
|
getsockname(cfd, (struct sockaddr *)&sockname, &namelen);
|
|
|
|
if (p->to_log) {
|
|
/* we have the client ip */
|
|
if (s->logs.logwait & LW_CLIP)
|
|
if (!(s->logs.logwait &= ~LW_CLIP))
|
|
sess_log(s);
|
|
}
|
|
else if (s->cli_addr.ss_family == AF_INET) {
|
|
char pn[INET_ADDRSTRLEN], sn[INET_ADDRSTRLEN];
|
|
if (inet_ntop(AF_INET, (const void *)&((struct sockaddr_in *)&sockname)->sin_addr,
|
|
sn, sizeof(sn)) &&
|
|
inet_ntop(AF_INET, (const void *)&((struct sockaddr_in *)&s->cli_addr)->sin_addr,
|
|
pn, sizeof(pn))) {
|
|
send_log(p, LOG_INFO, "Connect from %s:%d to %s:%d (%s/%s)\n",
|
|
pn, ntohs(((struct sockaddr_in *)&s->cli_addr)->sin_port),
|
|
sn, ntohs(((struct sockaddr_in *)&sockname)->sin_port),
|
|
p->id, (p->mode == PR_MODE_HTTP) ? "HTTP" : "TCP");
|
|
}
|
|
}
|
|
else {
|
|
char pn[INET6_ADDRSTRLEN], sn[INET6_ADDRSTRLEN];
|
|
if (inet_ntop(AF_INET6, (const void *)&((struct sockaddr_in6 *)&sockname)->sin6_addr,
|
|
sn, sizeof(sn)) &&
|
|
inet_ntop(AF_INET6, (const void *)&((struct sockaddr_in6 *)&s->cli_addr)->sin6_addr,
|
|
pn, sizeof(pn))) {
|
|
send_log(p, LOG_INFO, "Connect from %s:%d to %s:%d (%s/%s)\n",
|
|
pn, ntohs(((struct sockaddr_in6 *)&s->cli_addr)->sin6_port),
|
|
sn, ntohs(((struct sockaddr_in6 *)&sockname)->sin6_port),
|
|
p->id, (p->mode == PR_MODE_HTTP) ? "HTTP" : "TCP");
|
|
}
|
|
}
|
|
}
|
|
|
|
if ((global.mode & MODE_DEBUG) && (!(global.mode & MODE_QUIET) || (global.mode & MODE_VERBOSE))) {
|
|
struct sockaddr_in sockname;
|
|
int namelen;
|
|
int len;
|
|
namelen = sizeof(sockname);
|
|
if (addr.ss_family != AF_INET ||
|
|
get_original_dst(cfd, (struct sockaddr_in *)&sockname, &namelen) == -1)
|
|
getsockname(cfd, (struct sockaddr *)&sockname, &namelen);
|
|
|
|
if (s->cli_addr.ss_family == AF_INET) {
|
|
char pn[INET_ADDRSTRLEN];
|
|
inet_ntop(AF_INET,
|
|
(const void *)&((struct sockaddr_in *)&s->cli_addr)->sin_addr,
|
|
pn, sizeof(pn));
|
|
|
|
len = sprintf(trash, "%08x:%s.accept(%04x)=%04x from [%s:%d]\n",
|
|
s->uniq_id, p->id, (unsigned short)fd, (unsigned short)cfd,
|
|
pn, ntohs(((struct sockaddr_in *)&s->cli_addr)->sin_port));
|
|
}
|
|
else {
|
|
char pn[INET6_ADDRSTRLEN];
|
|
inet_ntop(AF_INET6,
|
|
(const void *)&((struct sockaddr_in6 *)(&s->cli_addr))->sin6_addr,
|
|
pn, sizeof(pn));
|
|
|
|
len = sprintf(trash, "%08x:%s.accept(%04x)=%04x from [%s:%d]\n",
|
|
s->uniq_id, p->id, (unsigned short)fd, (unsigned short)cfd,
|
|
pn, ntohs(((struct sockaddr_in6 *)(&s->cli_addr))->sin6_port));
|
|
}
|
|
|
|
write(1, trash, len);
|
|
}
|
|
|
|
if ((s->req = pool_alloc(buffer)) == NULL) { /* no memory */
|
|
if (s->rsp_cap != NULL)
|
|
pool_free_to(p->rsp_cap_pool, s->rsp_cap);
|
|
if (s->req_cap != NULL)
|
|
pool_free_to(p->req_cap_pool, s->req_cap);
|
|
close(cfd); /* nothing can be done for this fd without memory */
|
|
pool_free(task, t);
|
|
pool_free(session, s);
|
|
return 0;
|
|
}
|
|
|
|
s->req->l = 0;
|
|
s->req->total = 0;
|
|
s->req->h = s->req->r = s->req->lr = s->req->w = s->req->data; /* r and w will be reset further */
|
|
s->req->rlim = s->req->data + BUFSIZE;
|
|
if (s->cli_state == CL_STHEADERS) /* reserve some space for header rewriting */
|
|
s->req->rlim -= MAXREWRITE;
|
|
|
|
if ((s->rep = pool_alloc(buffer)) == NULL) { /* no memory */
|
|
pool_free(buffer, s->req);
|
|
if (s->rsp_cap != NULL)
|
|
pool_free_to(p->rsp_cap_pool, s->rsp_cap);
|
|
if (s->req_cap != NULL)
|
|
pool_free_to(p->req_cap_pool, s->req_cap);
|
|
close(cfd); /* nothing can be done for this fd without memory */
|
|
pool_free(task, t);
|
|
pool_free(session, s);
|
|
return 0;
|
|
}
|
|
s->rep->l = 0;
|
|
s->rep->total = 0;
|
|
s->rep->h = s->rep->r = s->rep->lr = s->rep->w = s->rep->rlim = s->rep->data;
|
|
|
|
fdtab[cfd].read = &event_cli_read;
|
|
fdtab[cfd].write = &event_cli_write;
|
|
fdtab[cfd].owner = t;
|
|
fdtab[cfd].state = FD_STREADY;
|
|
|
|
if (p->mode == PR_MODE_HEALTH) { /* health check mode, no client reading */
|
|
if (p->options & PR_O_HTTP_CHK) /* "option httpchk" will make it speak HTTP */
|
|
client_retnclose(s, 19, "HTTP/1.0 200 OK\r\n\r\n"); /* forge a 200 response */
|
|
else
|
|
client_retnclose(s, 3, "OK\n"); /* forge an "OK" response */
|
|
}
|
|
else {
|
|
FD_SET(cfd, StaticReadEvent);
|
|
}
|
|
|
|
fd_insert(cfd);
|
|
|
|
tv_eternity(&s->cnexpire);
|
|
tv_eternity(&s->srexpire);
|
|
tv_eternity(&s->swexpire);
|
|
tv_eternity(&s->cwexpire);
|
|
|
|
if (s->proxy->clitimeout)
|
|
tv_delayfrom(&s->crexpire, &now, s->proxy->clitimeout);
|
|
else
|
|
tv_eternity(&s->crexpire);
|
|
|
|
t->expire = s->crexpire;
|
|
|
|
task_queue(t);
|
|
|
|
if (p->mode != PR_MODE_HEALTH)
|
|
task_wakeup(&rq, t);
|
|
|
|
p->nbconn++;
|
|
actconn++;
|
|
totalconn++;
|
|
|
|
// fprintf(stderr, "accepting from %p => %d conn, %d total\n", p, actconn, totalconn);
|
|
} /* end of while (p->nbconn < p->maxconn) */
|
|
return 0;
|
|
}
|
|
|
|
|
|
/*
|
|
* This function is used only for server health-checks. It handles
|
|
* the connection acknowledgement. If the proxy requires HTTP health-checks,
|
|
* it sends the request. In other cases, it returns 1 if the socket is OK,
|
|
* or -1 if an error occured.
|
|
*/
|
|
int event_srv_chk_w(int fd) {
|
|
struct task *t = fdtab[fd].owner;
|
|
struct server *s = t->context;
|
|
|
|
int skerr, lskerr;
|
|
lskerr = sizeof(skerr);
|
|
getsockopt(fd, SOL_SOCKET, SO_ERROR, &skerr, &lskerr);
|
|
/* in case of TCP only, this tells us if the connection succeeded */
|
|
if (skerr)
|
|
s->result = -1;
|
|
else {
|
|
if (s->proxy->options & PR_O_HTTP_CHK) {
|
|
int ret;
|
|
/* we want to check if this host replies to "OPTIONS / HTTP/1.0"
|
|
* so we'll send the request, and won't wake the checker up now.
|
|
*/
|
|
#ifndef MSG_NOSIGNAL
|
|
ret = send(fd, s->proxy->check_req, s->proxy->check_len, MSG_DONTWAIT);
|
|
#else
|
|
ret = send(fd, s->proxy->check_req, s->proxy->check_len, MSG_DONTWAIT | MSG_NOSIGNAL);
|
|
#endif
|
|
if (ret == s->proxy->check_len) {
|
|
FD_SET(fd, StaticReadEvent); /* prepare for reading reply */
|
|
FD_CLR(fd, StaticWriteEvent); /* nothing more to write */
|
|
return 0;
|
|
}
|
|
else
|
|
s->result = -1;
|
|
}
|
|
else {
|
|
/* good TCP connection is enough */
|
|
s->result = 1;
|
|
}
|
|
}
|
|
|
|
task_wakeup(&rq, t);
|
|
return 0;
|
|
}
|
|
|
|
|
|
/*
|
|
* This function is used only for server health-checks. It handles
|
|
* the server's reply to an HTTP request. It returns 1 if the server replies
|
|
* 2xx or 3xx (valid responses), or -1 in other cases.
|
|
*/
|
|
int event_srv_chk_r(int fd) {
|
|
char reply[64];
|
|
int len;
|
|
struct task *t = fdtab[fd].owner;
|
|
struct server *s = t->context;
|
|
|
|
int skerr, lskerr;
|
|
lskerr = sizeof(skerr);
|
|
|
|
s->result = len = -1;
|
|
#ifndef MSG_NOSIGNAL
|
|
getsockopt(fd, SOL_SOCKET, SO_ERROR, &skerr, &lskerr);
|
|
if (!skerr)
|
|
len = recv(fd, reply, sizeof(reply), 0);
|
|
#else
|
|
/* Warning! Linux returns EAGAIN on SO_ERROR if data are still available
|
|
* but the connection was closed on the remote end. Fortunately, recv still
|
|
* works correctly and we don't need to do the getsockopt() on linux.
|
|
*/
|
|
len = recv(fd, reply, sizeof(reply), MSG_NOSIGNAL);
|
|
#endif
|
|
if ((len >= sizeof("HTTP/1.0 000")) &&
|
|
!memcmp(reply, "HTTP/1.", 7) &&
|
|
(reply[9] == '2' || reply[9] == '3')) /* 2xx or 3xx */
|
|
s->result = 1;
|
|
|
|
FD_CLR(fd, StaticReadEvent);
|
|
task_wakeup(&rq, t);
|
|
return 0;
|
|
}
|
|
|
|
|
|
/*
|
|
* this function writes the string <str> at position <pos> which must be in buffer <b>,
|
|
* and moves <end> just after the end of <str>.
|
|
* <b>'s parameters (l, r, w, h, lr) are recomputed to be valid after the shift.
|
|
* the shift value (positive or negative) is returned.
|
|
* If there's no space left, the move is not done.
|
|
*
|
|
*/
|
|
int buffer_replace(struct buffer *b, char *pos, char *end, char *str) {
|
|
int delta;
|
|
int len;
|
|
|
|
len = strlen(str);
|
|
delta = len - (end - pos);
|
|
|
|
if (delta + b->r >= b->data + BUFSIZE)
|
|
return 0; /* no space left */
|
|
|
|
/* first, protect the end of the buffer */
|
|
memmove(end + delta, end, b->data + b->l - end);
|
|
|
|
/* now, copy str over pos */
|
|
memcpy(pos, str,len);
|
|
|
|
/* we only move data after the displaced zone */
|
|
if (b->r > pos) b->r += delta;
|
|
if (b->w > pos) b->w += delta;
|
|
if (b->h > pos) b->h += delta;
|
|
if (b->lr > pos) b->lr += delta;
|
|
b->l += delta;
|
|
|
|
return delta;
|
|
}
|
|
|
|
/* same except that the string length is given, which allows str to be NULL if
|
|
* len is 0.
|
|
*/
|
|
int buffer_replace2(struct buffer *b, char *pos, char *end, char *str, int len) {
|
|
int delta;
|
|
|
|
delta = len - (end - pos);
|
|
|
|
if (delta + b->r >= b->data + BUFSIZE)
|
|
return 0; /* no space left */
|
|
|
|
/* first, protect the end of the buffer */
|
|
memmove(end + delta, end, b->data + b->l - end);
|
|
|
|
/* now, copy str over pos */
|
|
if (len)
|
|
memcpy(pos, str, len);
|
|
|
|
/* we only move data after the displaced zone */
|
|
if (b->r > pos) b->r += delta;
|
|
if (b->w > pos) b->w += delta;
|
|
if (b->h > pos) b->h += delta;
|
|
if (b->lr > pos) b->lr += delta;
|
|
b->l += delta;
|
|
|
|
return delta;
|
|
}
|
|
|
|
|
|
int exp_replace(char *dst, char *src, char *str, regmatch_t *matches) {
|
|
char *old_dst = dst;
|
|
|
|
while (*str) {
|
|
if (*str == '\\') {
|
|
str++;
|
|
if (isdigit((int)*str)) {
|
|
int len, num;
|
|
|
|
num = *str - '0';
|
|
str++;
|
|
|
|
if (matches[num].rm_eo > -1 && matches[num].rm_so > -1) {
|
|
len = matches[num].rm_eo - matches[num].rm_so;
|
|
memcpy(dst, src + matches[num].rm_so, len);
|
|
dst += len;
|
|
}
|
|
|
|
}
|
|
else if (*str == 'x') {
|
|
unsigned char hex1, hex2;
|
|
str++;
|
|
|
|
hex1 = toupper(*str++) - '0';
|
|
hex2 = toupper(*str++) - '0';
|
|
|
|
if (hex1 > 9) hex1 -= 'A' - '9' - 1;
|
|
if (hex2 > 9) hex2 -= 'A' - '9' - 1;
|
|
*dst++ = (hex1<<4) + hex2;
|
|
}
|
|
else
|
|
*dst++ = *str++;
|
|
}
|
|
else
|
|
*dst++ = *str++;
|
|
}
|
|
*dst = 0;
|
|
return dst - old_dst;
|
|
}
|
|
|
|
static int ishex(char s)
|
|
{
|
|
return (s >= '0' && s <= '9') || (s >= 'A' && s <= 'F') || (s >= 'a' && s <= 'f');
|
|
}
|
|
|
|
/* returns NULL if the replacement string <str> is valid, or the pointer to the first error */
|
|
char *check_replace_string(char *str)
|
|
{
|
|
char *err = NULL;
|
|
while (*str) {
|
|
if (*str == '\\') {
|
|
err = str; /* in case of a backslash, we return the pointer to it */
|
|
str++;
|
|
if (!*str)
|
|
return err;
|
|
else if (isdigit((int)*str))
|
|
err = NULL;
|
|
else if (*str == 'x') {
|
|
str++;
|
|
if (!ishex(*str))
|
|
return err;
|
|
str++;
|
|
if (!ishex(*str))
|
|
return err;
|
|
err = NULL;
|
|
}
|
|
else {
|
|
Warning("'\\%c' : deprecated use of a backslash before something not '\\','x' or a digit.\n", *str);
|
|
err = NULL;
|
|
}
|
|
}
|
|
str++;
|
|
}
|
|
return err;
|
|
}
|
|
|
|
|
|
|
|
/*
|
|
* manages the client FSM and its socket. BTW, it also tries to handle the
|
|
* cookie. It returns 1 if a state has changed (and a resync may be needed),
|
|
* 0 else.
|
|
*/
|
|
int process_cli(struct session *t) {
|
|
int s = t->srv_state;
|
|
int c = t->cli_state;
|
|
struct buffer *req = t->req;
|
|
struct buffer *rep = t->rep;
|
|
int method_checked = 0;
|
|
appsess *asession_temp = NULL;
|
|
appsess local_asession;
|
|
|
|
#ifdef DEBUG_FULL
|
|
fprintf(stderr,"process_cli: c=%s, s=%s\n", cli_stnames[c], srv_stnames[s]);
|
|
#endif
|
|
//fprintf(stderr,"process_cli: c=%d, s=%d, cr=%d, cw=%d, sr=%d, sw=%d\n", c, s,
|
|
//FD_ISSET(t->cli_fd, StaticReadEvent), FD_ISSET(t->cli_fd, StaticWriteEvent),
|
|
//FD_ISSET(t->srv_fd, StaticReadEvent), FD_ISSET(t->srv_fd, StaticWriteEvent)
|
|
//);
|
|
if (c == CL_STHEADERS) {
|
|
/* now parse the partial (or complete) headers */
|
|
while (req->lr < req->r) { /* this loop only sees one header at each iteration */
|
|
char *ptr;
|
|
int delete_header;
|
|
char *request_line = NULL;
|
|
|
|
ptr = req->lr;
|
|
|
|
/* look for the end of the current header */
|
|
while (ptr < req->r && *ptr != '\n' && *ptr != '\r')
|
|
ptr++;
|
|
|
|
if (ptr == req->h) { /* empty line, end of headers */
|
|
int line, len;
|
|
/* we can only get here after an end of headers */
|
|
/* we'll have something else to do here : add new headers ... */
|
|
|
|
if (t->flags & SN_CLDENY) {
|
|
/* no need to go further */
|
|
t->logs.status = 403;
|
|
client_retnclose(t, t->proxy->errmsg.len403, t->proxy->errmsg.msg403);
|
|
if (!(t->flags & SN_ERR_MASK))
|
|
t->flags |= SN_ERR_PRXCOND;
|
|
if (!(t->flags & SN_FINST_MASK))
|
|
t->flags |= SN_FINST_R;
|
|
return 1;
|
|
}
|
|
|
|
for (line = 0; line < t->proxy->nb_reqadd; line++) {
|
|
len = sprintf(trash, "%s\r\n", t->proxy->req_add[line]);
|
|
buffer_replace2(req, req->h, req->h, trash, len);
|
|
}
|
|
|
|
if (t->proxy->options & PR_O_FWDFOR) {
|
|
if (t->cli_addr.ss_family == AF_INET) {
|
|
unsigned char *pn;
|
|
pn = (unsigned char *)&((struct sockaddr_in *)&t->cli_addr)->sin_addr;
|
|
len = sprintf(trash, "X-Forwarded-For: %d.%d.%d.%d\r\n",
|
|
pn[0], pn[1], pn[2], pn[3]);
|
|
buffer_replace2(req, req->h, req->h, trash, len);
|
|
}
|
|
else if (t->cli_addr.ss_family == AF_INET6) {
|
|
char pn[INET6_ADDRSTRLEN];
|
|
inet_ntop(AF_INET6,
|
|
(const void *)&((struct sockaddr_in6 *)(&t->cli_addr))->sin6_addr,
|
|
pn, sizeof(pn));
|
|
len = sprintf(trash, "X-Forwarded-For: %s\r\n", pn);
|
|
buffer_replace2(req, req->h, req->h, trash, len);
|
|
}
|
|
}
|
|
|
|
/* add a "connection: close" line if needed */
|
|
if (t->proxy->options & PR_O_HTTP_CLOSE)
|
|
buffer_replace2(req, req->h, req->h, "Connection: close\r\n", 19);
|
|
|
|
if (!memcmp(req->data, "POST ", 5)) {
|
|
/* this is a POST request, which is not cacheable by default */
|
|
t->flags |= SN_POST;
|
|
}
|
|
|
|
t->cli_state = CL_STDATA;
|
|
req->rlim = req->data + BUFSIZE; /* no more rewrite needed */
|
|
|
|
t->logs.t_request = tv_diff(&t->logs.tv_accept, &now);
|
|
/* FIXME: we'll set the client in a wait state while we try to
|
|
* connect to the server. Is this really needed ? wouldn't it be
|
|
* better to release the maximum of system buffers instead ? */
|
|
//FD_CLR(t->cli_fd, StaticReadEvent);
|
|
//tv_eternity(&t->crexpire);
|
|
|
|
/* FIXME: if we break here (as up to 1.1.23), having the client
|
|
* shutdown its connection can lead to an abort further.
|
|
* it's better to either return 1 or even jump directly to the
|
|
* data state which will save one schedule.
|
|
*/
|
|
//break;
|
|
|
|
if (!t->proxy->clitimeout ||
|
|
(t->srv_state < SV_STDATA && t->proxy->srvtimeout))
|
|
/* If the client has no timeout, or if the server is not ready yet,
|
|
* and we know for sure that it can expire, then it's cleaner to
|
|
* disable the timeout on the client side so that too low values
|
|
* cannot make the sessions abort too early.
|
|
*/
|
|
tv_eternity(&t->crexpire);
|
|
|
|
goto process_data;
|
|
}
|
|
|
|
/* to get a complete header line, we need the ending \r\n, \n\r, \r or \n too */
|
|
if (ptr > req->r - 2) {
|
|
/* this is a partial header, let's wait for more to come */
|
|
req->lr = ptr;
|
|
break;
|
|
}
|
|
|
|
/* now we know that *ptr is either \r or \n,
|
|
* and that there are at least 1 char after it.
|
|
*/
|
|
if ((ptr[0] == ptr[1]) || (ptr[1] != '\r' && ptr[1] != '\n'))
|
|
req->lr = ptr + 1; /* \r\r, \n\n, \r[^\n], \n[^\r] */
|
|
else
|
|
req->lr = ptr + 2; /* \r\n or \n\r */
|
|
|
|
/*
|
|
* now we know that we have a full header ; we can do whatever
|
|
* we want with these pointers :
|
|
* req->h = beginning of header
|
|
* ptr = end of header (first \r or \n)
|
|
* req->lr = beginning of next line (next rep->h)
|
|
* req->r = end of data (not used at this stage)
|
|
*/
|
|
|
|
if (!method_checked && (t->proxy->appsession_name != NULL) &&
|
|
((memcmp(req->h, "GET ", 4) == 0) || (memcmp(req->h, "POST ", 4) == 0)) &&
|
|
((request_line = memchr(req->h, ';', req->lr - req->h)) != NULL)) {
|
|
|
|
/* skip ; */
|
|
request_line++;
|
|
|
|
/* look if we have a jsessionid */
|
|
|
|
if (strncasecmp(request_line, t->proxy->appsession_name, t->proxy->appsession_name_len) == 0) {
|
|
|
|
/* skip jsessionid= */
|
|
request_line += t->proxy->appsession_name_len + 1;
|
|
|
|
/* First try if we allready have an appsession */
|
|
asession_temp = &local_asession;
|
|
|
|
if ((asession_temp->sessid = pool_alloc_from(apools.sessid, apools.ses_msize)) == NULL) {
|
|
Alert("Not enough memory process_cli():asession_temp->sessid:calloc().\n");
|
|
send_log(t->proxy, LOG_ALERT, "Not enough Memory process_cli():asession_temp->sessid:calloc().\n");
|
|
return 0;
|
|
}
|
|
|
|
/* Copy the sessionid */
|
|
memcpy(asession_temp->sessid, request_line, t->proxy->appsession_len);
|
|
asession_temp->sessid[t->proxy->appsession_len] = 0;
|
|
asession_temp->serverid = NULL;
|
|
|
|
/* only do insert, if lookup fails */
|
|
if (chtbl_lookup(&(t->proxy->htbl_proxy), (void *)&asession_temp)) {
|
|
if ((asession_temp = pool_alloc(appsess)) == NULL) {
|
|
Alert("Not enough memory process_cli():asession:calloc().\n");
|
|
send_log(t->proxy, LOG_ALERT, "Not enough memory process_cli():asession:calloc().\n");
|
|
return 0;
|
|
}
|
|
asession_temp->sessid = local_asession.sessid;
|
|
asession_temp->serverid = local_asession.serverid;
|
|
chtbl_insert(&(t->proxy->htbl_proxy), (void *) asession_temp);
|
|
} /* end if(chtbl_lookup()) */
|
|
else{
|
|
/*free wasted memory;*/
|
|
pool_free_to(apools.sessid, local_asession.sessid);
|
|
}
|
|
|
|
tv_delayfrom(&asession_temp->expire, &now, t->proxy->appsession_timeout);
|
|
asession_temp->request_count++;
|
|
|
|
#if defined(DEBUG_HASH)
|
|
print_table(&(t->proxy->htbl_proxy));
|
|
#endif
|
|
|
|
if (asession_temp->serverid == NULL) {
|
|
Alert("Found Application Session without matching server.\n");
|
|
} else {
|
|
struct server *srv = t->proxy->srv;
|
|
while (srv) {
|
|
if (strcmp(srv->id, asession_temp->serverid) == 0) {
|
|
if (srv->state & SRV_RUNNING || t->proxy->options & PR_O_PERSIST) {
|
|
/* we found the server and it's usable */
|
|
t->flags &= ~SN_CK_MASK;
|
|
t->flags |= SN_CK_VALID | SN_DIRECT;
|
|
t->srv = srv;
|
|
break;
|
|
}else {
|
|
t->flags &= ~SN_CK_MASK;
|
|
t->flags |= SN_CK_DOWN;
|
|
}
|
|
}/* end if(strcmp()) */
|
|
srv = srv->next;
|
|
}/* end while(srv) */
|
|
}/* end else of if (asession_temp->serverid == NULL) */
|
|
}/* end if(strncasecmp(request_line,t->proxy->appsession_name,apssesion_name_len) == 0) */
|
|
else {
|
|
//fprintf(stderr,">>>>>>>>>>>>>>>>>>>>>>NO SESSION\n");
|
|
}
|
|
method_checked = 1;
|
|
}/* end if(!method_checked ...) */
|
|
else{
|
|
//printf("No Methode-Header with Session-String\n");
|
|
}
|
|
|
|
if (t->logs.logwait & LW_REQ) {
|
|
/* we have a complete HTTP request that we must log */
|
|
int urilen;
|
|
|
|
if ((t->logs.uri = pool_alloc(requri)) == NULL) {
|
|
Alert("HTTP logging : out of memory.\n");
|
|
t->logs.status = 500;
|
|
client_retnclose(t, t->proxy->errmsg.len500, t->proxy->errmsg.msg500);
|
|
if (!(t->flags & SN_ERR_MASK))
|
|
t->flags |= SN_ERR_PRXCOND;
|
|
if (!(t->flags & SN_FINST_MASK))
|
|
t->flags |= SN_FINST_R;
|
|
return 1;
|
|
}
|
|
|
|
urilen = ptr - req->h;
|
|
if (urilen >= REQURI_LEN)
|
|
urilen = REQURI_LEN - 1;
|
|
memcpy(t->logs.uri, req->h, urilen);
|
|
t->logs.uri[urilen] = 0;
|
|
|
|
if (!(t->logs.logwait &= ~LW_REQ))
|
|
sess_log(t);
|
|
}
|
|
else if (t->logs.logwait & LW_REQHDR) {
|
|
struct cap_hdr *h;
|
|
int len;
|
|
for (h = t->proxy->req_cap; h; h = h->next) {
|
|
if ((h->namelen + 2 <= ptr - req->h) &&
|
|
(req->h[h->namelen] == ':') &&
|
|
(strncasecmp(req->h, h->name, h->namelen) == 0)) {
|
|
|
|
if (t->req_cap[h->index] == NULL)
|
|
t->req_cap[h->index] = pool_alloc_from(h->pool, h->len + 1);
|
|
|
|
len = ptr - (req->h + h->namelen + 2);
|
|
if (len > h->len)
|
|
len = h->len;
|
|
|
|
memcpy(t->req_cap[h->index], req->h + h->namelen + 2, len);
|
|
t->req_cap[h->index][len]=0;
|
|
}
|
|
}
|
|
|
|
}
|
|
|
|
delete_header = 0;
|
|
|
|
if ((global.mode & MODE_DEBUG) && (!(global.mode & MODE_QUIET) || (global.mode & MODE_VERBOSE))) {
|
|
int len, max;
|
|
len = sprintf(trash, "%08x:%s.clihdr[%04x:%04x]: ", t->uniq_id, t->proxy->id, (unsigned short)t->cli_fd, (unsigned short)t->srv_fd);
|
|
max = ptr - req->h;
|
|
UBOUND(max, sizeof(trash) - len - 1);
|
|
len += strlcpy2(trash + len, req->h, max + 1);
|
|
trash[len++] = '\n';
|
|
write(1, trash, len);
|
|
}
|
|
|
|
|
|
/* remove "connection: " if needed */
|
|
if (!delete_header && (t->proxy->options & PR_O_HTTP_CLOSE)
|
|
&& (strncasecmp(req->h, "Connection: ", 12) == 0)) {
|
|
delete_header = 1;
|
|
}
|
|
|
|
/* try headers regexps */
|
|
if (!delete_header && t->proxy->req_exp != NULL
|
|
&& !(t->flags & SN_CLDENY)) {
|
|
struct hdr_exp *exp;
|
|
char term;
|
|
|
|
term = *ptr;
|
|
*ptr = '\0';
|
|
exp = t->proxy->req_exp;
|
|
do {
|
|
if (regexec(exp->preg, req->h, MAX_MATCH, pmatch, 0) == 0) {
|
|
switch (exp->action) {
|
|
case ACT_ALLOW:
|
|
if (!(t->flags & SN_CLDENY))
|
|
t->flags |= SN_CLALLOW;
|
|
break;
|
|
case ACT_REPLACE:
|
|
if (!(t->flags & SN_CLDENY)) {
|
|
int len = exp_replace(trash, req->h, exp->replace, pmatch);
|
|
ptr += buffer_replace2(req, req->h, ptr, trash, len);
|
|
}
|
|
break;
|
|
case ACT_REMOVE:
|
|
if (!(t->flags & SN_CLDENY))
|
|
delete_header = 1;
|
|
break;
|
|
case ACT_DENY:
|
|
if (!(t->flags & SN_CLALLOW))
|
|
t->flags |= SN_CLDENY;
|
|
break;
|
|
case ACT_PASS: /* we simply don't deny this one */
|
|
break;
|
|
}
|
|
break;
|
|
}
|
|
} while ((exp = exp->next) != NULL);
|
|
*ptr = term; /* restore the string terminator */
|
|
}
|
|
|
|
/* Now look for cookies. Conforming to RFC2109, we have to support
|
|
* attributes whose name begin with a '$', and associate them with
|
|
* the right cookie, if we want to delete this cookie.
|
|
* So there are 3 cases for each cookie read :
|
|
* 1) it's a special attribute, beginning with a '$' : ignore it.
|
|
* 2) it's a server id cookie that we *MAY* want to delete : save
|
|
* some pointers on it (last semi-colon, beginning of cookie...)
|
|
* 3) it's an application cookie : we *MAY* have to delete a previous
|
|
* "special" cookie.
|
|
* At the end of loop, if a "special" cookie remains, we may have to
|
|
* remove it. If no application cookie persists in the header, we
|
|
* *MUST* delete it
|
|
*/
|
|
if (!delete_header &&
|
|
(t->proxy->cookie_name != NULL || t->proxy->capture_name != NULL || t->proxy->appsession_name !=NULL)
|
|
&& !(t->flags & SN_CLDENY) && (ptr >= req->h + 8)
|
|
&& (strncasecmp(req->h, "Cookie: ", 8) == 0)) {
|
|
char *p1, *p2, *p3, *p4;
|
|
char *del_colon, *del_cookie, *colon;
|
|
int app_cookies;
|
|
|
|
p1 = req->h + 8; /* first char after 'Cookie: ' */
|
|
colon = p1;
|
|
/* del_cookie == NULL => nothing to be deleted */
|
|
del_colon = del_cookie = NULL;
|
|
app_cookies = 0;
|
|
|
|
while (p1 < ptr) {
|
|
/* skip spaces and colons, but keep an eye on these ones */
|
|
while (p1 < ptr) {
|
|
if (*p1 == ';' || *p1 == ',')
|
|
colon = p1;
|
|
else if (!isspace((int)*p1))
|
|
break;
|
|
p1++;
|
|
}
|
|
|
|
if (p1 == ptr)
|
|
break;
|
|
|
|
/* p1 is at the beginning of the cookie name */
|
|
p2 = p1;
|
|
while (p2 < ptr && *p2 != '=')
|
|
p2++;
|
|
|
|
if (p2 == ptr)
|
|
break;
|
|
|
|
p3 = p2 + 1; /* skips the '=' sign */
|
|
if (p3 == ptr)
|
|
break;
|
|
|
|
p4 = p3;
|
|
while (p4 < ptr && !isspace((int)*p4) && *p4 != ';' && *p4 != ',')
|
|
p4++;
|
|
|
|
/* here, we have the cookie name between p1 and p2,
|
|
* and its value between p3 and p4.
|
|
* we can process it :
|
|
*
|
|
* Cookie: NAME=VALUE;
|
|
* | || || |
|
|
* | || || +--> p4
|
|
* | || |+-------> p3
|
|
* | || +--------> p2
|
|
* | |+------------> p1
|
|
* | +-------------> colon
|
|
* +--------------------> req->h
|
|
*/
|
|
|
|
if (*p1 == '$') {
|
|
/* skip this one */
|
|
}
|
|
else {
|
|
/* first, let's see if we want to capture it */
|
|
if (t->proxy->capture_name != NULL &&
|
|
t->logs.cli_cookie == NULL &&
|
|
(p4 - p1 >= t->proxy->capture_namelen) &&
|
|
memcmp(p1, t->proxy->capture_name, t->proxy->capture_namelen) == 0) {
|
|
int log_len = p4 - p1;
|
|
|
|
if ((t->logs.cli_cookie = pool_alloc(capture)) == NULL) {
|
|
Alert("HTTP logging : out of memory.\n");
|
|
} else {
|
|
if (log_len > t->proxy->capture_len)
|
|
log_len = t->proxy->capture_len;
|
|
memcpy(t->logs.cli_cookie, p1, log_len);
|
|
t->logs.cli_cookie[log_len] = 0;
|
|
}
|
|
}
|
|
|
|
if ((p2 - p1 == t->proxy->cookie_len) && (t->proxy->cookie_name != NULL) &&
|
|
(memcmp(p1, t->proxy->cookie_name, p2 - p1) == 0)) {
|
|
/* Cool... it's the right one */
|
|
struct server *srv = t->proxy->srv;
|
|
char *delim;
|
|
|
|
/* if we're in cookie prefix mode, we'll search the delimitor so that we
|
|
* have the server ID betweek p3 and delim, and the original cookie between
|
|
* delim+1 and p4. Otherwise, delim==p4 :
|
|
*
|
|
* Cookie: NAME=SRV~VALUE;
|
|
* | || || | |
|
|
* | || || | +--> p4
|
|
* | || || +--------> delim
|
|
* | || |+-----------> p3
|
|
* | || +------------> p2
|
|
* | |+----------------> p1
|
|
* | +-----------------> colon
|
|
* +------------------------> req->h
|
|
*/
|
|
|
|
if (t->proxy->options & PR_O_COOK_PFX) {
|
|
for (delim = p3; delim < p4; delim++)
|
|
if (*delim == COOKIE_DELIM)
|
|
break;
|
|
}
|
|
else
|
|
delim = p4;
|
|
|
|
|
|
/* Here, we'll look for the first running server which supports the cookie.
|
|
* This allows to share a same cookie between several servers, for example
|
|
* to dedicate backup servers to specific servers only.
|
|
*/
|
|
while (srv) {
|
|
if ((srv->cklen == delim - p3) && !memcmp(p3, srv->cookie, delim - p3)) {
|
|
if (srv->state & SRV_RUNNING || t->proxy->options & PR_O_PERSIST) {
|
|
/* we found the server and it's usable */
|
|
t->flags &= ~SN_CK_MASK;
|
|
t->flags |= SN_CK_VALID | SN_DIRECT;
|
|
t->srv = srv;
|
|
break;
|
|
} else {
|
|
/* we found a server, but it's down */
|
|
t->flags &= ~SN_CK_MASK;
|
|
t->flags |= SN_CK_DOWN;
|
|
}
|
|
}
|
|
srv = srv->next;
|
|
}
|
|
|
|
if (!srv && !(t->flags & SN_CK_DOWN)) {
|
|
/* no server matched this cookie */
|
|
t->flags &= ~SN_CK_MASK;
|
|
t->flags |= SN_CK_INVALID;
|
|
}
|
|
|
|
/* depending on the cookie mode, we may have to either :
|
|
* - delete the complete cookie if we're in insert+indirect mode, so that
|
|
* the server never sees it ;
|
|
* - remove the server id from the cookie value, and tag the cookie as an
|
|
* application cookie so that it does not get accidentely removed later,
|
|
* if we're in cookie prefix mode
|
|
*/
|
|
if ((t->proxy->options & PR_O_COOK_PFX) && (delim != p4)) {
|
|
buffer_replace2(req, p3, delim + 1, NULL, 0);
|
|
p4 -= (delim + 1 - p3);
|
|
ptr -= (delim + 1 - p3);
|
|
del_cookie = del_colon = NULL;
|
|
app_cookies++; /* protect the header from deletion */
|
|
}
|
|
else if (del_cookie == NULL &&
|
|
(t->proxy->options & (PR_O_COOK_INS | PR_O_COOK_IND)) == (PR_O_COOK_INS | PR_O_COOK_IND)) {
|
|
del_cookie = p1;
|
|
del_colon = colon;
|
|
}
|
|
} else {
|
|
/* now we know that we must keep this cookie since it's
|
|
* not ours. But if we wanted to delete our cookie
|
|
* earlier, we cannot remove the complete header, but we
|
|
* can remove the previous block itself.
|
|
*/
|
|
app_cookies++;
|
|
|
|
if (del_cookie != NULL) {
|
|
buffer_replace2(req, del_cookie, p1, NULL, 0);
|
|
p4 -= (p1 - del_cookie);
|
|
ptr -= (p1 - del_cookie);
|
|
del_cookie = del_colon = NULL;
|
|
}
|
|
}
|
|
|
|
if ((t->proxy->appsession_name != NULL) &&
|
|
(memcmp(p1, t->proxy->appsession_name, p2 - p1) == 0)) {
|
|
/* first, let's see if the cookie is our appcookie*/
|
|
|
|
/* Cool... it's the right one */
|
|
|
|
asession_temp = &local_asession;
|
|
|
|
if ((asession_temp->sessid = pool_alloc_from(apools.sessid, apools.ses_msize)) == NULL) {
|
|
Alert("Not enough memory process_cli():asession->sessid:malloc().\n");
|
|
send_log(t->proxy, LOG_ALERT, "Not enough memory process_cli():asession->sessid:malloc().\n");
|
|
return 0;
|
|
}
|
|
|
|
memcpy(asession_temp->sessid, p3, t->proxy->appsession_len);
|
|
asession_temp->sessid[t->proxy->appsession_len] = 0;
|
|
asession_temp->serverid = NULL;
|
|
|
|
/* only do insert, if lookup fails */
|
|
if (chtbl_lookup(&(t->proxy->htbl_proxy), (void *) &asession_temp) != 0) {
|
|
if ((asession_temp = pool_alloc(appsess)) == NULL) {
|
|
Alert("Not enough memory process_cli():asession:calloc().\n");
|
|
send_log(t->proxy, LOG_ALERT, "Not enough memory process_cli():asession:calloc().\n");
|
|
return 0;
|
|
}
|
|
|
|
asession_temp->sessid = local_asession.sessid;
|
|
asession_temp->serverid = local_asession.serverid;
|
|
chtbl_insert(&(t->proxy->htbl_proxy), (void *) asession_temp);
|
|
}
|
|
else{
|
|
/* free wasted memory */
|
|
pool_free_to(apools.sessid, local_asession.sessid);
|
|
}
|
|
|
|
if (asession_temp->serverid == NULL) {
|
|
Alert("Found Application Session without matching server.\n");
|
|
} else {
|
|
struct server *srv = t->proxy->srv;
|
|
while (srv) {
|
|
if(strcmp(srv->id, asession_temp->serverid) == 0) {
|
|
if (srv->state & SRV_RUNNING || t->proxy->options & PR_O_PERSIST) {
|
|
/* we found the server and it's usable */
|
|
t->flags &= ~SN_CK_MASK;
|
|
t->flags |= SN_CK_VALID | SN_DIRECT;
|
|
t->srv = srv;
|
|
break;
|
|
} else {
|
|
t->flags &= ~SN_CK_MASK;
|
|
t->flags |= SN_CK_DOWN;
|
|
}
|
|
}
|
|
srv = srv->next;
|
|
}/* end while(srv) */
|
|
}/* end else if server == NULL */
|
|
|
|
tv_delayfrom(&asession_temp->expire, &now, t->proxy->appsession_timeout);
|
|
}/* end if ((t->proxy->appsession_name != NULL) ... */
|
|
}
|
|
|
|
/* we'll have to look for another cookie ... */
|
|
p1 = p4;
|
|
} /* while (p1 < ptr) */
|
|
|
|
/* There's no more cookie on this line.
|
|
* We may have marked the last one(s) for deletion.
|
|
* We must do this now in two ways :
|
|
* - if there is no app cookie, we simply delete the header ;
|
|
* - if there are app cookies, we must delete the end of the
|
|
* string properly, including the colon/semi-colon before
|
|
* the cookie name.
|
|
*/
|
|
if (del_cookie != NULL) {
|
|
if (app_cookies) {
|
|
buffer_replace2(req, del_colon, ptr, NULL, 0);
|
|
/* WARNING! <ptr> becomes invalid for now. If some code
|
|
* below needs to rely on it before the end of the global
|
|
* header loop, we need to correct it with this code :
|
|
* ptr = del_colon;
|
|
*/
|
|
}
|
|
else
|
|
delete_header = 1;
|
|
}
|
|
} /* end of cookie processing on this header */
|
|
|
|
/* let's look if we have to delete this header */
|
|
if (delete_header && !(t->flags & SN_CLDENY)) {
|
|
buffer_replace2(req, req->h, req->lr, NULL, 0);
|
|
}
|
|
/* WARNING: ptr is not valid anymore, since the header may have been deleted or truncated ! */
|
|
|
|
req->h = req->lr;
|
|
} /* while (req->lr < req->r) */
|
|
|
|
/* end of header processing (even if incomplete) */
|
|
|
|
if ((req->l < req->rlim - req->data) && ! FD_ISSET(t->cli_fd, StaticReadEvent)) {
|
|
/* fd in StaticReadEvent was disabled, perhaps because of a previous buffer
|
|
* full. We cannot loop here since event_cli_read will disable it only if
|
|
* req->l == rlim-data
|
|
*/
|
|
FD_SET(t->cli_fd, StaticReadEvent);
|
|
if (t->proxy->clitimeout)
|
|
tv_delayfrom(&t->crexpire, &now, t->proxy->clitimeout);
|
|
else
|
|
tv_eternity(&t->crexpire);
|
|
}
|
|
|
|
/* Since we are in header mode, if there's no space left for headers, we
|
|
* won't be able to free more later, so the session will never terminate.
|
|
*/
|
|
if (req->l >= req->rlim - req->data) {
|
|
t->logs.status = 400;
|
|
client_retnclose(t, t->proxy->errmsg.len400, t->proxy->errmsg.msg400);
|
|
if (!(t->flags & SN_ERR_MASK))
|
|
t->flags |= SN_ERR_PRXCOND;
|
|
if (!(t->flags & SN_FINST_MASK))
|
|
t->flags |= SN_FINST_R;
|
|
return 1;
|
|
}
|
|
else if (t->res_cr == RES_ERROR || t->res_cr == RES_NULL) {
|
|
/* read error, or last read : give up. */
|
|
tv_eternity(&t->crexpire);
|
|
fd_delete(t->cli_fd);
|
|
t->cli_state = CL_STCLOSE;
|
|
if (!(t->flags & SN_ERR_MASK))
|
|
t->flags |= SN_ERR_CLICL;
|
|
if (!(t->flags & SN_FINST_MASK))
|
|
t->flags |= SN_FINST_R;
|
|
return 1;
|
|
}
|
|
else if (tv_cmp2_ms(&t->crexpire, &now) <= 0) {
|
|
|
|
/* read timeout : give up with an error message.
|
|
*/
|
|
t->logs.status = 408;
|
|
client_retnclose(t, t->proxy->errmsg.len408, t->proxy->errmsg.msg408);
|
|
if (!(t->flags & SN_ERR_MASK))
|
|
t->flags |= SN_ERR_CLITO;
|
|
if (!(t->flags & SN_FINST_MASK))
|
|
t->flags |= SN_FINST_R;
|
|
return 1;
|
|
}
|
|
|
|
return t->cli_state != CL_STHEADERS;
|
|
}
|
|
else if (c == CL_STDATA) {
|
|
process_data:
|
|
/* FIXME: this error handling is partly buggy because we always report
|
|
* a 'DATA' phase while we don't know if the server was in IDLE, CONN
|
|
* or HEADER phase. BTW, it's not logical to expire the client while
|
|
* we're waiting for the server to connect.
|
|
*/
|
|
/* read or write error */
|
|
if (t->res_cw == RES_ERROR || t->res_cr == RES_ERROR) {
|
|
tv_eternity(&t->crexpire);
|
|
tv_eternity(&t->cwexpire);
|
|
fd_delete(t->cli_fd);
|
|
t->cli_state = CL_STCLOSE;
|
|
if (!(t->flags & SN_ERR_MASK))
|
|
t->flags |= SN_ERR_CLICL;
|
|
if (!(t->flags & SN_FINST_MASK))
|
|
t->flags |= SN_FINST_D;
|
|
return 1;
|
|
}
|
|
/* last read, or end of server write */
|
|
else if (t->res_cr == RES_NULL || s == SV_STSHUTW || s == SV_STCLOSE) {
|
|
FD_CLR(t->cli_fd, StaticReadEvent);
|
|
tv_eternity(&t->crexpire);
|
|
shutdown(t->cli_fd, SHUT_RD);
|
|
t->cli_state = CL_STSHUTR;
|
|
return 1;
|
|
}
|
|
/* last server read and buffer empty */
|
|
else if ((s == SV_STSHUTR || s == SV_STCLOSE) && (rep->l == 0)) {
|
|
FD_CLR(t->cli_fd, StaticWriteEvent);
|
|
tv_eternity(&t->cwexpire);
|
|
shutdown(t->cli_fd, SHUT_WR);
|
|
t->cli_state = CL_STSHUTW;
|
|
return 1;
|
|
}
|
|
/* read timeout */
|
|
else if (tv_cmp2_ms(&t->crexpire, &now) <= 0) {
|
|
FD_CLR(t->cli_fd, StaticReadEvent);
|
|
tv_eternity(&t->crexpire);
|
|
shutdown(t->cli_fd, SHUT_RD);
|
|
t->cli_state = CL_STSHUTR;
|
|
if (!(t->flags & SN_ERR_MASK))
|
|
t->flags |= SN_ERR_CLITO;
|
|
if (!(t->flags & SN_FINST_MASK))
|
|
t->flags |= SN_FINST_D;
|
|
return 1;
|
|
}
|
|
/* write timeout */
|
|
else if (tv_cmp2_ms(&t->cwexpire, &now) <= 0) {
|
|
FD_CLR(t->cli_fd, StaticWriteEvent);
|
|
tv_eternity(&t->cwexpire);
|
|
shutdown(t->cli_fd, SHUT_WR);
|
|
t->cli_state = CL_STSHUTW;
|
|
if (!(t->flags & SN_ERR_MASK))
|
|
t->flags |= SN_ERR_CLITO;
|
|
if (!(t->flags & SN_FINST_MASK))
|
|
t->flags |= SN_FINST_D;
|
|
return 1;
|
|
}
|
|
|
|
if (req->l >= req->rlim - req->data) {
|
|
/* no room to read more data */
|
|
if (FD_ISSET(t->cli_fd, StaticReadEvent)) {
|
|
/* stop reading until we get some space */
|
|
FD_CLR(t->cli_fd, StaticReadEvent);
|
|
tv_eternity(&t->crexpire);
|
|
}
|
|
}
|
|
else {
|
|
/* there's still some space in the buffer */
|
|
if (! FD_ISSET(t->cli_fd, StaticReadEvent)) {
|
|
FD_SET(t->cli_fd, StaticReadEvent);
|
|
if (!t->proxy->clitimeout ||
|
|
(t->srv_state < SV_STDATA && t->proxy->srvtimeout))
|
|
/* If the client has no timeout, or if the server not ready yet, and we
|
|
* know for sure that it can expire, then it's cleaner to disable the
|
|
* timeout on the client side so that too low values cannot make the
|
|
* sessions abort too early.
|
|
*/
|
|
tv_eternity(&t->crexpire);
|
|
else
|
|
tv_delayfrom(&t->crexpire, &now, t->proxy->clitimeout);
|
|
}
|
|
}
|
|
|
|
if ((rep->l == 0) ||
|
|
((s < SV_STDATA) /* FIXME: this may be optimized && (rep->w == rep->h)*/)) {
|
|
if (FD_ISSET(t->cli_fd, StaticWriteEvent)) {
|
|
FD_CLR(t->cli_fd, StaticWriteEvent); /* stop writing */
|
|
tv_eternity(&t->cwexpire);
|
|
}
|
|
}
|
|
else { /* buffer not empty */
|
|
if (! FD_ISSET(t->cli_fd, StaticWriteEvent)) {
|
|
FD_SET(t->cli_fd, StaticWriteEvent); /* restart writing */
|
|
if (t->proxy->clitimeout) {
|
|
tv_delayfrom(&t->cwexpire, &now, t->proxy->clitimeout);
|
|
/* FIXME: to avoid the client to read-time-out during writes, we refresh it */
|
|
t->crexpire = t->cwexpire;
|
|
}
|
|
else
|
|
tv_eternity(&t->cwexpire);
|
|
}
|
|
}
|
|
return 0; /* other cases change nothing */
|
|
}
|
|
else if (c == CL_STSHUTR) {
|
|
if (t->res_cw == RES_ERROR) {
|
|
tv_eternity(&t->cwexpire);
|
|
fd_delete(t->cli_fd);
|
|
t->cli_state = CL_STCLOSE;
|
|
if (!(t->flags & SN_ERR_MASK))
|
|
t->flags |= SN_ERR_CLICL;
|
|
if (!(t->flags & SN_FINST_MASK))
|
|
t->flags |= SN_FINST_D;
|
|
return 1;
|
|
}
|
|
else if ((s == SV_STSHUTR || s == SV_STCLOSE) && (rep->l == 0)) {
|
|
tv_eternity(&t->cwexpire);
|
|
fd_delete(t->cli_fd);
|
|
t->cli_state = CL_STCLOSE;
|
|
return 1;
|
|
}
|
|
else if (tv_cmp2_ms(&t->cwexpire, &now) <= 0) {
|
|
tv_eternity(&t->cwexpire);
|
|
fd_delete(t->cli_fd);
|
|
t->cli_state = CL_STCLOSE;
|
|
if (!(t->flags & SN_ERR_MASK))
|
|
t->flags |= SN_ERR_CLITO;
|
|
if (!(t->flags & SN_FINST_MASK))
|
|
t->flags |= SN_FINST_D;
|
|
return 1;
|
|
}
|
|
else if ((rep->l == 0) ||
|
|
((s == SV_STHEADERS) /* FIXME: this may be optimized && (rep->w == rep->h)*/)) {
|
|
if (FD_ISSET(t->cli_fd, StaticWriteEvent)) {
|
|
FD_CLR(t->cli_fd, StaticWriteEvent); /* stop writing */
|
|
tv_eternity(&t->cwexpire);
|
|
}
|
|
}
|
|
else { /* buffer not empty */
|
|
if (! FD_ISSET(t->cli_fd, StaticWriteEvent)) {
|
|
FD_SET(t->cli_fd, StaticWriteEvent); /* restart writing */
|
|
if (t->proxy->clitimeout) {
|
|
tv_delayfrom(&t->cwexpire, &now, t->proxy->clitimeout);
|
|
/* FIXME: to avoid the client to read-time-out during writes, we refresh it */
|
|
t->crexpire = t->cwexpire;
|
|
}
|
|
else
|
|
tv_eternity(&t->cwexpire);
|
|
}
|
|
}
|
|
return 0;
|
|
}
|
|
else if (c == CL_STSHUTW) {
|
|
if (t->res_cr == RES_ERROR) {
|
|
tv_eternity(&t->crexpire);
|
|
fd_delete(t->cli_fd);
|
|
t->cli_state = CL_STCLOSE;
|
|
if (!(t->flags & SN_ERR_MASK))
|
|
t->flags |= SN_ERR_CLICL;
|
|
if (!(t->flags & SN_FINST_MASK))
|
|
t->flags |= SN_FINST_D;
|
|
return 1;
|
|
}
|
|
else if (t->res_cr == RES_NULL || s == SV_STSHUTW || s == SV_STCLOSE) {
|
|
tv_eternity(&t->crexpire);
|
|
fd_delete(t->cli_fd);
|
|
t->cli_state = CL_STCLOSE;
|
|
return 1;
|
|
}
|
|
else if (tv_cmp2_ms(&t->crexpire, &now) <= 0) {
|
|
tv_eternity(&t->crexpire);
|
|
fd_delete(t->cli_fd);
|
|
t->cli_state = CL_STCLOSE;
|
|
if (!(t->flags & SN_ERR_MASK))
|
|
t->flags |= SN_ERR_CLITO;
|
|
if (!(t->flags & SN_FINST_MASK))
|
|
t->flags |= SN_FINST_D;
|
|
return 1;
|
|
}
|
|
else if (req->l >= req->rlim - req->data) {
|
|
/* no room to read more data */
|
|
if (FD_ISSET(t->cli_fd, StaticReadEvent)) {
|
|
/* stop reading until we get some space */
|
|
FD_CLR(t->cli_fd, StaticReadEvent);
|
|
tv_eternity(&t->crexpire);
|
|
}
|
|
}
|
|
else {
|
|
/* there's still some space in the buffer */
|
|
if (! FD_ISSET(t->cli_fd, StaticReadEvent)) {
|
|
FD_SET(t->cli_fd, StaticReadEvent);
|
|
if (t->proxy->clitimeout)
|
|
tv_delayfrom(&t->crexpire, &now, t->proxy->clitimeout);
|
|
else
|
|
tv_eternity(&t->crexpire);
|
|
}
|
|
}
|
|
return 0;
|
|
}
|
|
else { /* CL_STCLOSE: nothing to do */
|
|
if ((global.mode & MODE_DEBUG) && (!(global.mode & MODE_QUIET) || (global.mode & MODE_VERBOSE))) {
|
|
int len;
|
|
len = sprintf(trash, "%08x:%s.clicls[%04x:%04x]\n", t->uniq_id, t->proxy->id, (unsigned short)t->cli_fd, (unsigned short)t->srv_fd);
|
|
write(1, trash, len);
|
|
}
|
|
return 0;
|
|
}
|
|
return 0;
|
|
}
|
|
|
|
|
|
/*
|
|
* manages the server FSM and its socket. It returns 1 if a state has changed
|
|
* (and a resync may be needed), 0 else.
|
|
*/
|
|
int process_srv(struct session *t) {
|
|
int s = t->srv_state;
|
|
int c = t->cli_state;
|
|
struct buffer *req = t->req;
|
|
struct buffer *rep = t->rep;
|
|
appsess *asession_temp = NULL;
|
|
appsess local_asession;
|
|
|
|
#ifdef DEBUG_FULL
|
|
fprintf(stderr,"process_srv: c=%s, s=%s\n", cli_stnames[c], srv_stnames[s]);
|
|
#endif
|
|
//fprintf(stderr,"process_srv: c=%d, s=%d, cr=%d, cw=%d, sr=%d, sw=%d\n", c, s,
|
|
//FD_ISSET(t->cli_fd, StaticReadEvent), FD_ISSET(t->cli_fd, StaticWriteEvent),
|
|
//FD_ISSET(t->srv_fd, StaticReadEvent), FD_ISSET(t->srv_fd, StaticWriteEvent)
|
|
//);
|
|
if (s == SV_STIDLE) {
|
|
if (c == CL_STHEADERS)
|
|
return 0; /* stay in idle, waiting for data to reach the client side */
|
|
else if (c == CL_STCLOSE ||
|
|
c == CL_STSHUTW ||
|
|
(c == CL_STSHUTR && t->req->l == 0)) { /* give up */
|
|
tv_eternity(&t->cnexpire);
|
|
t->srv_state = SV_STCLOSE;
|
|
if (!(t->flags & SN_ERR_MASK))
|
|
t->flags |= SN_ERR_CLICL;
|
|
if (!(t->flags & SN_FINST_MASK))
|
|
t->flags |= SN_FINST_C;
|
|
return 1;
|
|
}
|
|
else { /* go to SV_STCONN */
|
|
if (connect_server(t) == 0) { /* initiate a connection to the server */
|
|
//fprintf(stderr,"0: c=%d, s=%d\n", c, s);
|
|
t->srv_state = SV_STCONN;
|
|
}
|
|
else { /* try again */
|
|
while (t->conn_retries-- > 0) {
|
|
if ((t->proxy->options & PR_O_REDISP) && (t->conn_retries == 0)) {
|
|
t->flags &= ~SN_DIRECT; /* ignore cookie and force to use the dispatcher */
|
|
t->srv = NULL; /* it's left to the dispatcher to choose a server */
|
|
if ((t->flags & SN_CK_MASK) == SN_CK_VALID) {
|
|
t->flags &= ~SN_CK_MASK;
|
|
t->flags |= SN_CK_DOWN;
|
|
}
|
|
}
|
|
|
|
if (connect_server(t) == 0) {
|
|
t->srv_state = SV_STCONN;
|
|
break;
|
|
}
|
|
}
|
|
if (t->conn_retries < 0) {
|
|
/* if conn_retries < 0 or other error, let's abort */
|
|
tv_eternity(&t->cnexpire);
|
|
t->srv_state = SV_STCLOSE;
|
|
t->logs.status = 503;
|
|
if (t->proxy->mode == PR_MODE_HTTP)
|
|
client_return(t, t->proxy->errmsg.len503, t->proxy->errmsg.msg503);
|
|
if (!(t->flags & SN_ERR_MASK))
|
|
t->flags |= SN_ERR_SRVCL;
|
|
if (!(t->flags & SN_FINST_MASK))
|
|
t->flags |= SN_FINST_C;
|
|
}
|
|
}
|
|
return 1;
|
|
}
|
|
}
|
|
else if (s == SV_STCONN) { /* connection in progress */
|
|
if (t->res_sw == RES_SILENT && tv_cmp2_ms(&t->cnexpire, &now) > 0) {
|
|
//fprintf(stderr,"1: c=%d, s=%d\n", c, s);
|
|
return 0; /* nothing changed */
|
|
}
|
|
else if (t->res_sw == RES_SILENT || t->res_sw == RES_ERROR) {
|
|
//fprintf(stderr,"2: c=%d, s=%d\n", c, s);
|
|
/* timeout, connect error or first write error */
|
|
//FD_CLR(t->srv_fd, StaticWriteEvent);
|
|
fd_delete(t->srv_fd);
|
|
//close(t->srv_fd);
|
|
t->conn_retries--;
|
|
if (t->conn_retries >= 0) {
|
|
if ((t->proxy->options & PR_O_REDISP) && (t->conn_retries == 0)) {
|
|
t->flags &= ~SN_DIRECT; /* ignore cookie and force to use the dispatcher */
|
|
t->srv = NULL; /* it's left to the dispatcher to choose a server */
|
|
if ((t->flags & SN_CK_MASK) == SN_CK_VALID) {
|
|
t->flags &= ~SN_CK_MASK;
|
|
t->flags |= SN_CK_DOWN;
|
|
}
|
|
}
|
|
if (connect_server(t) == 0)
|
|
return 0; /* no state changed */
|
|
}
|
|
/* if conn_retries < 0 or other error, let's abort */
|
|
tv_eternity(&t->cnexpire);
|
|
t->srv_state = SV_STCLOSE;
|
|
t->logs.status = 503;
|
|
if (t->proxy->mode == PR_MODE_HTTP)
|
|
client_return(t, t->proxy->errmsg.len503, t->proxy->errmsg.msg503);
|
|
if (!(t->flags & SN_ERR_MASK))
|
|
t->flags |= SN_ERR_SRVCL;
|
|
if (!(t->flags & SN_FINST_MASK))
|
|
t->flags |= SN_FINST_C;
|
|
return 1;
|
|
}
|
|
else { /* no error or write 0 */
|
|
t->logs.t_connect = tv_diff(&t->logs.tv_accept, &now);
|
|
|
|
//fprintf(stderr,"3: c=%d, s=%d\n", c, s);
|
|
if (req->l == 0) /* nothing to write */ {
|
|
FD_CLR(t->srv_fd, StaticWriteEvent);
|
|
tv_eternity(&t->swexpire);
|
|
} else /* need the right to write */ {
|
|
FD_SET(t->srv_fd, StaticWriteEvent);
|
|
if (t->proxy->srvtimeout) {
|
|
tv_delayfrom(&t->swexpire, &now, t->proxy->srvtimeout);
|
|
/* FIXME: to avoid the server to read-time-out during writes, we refresh it */
|
|
t->srexpire = t->swexpire;
|
|
}
|
|
else
|
|
tv_eternity(&t->swexpire);
|
|
}
|
|
|
|
if (t->proxy->mode == PR_MODE_TCP) { /* let's allow immediate data connection in this case */
|
|
FD_SET(t->srv_fd, StaticReadEvent);
|
|
if (t->proxy->srvtimeout)
|
|
tv_delayfrom(&t->srexpire, &now, t->proxy->srvtimeout);
|
|
else
|
|
tv_eternity(&t->srexpire);
|
|
|
|
t->srv_state = SV_STDATA;
|
|
rep->rlim = rep->data + BUFSIZE; /* no rewrite needed */
|
|
|
|
/* if the user wants to log as soon as possible, without counting
|
|
bytes from the server, then this is the right moment. */
|
|
if (t->proxy->to_log && !(t->logs.logwait & LW_BYTES)) {
|
|
t->logs.t_close = t->logs.t_connect; /* to get a valid end date */
|
|
sess_log(t);
|
|
}
|
|
}
|
|
else {
|
|
t->srv_state = SV_STHEADERS;
|
|
rep->rlim = rep->data + BUFSIZE - MAXREWRITE; /* rewrite needed */
|
|
}
|
|
tv_eternity(&t->cnexpire);
|
|
return 1;
|
|
}
|
|
}
|
|
else if (s == SV_STHEADERS) { /* receiving server headers */
|
|
/* now parse the partial (or complete) headers */
|
|
while (rep->lr < rep->r) { /* this loop only sees one header at each iteration */
|
|
char *ptr;
|
|
int delete_header;
|
|
|
|
ptr = rep->lr;
|
|
|
|
/* look for the end of the current header */
|
|
while (ptr < rep->r && *ptr != '\n' && *ptr != '\r')
|
|
ptr++;
|
|
|
|
if (ptr == rep->h) {
|
|
int line, len;
|
|
|
|
/* we can only get here after an end of headers */
|
|
|
|
/* first, we'll block if security checks have caught nasty things */
|
|
if (t->flags & SN_CACHEABLE) {
|
|
if ((t->flags & SN_CACHE_COOK) &&
|
|
(t->flags & SN_SCK_ANY) &&
|
|
(t->proxy->options & PR_O_CHK_CACHE)) {
|
|
|
|
/* we're in presence of a cacheable response containing
|
|
* a set-cookie header. We'll block it as requested by
|
|
* the 'checkcache' option, and send an alert.
|
|
*/
|
|
tv_eternity(&t->srexpire);
|
|
tv_eternity(&t->swexpire);
|
|
fd_delete(t->srv_fd);
|
|
t->srv_state = SV_STCLOSE;
|
|
t->logs.status = 502;
|
|
client_return(t, t->proxy->errmsg.len502, t->proxy->errmsg.msg502);
|
|
if (!(t->flags & SN_ERR_MASK))
|
|
t->flags |= SN_ERR_PRXCOND;
|
|
if (!(t->flags & SN_FINST_MASK))
|
|
t->flags |= SN_FINST_H;
|
|
|
|
Alert("Blocking cacheable cookie in response from instance %s, server %s.\n", t->proxy->id, t->srv->id);
|
|
send_log(t->proxy, LOG_ALERT, "Blocking cacheable cookie in response from instance %s, server %s.\n", t->proxy->id, t->srv->id);
|
|
|
|
return 1;
|
|
}
|
|
}
|
|
|
|
/* next, we'll block if an 'rspideny' or 'rspdeny' filter matched */
|
|
if (t->flags & SN_SVDENY) {
|
|
tv_eternity(&t->srexpire);
|
|
tv_eternity(&t->swexpire);
|
|
fd_delete(t->srv_fd);
|
|
t->srv_state = SV_STCLOSE;
|
|
t->logs.status = 502;
|
|
client_return(t, t->proxy->errmsg.len502, t->proxy->errmsg.msg502);
|
|
if (!(t->flags & SN_ERR_MASK))
|
|
t->flags |= SN_ERR_PRXCOND;
|
|
if (!(t->flags & SN_FINST_MASK))
|
|
t->flags |= SN_FINST_H;
|
|
return 1;
|
|
}
|
|
|
|
/* we'll have something else to do here : add new headers ... */
|
|
|
|
if ((t->srv) && !(t->flags & SN_DIRECT) && (t->proxy->options & PR_O_COOK_INS) &&
|
|
(!(t->proxy->options & PR_O_COOK_POST) || (t->flags & SN_POST))) {
|
|
/* the server is known, it's not the one the client requested, we have to
|
|
* insert a set-cookie here, except if we want to insert only on POST
|
|
* requests and this one isn't.
|
|
*/
|
|
len = sprintf(trash, "Set-Cookie: %s=%s; path=/\r\n",
|
|
t->proxy->cookie_name,
|
|
t->srv->cookie ? t->srv->cookie : "");
|
|
|
|
t->flags |= SN_SCK_INSERTED;
|
|
|
|
/* Here, we will tell an eventual cache on the client side that we don't
|
|
* want it to cache this reply because HTTP/1.0 caches also cache cookies !
|
|
* Some caches understand the correct form: 'no-cache="set-cookie"', but
|
|
* others don't (eg: apache <= 1.3.26). So we use 'private' instead.
|
|
*/
|
|
if (t->proxy->options & PR_O_COOK_NOC)
|
|
//len += sprintf(newhdr + len, "Cache-control: no-cache=\"set-cookie\"\r\n");
|
|
len += sprintf(trash + len, "Cache-control: private\r\n");
|
|
|
|
buffer_replace2(rep, rep->h, rep->h, trash, len);
|
|
}
|
|
|
|
/* headers to be added */
|
|
for (line = 0; line < t->proxy->nb_rspadd; line++) {
|
|
len = sprintf(trash, "%s\r\n", t->proxy->rsp_add[line]);
|
|
buffer_replace2(rep, rep->h, rep->h, trash, len);
|
|
}
|
|
|
|
/* add a "connection: close" line if needed */
|
|
if (t->proxy->options & PR_O_HTTP_CLOSE)
|
|
buffer_replace2(rep, rep->h, rep->h, "Connection: close\r\n", 19);
|
|
|
|
t->srv_state = SV_STDATA;
|
|
rep->rlim = rep->data + BUFSIZE; /* no more rewrite needed */
|
|
t->logs.t_data = tv_diff(&t->logs.tv_accept, &now);
|
|
|
|
/* if the user wants to log as soon as possible, without counting
|
|
bytes from the server, then this is the right moment. */
|
|
if (t->proxy->to_log && !(t->logs.logwait & LW_BYTES)) {
|
|
t->logs.t_close = t->logs.t_data; /* to get a valid end date */
|
|
t->logs.bytes = rep->h - rep->data;
|
|
sess_log(t);
|
|
}
|
|
break;
|
|
}
|
|
|
|
/* to get a complete header line, we need the ending \r\n, \n\r, \r or \n too */
|
|
if (ptr > rep->r - 2) {
|
|
/* this is a partial header, let's wait for more to come */
|
|
rep->lr = ptr;
|
|
break;
|
|
}
|
|
|
|
// fprintf(stderr,"h=%p, ptr=%p, lr=%p, r=%p, *h=", rep->h, ptr, rep->lr, rep->r);
|
|
// write(2, rep->h, ptr - rep->h); fprintf(stderr,"\n");
|
|
|
|
/* now we know that *ptr is either \r or \n,
|
|
* and that there are at least 1 char after it.
|
|
*/
|
|
if ((ptr[0] == ptr[1]) || (ptr[1] != '\r' && ptr[1] != '\n'))
|
|
rep->lr = ptr + 1; /* \r\r, \n\n, \r[^\n], \n[^\r] */
|
|
else
|
|
rep->lr = ptr + 2; /* \r\n or \n\r */
|
|
|
|
/*
|
|
* now we know that we have a full header ; we can do whatever
|
|
* we want with these pointers :
|
|
* rep->h = beginning of header
|
|
* ptr = end of header (first \r or \n)
|
|
* rep->lr = beginning of next line (next rep->h)
|
|
* rep->r = end of data (not used at this stage)
|
|
*/
|
|
|
|
|
|
if (t->logs.status == -1) {
|
|
t->logs.logwait &= ~LW_RESP;
|
|
t->logs.status = atoi(rep->h + 9);
|
|
switch (t->logs.status) {
|
|
case 200:
|
|
case 203:
|
|
case 206:
|
|
case 300:
|
|
case 301:
|
|
case 410:
|
|
/* RFC2616 @13.4:
|
|
* "A response received with a status code of
|
|
* 200, 203, 206, 300, 301 or 410 MAY be stored
|
|
* by a cache (...) unless a cache-control
|
|
* directive prohibits caching."
|
|
*
|
|
* RFC2616 @9.5: POST method :
|
|
* "Responses to this method are not cacheable,
|
|
* unless the response includes appropriate
|
|
* Cache-Control or Expires header fields."
|
|
*/
|
|
if ((!t->flags & SN_POST) && (t->proxy->options & PR_O_CHK_CACHE))
|
|
t->flags |= SN_CACHEABLE | SN_CACHE_COOK;
|
|
break;
|
|
default:
|
|
break;
|
|
}
|
|
}
|
|
else if (t->logs.logwait & LW_RSPHDR) {
|
|
struct cap_hdr *h;
|
|
int len;
|
|
for (h = t->proxy->rsp_cap; h; h = h->next) {
|
|
if ((h->namelen + 2 <= ptr - rep->h) &&
|
|
(rep->h[h->namelen] == ':') &&
|
|
(strncasecmp(rep->h, h->name, h->namelen) == 0)) {
|
|
|
|
if (t->rsp_cap[h->index] == NULL)
|
|
t->rsp_cap[h->index] = pool_alloc_from(h->pool, h->len + 1);
|
|
|
|
len = ptr - (rep->h + h->namelen + 2);
|
|
if (len > h->len)
|
|
len = h->len;
|
|
|
|
memcpy(t->rsp_cap[h->index], rep->h + h->namelen + 2, len);
|
|
t->rsp_cap[h->index][len]=0;
|
|
}
|
|
}
|
|
|
|
}
|
|
|
|
delete_header = 0;
|
|
|
|
if ((global.mode & MODE_DEBUG) && (!(global.mode & MODE_QUIET) || (global.mode & MODE_VERBOSE))) {
|
|
int len, max;
|
|
len = sprintf(trash, "%08x:%s.srvhdr[%04x:%04x]: ", t->uniq_id, t->proxy->id, (unsigned short)t->cli_fd, (unsigned short)t->srv_fd);
|
|
max = ptr - rep->h;
|
|
UBOUND(max, sizeof(trash) - len - 1);
|
|
len += strlcpy2(trash + len, rep->h, max + 1);
|
|
trash[len++] = '\n';
|
|
write(1, trash, len);
|
|
}
|
|
|
|
/* remove "connection: " if needed */
|
|
if (!delete_header && (t->proxy->options & PR_O_HTTP_CLOSE)
|
|
&& (strncasecmp(rep->h, "Connection: ", 12) == 0)) {
|
|
delete_header = 1;
|
|
}
|
|
|
|
/* try headers regexps */
|
|
if (!delete_header && t->proxy->rsp_exp != NULL
|
|
&& !(t->flags & SN_SVDENY)) {
|
|
struct hdr_exp *exp;
|
|
char term;
|
|
|
|
term = *ptr;
|
|
*ptr = '\0';
|
|
exp = t->proxy->rsp_exp;
|
|
do {
|
|
if (regexec(exp->preg, rep->h, MAX_MATCH, pmatch, 0) == 0) {
|
|
switch (exp->action) {
|
|
case ACT_ALLOW:
|
|
if (!(t->flags & SN_SVDENY))
|
|
t->flags |= SN_SVALLOW;
|
|
break;
|
|
case ACT_REPLACE:
|
|
if (!(t->flags & SN_SVDENY)) {
|
|
int len = exp_replace(trash, rep->h, exp->replace, pmatch);
|
|
ptr += buffer_replace2(rep, rep->h, ptr, trash, len);
|
|
}
|
|
break;
|
|
case ACT_REMOVE:
|
|
if (!(t->flags & SN_SVDENY))
|
|
delete_header = 1;
|
|
break;
|
|
case ACT_DENY:
|
|
if (!(t->flags & SN_SVALLOW))
|
|
t->flags |= SN_SVDENY;
|
|
break;
|
|
case ACT_PASS: /* we simply don't deny this one */
|
|
break;
|
|
}
|
|
break;
|
|
}
|
|
} while ((exp = exp->next) != NULL);
|
|
*ptr = term; /* restore the string terminator */
|
|
}
|
|
|
|
/* check for cache-control: or pragma: headers */
|
|
if (!delete_header && (t->flags & SN_CACHEABLE)) {
|
|
if (strncasecmp(rep->h, "Pragma: no-cache", 16) == 0)
|
|
t->flags &= ~SN_CACHEABLE & ~SN_CACHE_COOK;
|
|
else if (strncasecmp(rep->h, "Cache-control: ", 15) == 0) {
|
|
if (strncasecmp(rep->h + 15, "no-cache", 8) == 0) {
|
|
if (rep->h + 23 == ptr || rep->h[23] == ',')
|
|
t->flags &= ~SN_CACHEABLE & ~SN_CACHE_COOK;
|
|
else {
|
|
if (strncasecmp(rep->h + 23, "=\"set-cookie", 12) == 0
|
|
&& (rep->h[35] == '"' || rep->h[35] == ','))
|
|
t->flags &= ~SN_CACHE_COOK;
|
|
}
|
|
} else if ((strncasecmp(rep->h + 15, "private", 7) == 0 &&
|
|
(rep->h + 22 == ptr || rep->h[22] == ','))
|
|
|| (strncasecmp(rep->h + 15, "no-store", 8) == 0 &&
|
|
(rep->h + 23 == ptr || rep->h[23] == ','))) {
|
|
t->flags &= ~SN_CACHEABLE & ~SN_CACHE_COOK;
|
|
} else if (strncasecmp(rep->h + 15, "max-age=0", 9) == 0 &&
|
|
(rep->h + 24 == ptr || rep->h[24] == ',')) {
|
|
t->flags &= ~SN_CACHEABLE & ~SN_CACHE_COOK;
|
|
} else if (strncasecmp(rep->h + 15, "s-maxage=0", 10) == 0 &&
|
|
(rep->h + 25 == ptr || rep->h[25] == ',')) {
|
|
t->flags &= ~SN_CACHEABLE & ~SN_CACHE_COOK;
|
|
} else if (strncasecmp(rep->h + 15, "public", 6) == 0 &&
|
|
(rep->h + 21 == ptr || rep->h[21] == ',')) {
|
|
t->flags |= SN_CACHEABLE | SN_CACHE_COOK;
|
|
}
|
|
}
|
|
}
|
|
|
|
/* check for server cookies */
|
|
if (!delete_header /*&& (t->proxy->options & PR_O_COOK_ANY)*/
|
|
&& (t->proxy->cookie_name != NULL || t->proxy->capture_name != NULL || t->proxy->appsession_name !=NULL)
|
|
&& (strncasecmp(rep->h, "Set-Cookie: ", 12) == 0)) {
|
|
char *p1, *p2, *p3, *p4;
|
|
|
|
t->flags |= SN_SCK_ANY;
|
|
|
|
p1 = rep->h + 12; /* first char after 'Set-Cookie: ' */
|
|
|
|
while (p1 < ptr) { /* in fact, we'll break after the first cookie */
|
|
while (p1 < ptr && (isspace((int)*p1)))
|
|
p1++;
|
|
|
|
if (p1 == ptr || *p1 == ';') /* end of cookie */
|
|
break;
|
|
|
|
/* p1 is at the beginning of the cookie name */
|
|
p2 = p1;
|
|
|
|
while (p2 < ptr && *p2 != '=' && *p2 != ';')
|
|
p2++;
|
|
|
|
if (p2 == ptr || *p2 == ';') /* next cookie */
|
|
break;
|
|
|
|
p3 = p2 + 1; /* skips the '=' sign */
|
|
if (p3 == ptr)
|
|
break;
|
|
|
|
p4 = p3;
|
|
while (p4 < ptr && !isspace((int)*p4) && *p4 != ';')
|
|
p4++;
|
|
|
|
/* here, we have the cookie name between p1 and p2,
|
|
* and its value between p3 and p4.
|
|
* we can process it.
|
|
*/
|
|
|
|
/* first, let's see if we want to capture it */
|
|
if (t->proxy->capture_name != NULL &&
|
|
t->logs.srv_cookie == NULL &&
|
|
(p4 - p1 >= t->proxy->capture_namelen) &&
|
|
memcmp(p1, t->proxy->capture_name, t->proxy->capture_namelen) == 0) {
|
|
int log_len = p4 - p1;
|
|
|
|
if ((t->logs.srv_cookie = pool_alloc(capture)) == NULL) {
|
|
Alert("HTTP logging : out of memory.\n");
|
|
}
|
|
|
|
if (log_len > t->proxy->capture_len)
|
|
log_len = t->proxy->capture_len;
|
|
memcpy(t->logs.srv_cookie, p1, log_len);
|
|
t->logs.srv_cookie[log_len] = 0;
|
|
}
|
|
|
|
if ((p2 - p1 == t->proxy->cookie_len) && (t->proxy->cookie_name != NULL) &&
|
|
(memcmp(p1, t->proxy->cookie_name, p2 - p1) == 0)) {
|
|
/* Cool... it's the right one */
|
|
t->flags |= SN_SCK_SEEN;
|
|
|
|
/* If the cookie is in insert mode on a known server, we'll delete
|
|
* this occurrence because we'll insert another one later.
|
|
* We'll delete it too if the "indirect" option is set and we're in
|
|
* a direct access. */
|
|
if (((t->srv) && (t->proxy->options & PR_O_COOK_INS)) ||
|
|
((t->flags & SN_DIRECT) && (t->proxy->options & PR_O_COOK_IND))) {
|
|
/* this header must be deleted */
|
|
delete_header = 1;
|
|
t->flags |= SN_SCK_DELETED;
|
|
}
|
|
else if ((t->srv) && (t->proxy->options & PR_O_COOK_RW)) {
|
|
/* replace bytes p3->p4 with the cookie name associated
|
|
* with this server since we know it.
|
|
*/
|
|
buffer_replace2(rep, p3, p4, t->srv->cookie, t->srv->cklen);
|
|
t->flags |= SN_SCK_INSERTED | SN_SCK_DELETED;
|
|
}
|
|
else if ((t->srv) && (t->proxy->options & PR_O_COOK_PFX)) {
|
|
/* insert the cookie name associated with this server
|
|
* before existing cookie, and insert a delimitor between them..
|
|
*/
|
|
buffer_replace2(rep, p3, p3, t->srv->cookie, t->srv->cklen + 1);
|
|
p3[t->srv->cklen] = COOKIE_DELIM;
|
|
t->flags |= SN_SCK_INSERTED | SN_SCK_DELETED;
|
|
}
|
|
break;
|
|
}
|
|
|
|
/* first, let's see if the cookie is our appcookie*/
|
|
if ((t->proxy->appsession_name != NULL) &&
|
|
(memcmp(p1, t->proxy->appsession_name, p2 - p1) == 0)) {
|
|
|
|
/* Cool... it's the right one */
|
|
|
|
size_t server_id_len = strlen(t->srv->id)+1;
|
|
asession_temp = &local_asession;
|
|
|
|
if((asession_temp->sessid = pool_alloc_from(apools.sessid, apools.ses_msize)) == NULL){
|
|
Alert("Not enought Memory process_srv():asession->sessid:malloc().\n");
|
|
send_log(t->proxy, LOG_ALERT, "Not enought Memory process_srv():asession->sessid:malloc().\n");
|
|
}
|
|
memcpy(asession_temp->sessid, p3, t->proxy->appsession_len);
|
|
asession_temp->sessid[t->proxy->appsession_len] = 0;
|
|
asession_temp->serverid = NULL;
|
|
|
|
/* only do insert, if lookup fails */
|
|
if (chtbl_lookup(&(t->proxy->htbl_proxy), (void *) &asession_temp) != 0) {
|
|
if ((asession_temp = pool_alloc(appsess)) == NULL) {
|
|
Alert("Not enought Memory process_srv():asession:calloc().\n");
|
|
send_log(t->proxy, LOG_ALERT, "Not enought Memory process_srv():asession:calloc().\n");
|
|
return 0;
|
|
}
|
|
asession_temp->sessid = local_asession.sessid;
|
|
asession_temp->serverid = local_asession.serverid;
|
|
chtbl_insert(&(t->proxy->htbl_proxy), (void *) asession_temp);
|
|
}/* end if(chtbl_lookup()) */
|
|
else
|
|
{
|
|
/* free wasted memory */
|
|
pool_free_to(apools.sessid, local_asession.sessid);
|
|
} /* end else from if(chtbl_lookup()) */
|
|
|
|
if(asession_temp->serverid == NULL){
|
|
if((asession_temp->serverid = pool_alloc_from(apools.serverid, apools.ser_msize)) == NULL){
|
|
Alert("Not enought Memory process_srv():asession->sessid:malloc().\n");
|
|
send_log(t->proxy, LOG_ALERT, "Not enought Memory process_srv():asession->sessid:malloc().\n");
|
|
}
|
|
asession_temp->serverid[0] = '\0';
|
|
}
|
|
|
|
if(asession_temp->serverid[0] == '\0') memcpy(asession_temp->serverid,t->srv->id,server_id_len);
|
|
|
|
tv_delayfrom(&asession_temp->expire, &now, t->proxy->appsession_timeout);
|
|
|
|
#if defined(DEBUG_HASH)
|
|
print_table(&(t->proxy->htbl_proxy));
|
|
#endif
|
|
break;
|
|
}/* end if ((t->proxy->appsession_name != NULL) ... */
|
|
else {
|
|
// fprintf(stderr,"Ignoring unknown cookie : ");
|
|
// write(2, p1, p2-p1);
|
|
// fprintf(stderr," = ");
|
|
// write(2, p3, p4-p3);
|
|
// fprintf(stderr,"\n");
|
|
}
|
|
break; /* we don't want to loop again since there cannot be another cookie on the same line */
|
|
} /* we're now at the end of the cookie value */
|
|
} /* end of cookie processing */
|
|
|
|
/* check for any set-cookie in case we check for cacheability */
|
|
if (!delete_header && !(t->flags & SN_SCK_ANY) &&
|
|
(t->proxy->options & PR_O_CHK_CACHE) &&
|
|
(strncasecmp(rep->h, "Set-Cookie: ", 12) == 0)) {
|
|
t->flags |= SN_SCK_ANY;
|
|
}
|
|
|
|
/* let's look if we have to delete this header */
|
|
if (delete_header && !(t->flags & SN_SVDENY))
|
|
buffer_replace2(rep, rep->h, rep->lr, "", 0);
|
|
|
|
rep->h = rep->lr;
|
|
} /* while (rep->lr < rep->r) */
|
|
|
|
/* end of header processing (even if incomplete) */
|
|
|
|
if ((rep->l < rep->rlim - rep->data) && ! FD_ISSET(t->srv_fd, StaticReadEvent)) {
|
|
/* fd in StaticReadEvent was disabled, perhaps because of a previous buffer
|
|
* full. We cannot loop here since event_srv_read will disable it only if
|
|
* rep->l == rlim-data
|
|
*/
|
|
FD_SET(t->srv_fd, StaticReadEvent);
|
|
if (t->proxy->srvtimeout)
|
|
tv_delayfrom(&t->srexpire, &now, t->proxy->srvtimeout);
|
|
else
|
|
tv_eternity(&t->srexpire);
|
|
}
|
|
|
|
/* read error, write error */
|
|
if (t->res_sw == RES_ERROR || t->res_sr == RES_ERROR) {
|
|
tv_eternity(&t->srexpire);
|
|
tv_eternity(&t->swexpire);
|
|
fd_delete(t->srv_fd);
|
|
t->srv_state = SV_STCLOSE;
|
|
t->logs.status = 502;
|
|
client_return(t, t->proxy->errmsg.len502, t->proxy->errmsg.msg502);
|
|
if (!(t->flags & SN_ERR_MASK))
|
|
t->flags |= SN_ERR_SRVCL;
|
|
if (!(t->flags & SN_FINST_MASK))
|
|
t->flags |= SN_FINST_H;
|
|
return 1;
|
|
}
|
|
/* end of client write or end of server read.
|
|
* since we are in header mode, if there's no space left for headers, we
|
|
* won't be able to free more later, so the session will never terminate.
|
|
*/
|
|
else if (t->res_sr == RES_NULL || c == CL_STSHUTW || c == CL_STCLOSE || rep->l >= rep->rlim - rep->data) {
|
|
FD_CLR(t->srv_fd, StaticReadEvent);
|
|
tv_eternity(&t->srexpire);
|
|
shutdown(t->srv_fd, SHUT_RD);
|
|
t->srv_state = SV_STSHUTR;
|
|
return 1;
|
|
}
|
|
/* read timeout : return a 504 to the client.
|
|
*/
|
|
else if (FD_ISSET(t->srv_fd, StaticReadEvent) && tv_cmp2_ms(&t->srexpire, &now) <= 0) {
|
|
tv_eternity(&t->srexpire);
|
|
tv_eternity(&t->swexpire);
|
|
fd_delete(t->srv_fd);
|
|
t->srv_state = SV_STCLOSE;
|
|
t->logs.status = 504;
|
|
client_return(t, t->proxy->errmsg.len504, t->proxy->errmsg.msg504);
|
|
if (!(t->flags & SN_ERR_MASK))
|
|
t->flags |= SN_ERR_SRVTO;
|
|
if (!(t->flags & SN_FINST_MASK))
|
|
t->flags |= SN_FINST_H;
|
|
return 1;
|
|
|
|
}
|
|
/* last client read and buffer empty */
|
|
/* FIXME!!! here, we don't want to switch to SHUTW if the
|
|
* client shuts read too early, because we may still have
|
|
* some work to do on the headers.
|
|
* The side-effect is that if the client completely closes its
|
|
* connection during SV_STHEADER, the connection to the server
|
|
* is kept until a response comes back or the timeout is reached.
|
|
*/
|
|
else if ((/*c == CL_STSHUTR ||*/ c == CL_STCLOSE) && (req->l == 0)) {
|
|
FD_CLR(t->srv_fd, StaticWriteEvent);
|
|
tv_eternity(&t->swexpire);
|
|
shutdown(t->srv_fd, SHUT_WR);
|
|
t->srv_state = SV_STSHUTW;
|
|
return 1;
|
|
}
|
|
/* write timeout */
|
|
/* FIXME!!! here, we don't want to switch to SHUTW if the
|
|
* client shuts read too early, because we may still have
|
|
* some work to do on the headers.
|
|
*/
|
|
else if (FD_ISSET(t->srv_fd, StaticWriteEvent) && tv_cmp2_ms(&t->swexpire, &now) <= 0) {
|
|
FD_CLR(t->srv_fd, StaticWriteEvent);
|
|
tv_eternity(&t->swexpire);
|
|
shutdown(t->srv_fd, SHUT_WR);
|
|
t->srv_state = SV_STSHUTW;
|
|
if (!(t->flags & SN_ERR_MASK))
|
|
t->flags |= SN_ERR_SRVTO;
|
|
if (!(t->flags & SN_FINST_MASK))
|
|
t->flags |= SN_FINST_H;
|
|
return 1;
|
|
}
|
|
|
|
if (req->l == 0) {
|
|
if (FD_ISSET(t->srv_fd, StaticWriteEvent)) {
|
|
FD_CLR(t->srv_fd, StaticWriteEvent); /* stop writing */
|
|
tv_eternity(&t->swexpire);
|
|
}
|
|
}
|
|
else { /* client buffer not empty */
|
|
if (! FD_ISSET(t->srv_fd, StaticWriteEvent)) {
|
|
FD_SET(t->srv_fd, StaticWriteEvent); /* restart writing */
|
|
if (t->proxy->srvtimeout) {
|
|
tv_delayfrom(&t->swexpire, &now, t->proxy->srvtimeout);
|
|
/* FIXME: to avoid the server to read-time-out during writes, we refresh it */
|
|
t->srexpire = t->swexpire;
|
|
}
|
|
else
|
|
tv_eternity(&t->swexpire);
|
|
}
|
|
}
|
|
|
|
/* be nice with the client side which would like to send a complete header
|
|
* FIXME: COMPLETELY BUGGY !!! not all headers may be processed because the client
|
|
* would read all remaining data at once ! The client should not write past rep->lr
|
|
* when the server is in header state.
|
|
*/
|
|
//return header_processed;
|
|
return t->srv_state != SV_STHEADERS;
|
|
}
|
|
else if (s == SV_STDATA) {
|
|
/* read or write error */
|
|
if (t->res_sw == RES_ERROR || t->res_sr == RES_ERROR) {
|
|
tv_eternity(&t->srexpire);
|
|
tv_eternity(&t->swexpire);
|
|
fd_delete(t->srv_fd);
|
|
t->srv_state = SV_STCLOSE;
|
|
if (!(t->flags & SN_ERR_MASK))
|
|
t->flags |= SN_ERR_SRVCL;
|
|
if (!(t->flags & SN_FINST_MASK))
|
|
t->flags |= SN_FINST_D;
|
|
return 1;
|
|
}
|
|
/* last read, or end of client write */
|
|
else if (t->res_sr == RES_NULL || c == CL_STSHUTW || c == CL_STCLOSE) {
|
|
FD_CLR(t->srv_fd, StaticReadEvent);
|
|
tv_eternity(&t->srexpire);
|
|
shutdown(t->srv_fd, SHUT_RD);
|
|
t->srv_state = SV_STSHUTR;
|
|
return 1;
|
|
}
|
|
/* end of client read and no more data to send */
|
|
else if ((c == CL_STSHUTR || c == CL_STCLOSE) && (req->l == 0)) {
|
|
FD_CLR(t->srv_fd, StaticWriteEvent);
|
|
tv_eternity(&t->swexpire);
|
|
shutdown(t->srv_fd, SHUT_WR);
|
|
t->srv_state = SV_STSHUTW;
|
|
return 1;
|
|
}
|
|
/* read timeout */
|
|
else if (tv_cmp2_ms(&t->srexpire, &now) <= 0) {
|
|
FD_CLR(t->srv_fd, StaticReadEvent);
|
|
tv_eternity(&t->srexpire);
|
|
shutdown(t->srv_fd, SHUT_RD);
|
|
t->srv_state = SV_STSHUTR;
|
|
if (!(t->flags & SN_ERR_MASK))
|
|
t->flags |= SN_ERR_SRVTO;
|
|
if (!(t->flags & SN_FINST_MASK))
|
|
t->flags |= SN_FINST_D;
|
|
return 1;
|
|
}
|
|
/* write timeout */
|
|
else if (tv_cmp2_ms(&t->swexpire, &now) <= 0) {
|
|
FD_CLR(t->srv_fd, StaticWriteEvent);
|
|
tv_eternity(&t->swexpire);
|
|
shutdown(t->srv_fd, SHUT_WR);
|
|
t->srv_state = SV_STSHUTW;
|
|
if (!(t->flags & SN_ERR_MASK))
|
|
t->flags |= SN_ERR_SRVTO;
|
|
if (!(t->flags & SN_FINST_MASK))
|
|
t->flags |= SN_FINST_D;
|
|
return 1;
|
|
}
|
|
|
|
/* recompute request time-outs */
|
|
if (req->l == 0) {
|
|
if (FD_ISSET(t->srv_fd, StaticWriteEvent)) {
|
|
FD_CLR(t->srv_fd, StaticWriteEvent); /* stop writing */
|
|
tv_eternity(&t->swexpire);
|
|
}
|
|
}
|
|
else { /* buffer not empty, there are still data to be transferred */
|
|
if (! FD_ISSET(t->srv_fd, StaticWriteEvent)) {
|
|
FD_SET(t->srv_fd, StaticWriteEvent); /* restart writing */
|
|
if (t->proxy->srvtimeout) {
|
|
tv_delayfrom(&t->swexpire, &now, t->proxy->srvtimeout);
|
|
/* FIXME: to avoid the server to read-time-out during writes, we refresh it */
|
|
t->srexpire = t->swexpire;
|
|
}
|
|
else
|
|
tv_eternity(&t->swexpire);
|
|
}
|
|
}
|
|
|
|
/* recompute response time-outs */
|
|
if (rep->l == BUFSIZE) { /* no room to read more data */
|
|
if (FD_ISSET(t->srv_fd, StaticReadEvent)) {
|
|
FD_CLR(t->srv_fd, StaticReadEvent);
|
|
tv_eternity(&t->srexpire);
|
|
}
|
|
}
|
|
else {
|
|
if (! FD_ISSET(t->srv_fd, StaticReadEvent)) {
|
|
FD_SET(t->srv_fd, StaticReadEvent);
|
|
if (t->proxy->srvtimeout)
|
|
tv_delayfrom(&t->srexpire, &now, t->proxy->srvtimeout);
|
|
else
|
|
tv_eternity(&t->srexpire);
|
|
}
|
|
}
|
|
|
|
return 0; /* other cases change nothing */
|
|
}
|
|
else if (s == SV_STSHUTR) {
|
|
if (t->res_sw == RES_ERROR) {
|
|
//FD_CLR(t->srv_fd, StaticWriteEvent);
|
|
tv_eternity(&t->swexpire);
|
|
fd_delete(t->srv_fd);
|
|
//close(t->srv_fd);
|
|
t->srv_state = SV_STCLOSE;
|
|
if (!(t->flags & SN_ERR_MASK))
|
|
t->flags |= SN_ERR_SRVCL;
|
|
if (!(t->flags & SN_FINST_MASK))
|
|
t->flags |= SN_FINST_D;
|
|
return 1;
|
|
}
|
|
else if ((c == CL_STSHUTR || c == CL_STCLOSE) && (req->l == 0)) {
|
|
//FD_CLR(t->srv_fd, StaticWriteEvent);
|
|
tv_eternity(&t->swexpire);
|
|
fd_delete(t->srv_fd);
|
|
//close(t->srv_fd);
|
|
t->srv_state = SV_STCLOSE;
|
|
return 1;
|
|
}
|
|
else if (tv_cmp2_ms(&t->swexpire, &now) <= 0) {
|
|
//FD_CLR(t->srv_fd, StaticWriteEvent);
|
|
tv_eternity(&t->swexpire);
|
|
fd_delete(t->srv_fd);
|
|
//close(t->srv_fd);
|
|
t->srv_state = SV_STCLOSE;
|
|
if (!(t->flags & SN_ERR_MASK))
|
|
t->flags |= SN_ERR_SRVTO;
|
|
if (!(t->flags & SN_FINST_MASK))
|
|
t->flags |= SN_FINST_D;
|
|
return 1;
|
|
}
|
|
else if (req->l == 0) {
|
|
if (FD_ISSET(t->srv_fd, StaticWriteEvent)) {
|
|
FD_CLR(t->srv_fd, StaticWriteEvent); /* stop writing */
|
|
tv_eternity(&t->swexpire);
|
|
}
|
|
}
|
|
else { /* buffer not empty */
|
|
if (! FD_ISSET(t->srv_fd, StaticWriteEvent)) {
|
|
FD_SET(t->srv_fd, StaticWriteEvent); /* restart writing */
|
|
if (t->proxy->srvtimeout) {
|
|
tv_delayfrom(&t->swexpire, &now, t->proxy->srvtimeout);
|
|
/* FIXME: to avoid the server to read-time-out during writes, we refresh it */
|
|
t->srexpire = t->swexpire;
|
|
}
|
|
else
|
|
tv_eternity(&t->swexpire);
|
|
}
|
|
}
|
|
return 0;
|
|
}
|
|
else if (s == SV_STSHUTW) {
|
|
if (t->res_sr == RES_ERROR) {
|
|
//FD_CLR(t->srv_fd, StaticReadEvent);
|
|
tv_eternity(&t->srexpire);
|
|
fd_delete(t->srv_fd);
|
|
//close(t->srv_fd);
|
|
t->srv_state = SV_STCLOSE;
|
|
if (!(t->flags & SN_ERR_MASK))
|
|
t->flags |= SN_ERR_SRVCL;
|
|
if (!(t->flags & SN_FINST_MASK))
|
|
t->flags |= SN_FINST_D;
|
|
return 1;
|
|
}
|
|
else if (t->res_sr == RES_NULL || c == CL_STSHUTW || c == CL_STCLOSE) {
|
|
//FD_CLR(t->srv_fd, StaticReadEvent);
|
|
tv_eternity(&t->srexpire);
|
|
fd_delete(t->srv_fd);
|
|
//close(t->srv_fd);
|
|
t->srv_state = SV_STCLOSE;
|
|
return 1;
|
|
}
|
|
else if (tv_cmp2_ms(&t->srexpire, &now) <= 0) {
|
|
//FD_CLR(t->srv_fd, StaticReadEvent);
|
|
tv_eternity(&t->srexpire);
|
|
fd_delete(t->srv_fd);
|
|
//close(t->srv_fd);
|
|
t->srv_state = SV_STCLOSE;
|
|
if (!(t->flags & SN_ERR_MASK))
|
|
t->flags |= SN_ERR_SRVTO;
|
|
if (!(t->flags & SN_FINST_MASK))
|
|
t->flags |= SN_FINST_D;
|
|
return 1;
|
|
}
|
|
else if (rep->l == BUFSIZE) { /* no room to read more data */
|
|
if (FD_ISSET(t->srv_fd, StaticReadEvent)) {
|
|
FD_CLR(t->srv_fd, StaticReadEvent);
|
|
tv_eternity(&t->srexpire);
|
|
}
|
|
}
|
|
else {
|
|
if (! FD_ISSET(t->srv_fd, StaticReadEvent)) {
|
|
FD_SET(t->srv_fd, StaticReadEvent);
|
|
if (t->proxy->srvtimeout)
|
|
tv_delayfrom(&t->srexpire, &now, t->proxy->srvtimeout);
|
|
else
|
|
tv_eternity(&t->srexpire);
|
|
}
|
|
}
|
|
return 0;
|
|
}
|
|
else { /* SV_STCLOSE : nothing to do */
|
|
if ((global.mode & MODE_DEBUG) && (!(global.mode & MODE_QUIET) || (global.mode & MODE_VERBOSE))) {
|
|
int len;
|
|
len = sprintf(trash, "%08x:%s.srvcls[%04x:%04x]\n", t->uniq_id, t->proxy->id, (unsigned short)t->cli_fd, (unsigned short)t->srv_fd);
|
|
write(1, trash, len);
|
|
}
|
|
return 0;
|
|
}
|
|
return 0;
|
|
}
|
|
|
|
|
|
/* Processes the client and server jobs of a session task, then
|
|
* puts it back to the wait queue in a clean state, or
|
|
* cleans up its resources if it must be deleted. Returns
|
|
* the time the task accepts to wait, or -1 for infinity
|
|
*/
|
|
int process_session(struct task *t) {
|
|
struct session *s = t->context;
|
|
int fsm_resync = 0;
|
|
|
|
do {
|
|
fsm_resync = 0;
|
|
//fprintf(stderr,"before_cli:cli=%d, srv=%d\n", t->cli_state, t->srv_state);
|
|
fsm_resync |= process_cli(s);
|
|
//fprintf(stderr,"cli/srv:cli=%d, srv=%d\n", t->cli_state, t->srv_state);
|
|
fsm_resync |= process_srv(s);
|
|
//fprintf(stderr,"after_srv:cli=%d, srv=%d\n", t->cli_state, t->srv_state);
|
|
} while (fsm_resync);
|
|
|
|
if (s->cli_state != CL_STCLOSE || s->srv_state != SV_STCLOSE) {
|
|
struct timeval min1, min2;
|
|
s->res_cw = s->res_cr = s->res_sw = s->res_sr = RES_SILENT;
|
|
|
|
tv_min(&min1, &s->crexpire, &s->cwexpire);
|
|
tv_min(&min2, &s->srexpire, &s->swexpire);
|
|
tv_min(&min1, &min1, &s->cnexpire);
|
|
tv_min(&t->expire, &min1, &min2);
|
|
|
|
/* restore t to its place in the task list */
|
|
task_queue(t);
|
|
|
|
return tv_remain(&now, &t->expire); /* nothing more to do */
|
|
}
|
|
|
|
s->proxy->nbconn--;
|
|
actconn--;
|
|
|
|
if ((global.mode & MODE_DEBUG) && (!(global.mode & MODE_QUIET) || (global.mode & MODE_VERBOSE))) {
|
|
int len;
|
|
len = sprintf(trash, "%08x:%s.closed[%04x:%04x]\n", s->uniq_id, s->proxy->id, (unsigned short)s->cli_fd, (unsigned short)s->srv_fd);
|
|
write(1, trash, len);
|
|
}
|
|
|
|
s->logs.t_close = tv_diff(&s->logs.tv_accept, &now);
|
|
if (s->rep != NULL)
|
|
s->logs.bytes = s->rep->total;
|
|
|
|
/* let's do a final log if we need it */
|
|
if (s->logs.logwait && (!(s->proxy->options & PR_O_NULLNOLOG) || s->req->total))
|
|
sess_log(s);
|
|
|
|
/* the task MUST not be in the run queue anymore */
|
|
task_delete(t);
|
|
session_free(s);
|
|
task_free(t);
|
|
return -1; /* rest in peace for eternity */
|
|
}
|
|
|
|
|
|
|
|
/*
|
|
* manages a server health-check. Returns
|
|
* the time the task accepts to wait, or -1 for infinity.
|
|
*/
|
|
int process_chk(struct task *t) {
|
|
struct server *s = t->context;
|
|
struct sockaddr_in sa;
|
|
int fd = s->curfd;
|
|
|
|
//fprintf(stderr, "process_chk: task=%p\n", t);
|
|
|
|
if (fd < 0) { /* no check currently running */
|
|
//fprintf(stderr, "process_chk: 2\n");
|
|
if (tv_cmp2_ms(&t->expire, &now) > 0) { /* not good time yet */
|
|
task_queue(t); /* restore t to its place in the task list */
|
|
return tv_remain(&now, &t->expire);
|
|
}
|
|
|
|
/* we'll initiate a new check */
|
|
s->result = 0; /* no result yet */
|
|
if ((fd = socket(AF_INET, SOCK_STREAM, IPPROTO_TCP)) != -1) {
|
|
if ((fd < global.maxsock) &&
|
|
(fcntl(fd, F_SETFL, O_NONBLOCK) != -1) &&
|
|
(setsockopt(fd, IPPROTO_TCP, TCP_NODELAY, (char *) &one, sizeof(one)) != -1)) {
|
|
//fprintf(stderr, "process_chk: 3\n");
|
|
|
|
/* we'll connect to the check port on the server */
|
|
sa = s->addr;
|
|
sa.sin_port = htons(s->check_port);
|
|
|
|
/* allow specific binding :
|
|
* - server-specific at first
|
|
* - proxy-specific next
|
|
*/
|
|
if (s->state & SRV_BIND_SRC) {
|
|
setsockopt(fd, SOL_SOCKET, SO_REUSEADDR, (char *) &one, sizeof(one));
|
|
if (bind(fd, (struct sockaddr *)&s->source_addr, sizeof(s->source_addr)) == -1) {
|
|
Alert("Cannot bind to source address before connect() for server %s/%s. Aborting.\n",
|
|
s->proxy->id, s->id);
|
|
s->result = -1;
|
|
}
|
|
}
|
|
else if (s->proxy->options & PR_O_BIND_SRC) {
|
|
setsockopt(fd, SOL_SOCKET, SO_REUSEADDR, (char *) &one, sizeof(one));
|
|
if (bind(fd, (struct sockaddr *)&s->proxy->source_addr, sizeof(s->proxy->source_addr)) == -1) {
|
|
Alert("Cannot bind to source address before connect() for proxy %s. Aborting.\n",
|
|
s->proxy->id);
|
|
s->result = -1;
|
|
}
|
|
}
|
|
|
|
if (!s->result) {
|
|
if ((connect(fd, (struct sockaddr *)&sa, sizeof(sa)) != -1) || (errno == EINPROGRESS)) {
|
|
/* OK, connection in progress or established */
|
|
|
|
//fprintf(stderr, "process_chk: 4\n");
|
|
|
|
s->curfd = fd; /* that's how we know a test is in progress ;-) */
|
|
fdtab[fd].owner = t;
|
|
fdtab[fd].read = &event_srv_chk_r;
|
|
fdtab[fd].write = &event_srv_chk_w;
|
|
fdtab[fd].state = FD_STCONN; /* connection in progress */
|
|
FD_SET(fd, StaticWriteEvent); /* for connect status */
|
|
fd_insert(fd);
|
|
/* FIXME: we allow up to <inter> for a connection to establish, but we should use another parameter */
|
|
tv_delayfrom(&t->expire, &now, s->inter);
|
|
task_queue(t); /* restore t to its place in the task list */
|
|
return tv_remain(&now, &t->expire);
|
|
}
|
|
else if (errno != EALREADY && errno != EISCONN && errno != EAGAIN) {
|
|
s->result = -1; /* a real error */
|
|
}
|
|
}
|
|
}
|
|
close(fd); /* socket creation error */
|
|
}
|
|
|
|
if (!s->result) { /* nothing done */
|
|
//fprintf(stderr, "process_chk: 6\n");
|
|
tv_delayfrom(&t->expire, &now, s->inter);
|
|
task_queue(t); /* restore t to its place in the task list */
|
|
return tv_remain(&now, &t->expire);
|
|
}
|
|
|
|
/* here, we have seen a failure */
|
|
if (s->health > s->rise)
|
|
s->health--; /* still good */
|
|
else {
|
|
s->state &= ~SRV_RUNNING;
|
|
if (s->health == s->rise) {
|
|
Warning("Server %s/%s DOWN.\n", s->proxy->id, s->id);
|
|
send_log(s->proxy, LOG_ALERT, "Server %s/%s is DOWN.\n", s->proxy->id, s->id);
|
|
|
|
if (find_server(s->proxy) == NULL) {
|
|
Alert("Proxy %s has no server available !\n", s->proxy->id);
|
|
send_log(s->proxy, LOG_EMERG, "Proxy %s has no server available !\n", s->proxy->id);
|
|
}
|
|
}
|
|
s->health = 0; /* failure */
|
|
}
|
|
|
|
//fprintf(stderr, "process_chk: 7\n");
|
|
/* FIXME: we allow up to <inter> for a connection to establish, but we should use another parameter */
|
|
tv_delayfrom(&t->expire, &now, s->inter);
|
|
}
|
|
else {
|
|
//fprintf(stderr, "process_chk: 8\n");
|
|
/* there was a test running */
|
|
if (s->result > 0) { /* good server detected */
|
|
//fprintf(stderr, "process_chk: 9\n");
|
|
s->health++; /* was bad, stays for a while */
|
|
if (s->health >= s->rise) {
|
|
if (s->health == s->rise) {
|
|
Warning("server %s/%s UP.\n", s->proxy->id, s->id);
|
|
send_log(s->proxy, LOG_NOTICE, "Server %s/%s is UP.\n", s->proxy->id, s->id);
|
|
}
|
|
|
|
s->health = s->rise + s->fall - 1; /* OK now */
|
|
s->state |= SRV_RUNNING;
|
|
}
|
|
s->curfd = -1; /* no check running anymore */
|
|
//FD_CLR(fd, StaticWriteEvent);
|
|
fd_delete(fd);
|
|
tv_delayfrom(&t->expire, &now, s->inter);
|
|
}
|
|
else if (s->result < 0 || tv_cmp2_ms(&t->expire, &now) <= 0) {
|
|
//fprintf(stderr, "process_chk: 10\n");
|
|
/* failure or timeout detected */
|
|
if (s->health > s->rise)
|
|
s->health--; /* still good */
|
|
else {
|
|
s->state &= ~SRV_RUNNING;
|
|
|
|
if (s->health == s->rise) {
|
|
Warning("Server %s/%s DOWN.\n", s->proxy->id, s->id);
|
|
send_log(s->proxy, LOG_ALERT, "Server %s/%s is DOWN.\n", s->proxy->id, s->id);
|
|
|
|
if (find_server(s->proxy) == NULL) {
|
|
Alert("Proxy %s has no server available !\n", s->proxy->id);
|
|
send_log(s->proxy, LOG_EMERG, "Proxy %s has no server available !\n", s->proxy->id);
|
|
}
|
|
}
|
|
|
|
s->health = 0; /* failure */
|
|
}
|
|
s->curfd = -1;
|
|
//FD_CLR(fd, StaticWriteEvent);
|
|
fd_delete(fd);
|
|
tv_delayfrom(&t->expire, &now, s->inter);
|
|
}
|
|
/* if result is 0 and there's no timeout, we have to wait again */
|
|
}
|
|
//fprintf(stderr, "process_chk: 11\n");
|
|
s->result = 0;
|
|
task_queue(t); /* restore t to its place in the task list */
|
|
return tv_remain(&now, &t->expire);
|
|
}
|
|
|
|
|
|
|
|
#if STATTIME > 0
|
|
int stats(void);
|
|
#endif
|
|
|
|
/*
|
|
* This does 4 things :
|
|
* - wake up all expired tasks
|
|
* - call all runnable tasks
|
|
* - call maintain_proxies() to enable/disable the listeners
|
|
* - return the delay till next event in ms, -1 = wait indefinitely
|
|
* Note: this part should be rewritten with the O(ln(n)) scheduler.
|
|
*
|
|
*/
|
|
|
|
int process_runnable_tasks() {
|
|
int next_time;
|
|
int time2;
|
|
struct task *t, *tnext;
|
|
|
|
next_time = -1; /* set the timer to wait eternally first */
|
|
|
|
/* look for expired tasks and add them to the run queue.
|
|
*/
|
|
tnext = ((struct task *)LIST_HEAD(wait_queue))->next;
|
|
while ((t = tnext) != LIST_HEAD(wait_queue)) { /* we haven't looped ? */
|
|
tnext = t->next;
|
|
if (t->state & TASK_RUNNING)
|
|
continue;
|
|
|
|
/* wakeup expired entries. It doesn't matter if they are
|
|
* already running because of a previous event
|
|
*/
|
|
if (tv_cmp2_ms(&t->expire, &now) <= 0) {
|
|
task_wakeup(&rq, t);
|
|
}
|
|
else {
|
|
/* first non-runnable task. Use its expiration date as an upper bound */
|
|
int temp_time = tv_remain(&now, &t->expire);
|
|
if (temp_time)
|
|
next_time = temp_time;
|
|
break;
|
|
}
|
|
}
|
|
|
|
/* process each task in the run queue now. Each task may be deleted
|
|
* since we only use tnext.
|
|
*/
|
|
tnext = rq;
|
|
while ((t = tnext) != NULL) {
|
|
int temp_time;
|
|
|
|
tnext = t->rqnext;
|
|
task_sleep(&rq, t);
|
|
temp_time = t->process(t);
|
|
next_time = MINTIME(temp_time, next_time);
|
|
}
|
|
|
|
/* maintain all proxies in a consistent state. This should quickly become a task */
|
|
time2 = maintain_proxies();
|
|
return MINTIME(time2, next_time);
|
|
}
|
|
|
|
|
|
#if defined(ENABLE_EPOLL)
|
|
|
|
/*
|
|
* Main epoll() loop.
|
|
*/
|
|
|
|
/* does 3 actions :
|
|
* 0 (POLL_LOOP_ACTION_INIT) : initializes necessary private structures
|
|
* 1 (POLL_LOOP_ACTION_RUN) : runs the loop
|
|
* 2 (POLL_LOOP_ACTION_CLEAN) : cleans up
|
|
*
|
|
* returns 0 if initialization failed, !0 otherwise.
|
|
*/
|
|
|
|
int epoll_loop(int action) {
|
|
int next_time;
|
|
int status;
|
|
int fd;
|
|
|
|
int fds, count;
|
|
int pr, pw, sr, sw;
|
|
unsigned rn, ro, wn, wo; /* read new, read old, write new, write old */
|
|
struct epoll_event ev;
|
|
|
|
/* private data */
|
|
static struct epoll_event *epoll_events = NULL;
|
|
static int epoll_fd;
|
|
|
|
if (action == POLL_LOOP_ACTION_INIT) {
|
|
epoll_fd = epoll_create(global.maxsock + 1);
|
|
if (epoll_fd < 0)
|
|
return 0;
|
|
else {
|
|
epoll_events = (struct epoll_event*)
|
|
calloc(1, sizeof(struct epoll_event) * global.maxsock);
|
|
PrevReadEvent = (fd_set *)
|
|
calloc(1, sizeof(fd_set) * (global.maxsock + FD_SETSIZE - 1) / FD_SETSIZE);
|
|
PrevWriteEvent = (fd_set *)
|
|
calloc(1, sizeof(fd_set) * (global.maxsock + FD_SETSIZE - 1) / FD_SETSIZE);
|
|
}
|
|
return 1;
|
|
}
|
|
else if (action == POLL_LOOP_ACTION_CLEAN) {
|
|
if (PrevWriteEvent) free(PrevWriteEvent);
|
|
if (PrevReadEvent) free(PrevReadEvent);
|
|
if (epoll_events) free(epoll_events);
|
|
close(epoll_fd);
|
|
epoll_fd = 0;
|
|
return 1;
|
|
}
|
|
|
|
/* OK, it's POLL_LOOP_ACTION_RUN */
|
|
|
|
tv_now(&now);
|
|
|
|
while (1) {
|
|
next_time = process_runnable_tasks();
|
|
|
|
/* stop when there's no connection left and we don't allow them anymore */
|
|
if (!actconn && listeners == 0)
|
|
break;
|
|
|
|
#if STATTIME > 0
|
|
{
|
|
int time2;
|
|
time2 = stats();
|
|
next_time = MINTIME(time2, next_time);
|
|
}
|
|
#endif
|
|
|
|
for (fds = 0; (fds << INTBITS) < maxfd; fds++) {
|
|
|
|
rn = ((int*)StaticReadEvent)[fds]; ro = ((int*)PrevReadEvent)[fds];
|
|
wn = ((int*)StaticWriteEvent)[fds]; wo = ((int*)PrevWriteEvent)[fds];
|
|
|
|
if ((ro^rn) | (wo^wn)) {
|
|
for (count = 0, fd = fds << INTBITS; count < (1<<INTBITS) && fd < maxfd; count++, fd++) {
|
|
#define FDSETS_ARE_INT_ALIGNED
|
|
#ifdef FDSETS_ARE_INT_ALIGNED
|
|
|
|
#define WE_REALLY_NOW_THAT_FDSETS_ARE_INTS
|
|
#ifdef WE_REALLY_NOW_THAT_FDSETS_ARE_INTS
|
|
pr = (ro >> count) & 1;
|
|
pw = (wo >> count) & 1;
|
|
sr = (rn >> count) & 1;
|
|
sw = (wn >> count) & 1;
|
|
#else
|
|
pr = FD_ISSET(fd&((1<<INTBITS)-1), (typeof(fd_set*))&ro);
|
|
pw = FD_ISSET(fd&((1<<INTBITS)-1), (typeof(fd_set*))&wo);
|
|
sr = FD_ISSET(fd&((1<<INTBITS)-1), (typeof(fd_set*))&rn);
|
|
sw = FD_ISSET(fd&((1<<INTBITS)-1), (typeof(fd_set*))&wn);
|
|
#endif
|
|
#else
|
|
pr = FD_ISSET(fd, PrevReadEvent);
|
|
pw = FD_ISSET(fd, PrevWriteEvent);
|
|
sr = FD_ISSET(fd, StaticReadEvent);
|
|
sw = FD_ISSET(fd, StaticWriteEvent);
|
|
#endif
|
|
if (!((sr^pr) | (sw^pw)))
|
|
continue;
|
|
|
|
ev.events = (sr ? EPOLLIN : 0) | (sw ? EPOLLOUT : 0);
|
|
ev.data.fd = fd;
|
|
|
|
if ((pr | pw)) {
|
|
/* the file-descriptor already exists... */
|
|
if ((sr | sw)) {
|
|
/* ...and it will still exist */
|
|
if (epoll_ctl(epoll_fd, EPOLL_CTL_MOD, fd, &ev) < 0) {
|
|
// perror("epoll_ctl(MOD)");
|
|
// exit(1);
|
|
}
|
|
} else {
|
|
/* ...and it will be removed */
|
|
if (fdtab[fd].state != FD_STCLOSE &&
|
|
epoll_ctl(epoll_fd, EPOLL_CTL_DEL, fd, &ev) < 0) {
|
|
// perror("epoll_ctl(DEL)");
|
|
// exit(1);
|
|
}
|
|
}
|
|
} else {
|
|
/* the file-descriptor did not exist, let's add it */
|
|
if (epoll_ctl(epoll_fd, EPOLL_CTL_ADD, fd, &ev) < 0) {
|
|
// perror("epoll_ctl(ADD)");
|
|
// exit(1);
|
|
}
|
|
}
|
|
}
|
|
((int*)PrevReadEvent)[fds] = rn;
|
|
((int*)PrevWriteEvent)[fds] = wn;
|
|
}
|
|
}
|
|
|
|
/* now let's wait for events */
|
|
status = epoll_wait(epoll_fd, epoll_events, maxfd, next_time);
|
|
tv_now(&now);
|
|
|
|
for (count = 0; count < status; count++) {
|
|
fd = epoll_events[count].data.fd;
|
|
|
|
if (fdtab[fd].state == FD_STCLOSE)
|
|
continue;
|
|
|
|
if (epoll_events[count].events & ( EPOLLIN | EPOLLERR | EPOLLHUP ))
|
|
fdtab[fd].read(fd);
|
|
|
|
if (fdtab[fd].state == FD_STCLOSE)
|
|
continue;
|
|
|
|
if (epoll_events[count].events & ( EPOLLOUT | EPOLLERR | EPOLLHUP ))
|
|
fdtab[fd].write(fd);
|
|
}
|
|
}
|
|
return 1;
|
|
}
|
|
#endif
|
|
|
|
|
|
|
|
#if defined(ENABLE_POLL)
|
|
|
|
/*
|
|
* Main poll() loop.
|
|
*/
|
|
|
|
/* does 3 actions :
|
|
* 0 (POLL_LOOP_ACTION_INIT) : initializes necessary private structures
|
|
* 1 (POLL_LOOP_ACTION_RUN) : runs the loop
|
|
* 2 (POLL_LOOP_ACTION_CLEAN) : cleans up
|
|
*
|
|
* returns 0 if initialization failed, !0 otherwise.
|
|
*/
|
|
|
|
int poll_loop(int action) {
|
|
int next_time;
|
|
int status;
|
|
int fd, nbfd;
|
|
|
|
int fds, count;
|
|
int sr, sw;
|
|
unsigned rn, wn; /* read new, write new */
|
|
|
|
/* private data */
|
|
static struct pollfd *poll_events = NULL;
|
|
|
|
if (action == POLL_LOOP_ACTION_INIT) {
|
|
poll_events = (struct pollfd*)
|
|
calloc(1, sizeof(struct pollfd) * global.maxsock);
|
|
return 1;
|
|
}
|
|
else if (action == POLL_LOOP_ACTION_CLEAN) {
|
|
if (poll_events)
|
|
free(poll_events);
|
|
return 1;
|
|
}
|
|
|
|
/* OK, it's POLL_LOOP_ACTION_RUN */
|
|
|
|
tv_now(&now);
|
|
|
|
while (1) {
|
|
next_time = process_runnable_tasks();
|
|
|
|
/* stop when there's no connection left and we don't allow them anymore */
|
|
if (!actconn && listeners == 0)
|
|
break;
|
|
|
|
#if STATTIME > 0
|
|
{
|
|
int time2;
|
|
time2 = stats();
|
|
next_time = MINTIME(time2, next_time);
|
|
}
|
|
#endif
|
|
|
|
|
|
nbfd = 0;
|
|
for (fds = 0; (fds << INTBITS) < maxfd; fds++) {
|
|
|
|
rn = ((int*)StaticReadEvent)[fds];
|
|
wn = ((int*)StaticWriteEvent)[fds];
|
|
|
|
if ((rn|wn)) {
|
|
for (count = 0, fd = fds << INTBITS; count < (1<<INTBITS) && fd < maxfd; count++, fd++) {
|
|
#define FDSETS_ARE_INT_ALIGNED
|
|
#ifdef FDSETS_ARE_INT_ALIGNED
|
|
|
|
#define WE_REALLY_NOW_THAT_FDSETS_ARE_INTS
|
|
#ifdef WE_REALLY_NOW_THAT_FDSETS_ARE_INTS
|
|
sr = (rn >> count) & 1;
|
|
sw = (wn >> count) & 1;
|
|
#else
|
|
sr = FD_ISSET(fd&((1<<INTBITS)-1), (typeof(fd_set*))&rn);
|
|
sw = FD_ISSET(fd&((1<<INTBITS)-1), (typeof(fd_set*))&wn);
|
|
#endif
|
|
#else
|
|
sr = FD_ISSET(fd, StaticReadEvent);
|
|
sw = FD_ISSET(fd, StaticWriteEvent);
|
|
#endif
|
|
if ((sr|sw)) {
|
|
poll_events[nbfd].fd = fd;
|
|
poll_events[nbfd].events = (sr ? POLLIN : 0) | (sw ? POLLOUT : 0);
|
|
nbfd++;
|
|
}
|
|
}
|
|
}
|
|
}
|
|
|
|
/* now let's wait for events */
|
|
status = poll(poll_events, nbfd, next_time);
|
|
tv_now(&now);
|
|
|
|
for (count = 0; status > 0 && count < nbfd; count++) {
|
|
fd = poll_events[count].fd;
|
|
|
|
if (!poll_events[count].revents & ( POLLOUT | POLLIN | POLLERR | POLLHUP ))
|
|
continue;
|
|
|
|
/* ok, we found one active fd */
|
|
status--;
|
|
|
|
if (fdtab[fd].state == FD_STCLOSE)
|
|
continue;
|
|
|
|
if (poll_events[count].revents & ( POLLIN | POLLERR | POLLHUP ))
|
|
fdtab[fd].read(fd);
|
|
|
|
if (fdtab[fd].state == FD_STCLOSE)
|
|
continue;
|
|
|
|
if (poll_events[count].revents & ( POLLOUT | POLLERR | POLLHUP ))
|
|
fdtab[fd].write(fd);
|
|
}
|
|
}
|
|
return 1;
|
|
}
|
|
#endif
|
|
|
|
|
|
|
|
/*
|
|
* Main select() loop.
|
|
*/
|
|
|
|
/* does 3 actions :
|
|
* 0 (POLL_LOOP_ACTION_INIT) : initializes necessary private structures
|
|
* 1 (POLL_LOOP_ACTION_RUN) : runs the loop
|
|
* 2 (POLL_LOOP_ACTION_CLEAN) : cleans up
|
|
*
|
|
* returns 0 if initialization failed, !0 otherwise.
|
|
*/
|
|
|
|
|
|
int select_loop(int action) {
|
|
int next_time;
|
|
int status;
|
|
int fd,i;
|
|
struct timeval delta;
|
|
int readnotnull, writenotnull;
|
|
static fd_set *ReadEvent = NULL, *WriteEvent = NULL;
|
|
|
|
if (action == POLL_LOOP_ACTION_INIT) {
|
|
ReadEvent = (fd_set *)
|
|
calloc(1, sizeof(fd_set) * (global.maxsock + FD_SETSIZE - 1) / FD_SETSIZE);
|
|
WriteEvent = (fd_set *)
|
|
calloc(1, sizeof(fd_set) * (global.maxsock + FD_SETSIZE - 1) / FD_SETSIZE);
|
|
return 1;
|
|
}
|
|
else if (action == POLL_LOOP_ACTION_CLEAN) {
|
|
if (WriteEvent) free(WriteEvent);
|
|
if (ReadEvent) free(ReadEvent);
|
|
return 1;
|
|
}
|
|
|
|
/* OK, it's POLL_LOOP_ACTION_RUN */
|
|
|
|
tv_now(&now);
|
|
|
|
while (1) {
|
|
next_time = process_runnable_tasks();
|
|
|
|
/* stop when there's no connection left and we don't allow them anymore */
|
|
if (!actconn && listeners == 0)
|
|
break;
|
|
|
|
#if STATTIME > 0
|
|
{
|
|
int time2;
|
|
time2 = stats();
|
|
next_time = MINTIME(time2, next_time);
|
|
}
|
|
#endif
|
|
|
|
if (next_time > 0) { /* FIXME */
|
|
/* Convert to timeval */
|
|
/* to avoid eventual select loops due to timer precision */
|
|
next_time += SCHEDULER_RESOLUTION;
|
|
delta.tv_sec = next_time / 1000;
|
|
delta.tv_usec = (next_time % 1000) * 1000;
|
|
}
|
|
else if (next_time == 0) { /* allow select to return immediately when needed */
|
|
delta.tv_sec = delta.tv_usec = 0;
|
|
}
|
|
|
|
|
|
/* let's restore fdset state */
|
|
|
|
readnotnull = 0; writenotnull = 0;
|
|
for (i = 0; i < (maxfd + FD_SETSIZE - 1)/(8*sizeof(int)); i++) {
|
|
readnotnull |= (*(((int*)ReadEvent)+i) = *(((int*)StaticReadEvent)+i)) != 0;
|
|
writenotnull |= (*(((int*)WriteEvent)+i) = *(((int*)StaticWriteEvent)+i)) != 0;
|
|
}
|
|
|
|
// /* just a verification code, needs to be removed for performance */
|
|
// for (i=0; i<maxfd; i++) {
|
|
// if (FD_ISSET(i, ReadEvent) != FD_ISSET(i, StaticReadEvent))
|
|
// abort();
|
|
// if (FD_ISSET(i, WriteEvent) != FD_ISSET(i, StaticWriteEvent))
|
|
// abort();
|
|
//
|
|
// }
|
|
|
|
status = select(maxfd,
|
|
readnotnull ? ReadEvent : NULL,
|
|
writenotnull ? WriteEvent : NULL,
|
|
NULL,
|
|
(next_time >= 0) ? &delta : NULL);
|
|
|
|
/* this is an experiment on the separation of the select work */
|
|
// status = (readnotnull ? select(maxfd, ReadEvent, NULL, NULL, (next_time >= 0) ? &delta : NULL) : 0);
|
|
// status |= (writenotnull ? select(maxfd, NULL, WriteEvent, NULL, (next_time >= 0) ? &delta : NULL) : 0);
|
|
|
|
tv_now(&now);
|
|
|
|
if (status > 0) { /* must proceed with events */
|
|
|
|
int fds;
|
|
char count;
|
|
|
|
for (fds = 0; (fds << INTBITS) < maxfd; fds++)
|
|
if ((((int *)(ReadEvent))[fds] | ((int *)(WriteEvent))[fds]) != 0)
|
|
for (count = 1<<INTBITS, fd = fds << INTBITS; count && fd < maxfd; count--, fd++) {
|
|
|
|
/* if we specify read first, the accepts and zero reads will be
|
|
* seen first. Moreover, system buffers will be flushed faster.
|
|
*/
|
|
if (fdtab[fd].state == FD_STCLOSE)
|
|
continue;
|
|
|
|
if (FD_ISSET(fd, ReadEvent))
|
|
fdtab[fd].read(fd);
|
|
|
|
if (FD_ISSET(fd, WriteEvent))
|
|
fdtab[fd].write(fd);
|
|
}
|
|
}
|
|
else {
|
|
// fprintf(stderr,"select returned %d, maxfd=%d\n", status, maxfd);
|
|
}
|
|
}
|
|
return 1;
|
|
}
|
|
|
|
|
|
#if STATTIME > 0
|
|
/*
|
|
* Display proxy statistics regularly. It is designed to be called from the
|
|
* select_loop().
|
|
*/
|
|
int stats(void) {
|
|
static int lines;
|
|
static struct timeval nextevt;
|
|
static struct timeval lastevt;
|
|
static struct timeval starttime = {0,0};
|
|
unsigned long totaltime, deltatime;
|
|
int ret;
|
|
|
|
if (tv_cmp(&now, &nextevt) > 0) {
|
|
deltatime = (tv_diff(&lastevt, &now)?:1);
|
|
totaltime = (tv_diff(&starttime, &now)?:1);
|
|
|
|
if (global.mode & MODE_STATS) {
|
|
if ((lines++ % 16 == 0) && !(global.mode & MODE_LOG))
|
|
qfprintf(stderr,
|
|
"\n active total tsknew tskgood tskleft tskrght tsknsch tsklsch tskrsch\n");
|
|
if (lines>1) {
|
|
qfprintf(stderr,"%07d %07d %07d %07d %07d %07d %07d %07d %07d\n",
|
|
actconn, totalconn,
|
|
stats_tsk_new, stats_tsk_good,
|
|
stats_tsk_left, stats_tsk_right,
|
|
stats_tsk_nsrch, stats_tsk_lsrch, stats_tsk_rsrch);
|
|
}
|
|
}
|
|
|
|
tv_delayfrom(&nextevt, &now, STATTIME);
|
|
|
|
lastevt=now;
|
|
}
|
|
ret = tv_remain(&now, &nextevt);
|
|
return ret;
|
|
}
|
|
#endif
|
|
|
|
|
|
/*
|
|
* this function enables proxies when there are enough free sessions,
|
|
* or stops them when the table is full. It is designed to be called from the
|
|
* select_loop(). It returns the time left before next expiration event
|
|
* during stop time, -1 otherwise.
|
|
*/
|
|
static int maintain_proxies(void) {
|
|
struct proxy *p;
|
|
struct listener *l;
|
|
int tleft; /* time left */
|
|
|
|
p = proxy;
|
|
tleft = -1; /* infinite time */
|
|
|
|
/* if there are enough free sessions, we'll activate proxies */
|
|
if (actconn < global.maxconn) {
|
|
while (p) {
|
|
if (p->nbconn < p->maxconn) {
|
|
if (p->state == PR_STIDLE) {
|
|
for (l = p->listen; l != NULL; l = l->next) {
|
|
FD_SET(l->fd, StaticReadEvent);
|
|
}
|
|
p->state = PR_STRUN;
|
|
}
|
|
}
|
|
else {
|
|
if (p->state == PR_STRUN) {
|
|
for (l = p->listen; l != NULL; l = l->next) {
|
|
FD_CLR(l->fd, StaticReadEvent);
|
|
}
|
|
p->state = PR_STIDLE;
|
|
}
|
|
}
|
|
p = p->next;
|
|
}
|
|
}
|
|
else { /* block all proxies */
|
|
while (p) {
|
|
if (p->state == PR_STRUN) {
|
|
for (l = p->listen; l != NULL; l = l->next) {
|
|
FD_CLR(l->fd, StaticReadEvent);
|
|
}
|
|
p->state = PR_STIDLE;
|
|
}
|
|
p = p->next;
|
|
}
|
|
}
|
|
|
|
if (stopping) {
|
|
p = proxy;
|
|
while (p) {
|
|
if (p->state != PR_STDISABLED) {
|
|
int t;
|
|
t = tv_remain(&now, &p->stop_time);
|
|
if (t == 0) {
|
|
Warning("Proxy %s stopped.\n", p->id);
|
|
send_log(p, LOG_WARNING, "Proxy %s stopped.\n", p->id);
|
|
|
|
for (l = p->listen; l != NULL; l = l->next) {
|
|
fd_delete(l->fd);
|
|
listeners--;
|
|
}
|
|
p->state = PR_STDISABLED;
|
|
}
|
|
else {
|
|
tleft = MINTIME(t, tleft);
|
|
}
|
|
}
|
|
p = p->next;
|
|
}
|
|
}
|
|
return tleft;
|
|
}
|
|
|
|
/*
|
|
* this function disables health-check servers so that the process will quickly be ignored
|
|
* by load balancers.
|
|
*/
|
|
static void soft_stop(void) {
|
|
struct proxy *p;
|
|
|
|
stopping = 1;
|
|
p = proxy;
|
|
tv_now(&now); /* else, the old time before select will be used */
|
|
while (p) {
|
|
if (p->state != PR_STDISABLED) {
|
|
Warning("Stopping proxy %s in %d ms.\n", p->id, p->grace);
|
|
send_log(p, LOG_WARNING, "Stopping proxy %s in %d ms.\n", p->id, p->grace);
|
|
tv_delayfrom(&p->stop_time, &now, p->grace);
|
|
}
|
|
p = p->next;
|
|
}
|
|
}
|
|
|
|
/*
|
|
* upon SIGUSR1, let's have a soft stop.
|
|
*/
|
|
void sig_soft_stop(int sig) {
|
|
soft_stop();
|
|
signal(sig, SIG_IGN);
|
|
}
|
|
|
|
|
|
/*
|
|
* this function dumps every server's state when the process receives SIGHUP.
|
|
*/
|
|
void sig_dump_state(int sig) {
|
|
struct proxy *p = proxy;
|
|
|
|
Warning("SIGHUP received, dumping servers states.\n");
|
|
while (p) {
|
|
struct server *s = p->srv;
|
|
|
|
send_log(p, LOG_NOTICE, "SIGUP received, dumping servers states.\n");
|
|
while (s) {
|
|
if (s->state & SRV_RUNNING) {
|
|
Warning("SIGHUP: server %s/%s is UP.\n", p->id, s->id);
|
|
send_log(p, LOG_NOTICE, "SIGUP: server %s/%s is UP.\n", p->id, s->id);
|
|
}
|
|
else {
|
|
Warning("SIGHUP: server %s/%s is DOWN.\n", p->id, s->id);
|
|
send_log(p, LOG_NOTICE, "SIGHUP: server %s/%s is DOWN.\n", p->id, s->id);
|
|
}
|
|
s = s->next;
|
|
}
|
|
|
|
if (find_server(p) == NULL) {
|
|
Warning("SIGHUP: proxy %s has no server available !\n", p);
|
|
send_log(p, LOG_NOTICE, "SIGHUP: proxy %s has no server available !\n", p);
|
|
}
|
|
|
|
p = p->next;
|
|
}
|
|
signal(sig, sig_dump_state);
|
|
}
|
|
|
|
void dump(int sig) {
|
|
struct task *t, *tnext;
|
|
struct session *s;
|
|
|
|
tnext = ((struct task *)LIST_HEAD(wait_queue))->next;
|
|
while ((t = tnext) != LIST_HEAD(wait_queue)) { /* we haven't looped ? */
|
|
tnext = t->next;
|
|
s = t->context;
|
|
qfprintf(stderr,"[dump] wq: task %p, still %ld ms, "
|
|
"cli=%d, srv=%d, cr=%d, cw=%d, sr=%d, sw=%d, "
|
|
"req=%d, rep=%d, clifd=%d\n",
|
|
s, tv_remain(&now, &t->expire),
|
|
s->cli_state,
|
|
s->srv_state,
|
|
FD_ISSET(s->cli_fd, StaticReadEvent),
|
|
FD_ISSET(s->cli_fd, StaticWriteEvent),
|
|
FD_ISSET(s->srv_fd, StaticReadEvent),
|
|
FD_ISSET(s->srv_fd, StaticWriteEvent),
|
|
s->req->l, s->rep?s->rep->l:0, s->cli_fd
|
|
);
|
|
}
|
|
}
|
|
|
|
#ifdef DEBUG_MEMORY
|
|
static void fast_stop(void)
|
|
{
|
|
struct proxy *p;
|
|
p = proxy;
|
|
while (p) {
|
|
p->grace = 0;
|
|
p = p->next;
|
|
}
|
|
soft_stop();
|
|
}
|
|
|
|
void sig_int(int sig) {
|
|
/* This would normally be a hard stop,
|
|
but we want to be sure about deallocation,
|
|
and so on, so we do a soft stop with
|
|
0 GRACE time
|
|
*/
|
|
fast_stop();
|
|
/* If we are killed twice, we decide to die*/
|
|
signal(sig, SIG_DFL);
|
|
}
|
|
|
|
void sig_term(int sig) {
|
|
/* This would normally be a hard stop,
|
|
but we want to be sure about deallocation,
|
|
and so on, so we do a soft stop with
|
|
0 GRACE time
|
|
*/
|
|
fast_stop();
|
|
/* If we are killed twice, we decide to die*/
|
|
signal(sig, SIG_DFL);
|
|
}
|
|
#endif
|
|
|
|
/* returns the pointer to an error in the replacement string, or NULL if OK */
|
|
char *chain_regex(struct hdr_exp **head, regex_t *preg, int action, char *replace) {
|
|
struct hdr_exp *exp;
|
|
|
|
if (replace != NULL) {
|
|
char *err;
|
|
err = check_replace_string(replace);
|
|
if (err)
|
|
return err;
|
|
}
|
|
|
|
while (*head != NULL)
|
|
head = &(*head)->next;
|
|
|
|
exp = calloc(1, sizeof(struct hdr_exp));
|
|
|
|
exp->preg = preg;
|
|
exp->replace = replace;
|
|
exp->action = action;
|
|
*head = exp;
|
|
|
|
return NULL;
|
|
}
|
|
|
|
|
|
/*
|
|
* parse a line in a <global> section. Returns 0 if OK, -1 if error.
|
|
*/
|
|
int cfg_parse_global(char *file, int linenum, char **args) {
|
|
|
|
if (!strcmp(args[0], "global")) { /* new section */
|
|
/* no option, nothing special to do */
|
|
return 0;
|
|
}
|
|
else if (!strcmp(args[0], "daemon")) {
|
|
global.mode |= MODE_DAEMON;
|
|
}
|
|
else if (!strcmp(args[0], "debug")) {
|
|
global.mode |= MODE_DEBUG;
|
|
}
|
|
else if (!strcmp(args[0], "noepoll")) {
|
|
cfg_polling_mechanism &= ~POLL_USE_EPOLL;
|
|
}
|
|
else if (!strcmp(args[0], "nopoll")) {
|
|
cfg_polling_mechanism &= ~POLL_USE_POLL;
|
|
}
|
|
else if (!strcmp(args[0], "quiet")) {
|
|
global.mode |= MODE_QUIET;
|
|
}
|
|
else if (!strcmp(args[0], "stats")) {
|
|
global.mode |= MODE_STATS;
|
|
}
|
|
else if (!strcmp(args[0], "uid")) {
|
|
if (global.uid != 0) {
|
|
Alert("parsing [%s:%d] : '%s' already specified. Continuing.\n", file, linenum, args[0]);
|
|
return 0;
|
|
}
|
|
if (*(args[1]) == 0) {
|
|
Alert("parsing [%s:%d] : '%s' expects an integer argument.\n", file, linenum, args[0]);
|
|
return -1;
|
|
}
|
|
global.uid = atol(args[1]);
|
|
}
|
|
else if (!strcmp(args[0], "gid")) {
|
|
if (global.gid != 0) {
|
|
Alert("parsing [%s:%d] : '%s' already specified. Continuing.\n", file, linenum, args[0]);
|
|
return 0;
|
|
}
|
|
if (*(args[1]) == 0) {
|
|
Alert("parsing [%s:%d] : '%s' expects an integer argument.\n", file, linenum, args[0]);
|
|
return -1;
|
|
}
|
|
global.gid = atol(args[1]);
|
|
}
|
|
else if (!strcmp(args[0], "nbproc")) {
|
|
if (global.nbproc != 0) {
|
|
Alert("parsing [%s:%d] : '%s' already specified. Continuing.\n", file, linenum, args[0]);
|
|
return 0;
|
|
}
|
|
if (*(args[1]) == 0) {
|
|
Alert("parsing [%s:%d] : '%s' expects an integer argument.\n", file, linenum, args[0]);
|
|
return -1;
|
|
}
|
|
global.nbproc = atol(args[1]);
|
|
}
|
|
else if (!strcmp(args[0], "maxconn")) {
|
|
if (global.maxconn != 0) {
|
|
Alert("parsing [%s:%d] : '%s' already specified. Continuing.\n", file, linenum, args[0]);
|
|
return 0;
|
|
}
|
|
if (*(args[1]) == 0) {
|
|
Alert("parsing [%s:%d] : '%s' expects an integer argument.\n", file, linenum, args[0]);
|
|
return -1;
|
|
}
|
|
global.maxconn = atol(args[1]);
|
|
}
|
|
else if (!strcmp(args[0], "chroot")) {
|
|
if (global.chroot != NULL) {
|
|
Alert("parsing [%s:%d] : '%s' already specified. Continuing.\n", file, linenum, args[0]);
|
|
return 0;
|
|
}
|
|
if (*(args[1]) == 0) {
|
|
Alert("parsing [%s:%d] : '%s' expects a directory as an argument.\n", file, linenum, args[0]);
|
|
return -1;
|
|
}
|
|
global.chroot = strdup(args[1]);
|
|
}
|
|
else if (!strcmp(args[0], "pidfile")) {
|
|
if (global.pidfile != NULL) {
|
|
Alert("parsing [%s:%d] : '%s' already specified. Continuing.\n", file, linenum, args[0]);
|
|
return 0;
|
|
}
|
|
if (*(args[1]) == 0) {
|
|
Alert("parsing [%s:%d] : '%s' expects a file name as an argument.\n", file, linenum, args[0]);
|
|
return -1;
|
|
}
|
|
global.pidfile = strdup(args[1]);
|
|
}
|
|
else if (!strcmp(args[0], "log")) { /* syslog server address */
|
|
struct sockaddr_in *sa;
|
|
int facility, level;
|
|
|
|
if (*(args[1]) == 0 || *(args[2]) == 0) {
|
|
Alert("parsing [%s:%d] : '%s' expects <address> and <facility> as arguments.\n", file, linenum, args[0]);
|
|
return -1;
|
|
}
|
|
|
|
for (facility = 0; facility < NB_LOG_FACILITIES; facility++)
|
|
if (!strcmp(log_facilities[facility], args[2]))
|
|
break;
|
|
|
|
if (facility >= NB_LOG_FACILITIES) {
|
|
Alert("parsing [%s:%d] : unknown log facility '%s'\n", file, linenum, args[2]);
|
|
exit(1);
|
|
}
|
|
|
|
level = 7; /* max syslog level = debug */
|
|
if (*(args[3])) {
|
|
while (level >= 0 && strcmp(log_levels[level], args[3]))
|
|
level--;
|
|
if (level < 0) {
|
|
Alert("parsing [%s:%d] : unknown optional log level '%s'\n", file, linenum, args[3]);
|
|
exit(1);
|
|
}
|
|
}
|
|
|
|
sa = str2sa(args[1]);
|
|
if (!sa->sin_port)
|
|
sa->sin_port = htons(SYSLOG_PORT);
|
|
|
|
if (global.logfac1 == -1) {
|
|
global.logsrv1 = *sa;
|
|
global.logfac1 = facility;
|
|
global.loglev1 = level;
|
|
}
|
|
else if (global.logfac2 == -1) {
|
|
global.logsrv2 = *sa;
|
|
global.logfac2 = facility;
|
|
global.loglev2 = level;
|
|
}
|
|
else {
|
|
Alert("parsing [%s:%d] : too many syslog servers\n", file, linenum);
|
|
return -1;
|
|
}
|
|
|
|
}
|
|
else {
|
|
Alert("parsing [%s:%d] : unknown keyword '%s' in '%s' section\n", file, linenum, args[0], "global");
|
|
return -1;
|
|
}
|
|
return 0;
|
|
}
|
|
|
|
|
|
void init_default_instance() {
|
|
memset(&defproxy, 0, sizeof(defproxy));
|
|
defproxy.mode = PR_MODE_TCP;
|
|
defproxy.state = PR_STNEW;
|
|
defproxy.maxconn = cfg_maxpconn;
|
|
defproxy.conn_retries = CONN_RETRIES;
|
|
defproxy.logfac1 = defproxy.logfac2 = -1; /* log disabled */
|
|
}
|
|
|
|
/*
|
|
* parse a line in a <listen> section. Returns 0 if OK, -1 if error.
|
|
*/
|
|
int cfg_parse_listen(char *file, int linenum, char **args) {
|
|
static struct proxy *curproxy = NULL;
|
|
struct server *newsrv = NULL;
|
|
char *err;
|
|
int rc;
|
|
|
|
if (!strcmp(args[0], "listen")) { /* new proxy */
|
|
if (!*args[1]) {
|
|
Alert("parsing [%s:%d] : '%s' expects an <id> argument and\n"
|
|
" optionnally supports [addr1]:port1[-end1]{,[addr]:port[-end]}...\n",
|
|
file, linenum, args[0]);
|
|
return -1;
|
|
}
|
|
|
|
if ((curproxy = (struct proxy *)calloc(1, sizeof(struct proxy))) == NULL) {
|
|
Alert("parsing [%s:%d] : out of memory.\n", file, linenum);
|
|
return -1;
|
|
}
|
|
curproxy->next = proxy;
|
|
proxy = curproxy;
|
|
curproxy->id = strdup(args[1]);
|
|
if (strchr(args[2], ':') != NULL)
|
|
curproxy->listen = str2listener(args[2], curproxy->listen);
|
|
|
|
/* set default values */
|
|
curproxy->state = defproxy.state;
|
|
curproxy->maxconn = defproxy.maxconn;
|
|
curproxy->conn_retries = defproxy.conn_retries;
|
|
curproxy->options = defproxy.options;
|
|
|
|
if (defproxy.check_req)
|
|
curproxy->check_req = strdup(defproxy.check_req);
|
|
curproxy->check_len = defproxy.check_len;
|
|
|
|
if (defproxy.cookie_name)
|
|
curproxy->cookie_name = strdup(defproxy.cookie_name);
|
|
curproxy->cookie_len = defproxy.cookie_len;
|
|
|
|
if (defproxy.capture_name)
|
|
curproxy->capture_name = strdup(defproxy.capture_name);
|
|
curproxy->capture_namelen = defproxy.capture_namelen;
|
|
curproxy->capture_len = defproxy.capture_len;
|
|
|
|
if (defproxy.errmsg.msg400)
|
|
curproxy->errmsg.msg400 = strdup(defproxy.errmsg.msg400);
|
|
curproxy->errmsg.len400 = defproxy.errmsg.len400;
|
|
|
|
if (defproxy.errmsg.msg403)
|
|
curproxy->errmsg.msg403 = strdup(defproxy.errmsg.msg403);
|
|
curproxy->errmsg.len403 = defproxy.errmsg.len403;
|
|
|
|
if (defproxy.errmsg.msg408)
|
|
curproxy->errmsg.msg408 = strdup(defproxy.errmsg.msg408);
|
|
curproxy->errmsg.len408 = defproxy.errmsg.len408;
|
|
|
|
if (defproxy.errmsg.msg500)
|
|
curproxy->errmsg.msg500 = strdup(defproxy.errmsg.msg500);
|
|
curproxy->errmsg.len500 = defproxy.errmsg.len500;
|
|
|
|
if (defproxy.errmsg.msg502)
|
|
curproxy->errmsg.msg502 = strdup(defproxy.errmsg.msg502);
|
|
curproxy->errmsg.len502 = defproxy.errmsg.len502;
|
|
|
|
if (defproxy.errmsg.msg503)
|
|
curproxy->errmsg.msg503 = strdup(defproxy.errmsg.msg503);
|
|
curproxy->errmsg.len503 = defproxy.errmsg.len503;
|
|
|
|
if (defproxy.errmsg.msg504)
|
|
curproxy->errmsg.msg504 = strdup(defproxy.errmsg.msg504);
|
|
curproxy->errmsg.len504 = defproxy.errmsg.len504;
|
|
|
|
curproxy->clitimeout = defproxy.clitimeout;
|
|
curproxy->contimeout = defproxy.contimeout;
|
|
curproxy->srvtimeout = defproxy.srvtimeout;
|
|
curproxy->mode = defproxy.mode;
|
|
curproxy->logfac1 = defproxy.logfac1;
|
|
curproxy->logsrv1 = defproxy.logsrv1;
|
|
curproxy->loglev1 = defproxy.loglev1;
|
|
curproxy->logfac2 = defproxy.logfac2;
|
|
curproxy->logsrv2 = defproxy.logsrv2;
|
|
curproxy->loglev2 = defproxy.loglev2;
|
|
curproxy->to_log = defproxy.to_log & ~LW_COOKIE & ~LW_REQHDR & ~ LW_RSPHDR;
|
|
curproxy->grace = defproxy.grace;
|
|
curproxy->source_addr = defproxy.source_addr;
|
|
return 0;
|
|
}
|
|
else if (!strcmp(args[0], "defaults")) { /* use this one to assign default values */
|
|
/* some variables may have already been initialized earlier */
|
|
if (defproxy.check_req) free(defproxy.check_req);
|
|
if (defproxy.cookie_name) free(defproxy.cookie_name);
|
|
if (defproxy.capture_name) free(defproxy.capture_name);
|
|
if (defproxy.errmsg.msg400) free(defproxy.errmsg.msg400);
|
|
if (defproxy.errmsg.msg403) free(defproxy.errmsg.msg403);
|
|
if (defproxy.errmsg.msg408) free(defproxy.errmsg.msg408);
|
|
if (defproxy.errmsg.msg500) free(defproxy.errmsg.msg500);
|
|
if (defproxy.errmsg.msg502) free(defproxy.errmsg.msg502);
|
|
if (defproxy.errmsg.msg503) free(defproxy.errmsg.msg503);
|
|
if (defproxy.errmsg.msg504) free(defproxy.errmsg.msg504);
|
|
|
|
init_default_instance();
|
|
curproxy = &defproxy;
|
|
return 0;
|
|
}
|
|
else if (curproxy == NULL) {
|
|
Alert("parsing [%s:%d] : 'listen' or 'defaults' expected.\n", file, linenum);
|
|
return -1;
|
|
}
|
|
|
|
if (!strcmp(args[0], "bind")) { /* new listen addresses */
|
|
if (curproxy == &defproxy) {
|
|
Alert("parsing [%s:%d] : '%s' not allowed in 'defaults' section.\n", file, linenum, args[0]);
|
|
return -1;
|
|
}
|
|
|
|
if (strchr(args[1], ':') == NULL) {
|
|
Alert("parsing [%s:%d] : '%s' expects [addr1]:port1[-end1]{,[addr]:port[-end]}... as arguments.\n",
|
|
file, linenum, args[0]);
|
|
return -1;
|
|
}
|
|
curproxy->listen = str2listener(args[1], curproxy->listen);
|
|
return 0;
|
|
}
|
|
else if (!strcmp(args[0], "mode")) { /* sets the proxy mode */
|
|
if (!strcmp(args[1], "http")) curproxy->mode = PR_MODE_HTTP;
|
|
else if (!strcmp(args[1], "tcp")) curproxy->mode = PR_MODE_TCP;
|
|
else if (!strcmp(args[1], "health")) curproxy->mode = PR_MODE_HEALTH;
|
|
else {
|
|
Alert("parsing [%s:%d] : unknown proxy mode '%s'.\n", file, linenum, args[1]);
|
|
return -1;
|
|
}
|
|
}
|
|
else if (!strcmp(args[0], "disabled")) { /* disables this proxy */
|
|
curproxy->state = PR_STDISABLED;
|
|
}
|
|
else if (!strcmp(args[0], "enabled")) { /* enables this proxy (used to revert a disabled default) */
|
|
curproxy->state = PR_STNEW;
|
|
}
|
|
else if (!strcmp(args[0], "cookie")) { /* cookie name */
|
|
int cur_arg;
|
|
// if (curproxy == &defproxy) {
|
|
// Alert("parsing [%s:%d] : '%s' not allowed in 'defaults' section.\n", file, linenum, args[0]);
|
|
// return -1;
|
|
// }
|
|
|
|
if (curproxy->cookie_name != NULL) {
|
|
// Alert("parsing [%s:%d] : cookie name already specified. Continuing.\n",
|
|
// file, linenum);
|
|
// return 0;
|
|
free(curproxy->cookie_name);
|
|
}
|
|
|
|
if (*(args[1]) == 0) {
|
|
Alert("parsing [%s:%d] : '%s' expects <cookie_name> as argument.\n",
|
|
file, linenum, args[0]);
|
|
return -1;
|
|
}
|
|
curproxy->cookie_name = strdup(args[1]);
|
|
curproxy->cookie_len = strlen(curproxy->cookie_name);
|
|
|
|
cur_arg = 2;
|
|
while (*(args[cur_arg])) {
|
|
if (!strcmp(args[cur_arg], "rewrite")) {
|
|
curproxy->options |= PR_O_COOK_RW;
|
|
}
|
|
else if (!strcmp(args[cur_arg], "indirect")) {
|
|
curproxy->options |= PR_O_COOK_IND;
|
|
}
|
|
else if (!strcmp(args[cur_arg], "insert")) {
|
|
curproxy->options |= PR_O_COOK_INS;
|
|
}
|
|
else if (!strcmp(args[cur_arg], "nocache")) {
|
|
curproxy->options |= PR_O_COOK_NOC;
|
|
}
|
|
else if (!strcmp(args[cur_arg], "postonly")) {
|
|
curproxy->options |= PR_O_COOK_POST;
|
|
}
|
|
else if (!strcmp(args[cur_arg], "prefix")) {
|
|
curproxy->options |= PR_O_COOK_PFX;
|
|
}
|
|
else {
|
|
Alert("parsing [%s:%d] : '%s' supports 'rewrite', 'insert', 'prefix', 'indirect', 'nocache' and 'postonly' options.\n",
|
|
file, linenum, args[0]);
|
|
return -1;
|
|
}
|
|
cur_arg++;
|
|
}
|
|
if (!POWEROF2(curproxy->options & (PR_O_COOK_RW|PR_O_COOK_IND))) {
|
|
Alert("parsing [%s:%d] : cookie 'rewrite' and 'indirect' modes are incompatible.\n",
|
|
file, linenum);
|
|
return -1;
|
|
}
|
|
|
|
if (!POWEROF2(curproxy->options & (PR_O_COOK_RW|PR_O_COOK_INS|PR_O_COOK_PFX))) {
|
|
Alert("parsing [%s:%d] : cookie 'rewrite', 'insert' and 'prefix' modes are incompatible.\n",
|
|
file, linenum);
|
|
return -1;
|
|
}
|
|
}/* end else if (!strcmp(args[0], "cookie")) */
|
|
else if (!strcmp(args[0], "appsession")) { /* cookie name */
|
|
// if (curproxy == &defproxy) {
|
|
// Alert("parsing [%s:%d] : '%s' not allowed in 'defaults' section.\n", file, linenum, args[0]);
|
|
// return -1;
|
|
// }
|
|
|
|
if (curproxy->appsession_name != NULL) {
|
|
// Alert("parsing [%s:%d] : cookie name already specified. Continuing.\n",
|
|
// file, linenum);
|
|
// return 0;
|
|
free(curproxy->appsession_name);
|
|
}
|
|
|
|
if (*(args[5]) == 0) {
|
|
Alert("parsing [%s:%d] : '%s' expects 'appsession' <cookie_name> 'len' <len> 'timeout' <timeout>.\n",
|
|
file, linenum, args[0]);
|
|
return -1;
|
|
}
|
|
have_appsession = 1;
|
|
curproxy->appsession_name = strdup(args[1]);
|
|
curproxy->appsession_name_len = strlen(curproxy->appsession_name);
|
|
curproxy->appsession_len = atoi(args[3]);
|
|
curproxy->appsession_timeout = atoi(args[5]);
|
|
rc = chtbl_init(&(curproxy->htbl_proxy), TBLSIZ, hashpjw, match_str, destroy);
|
|
if (rc) {
|
|
Alert("Error Init Appsession Hashtable.\n");
|
|
return -1;
|
|
}
|
|
} /* Url App Session */
|
|
else if (!strcmp(args[0], "capture")) {
|
|
if (!strcmp(args[1], "cookie")) { /* name of a cookie to capture */
|
|
// if (curproxy == &defproxy) {
|
|
// Alert("parsing [%s:%d] : '%s' not allowed in 'defaults' section.\n", file, linenum, args[0]);
|
|
// return -1;
|
|
// }
|
|
|
|
if (curproxy->capture_name != NULL) {
|
|
// Alert("parsing [%s:%d] : '%s' already specified. Continuing.\n",
|
|
// file, linenum, args[0]);
|
|
// return 0;
|
|
free(curproxy->capture_name);
|
|
}
|
|
|
|
if (*(args[4]) == 0) {
|
|
Alert("parsing [%s:%d] : '%s' expects 'cookie' <cookie_name> 'len' <len>.\n",
|
|
file, linenum, args[0]);
|
|
return -1;
|
|
}
|
|
curproxy->capture_name = strdup(args[2]);
|
|
curproxy->capture_namelen = strlen(curproxy->capture_name);
|
|
curproxy->capture_len = atol(args[4]);
|
|
if (curproxy->capture_len >= CAPTURE_LEN) {
|
|
Warning("parsing [%s:%d] : truncating capture length to %d bytes.\n",
|
|
file, linenum, CAPTURE_LEN - 1);
|
|
curproxy->capture_len = CAPTURE_LEN - 1;
|
|
}
|
|
curproxy->to_log |= LW_COOKIE;
|
|
}
|
|
else if (!strcmp(args[1], "request") && !strcmp(args[2], "header")) {
|
|
struct cap_hdr *hdr;
|
|
|
|
if (curproxy == &defproxy) {
|
|
Alert("parsing [%s:%d] : '%s %s' not allowed in 'defaults' section.\n", file, linenum, args[0], args[1]);
|
|
return -1;
|
|
}
|
|
|
|
if (*(args[3]) == 0 || strcmp(args[4], "len") != 0 || *(args[5]) == 0) {
|
|
Alert("parsing [%s:%d] : '%s %s' expects 'header' <header_name> 'len' <len>.\n",
|
|
file, linenum, args[0], args[1]);
|
|
return -1;
|
|
}
|
|
|
|
hdr = calloc(sizeof(struct cap_hdr), 1);
|
|
hdr->next = curproxy->req_cap;
|
|
hdr->name = strdup(args[3]);
|
|
hdr->namelen = strlen(args[3]);
|
|
hdr->len = atol(args[5]);
|
|
hdr->index = curproxy->nb_req_cap++;
|
|
curproxy->req_cap = hdr;
|
|
curproxy->to_log |= LW_REQHDR;
|
|
}
|
|
else if (!strcmp(args[1], "response") && !strcmp(args[2], "header")) {
|
|
struct cap_hdr *hdr;
|
|
|
|
if (curproxy == &defproxy) {
|
|
Alert("parsing [%s:%d] : '%s %s' not allowed in 'defaults' section.\n", file, linenum, args[0], args[1]);
|
|
return -1;
|
|
}
|
|
|
|
if (*(args[3]) == 0 || strcmp(args[4], "len") != 0 || *(args[5]) == 0) {
|
|
Alert("parsing [%s:%d] : '%s %s' expects 'header' <header_name> 'len' <len>.\n",
|
|
file, linenum, args[0], args[1]);
|
|
return -1;
|
|
}
|
|
hdr = calloc(sizeof(struct cap_hdr), 1);
|
|
hdr->next = curproxy->rsp_cap;
|
|
hdr->name = strdup(args[3]);
|
|
hdr->namelen = strlen(args[3]);
|
|
hdr->len = atol(args[5]);
|
|
hdr->index = curproxy->nb_rsp_cap++;
|
|
curproxy->rsp_cap = hdr;
|
|
curproxy->to_log |= LW_RSPHDR;
|
|
}
|
|
else {
|
|
Alert("parsing [%s:%d] : '%s' expects 'cookie' or 'request header' or 'response header'.\n",
|
|
file, linenum, args[0]);
|
|
return -1;
|
|
}
|
|
}
|
|
else if (!strcmp(args[0], "contimeout")) { /* connect timeout */
|
|
if (curproxy->contimeout != defproxy.contimeout) {
|
|
Alert("parsing [%s:%d] : '%s' already specified. Continuing.\n", file, linenum, args[0]);
|
|
return 0;
|
|
}
|
|
if (*(args[1]) == 0) {
|
|
Alert("parsing [%s:%d] : '%s' expects an integer <time_in_ms> as argument.\n",
|
|
file, linenum, args[0]);
|
|
return -1;
|
|
}
|
|
curproxy->contimeout = atol(args[1]);
|
|
}
|
|
else if (!strcmp(args[0], "clitimeout")) { /* client timeout */
|
|
if (curproxy->clitimeout != defproxy.clitimeout) {
|
|
Alert("parsing [%s:%d] : '%s' already specified. Continuing.\n",
|
|
file, linenum, args[0]);
|
|
return 0;
|
|
}
|
|
if (*(args[1]) == 0) {
|
|
Alert("parsing [%s:%d] : '%s' expects an integer <time_in_ms> as argument.\n",
|
|
file, linenum, args[0]);
|
|
return -1;
|
|
}
|
|
curproxy->clitimeout = atol(args[1]);
|
|
}
|
|
else if (!strcmp(args[0], "srvtimeout")) { /* server timeout */
|
|
if (curproxy->srvtimeout != defproxy.srvtimeout) {
|
|
Alert("parsing [%s:%d] : '%s' already specified. Continuing.\n", file, linenum, args[0]);
|
|
return 0;
|
|
}
|
|
if (*(args[1]) == 0) {
|
|
Alert("parsing [%s:%d] : '%s' expects an integer <time_in_ms> as argument.\n",
|
|
file, linenum, args[0]);
|
|
return -1;
|
|
}
|
|
curproxy->srvtimeout = atol(args[1]);
|
|
}
|
|
else if (!strcmp(args[0], "retries")) { /* connection retries */
|
|
if (*(args[1]) == 0) {
|
|
Alert("parsing [%s:%d] : '%s' expects an integer argument (dispatch counts for one).\n",
|
|
file, linenum, args[0]);
|
|
return -1;
|
|
}
|
|
curproxy->conn_retries = atol(args[1]);
|
|
}
|
|
else if (!strcmp(args[0], "option")) {
|
|
if (*(args[1]) == 0) {
|
|
Alert("parsing [%s:%d] : '%s' expects an option name.\n", file, linenum, args[0]);
|
|
return -1;
|
|
}
|
|
if (!strcmp(args[1], "redispatch"))
|
|
/* enable reconnections to dispatch */
|
|
curproxy->options |= PR_O_REDISP;
|
|
#ifdef TPROXY
|
|
else if (!strcmp(args[1], "transparent"))
|
|
/* enable transparent proxy connections */
|
|
curproxy->options |= PR_O_TRANSP;
|
|
#endif
|
|
else if (!strcmp(args[1], "keepalive"))
|
|
/* enable keep-alive */
|
|
curproxy->options |= PR_O_KEEPALIVE;
|
|
else if (!strcmp(args[1], "forwardfor"))
|
|
/* insert x-forwarded-for field */
|
|
curproxy->options |= PR_O_FWDFOR;
|
|
else if (!strcmp(args[1], "logasap"))
|
|
/* log as soon as possible, without waiting for the session to complete */
|
|
curproxy->options |= PR_O_LOGASAP;
|
|
else if (!strcmp(args[1], "httpclose"))
|
|
/* force connection: close in both directions in HTTP mode */
|
|
curproxy->options |= PR_O_HTTP_CLOSE;
|
|
else if (!strcmp(args[1], "checkcache"))
|
|
/* require examination of cacheability of the 'set-cookie' field */
|
|
curproxy->options |= PR_O_CHK_CACHE;
|
|
else if (!strcmp(args[1], "httplog"))
|
|
/* generate a complete HTTP log */
|
|
curproxy->to_log |= LW_DATE | LW_CLIP | LW_SVID | LW_REQ | LW_PXID | LW_RESP | LW_BYTES;
|
|
else if (!strcmp(args[1], "tcplog"))
|
|
/* generate a detailed TCP log */
|
|
curproxy->to_log |= LW_DATE | LW_CLIP | LW_SVID | LW_PXID | LW_BYTES;
|
|
else if (!strcmp(args[1], "dontlognull")) {
|
|
/* don't log empty requests */
|
|
curproxy->options |= PR_O_NULLNOLOG;
|
|
}
|
|
else if (!strcmp(args[1], "httpchk")) {
|
|
/* use HTTP request to check servers' health */
|
|
if (curproxy->check_req != NULL) {
|
|
free(curproxy->check_req);
|
|
}
|
|
curproxy->options |= PR_O_HTTP_CHK;
|
|
if (!*args[2]) { /* no argument */
|
|
curproxy->check_req = strdup(DEF_CHECK_REQ); /* default request */
|
|
curproxy->check_len = strlen(DEF_CHECK_REQ);
|
|
} else if (!*args[3]) { /* one argument : URI */
|
|
int reqlen = strlen(args[2]) + strlen("OPTIONS / HTTP/1.0\r\n\r\n");
|
|
curproxy->check_req = (char *)malloc(reqlen);
|
|
curproxy->check_len = snprintf(curproxy->check_req, reqlen,
|
|
"OPTIONS %s HTTP/1.0\r\n\r\n", args[2]); /* URI to use */
|
|
} else { /* more arguments : METHOD URI [HTTP_VER] */
|
|
int reqlen = strlen(args[2]) + strlen(args[3]) + 3 + strlen("\r\n\r\n");
|
|
if (*args[4])
|
|
reqlen += strlen(args[4]);
|
|
else
|
|
reqlen += strlen("HTTP/1.0");
|
|
|
|
curproxy->check_req = (char *)malloc(reqlen);
|
|
curproxy->check_len = snprintf(curproxy->check_req, reqlen,
|
|
"%s %s %s\r\n\r\n", args[2], args[3], *args[4]?args[4]:"HTTP/1.0");
|
|
}
|
|
}
|
|
else if (!strcmp(args[1], "persist")) {
|
|
/* persist on using the server specified by the cookie, even when it's down */
|
|
curproxy->options |= PR_O_PERSIST;
|
|
}
|
|
else {
|
|
Alert("parsing [%s:%d] : unknown option '%s'.\n", file, linenum, args[1]);
|
|
return -1;
|
|
}
|
|
return 0;
|
|
}
|
|
else if (!strcmp(args[0], "redispatch") || !strcmp(args[0], "redisp")) {
|
|
/* enable reconnections to dispatch */
|
|
curproxy->options |= PR_O_REDISP;
|
|
}
|
|
#ifdef TPROXY
|
|
else if (!strcmp(args[0], "transparent")) {
|
|
/* enable transparent proxy connections */
|
|
curproxy->options |= PR_O_TRANSP;
|
|
}
|
|
#endif
|
|
else if (!strcmp(args[0], "maxconn")) { /* maxconn */
|
|
if (*(args[1]) == 0) {
|
|
Alert("parsing [%s:%d] : '%s' expects an integer argument.\n", file, linenum, args[0]);
|
|
return -1;
|
|
}
|
|
curproxy->maxconn = atol(args[1]);
|
|
}
|
|
else if (!strcmp(args[0], "grace")) { /* grace time (ms) */
|
|
if (*(args[1]) == 0) {
|
|
Alert("parsing [%s:%d] : '%s' expects a time in milliseconds.\n", file, linenum, args[0]);
|
|
return -1;
|
|
}
|
|
curproxy->grace = atol(args[1]);
|
|
}
|
|
else if (!strcmp(args[0], "dispatch")) { /* dispatch address */
|
|
if (curproxy == &defproxy) {
|
|
Alert("parsing [%s:%d] : '%s' not allowed in 'defaults' section.\n", file, linenum, args[0]);
|
|
return -1;
|
|
}
|
|
if (strchr(args[1], ':') == NULL) {
|
|
Alert("parsing [%s:%d] : '%s' expects <addr:port> as argument.\n", file, linenum, args[0]);
|
|
return -1;
|
|
}
|
|
curproxy->dispatch_addr = *str2sa(args[1]);
|
|
}
|
|
else if (!strcmp(args[0], "balance")) { /* set balancing with optional algorithm */
|
|
if (*(args[1])) {
|
|
if (!strcmp(args[1], "roundrobin")) {
|
|
curproxy->options |= PR_O_BALANCE_RR;
|
|
}
|
|
else {
|
|
Alert("parsing [%s:%d] : '%s' only supports 'roundrobin' option.\n", file, linenum, args[0]);
|
|
return -1;
|
|
}
|
|
}
|
|
else /* if no option is set, use round-robin by default */
|
|
curproxy->options |= PR_O_BALANCE_RR;
|
|
}
|
|
else if (!strcmp(args[0], "server")) { /* server address */
|
|
int cur_arg;
|
|
char *rport;
|
|
char *raddr;
|
|
short realport;
|
|
int do_check;
|
|
|
|
if (curproxy == &defproxy) {
|
|
Alert("parsing [%s:%d] : '%s' not allowed in 'defaults' section.\n", file, linenum, args[0]);
|
|
return -1;
|
|
}
|
|
|
|
if (!*args[2]) {
|
|
Alert("parsing [%s:%d] : '%s' expects <name> and <addr>[:<port>] as arguments.\n",
|
|
file, linenum, args[0]);
|
|
return -1;
|
|
}
|
|
if ((newsrv = (struct server *)calloc(1, sizeof(struct server))) == NULL) {
|
|
Alert("parsing [%s:%d] : out of memory.\n", file, linenum);
|
|
return -1;
|
|
}
|
|
|
|
if (curproxy->srv == NULL)
|
|
curproxy->srv = newsrv;
|
|
else
|
|
curproxy->cursrv->next = newsrv;
|
|
curproxy->cursrv = newsrv;
|
|
|
|
newsrv->next = NULL;
|
|
newsrv->proxy = curproxy;
|
|
|
|
do_check = 0;
|
|
newsrv->state = SRV_RUNNING; /* early server setup */
|
|
newsrv->id = strdup(args[1]);
|
|
|
|
/* several ways to check the port component :
|
|
* - IP => port=+0, relative
|
|
* - IP: => port=+0, relative
|
|
* - IP:N => port=N, absolute
|
|
* - IP:+N => port=+N, relative
|
|
* - IP:-N => port=-N, relative
|
|
*/
|
|
raddr = strdup(args[2]);
|
|
rport = strchr(raddr, ':');
|
|
if (rport) {
|
|
*rport++ = 0;
|
|
realport = atol(rport);
|
|
if (!isdigit((int)*rport))
|
|
newsrv->state |= SRV_MAPPORTS;
|
|
} else {
|
|
realport = 0;
|
|
newsrv->state |= SRV_MAPPORTS;
|
|
}
|
|
|
|
newsrv->addr = *str2sa(raddr);
|
|
newsrv->addr.sin_port = htons(realport);
|
|
free(raddr);
|
|
|
|
newsrv->curfd = -1; /* no health-check in progress */
|
|
newsrv->inter = DEF_CHKINTR;
|
|
newsrv->rise = DEF_RISETIME;
|
|
newsrv->fall = DEF_FALLTIME;
|
|
newsrv->health = newsrv->rise; /* up, but will fall down at first failure */
|
|
cur_arg = 3;
|
|
while (*args[cur_arg]) {
|
|
if (!strcmp(args[cur_arg], "cookie")) {
|
|
newsrv->cookie = strdup(args[cur_arg + 1]);
|
|
newsrv->cklen = strlen(args[cur_arg + 1]);
|
|
cur_arg += 2;
|
|
}
|
|
else if (!strcmp(args[cur_arg], "rise")) {
|
|
newsrv->rise = atol(args[cur_arg + 1]);
|
|
newsrv->health = newsrv->rise;
|
|
cur_arg += 2;
|
|
}
|
|
else if (!strcmp(args[cur_arg], "fall")) {
|
|
newsrv->fall = atol(args[cur_arg + 1]);
|
|
cur_arg += 2;
|
|
}
|
|
else if (!strcmp(args[cur_arg], "inter")) {
|
|
newsrv->inter = atol(args[cur_arg + 1]);
|
|
cur_arg += 2;
|
|
}
|
|
else if (!strcmp(args[cur_arg], "port")) {
|
|
newsrv->check_port = atol(args[cur_arg + 1]);
|
|
cur_arg += 2;
|
|
}
|
|
else if (!strcmp(args[cur_arg], "backup")) {
|
|
newsrv->state |= SRV_BACKUP;
|
|
cur_arg ++;
|
|
}
|
|
else if (!strcmp(args[cur_arg], "check")) {
|
|
do_check = 1;
|
|
cur_arg += 1;
|
|
}
|
|
else if (!strcmp(args[cur_arg], "source")) { /* address to which we bind when connecting */
|
|
if (!*args[cur_arg + 1]) {
|
|
Alert("parsing [%s:%d] : '%s' expects <addr>[:<port>] as argument.\n",
|
|
file, linenum, "source");
|
|
return -1;
|
|
}
|
|
newsrv->state |= SRV_BIND_SRC;
|
|
newsrv->source_addr = *str2sa(args[cur_arg + 1]);
|
|
cur_arg += 2;
|
|
}
|
|
else {
|
|
Alert("parsing [%s:%d] : server %s only supports options 'backup', 'cookie', 'check', 'inter', 'rise', 'fall', 'port' and 'source'.\n",
|
|
file, linenum, newsrv->id);
|
|
return -1;
|
|
}
|
|
}
|
|
|
|
if (do_check) {
|
|
struct task *t;
|
|
|
|
if (!newsrv->check_port && !(newsrv->state & SRV_MAPPORTS))
|
|
newsrv->check_port = realport; /* by default */
|
|
if (!newsrv->check_port) {
|
|
Alert("parsing [%s:%d] : server %s has neither service port nor check port. Check has been disabled.\n",
|
|
file, linenum, newsrv->id);
|
|
return -1;
|
|
}
|
|
|
|
if ((t = pool_alloc(task)) == NULL) {
|
|
Alert("parsing [%s:%d] : out of memory.\n", file, linenum);
|
|
return -1;
|
|
}
|
|
|
|
t->next = t->prev = t->rqnext = NULL; /* task not in run queue yet */
|
|
t->wq = LIST_HEAD(wait_queue); /* but already has a wait queue assigned */
|
|
t->state = TASK_IDLE;
|
|
t->process = process_chk;
|
|
t->context = newsrv;
|
|
|
|
if (curproxy->state != PR_STDISABLED) {
|
|
tv_delayfrom(&t->expire, &now, newsrv->inter); /* check this every ms */
|
|
task_queue(t);
|
|
task_wakeup(&rq, t);
|
|
}
|
|
}
|
|
|
|
curproxy->nbservers++;
|
|
}
|
|
else if (!strcmp(args[0], "log")) { /* syslog server address */
|
|
struct sockaddr_in *sa;
|
|
int facility;
|
|
|
|
if (*(args[1]) && *(args[2]) == 0 && !strcmp(args[1], "global")) {
|
|
curproxy->logfac1 = global.logfac1;
|
|
curproxy->logsrv1 = global.logsrv1;
|
|
curproxy->loglev1 = global.loglev1;
|
|
curproxy->logfac2 = global.logfac2;
|
|
curproxy->logsrv2 = global.logsrv2;
|
|
curproxy->loglev2 = global.loglev2;
|
|
}
|
|
else if (*(args[1]) && *(args[2])) {
|
|
int level;
|
|
|
|
for (facility = 0; facility < NB_LOG_FACILITIES; facility++)
|
|
if (!strcmp(log_facilities[facility], args[2]))
|
|
break;
|
|
|
|
if (facility >= NB_LOG_FACILITIES) {
|
|
Alert("parsing [%s:%d] : unknown log facility '%s'\n", file, linenum, args[2]);
|
|
exit(1);
|
|
}
|
|
|
|
level = 7; /* max syslog level = debug */
|
|
if (*(args[3])) {
|
|
while (level >= 0 && strcmp(log_levels[level], args[3]))
|
|
level--;
|
|
if (level < 0) {
|
|
Alert("parsing [%s:%d] : unknown optional log level '%s'\n", file, linenum, args[3]);
|
|
exit(1);
|
|
}
|
|
}
|
|
|
|
sa = str2sa(args[1]);
|
|
if (!sa->sin_port)
|
|
sa->sin_port = htons(SYSLOG_PORT);
|
|
|
|
if (curproxy->logfac1 == -1) {
|
|
curproxy->logsrv1 = *sa;
|
|
curproxy->logfac1 = facility;
|
|
curproxy->loglev1 = level;
|
|
}
|
|
else if (curproxy->logfac2 == -1) {
|
|
curproxy->logsrv2 = *sa;
|
|
curproxy->logfac2 = facility;
|
|
curproxy->loglev2 = level;
|
|
}
|
|
else {
|
|
Alert("parsing [%s:%d] : too many syslog servers\n", file, linenum);
|
|
return -1;
|
|
}
|
|
}
|
|
else {
|
|
Alert("parsing [%s:%d] : 'log' expects either <address[:port]> and <facility> or 'global' as arguments.\n",
|
|
file, linenum);
|
|
return -1;
|
|
}
|
|
}
|
|
else if (!strcmp(args[0], "source")) { /* address to which we bind when connecting */
|
|
if (!*args[1]) {
|
|
Alert("parsing [%s:%d] : '%s' expects <addr>[:<port>] as argument.\n",
|
|
file, linenum, "source");
|
|
return -1;
|
|
}
|
|
|
|
curproxy->source_addr = *str2sa(args[1]);
|
|
curproxy->options |= PR_O_BIND_SRC;
|
|
}
|
|
else if (!strcmp(args[0], "cliexp") || !strcmp(args[0], "reqrep")) { /* replace request header from a regex */
|
|
regex_t *preg;
|
|
if (curproxy == &defproxy) {
|
|
Alert("parsing [%s:%d] : '%s' not allowed in 'defaults' section.\n", file, linenum, args[0]);
|
|
return -1;
|
|
}
|
|
|
|
if (*(args[1]) == 0 || *(args[2]) == 0) {
|
|
Alert("parsing [%s:%d] : '%s' expects <search> and <replace> as arguments.\n",
|
|
file, linenum, args[0]);
|
|
return -1;
|
|
}
|
|
|
|
preg = calloc(1, sizeof(regex_t));
|
|
if (regcomp(preg, args[1], REG_EXTENDED) != 0) {
|
|
Alert("parsing [%s:%d] : bad regular expression '%s'.\n", file, linenum, args[1]);
|
|
return -1;
|
|
}
|
|
|
|
err = chain_regex(&curproxy->req_exp, preg, ACT_REPLACE, strdup(args[2]));
|
|
if (err) {
|
|
Alert("parsing [%s:%d] : invalid character or unterminated sequence in replacement string near '%c'.\n",
|
|
file, linenum, *err);
|
|
return -1;
|
|
}
|
|
}
|
|
else if (!strcmp(args[0], "reqdel")) { /* delete request header from a regex */
|
|
regex_t *preg;
|
|
if (curproxy == &defproxy) {
|
|
Alert("parsing [%s:%d] : '%s' not allowed in 'defaults' section.\n", file, linenum, args[0]);
|
|
return -1;
|
|
}
|
|
|
|
if (*(args[1]) == 0) {
|
|
Alert("parsing [%s:%d] : '%s' expects <regex> as an argument.\n", file, linenum, args[0]);
|
|
return -1;
|
|
}
|
|
|
|
preg = calloc(1, sizeof(regex_t));
|
|
if (regcomp(preg, args[1], REG_EXTENDED) != 0) {
|
|
Alert("parsing [%s:%d] : bad regular expression '%s'.\n", file, linenum, args[1]);
|
|
return -1;
|
|
}
|
|
|
|
chain_regex(&curproxy->req_exp, preg, ACT_REMOVE, NULL);
|
|
}
|
|
else if (!strcmp(args[0], "reqdeny")) { /* deny a request if a header matches this regex */
|
|
regex_t *preg;
|
|
if (curproxy == &defproxy) {
|
|
Alert("parsing [%s:%d] : '%s' not allowed in 'defaults' section.\n", file, linenum, args[0]);
|
|
return -1;
|
|
}
|
|
|
|
if (*(args[1]) == 0) {
|
|
Alert("parsing [%s:%d] : '%s' expects <regex> as an argument.\n", file, linenum, args[0]);
|
|
return -1;
|
|
}
|
|
|
|
preg = calloc(1, sizeof(regex_t));
|
|
if (regcomp(preg, args[1], REG_EXTENDED) != 0) {
|
|
Alert("parsing [%s:%d] : bad regular expression '%s'.\n", file, linenum, args[1]);
|
|
return -1;
|
|
}
|
|
|
|
chain_regex(&curproxy->req_exp, preg, ACT_DENY, NULL);
|
|
}
|
|
else if (!strcmp(args[0], "reqpass")) { /* pass this header without allowing or denying the request */
|
|
regex_t *preg;
|
|
if (curproxy == &defproxy) {
|
|
Alert("parsing [%s:%d] : '%s' not allowed in 'defaults' section.\n", file, linenum, args[0]);
|
|
return -1;
|
|
}
|
|
|
|
if (*(args[1]) == 0) {
|
|
Alert("parsing [%s:%d] : '%s' expects <regex> as an argument.\n", file, linenum, args[0]);
|
|
return -1;
|
|
}
|
|
|
|
preg = calloc(1, sizeof(regex_t));
|
|
if (regcomp(preg, args[1], REG_EXTENDED) != 0) {
|
|
Alert("parsing [%s:%d] : bad regular expression '%s'.\n", file, linenum, args[1]);
|
|
return -1;
|
|
}
|
|
|
|
chain_regex(&curproxy->req_exp, preg, ACT_PASS, NULL);
|
|
}
|
|
else if (!strcmp(args[0], "reqallow")) { /* allow a request if a header matches this regex */
|
|
regex_t *preg;
|
|
if (curproxy == &defproxy) {
|
|
Alert("parsing [%s:%d] : '%s' not allowed in 'defaults' section.\n", file, linenum, args[0]);
|
|
return -1;
|
|
}
|
|
|
|
if (*(args[1]) == 0) {
|
|
Alert("parsing [%s:%d] : '%s' expects <regex> as an argument.\n", file, linenum, args[0]);
|
|
return -1;
|
|
}
|
|
|
|
preg = calloc(1, sizeof(regex_t));
|
|
if (regcomp(preg, args[1], REG_EXTENDED) != 0) {
|
|
Alert("parsing [%s:%d] : bad regular expression '%s'.\n", file, linenum, args[1]);
|
|
return -1;
|
|
}
|
|
|
|
chain_regex(&curproxy->req_exp, preg, ACT_ALLOW, NULL);
|
|
}
|
|
else if (!strcmp(args[0], "reqirep")) { /* replace request header from a regex, ignoring case */
|
|
regex_t *preg;
|
|
if (curproxy == &defproxy) {
|
|
Alert("parsing [%s:%d] : '%s' not allowed in 'defaults' section.\n", file, linenum, args[0]);
|
|
return -1;
|
|
}
|
|
|
|
if (*(args[1]) == 0 || *(args[2]) == 0) {
|
|
Alert("parsing [%s:%d] : '%s' expects <search> and <replace> as arguments.\n",
|
|
file, linenum, args[0]);
|
|
return -1;
|
|
}
|
|
|
|
preg = calloc(1, sizeof(regex_t));
|
|
if (regcomp(preg, args[1], REG_EXTENDED | REG_ICASE) != 0) {
|
|
Alert("parsing [%s:%d] : bad regular expression '%s'.\n", file, linenum, args[1]);
|
|
return -1;
|
|
}
|
|
|
|
err = chain_regex(&curproxy->req_exp, preg, ACT_REPLACE, strdup(args[2]));
|
|
if (err) {
|
|
Alert("parsing [%s:%d] : invalid character or unterminated sequence in replacement string near '%c'.\n",
|
|
file, linenum, *err);
|
|
return -1;
|
|
}
|
|
}
|
|
else if (!strcmp(args[0], "reqidel")) { /* delete request header from a regex ignoring case */
|
|
regex_t *preg;
|
|
if (curproxy == &defproxy) {
|
|
Alert("parsing [%s:%d] : '%s' not allowed in 'defaults' section.\n", file, linenum, args[0]);
|
|
return -1;
|
|
}
|
|
|
|
if (*(args[1]) == 0) {
|
|
Alert("parsing [%s:%d] : '%s' expects <regex> as an argument.\n", file, linenum, args[0]);
|
|
return -1;
|
|
}
|
|
|
|
preg = calloc(1, sizeof(regex_t));
|
|
if (regcomp(preg, args[1], REG_EXTENDED | REG_ICASE) != 0) {
|
|
Alert("parsing [%s:%d] : bad regular expression '%s'.\n", file, linenum, args[1]);
|
|
return -1;
|
|
}
|
|
|
|
chain_regex(&curproxy->req_exp, preg, ACT_REMOVE, NULL);
|
|
}
|
|
else if (!strcmp(args[0], "reqideny")) { /* deny a request if a header matches this regex ignoring case */
|
|
regex_t *preg;
|
|
if (curproxy == &defproxy) {
|
|
Alert("parsing [%s:%d] : '%s' not allowed in 'defaults' section.\n", file, linenum, args[0]);
|
|
return -1;
|
|
}
|
|
|
|
if (*(args[1]) == 0) {
|
|
Alert("parsing [%s:%d] : '%s' expects <regex> as an argument.\n", file, linenum, args[0]);
|
|
return -1;
|
|
}
|
|
|
|
preg = calloc(1, sizeof(regex_t));
|
|
if (regcomp(preg, args[1], REG_EXTENDED | REG_ICASE) != 0) {
|
|
Alert("parsing [%s:%d] : bad regular expression '%s'.\n", file, linenum, args[1]);
|
|
return -1;
|
|
}
|
|
|
|
chain_regex(&curproxy->req_exp, preg, ACT_DENY, NULL);
|
|
}
|
|
else if (!strcmp(args[0], "reqipass")) { /* pass this header without allowing or denying the request */
|
|
regex_t *preg;
|
|
if (curproxy == &defproxy) {
|
|
Alert("parsing [%s:%d] : '%s' not allowed in 'defaults' section.\n", file, linenum, args[0]);
|
|
return -1;
|
|
}
|
|
|
|
if (*(args[1]) == 0) {
|
|
Alert("parsing [%s:%d] : '%s' expects <regex> as an argument.\n", file, linenum, args[0]);
|
|
return -1;
|
|
}
|
|
|
|
preg = calloc(1, sizeof(regex_t));
|
|
if (regcomp(preg, args[1], REG_EXTENDED | REG_ICASE) != 0) {
|
|
Alert("parsing [%s:%d] : bad regular expression '%s'.\n", file, linenum, args[1]);
|
|
return -1;
|
|
}
|
|
|
|
chain_regex(&curproxy->req_exp, preg, ACT_PASS, NULL);
|
|
}
|
|
else if (!strcmp(args[0], "reqiallow")) { /* allow a request if a header matches this regex ignoring case */
|
|
regex_t *preg;
|
|
if (curproxy == &defproxy) {
|
|
Alert("parsing [%s:%d] : '%s' not allowed in 'defaults' section.\n", file, linenum, args[0]);
|
|
return -1;
|
|
}
|
|
|
|
if (*(args[1]) == 0) {
|
|
Alert("parsing [%s:%d] : '%s' expects <regex> as an argument.\n", file, linenum, args[0]);
|
|
return -1;
|
|
}
|
|
|
|
preg = calloc(1, sizeof(regex_t));
|
|
if (regcomp(preg, args[1], REG_EXTENDED | REG_ICASE) != 0) {
|
|
Alert("parsing [%s:%d] : bad regular expression '%s'.\n", file, linenum, args[1]);
|
|
return -1;
|
|
}
|
|
|
|
chain_regex(&curproxy->req_exp, preg, ACT_ALLOW, NULL);
|
|
}
|
|
else if (!strcmp(args[0], "reqadd")) { /* add request header */
|
|
if (curproxy == &defproxy) {
|
|
Alert("parsing [%s:%d] : '%s' not allowed in 'defaults' section.\n", file, linenum, args[0]);
|
|
return -1;
|
|
}
|
|
|
|
if (curproxy->nb_reqadd >= MAX_NEWHDR) {
|
|
Alert("parsing [%s:%d] : too many '%s'. Continuing.\n", file, linenum, args[0]);
|
|
return 0;
|
|
}
|
|
|
|
if (*(args[1]) == 0) {
|
|
Alert("parsing [%s:%d] : '%s' expects <header> as an argument.\n", file, linenum, args[0]);
|
|
return -1;
|
|
}
|
|
|
|
curproxy->req_add[curproxy->nb_reqadd++] = strdup(args[1]);
|
|
}
|
|
else if (!strcmp(args[0], "srvexp") || !strcmp(args[0], "rsprep")) { /* replace response header from a regex */
|
|
regex_t *preg;
|
|
|
|
if (*(args[1]) == 0 || *(args[2]) == 0) {
|
|
Alert("parsing [%s:%d] : '%s' expects <search> and <replace> as arguments.\n",
|
|
file, linenum, args[0]);
|
|
return -1;
|
|
}
|
|
|
|
preg = calloc(1, sizeof(regex_t));
|
|
if (regcomp(preg, args[1], REG_EXTENDED) != 0) {
|
|
Alert("parsing [%s:%d] : bad regular expression '%s'.\n", file, linenum, args[1]);
|
|
return -1;
|
|
}
|
|
|
|
err = chain_regex(&curproxy->rsp_exp, preg, ACT_REPLACE, strdup(args[2]));
|
|
if (err) {
|
|
Alert("parsing [%s:%d] : invalid character or unterminated sequence in replacement string near '%c'.\n",
|
|
file, linenum, *err);
|
|
return -1;
|
|
}
|
|
}
|
|
else if (!strcmp(args[0], "rspdel")) { /* delete response header from a regex */
|
|
regex_t *preg;
|
|
if (curproxy == &defproxy) {
|
|
Alert("parsing [%s:%d] : '%s' not allowed in 'defaults' section.\n", file, linenum, args[0]);
|
|
return -1;
|
|
}
|
|
|
|
if (*(args[1]) == 0) {
|
|
Alert("parsing [%s:%d] : '%s' expects <search> as an argument.\n", file, linenum, args[0]);
|
|
return -1;
|
|
}
|
|
|
|
preg = calloc(1, sizeof(regex_t));
|
|
if (regcomp(preg, args[1], REG_EXTENDED) != 0) {
|
|
Alert("parsing [%s:%d] : bad regular expression '%s'.\n", file, linenum, args[1]);
|
|
return -1;
|
|
}
|
|
|
|
err = chain_regex(&curproxy->rsp_exp, preg, ACT_REMOVE, strdup(args[2]));
|
|
if (err) {
|
|
Alert("parsing [%s:%d] : invalid character or unterminated sequence in replacement string near '%c'.\n",
|
|
file, linenum, *err);
|
|
return -1;
|
|
}
|
|
}
|
|
else if (!strcmp(args[0], "rspdeny")) { /* block response header from a regex */
|
|
regex_t *preg;
|
|
if (curproxy == &defproxy) {
|
|
Alert("parsing [%s:%d] : '%s' not allowed in 'defaults' section.\n", file, linenum, args[0]);
|
|
return -1;
|
|
}
|
|
|
|
if (*(args[1]) == 0) {
|
|
Alert("parsing [%s:%d] : '%s' expects <search> as an argument.\n", file, linenum, args[0]);
|
|
return -1;
|
|
}
|
|
|
|
preg = calloc(1, sizeof(regex_t));
|
|
if (regcomp(preg, args[1], REG_EXTENDED) != 0) {
|
|
Alert("parsing [%s:%d] : bad regular expression '%s'.\n", file, linenum, args[1]);
|
|
return -1;
|
|
}
|
|
|
|
err = chain_regex(&curproxy->rsp_exp, preg, ACT_DENY, strdup(args[2]));
|
|
if (err) {
|
|
Alert("parsing [%s:%d] : invalid character or unterminated sequence in replacement string near '%c'.\n",
|
|
file, linenum, *err);
|
|
return -1;
|
|
}
|
|
}
|
|
else if (!strcmp(args[0], "rspirep")) { /* replace response header from a regex ignoring case */
|
|
regex_t *preg;
|
|
if (curproxy == &defproxy) {
|
|
Alert("parsing [%s:%d] : '%s' not allowed in 'defaults' section.\n", file, linenum, args[0]);
|
|
return -1;
|
|
}
|
|
|
|
if (*(args[1]) == 0 || *(args[2]) == 0) {
|
|
Alert("parsing [%s:%d] : '%s' expects <search> and <replace> as arguments.\n",
|
|
file, linenum, args[0]);
|
|
return -1;
|
|
}
|
|
|
|
preg = calloc(1, sizeof(regex_t));
|
|
if (regcomp(preg, args[1], REG_EXTENDED | REG_ICASE) != 0) {
|
|
Alert("parsing [%s:%d] : bad regular expression '%s'.\n", file, linenum, args[1]);
|
|
return -1;
|
|
}
|
|
|
|
err = chain_regex(&curproxy->rsp_exp, preg, ACT_REPLACE, strdup(args[2]));
|
|
if (err) {
|
|
Alert("parsing [%s:%d] : invalid character or unterminated sequence in replacement string near '%c'.\n",
|
|
file, linenum, *err);
|
|
return -1;
|
|
}
|
|
}
|
|
else if (!strcmp(args[0], "rspidel")) { /* delete response header from a regex ignoring case */
|
|
regex_t *preg;
|
|
if (curproxy == &defproxy) {
|
|
Alert("parsing [%s:%d] : '%s' not allowed in 'defaults' section.\n", file, linenum, args[0]);
|
|
return -1;
|
|
}
|
|
|
|
if (*(args[1]) == 0) {
|
|
Alert("parsing [%s:%d] : '%s' expects <search> as an argument.\n", file, linenum, args[0]);
|
|
return -1;
|
|
}
|
|
|
|
preg = calloc(1, sizeof(regex_t));
|
|
if (regcomp(preg, args[1], REG_EXTENDED | REG_ICASE) != 0) {
|
|
Alert("parsing [%s:%d] : bad regular expression '%s'.\n", file, linenum, args[1]);
|
|
return -1;
|
|
}
|
|
|
|
err = chain_regex(&curproxy->rsp_exp, preg, ACT_REMOVE, strdup(args[2]));
|
|
if (err) {
|
|
Alert("parsing [%s:%d] : invalid character or unterminated sequence in replacement string near '%c'.\n",
|
|
file, linenum, *err);
|
|
return -1;
|
|
}
|
|
}
|
|
else if (!strcmp(args[0], "rspideny")) { /* block response header from a regex ignoring case */
|
|
regex_t *preg;
|
|
if (curproxy == &defproxy) {
|
|
Alert("parsing [%s:%d] : '%s' not allowed in 'defaults' section.\n", file, linenum, args[0]);
|
|
return -1;
|
|
}
|
|
|
|
if (*(args[1]) == 0) {
|
|
Alert("parsing [%s:%d] : '%s' expects <search> as an argument.\n", file, linenum, args[0]);
|
|
return -1;
|
|
}
|
|
|
|
preg = calloc(1, sizeof(regex_t));
|
|
if (regcomp(preg, args[1], REG_EXTENDED | REG_ICASE) != 0) {
|
|
Alert("parsing [%s:%d] : bad regular expression '%s'.\n", file, linenum, args[1]);
|
|
return -1;
|
|
}
|
|
|
|
err = chain_regex(&curproxy->rsp_exp, preg, ACT_DENY, strdup(args[2]));
|
|
if (err) {
|
|
Alert("parsing [%s:%d] : invalid character or unterminated sequence in replacement string near '%c'.\n",
|
|
file, linenum, *err);
|
|
return -1;
|
|
}
|
|
}
|
|
else if (!strcmp(args[0], "rspadd")) { /* add response header */
|
|
if (curproxy == &defproxy) {
|
|
Alert("parsing [%s:%d] : '%s' not allowed in 'defaults' section.\n", file, linenum, args[0]);
|
|
return -1;
|
|
}
|
|
|
|
if (curproxy->nb_rspadd >= MAX_NEWHDR) {
|
|
Alert("parsing [%s:%d] : too many '%s'. Continuing.\n", file, linenum, args[0]);
|
|
return 0;
|
|
}
|
|
|
|
if (*(args[1]) == 0) {
|
|
Alert("parsing [%s:%d] : '%s' expects <header> as an argument.\n", file, linenum, args[0]);
|
|
return -1;
|
|
}
|
|
|
|
curproxy->rsp_add[curproxy->nb_rspadd++] = strdup(args[1]);
|
|
}
|
|
else if (!strcmp(args[0], "errorloc") ||
|
|
!strcmp(args[0], "errorloc302") ||
|
|
!strcmp(args[0], "errorloc303")) { /* error location */
|
|
int errnum, errlen;
|
|
char *err;
|
|
|
|
// if (curproxy == &defproxy) {
|
|
// Alert("parsing [%s:%d] : '%s' not allowed in 'defaults' section.\n", file, linenum, args[0]);
|
|
// return -1;
|
|
// }
|
|
|
|
if (*(args[2]) == 0) {
|
|
Alert("parsing [%s:%d] : <errorloc> expects <error> and <url> as arguments.\n", file, linenum);
|
|
return -1;
|
|
}
|
|
|
|
errnum = atol(args[1]);
|
|
if (!strcmp(args[0], "errorloc303")) {
|
|
err = malloc(strlen(HTTP_303) + strlen(args[2]) + 5);
|
|
errlen = sprintf(err, "%s%s\r\n\r\n", HTTP_303, args[2]);
|
|
} else {
|
|
err = malloc(strlen(HTTP_302) + strlen(args[2]) + 5);
|
|
errlen = sprintf(err, "%s%s\r\n\r\n", HTTP_302, args[2]);
|
|
}
|
|
|
|
if (errnum == 400) {
|
|
if (curproxy->errmsg.msg400) {
|
|
//Warning("parsing [%s:%d] : error %d already defined.\n", file, linenum, errnum);
|
|
free(curproxy->errmsg.msg400);
|
|
}
|
|
curproxy->errmsg.msg400 = err;
|
|
curproxy->errmsg.len400 = errlen;
|
|
}
|
|
else if (errnum == 403) {
|
|
if (curproxy->errmsg.msg403) {
|
|
//Warning("parsing [%s:%d] : error %d already defined.\n", file, linenum, errnum);
|
|
free(curproxy->errmsg.msg403);
|
|
}
|
|
curproxy->errmsg.msg403 = err;
|
|
curproxy->errmsg.len403 = errlen;
|
|
}
|
|
else if (errnum == 408) {
|
|
if (curproxy->errmsg.msg408) {
|
|
//Warning("parsing [%s:%d] : error %d already defined.\n", file, linenum, errnum);
|
|
free(curproxy->errmsg.msg408);
|
|
}
|
|
curproxy->errmsg.msg408 = err;
|
|
curproxy->errmsg.len408 = errlen;
|
|
}
|
|
else if (errnum == 500) {
|
|
if (curproxy->errmsg.msg500) {
|
|
//Warning("parsing [%s:%d] : error %d already defined.\n", file, linenum, errnum);
|
|
free(curproxy->errmsg.msg500);
|
|
}
|
|
curproxy->errmsg.msg500 = err;
|
|
curproxy->errmsg.len500 = errlen;
|
|
}
|
|
else if (errnum == 502) {
|
|
if (curproxy->errmsg.msg502) {
|
|
//Warning("parsing [%s:%d] : error %d already defined.\n", file, linenum, errnum);
|
|
free(curproxy->errmsg.msg502);
|
|
}
|
|
curproxy->errmsg.msg502 = err;
|
|
curproxy->errmsg.len502 = errlen;
|
|
}
|
|
else if (errnum == 503) {
|
|
if (curproxy->errmsg.msg503) {
|
|
//Warning("parsing [%s:%d] : error %d already defined.\n", file, linenum, errnum);
|
|
free(curproxy->errmsg.msg503);
|
|
}
|
|
curproxy->errmsg.msg503 = err;
|
|
curproxy->errmsg.len503 = errlen;
|
|
}
|
|
else if (errnum == 504) {
|
|
if (curproxy->errmsg.msg504) {
|
|
//Warning("parsing [%s:%d] : error %d already defined.\n", file, linenum, errnum);
|
|
free(curproxy->errmsg.msg504);
|
|
}
|
|
curproxy->errmsg.msg504 = err;
|
|
curproxy->errmsg.len504 = errlen;
|
|
}
|
|
else {
|
|
Warning("parsing [%s:%d] : error %d relocation will be ignored.\n", file, linenum, errnum);
|
|
free(err);
|
|
}
|
|
}
|
|
else {
|
|
Alert("parsing [%s:%d] : unknown keyword '%s' in '%s' section\n", file, linenum, args[0], "listen");
|
|
return -1;
|
|
}
|
|
return 0;
|
|
}
|
|
|
|
|
|
/*
|
|
* This function reads and parses the configuration file given in the argument.
|
|
* returns 0 if OK, -1 if error.
|
|
*/
|
|
int readcfgfile(char *file) {
|
|
char thisline[256];
|
|
char *line;
|
|
FILE *f;
|
|
int linenum = 0;
|
|
char *end;
|
|
char *args[MAX_LINE_ARGS];
|
|
int arg;
|
|
int cfgerr = 0;
|
|
int confsect = CFG_NONE;
|
|
|
|
struct proxy *curproxy = NULL;
|
|
struct server *newsrv = NULL;
|
|
|
|
if ((f=fopen(file,"r")) == NULL)
|
|
return -1;
|
|
|
|
init_default_instance();
|
|
|
|
while (fgets(line = thisline, sizeof(thisline), f) != NULL) {
|
|
linenum++;
|
|
|
|
end = line + strlen(line);
|
|
|
|
/* skip leading spaces */
|
|
while (isspace((int)*line))
|
|
line++;
|
|
|
|
arg = 0;
|
|
args[arg] = line;
|
|
|
|
while (*line && arg < MAX_LINE_ARGS) {
|
|
/* first, we'll replace \\, \<space>, \#, \r, \n, \t, \xXX with their
|
|
* C equivalent value. Other combinations left unchanged (eg: \1).
|
|
*/
|
|
if (*line == '\\') {
|
|
int skip = 0;
|
|
if (line[1] == ' ' || line[1] == '\\' || line[1] == '#') {
|
|
*line = line[1];
|
|
skip = 1;
|
|
}
|
|
else if (line[1] == 'r') {
|
|
*line = '\r';
|
|
skip = 1;
|
|
}
|
|
else if (line[1] == 'n') {
|
|
*line = '\n';
|
|
skip = 1;
|
|
}
|
|
else if (line[1] == 't') {
|
|
*line = '\t';
|
|
skip = 1;
|
|
}
|
|
else if (line[1] == 'x') {
|
|
if ((line + 3 < end ) && ishex(line[2]) && ishex(line[3])) {
|
|
unsigned char hex1, hex2;
|
|
hex1 = toupper(line[2]) - '0';
|
|
hex2 = toupper(line[3]) - '0';
|
|
if (hex1 > 9) hex1 -= 'A' - '9' - 1;
|
|
if (hex2 > 9) hex2 -= 'A' - '9' - 1;
|
|
*line = (hex1<<4) + hex2;
|
|
skip = 3;
|
|
}
|
|
else {
|
|
Alert("parsing [%s:%d] : invalid or incomplete '\\x' sequence in '%s'.\n", file, linenum, args[0]);
|
|
return -1;
|
|
}
|
|
}
|
|
if (skip) {
|
|
memmove(line + 1, line + 1 + skip, end - (line + skip + 1));
|
|
end -= skip;
|
|
}
|
|
line++;
|
|
}
|
|
else if (*line == '#' || *line == '\n' || *line == '\r') {
|
|
/* end of string, end of loop */
|
|
*line = 0;
|
|
break;
|
|
}
|
|
else if (isspace((int)*line)) {
|
|
/* a non-escaped space is an argument separator */
|
|
*line++ = 0;
|
|
while (isspace((int)*line))
|
|
line++;
|
|
args[++arg] = line;
|
|
}
|
|
else {
|
|
line++;
|
|
}
|
|
}
|
|
|
|
/* empty line */
|
|
if (!**args)
|
|
continue;
|
|
|
|
/* zero out remaining args */
|
|
while (++arg < MAX_LINE_ARGS) {
|
|
args[arg] = line;
|
|
}
|
|
|
|
if (!strcmp(args[0], "listen") || !strcmp(args[0], "defaults")) /* new proxy */
|
|
confsect = CFG_LISTEN;
|
|
else if (!strcmp(args[0], "global")) /* global config */
|
|
confsect = CFG_GLOBAL;
|
|
/* else it's a section keyword */
|
|
|
|
switch (confsect) {
|
|
case CFG_LISTEN:
|
|
if (cfg_parse_listen(file, linenum, args) < 0)
|
|
return -1;
|
|
break;
|
|
case CFG_GLOBAL:
|
|
if (cfg_parse_global(file, linenum, args) < 0)
|
|
return -1;
|
|
break;
|
|
default:
|
|
Alert("parsing [%s:%d] : unknown keyword '%s' out of section.\n", file, linenum, args[0]);
|
|
return -1;
|
|
}
|
|
|
|
|
|
}
|
|
fclose(f);
|
|
|
|
/*
|
|
* Now, check for the integrity of all that we have collected.
|
|
*/
|
|
|
|
if ((curproxy = proxy) == NULL) {
|
|
Alert("parsing %s : no <listen> line. Nothing to do !\n",
|
|
file);
|
|
return -1;
|
|
}
|
|
|
|
while (curproxy != NULL) {
|
|
curproxy->cursrv = NULL;
|
|
if (curproxy->state == PR_STDISABLED) {
|
|
curproxy = curproxy->next;
|
|
continue;
|
|
}
|
|
if ((curproxy->mode != PR_MODE_HEALTH) &&
|
|
!(curproxy->options & (PR_O_TRANSP | PR_O_BALANCE)) &&
|
|
(*(int *)&curproxy->dispatch_addr.sin_addr == 0)) {
|
|
Alert("parsing %s : listener %s has no dispatch address and is not in transparent or balance mode.\n",
|
|
file, curproxy->id);
|
|
cfgerr++;
|
|
}
|
|
else if ((curproxy->mode != PR_MODE_HEALTH) && (curproxy->options & PR_O_BALANCE)) {
|
|
if (curproxy->options & PR_O_TRANSP) {
|
|
Alert("parsing %s : listener %s cannot use both transparent and balance mode.\n",
|
|
file, curproxy->id);
|
|
cfgerr++;
|
|
}
|
|
else if (curproxy->srv == NULL) {
|
|
Alert("parsing %s : listener %s needs at least 1 server in balance mode.\n",
|
|
file, curproxy->id);
|
|
cfgerr++;
|
|
}
|
|
else if (*(int *)&curproxy->dispatch_addr.sin_addr != 0) {
|
|
Warning("parsing %s : dispatch address of listener %s will be ignored in balance mode.\n",
|
|
file, curproxy->id);
|
|
}
|
|
}
|
|
else if (curproxy->mode == PR_MODE_TCP || curproxy->mode == PR_MODE_HEALTH) { /* TCP PROXY or HEALTH CHECK */
|
|
if (curproxy->cookie_name != NULL) {
|
|
Warning("parsing %s : cookie will be ignored for listener %s.\n",
|
|
file, curproxy->id);
|
|
}
|
|
if ((newsrv = curproxy->srv) != NULL) {
|
|
Warning("parsing %s : servers will be ignored for listener %s.\n",
|
|
file, curproxy->id);
|
|
}
|
|
if (curproxy->rsp_exp != NULL) {
|
|
Warning("parsing %s : server regular expressions will be ignored for listener %s.\n",
|
|
file, curproxy->id);
|
|
}
|
|
if (curproxy->req_exp != NULL) {
|
|
Warning("parsing %s : client regular expressions will be ignored for listener %s.\n",
|
|
file, curproxy->id);
|
|
}
|
|
}
|
|
else if (curproxy->mode == PR_MODE_HTTP) { /* HTTP PROXY */
|
|
if ((curproxy->cookie_name != NULL) && ((newsrv = curproxy->srv) == NULL)) {
|
|
Alert("parsing %s : HTTP proxy %s has a cookie but no server list !\n",
|
|
file, curproxy->id);
|
|
cfgerr++;
|
|
}
|
|
else {
|
|
while (newsrv != NULL) {
|
|
/* nothing to check for now */
|
|
newsrv = newsrv->next;
|
|
}
|
|
}
|
|
}
|
|
|
|
if (curproxy->options & PR_O_LOGASAP)
|
|
curproxy->to_log &= ~LW_BYTES;
|
|
|
|
if (curproxy->errmsg.msg400 == NULL) {
|
|
curproxy->errmsg.msg400 = (char *)HTTP_400;
|
|
curproxy->errmsg.len400 = strlen(HTTP_400);
|
|
}
|
|
if (curproxy->errmsg.msg403 == NULL) {
|
|
curproxy->errmsg.msg403 = (char *)HTTP_403;
|
|
curproxy->errmsg.len403 = strlen(HTTP_403);
|
|
}
|
|
if (curproxy->errmsg.msg408 == NULL) {
|
|
curproxy->errmsg.msg408 = (char *)HTTP_408;
|
|
curproxy->errmsg.len408 = strlen(HTTP_408);
|
|
}
|
|
if (curproxy->errmsg.msg500 == NULL) {
|
|
curproxy->errmsg.msg500 = (char *)HTTP_500;
|
|
curproxy->errmsg.len500 = strlen(HTTP_500);
|
|
}
|
|
if (curproxy->errmsg.msg502 == NULL) {
|
|
curproxy->errmsg.msg502 = (char *)HTTP_502;
|
|
curproxy->errmsg.len502 = strlen(HTTP_502);
|
|
}
|
|
if (curproxy->errmsg.msg503 == NULL) {
|
|
curproxy->errmsg.msg503 = (char *)HTTP_503;
|
|
curproxy->errmsg.len503 = strlen(HTTP_503);
|
|
}
|
|
if (curproxy->errmsg.msg504 == NULL) {
|
|
curproxy->errmsg.msg504 = (char *)HTTP_504;
|
|
curproxy->errmsg.len504 = strlen(HTTP_504);
|
|
}
|
|
curproxy = curproxy->next;
|
|
}
|
|
if (cfgerr > 0) {
|
|
Alert("Errors found in configuration file, aborting.\n");
|
|
return -1;
|
|
}
|
|
else
|
|
return 0;
|
|
}
|
|
|
|
|
|
/*
|
|
* This function initializes all the necessary variables. It only returns
|
|
* if everything is OK. If something fails, it exits.
|
|
*/
|
|
void init(int argc, char **argv) {
|
|
int i;
|
|
int arg_mode = 0; /* MODE_DEBUG, ... */
|
|
char *old_argv = *argv;
|
|
char *tmp;
|
|
char *cfg_pidfile = NULL;
|
|
int cfg_maxconn = 0; /* # of simultaneous connections, (-n) */
|
|
|
|
if (1<<INTBITS != sizeof(int)*8) {
|
|
fprintf(stderr,
|
|
"Error: wrong architecture. Recompile so that sizeof(int)=%d\n",
|
|
(int)(sizeof(int)*8));
|
|
exit(1);
|
|
}
|
|
|
|
/* initialize the log header encoding map : '{|}"#' should be encoded with
|
|
* '#' as prefix, as well as non-printable characters ( <32 or >= 127 ).
|
|
* URL encoding only requires '"', '#' to be encoded as well as non-
|
|
* printable characters above.
|
|
*/
|
|
memset(hdr_encode_map, 0, sizeof(hdr_encode_map));
|
|
memset(url_encode_map, 0, sizeof(url_encode_map));
|
|
for (i = 0; i < 32; i++) {
|
|
FD_SET(i, hdr_encode_map);
|
|
FD_SET(i, url_encode_map);
|
|
}
|
|
for (i = 127; i < 256; i++) {
|
|
FD_SET(i, hdr_encode_map);
|
|
FD_SET(i, url_encode_map);
|
|
}
|
|
|
|
tmp = "\"#{|}";
|
|
while (*tmp) {
|
|
FD_SET(*tmp, hdr_encode_map);
|
|
tmp++;
|
|
}
|
|
|
|
tmp = "\"#";
|
|
while (*tmp) {
|
|
FD_SET(*tmp, url_encode_map);
|
|
tmp++;
|
|
}
|
|
|
|
cfg_polling_mechanism = POLL_USE_SELECT; /* select() is always available */
|
|
#if defined(ENABLE_POLL)
|
|
cfg_polling_mechanism |= POLL_USE_POLL;
|
|
#endif
|
|
#if defined(ENABLE_EPOLL)
|
|
cfg_polling_mechanism |= POLL_USE_EPOLL;
|
|
#endif
|
|
|
|
pid = getpid();
|
|
progname = *argv;
|
|
while ((tmp = strchr(progname, '/')) != NULL)
|
|
progname = tmp + 1;
|
|
|
|
argc--; argv++;
|
|
while (argc > 0) {
|
|
char *flag;
|
|
|
|
if (**argv == '-') {
|
|
flag = *argv+1;
|
|
|
|
/* 1 arg */
|
|
if (*flag == 'v') {
|
|
display_version();
|
|
exit(0);
|
|
}
|
|
#if defined(ENABLE_EPOLL)
|
|
else if (*flag == 'd' && flag[1] == 'e')
|
|
cfg_polling_mechanism &= ~POLL_USE_EPOLL;
|
|
#endif
|
|
#if defined(ENABLE_POLL)
|
|
else if (*flag == 'd' && flag[1] == 'p')
|
|
cfg_polling_mechanism &= ~POLL_USE_POLL;
|
|
#endif
|
|
else if (*flag == 'V')
|
|
arg_mode |= MODE_VERBOSE;
|
|
else if (*flag == 'd')
|
|
arg_mode |= MODE_DEBUG;
|
|
else if (*flag == 'c')
|
|
arg_mode |= MODE_CHECK;
|
|
else if (*flag == 'D')
|
|
arg_mode |= MODE_DAEMON | MODE_QUIET;
|
|
else if (*flag == 'q')
|
|
arg_mode |= MODE_QUIET;
|
|
#if STATTIME > 0
|
|
else if (*flag == 's')
|
|
arg_mode |= MODE_STATS;
|
|
else if (*flag == 'l')
|
|
arg_mode |= MODE_LOG;
|
|
#endif
|
|
else { /* >=2 args */
|
|
argv++; argc--;
|
|
if (argc == 0)
|
|
usage(old_argv);
|
|
|
|
switch (*flag) {
|
|
case 'n' : cfg_maxconn = atol(*argv); break;
|
|
case 'N' : cfg_maxpconn = atol(*argv); break;
|
|
case 'f' : cfg_cfgfile = *argv; break;
|
|
case 'p' : cfg_pidfile = *argv; break;
|
|
default: usage(old_argv);
|
|
}
|
|
}
|
|
}
|
|
else
|
|
usage(old_argv);
|
|
argv++; argc--;
|
|
}
|
|
|
|
global.mode = (arg_mode & (MODE_DAEMON | MODE_VERBOSE | MODE_QUIET | MODE_CHECK | MODE_DEBUG));
|
|
|
|
if (!cfg_cfgfile)
|
|
usage(old_argv);
|
|
|
|
gethostname(hostname, MAX_HOSTNAME_LEN);
|
|
|
|
have_appsession = 0;
|
|
if (readcfgfile(cfg_cfgfile) < 0) {
|
|
Alert("Error reading configuration file : %s\n", cfg_cfgfile);
|
|
exit(1);
|
|
}
|
|
if (have_appsession)
|
|
appsession_init();
|
|
|
|
if (global.mode & MODE_CHECK) {
|
|
qfprintf(stdout, "Configuration file is valid : %s\n", cfg_cfgfile);
|
|
exit(0);
|
|
}
|
|
|
|
if (cfg_maxconn > 0)
|
|
global.maxconn = cfg_maxconn;
|
|
|
|
if (cfg_pidfile) {
|
|
if (global.pidfile)
|
|
free(global.pidfile);
|
|
global.pidfile = strdup(cfg_pidfile);
|
|
}
|
|
|
|
if (global.maxconn == 0)
|
|
global.maxconn = DEFAULT_MAXCONN;
|
|
|
|
global.maxsock = global.maxconn * 2; /* each connection needs two sockets */
|
|
|
|
if (arg_mode & MODE_DEBUG) {
|
|
/* command line debug mode inhibits configuration mode */
|
|
global.mode &= ~(MODE_DAEMON | MODE_QUIET);
|
|
}
|
|
global.mode |= (arg_mode & (MODE_DAEMON | MODE_QUIET | MODE_VERBOSE
|
|
| MODE_DEBUG | MODE_STATS | MODE_LOG));
|
|
|
|
if ((global.mode & MODE_DEBUG) && (global.mode & (MODE_DAEMON | MODE_QUIET))) {
|
|
Warning("<debug> mode incompatible with <quiet> and <daemon>. Keeping <debug> only.\n");
|
|
global.mode &= ~(MODE_DAEMON | MODE_QUIET);
|
|
}
|
|
|
|
if ((global.nbproc > 1) && !(global.mode & MODE_DAEMON)) {
|
|
Warning("<nbproc> is only meaningful in daemon mode. Setting limit to 1 process.\n");
|
|
global.nbproc = 1;
|
|
}
|
|
|
|
if (global.nbproc < 1)
|
|
global.nbproc = 1;
|
|
|
|
StaticReadEvent = (fd_set *)calloc(1,
|
|
sizeof(fd_set) *
|
|
(global.maxsock + FD_SETSIZE - 1) / FD_SETSIZE);
|
|
StaticWriteEvent = (fd_set *)calloc(1,
|
|
sizeof(fd_set) *
|
|
(global.maxsock + FD_SETSIZE - 1) / FD_SETSIZE);
|
|
|
|
fdtab = (struct fdtab *)calloc(1,
|
|
sizeof(struct fdtab) * (global.maxsock));
|
|
for (i = 0; i < global.maxsock; i++) {
|
|
fdtab[i].state = FD_STCLOSE;
|
|
}
|
|
}
|
|
|
|
/*
|
|
* this function starts all the proxies. It returns 0 if OK, -1 if not.
|
|
*/
|
|
int start_proxies() {
|
|
struct proxy *curproxy;
|
|
struct listener *listener;
|
|
int fd;
|
|
|
|
for (curproxy = proxy; curproxy != NULL; curproxy = curproxy->next) {
|
|
if (curproxy->state == PR_STDISABLED)
|
|
continue;
|
|
|
|
for (listener = curproxy->listen; listener != NULL; listener = listener->next) {
|
|
if ((fd = listener->fd =
|
|
socket(listener->addr.ss_family, SOCK_STREAM, IPPROTO_TCP)) == -1) {
|
|
Alert("cannot create listening socket for proxy %s. Aborting.\n",
|
|
curproxy->id);
|
|
return -1;
|
|
}
|
|
|
|
if (fd >= global.maxsock) {
|
|
Alert("socket(): not enough free sockets for proxy %s. Raise -n argument. Aborting.\n",
|
|
curproxy->id);
|
|
close(fd);
|
|
return -1;
|
|
}
|
|
|
|
if ((fcntl(fd, F_SETFL, O_NONBLOCK) == -1) ||
|
|
(setsockopt(fd, IPPROTO_TCP, TCP_NODELAY,
|
|
(char *) &one, sizeof(one)) == -1)) {
|
|
Alert("cannot make socket non-blocking for proxy %s. Aborting.\n",
|
|
curproxy->id);
|
|
close(fd);
|
|
return -1;
|
|
}
|
|
|
|
if (setsockopt(fd, SOL_SOCKET, SO_REUSEADDR, (char *) &one, sizeof(one)) == -1) {
|
|
Alert("cannot do so_reuseaddr for proxy %s. Continuing.\n",
|
|
curproxy->id);
|
|
}
|
|
|
|
if (bind(fd,
|
|
(struct sockaddr *)&listener->addr,
|
|
listener->addr.ss_family == AF_INET6 ?
|
|
sizeof(struct sockaddr_in6) :
|
|
sizeof(struct sockaddr_in)) == -1) {
|
|
Alert("cannot bind socket for proxy %s. Aborting.\n",
|
|
curproxy->id);
|
|
close(fd);
|
|
return -1;
|
|
}
|
|
|
|
if (listen(fd, curproxy->maxconn) == -1) {
|
|
Alert("cannot listen to socket for proxy %s. Aborting.\n",
|
|
curproxy->id);
|
|
close(fd);
|
|
return -1;
|
|
}
|
|
|
|
/* the function for the accept() event */
|
|
fdtab[fd].read = &event_accept;
|
|
fdtab[fd].write = NULL; /* never called */
|
|
fdtab[fd].owner = (struct task *)curproxy; /* reference the proxy instead of a task */
|
|
curproxy->state = PR_STRUN;
|
|
fdtab[fd].state = FD_STLISTEN;
|
|
FD_SET(fd, StaticReadEvent);
|
|
fd_insert(fd);
|
|
listeners++;
|
|
}
|
|
send_log(curproxy, LOG_NOTICE, "Proxy %s started.\n", curproxy->id);
|
|
}
|
|
return 0;
|
|
}
|
|
|
|
int match_str(const void *key1, const void *key2){
|
|
|
|
appsess *temp1,*temp2;
|
|
temp1 = (appsess *)key1;
|
|
temp2 = (appsess *)key2;
|
|
|
|
//fprintf(stdout,">>>>>>>>>>>>>>temp1->sessid :%s:\n",temp1->sessid);
|
|
//fprintf(stdout,">>>>>>>>>>>>>>temp2->sessid :%s:\n",temp2->sessid);
|
|
|
|
return (strcmp(temp1->sessid,temp2->sessid) == 0);
|
|
}/* end match_str */
|
|
|
|
void destroy(void *data){
|
|
appsess *temp1;
|
|
|
|
//printf("destroy called\n");
|
|
temp1 = (appsess *)data;
|
|
|
|
if (temp1->sessid)
|
|
pool_free_to(apools.sessid, temp1->sessid);
|
|
|
|
if (temp1->serverid)
|
|
pool_free_to(apools.serverid, temp1->serverid);
|
|
|
|
pool_free(appsess, temp1);
|
|
} /* end destroy */
|
|
|
|
void appsession_cleanup( void )
|
|
{
|
|
struct proxy *p = proxy;
|
|
|
|
while(p) {
|
|
chtbl_destroy(&(p->htbl_proxy));
|
|
p = p->next;
|
|
}
|
|
}/* end appsession_cleanup() */
|
|
|
|
void pool_destroy(void **pool)
|
|
{
|
|
void *temp, *next;
|
|
next = pool;
|
|
while (next) {
|
|
temp = next;
|
|
next = *(void **)temp;
|
|
free(temp);
|
|
}
|
|
}/* end pool_destroy() */
|
|
|
|
void deinit(void){
|
|
struct proxy *p = proxy;
|
|
struct cap_hdr *h,*h_next;
|
|
struct server *s,*s_next;
|
|
struct listener *l,*l_next;
|
|
|
|
while (p) {
|
|
if (p->id)
|
|
free(p->id);
|
|
|
|
if (p->check_req)
|
|
free(p->check_req);
|
|
|
|
if (p->cookie_name)
|
|
free(p->cookie_name);
|
|
|
|
if (p->capture_name)
|
|
free(p->capture_name);
|
|
|
|
/* only strup if the user have set in config.
|
|
When should we free it?!
|
|
if(p->errmsg.msg400) free(p->errmsg.msg400);
|
|
if(p->errmsg.msg403) free(p->errmsg.msg403);
|
|
if(p->errmsg.msg408) free(p->errmsg.msg408);
|
|
if(p->errmsg.msg500) free(p->errmsg.msg500);
|
|
if(p->errmsg.msg502) free(p->errmsg.msg502);
|
|
if(p->errmsg.msg503) free(p->errmsg.msg503);
|
|
if(p->errmsg.msg504) free(p->errmsg.msg504);
|
|
*/
|
|
if (p->appsession_name)
|
|
free(p->appsession_name);
|
|
|
|
h = p->req_cap;
|
|
while (h) {
|
|
h_next = h->next;
|
|
if (h->name)
|
|
free(h->name);
|
|
pool_destroy(h->pool);
|
|
free(h);
|
|
h = h_next;
|
|
}/* end while(h) */
|
|
|
|
h = p->rsp_cap;
|
|
while (h) {
|
|
h_next = h->next;
|
|
if (h->name)
|
|
free(h->name);
|
|
|
|
pool_destroy(h->pool);
|
|
free(h);
|
|
h = h_next;
|
|
}/* end while(h) */
|
|
|
|
s = p->srv;
|
|
while (s) {
|
|
s_next = s->next;
|
|
if(s->id)
|
|
free(s->id);
|
|
|
|
if(s->cookie)
|
|
free(s->cookie);
|
|
|
|
free(s);
|
|
s = s_next;
|
|
}/* end while(s) */
|
|
|
|
l = p->listen;
|
|
while (l) {
|
|
l_next = l->next;
|
|
free(l);
|
|
l = l_next;
|
|
}/* end while(l) */
|
|
|
|
pool_destroy((void **) p->req_cap_pool);
|
|
pool_destroy((void **) p->rsp_cap_pool);
|
|
p = p->next;
|
|
}/* end while(p) */
|
|
|
|
if (global.chroot) free(global.chroot);
|
|
if (global.pidfile) free(global.pidfile);
|
|
|
|
if (StaticReadEvent) free(StaticReadEvent);
|
|
if (StaticWriteEvent) free(StaticWriteEvent);
|
|
if (fdtab) free(fdtab);
|
|
|
|
pool_destroy(pool_session);
|
|
pool_destroy(pool_buffer);
|
|
pool_destroy(pool_fdtab);
|
|
pool_destroy(pool_requri);
|
|
pool_destroy(pool_task);
|
|
pool_destroy(pool_capture);
|
|
pool_destroy(pool_appsess);
|
|
|
|
if (have_appsession) {
|
|
pool_destroy(apools.serverid);
|
|
pool_destroy(apools.sessid);
|
|
}
|
|
} /* end deinit() */
|
|
|
|
int main(int argc, char **argv) {
|
|
FILE *pidfile = NULL;
|
|
init(argc, argv);
|
|
|
|
if (global.mode & MODE_QUIET) {
|
|
/* detach from the tty */
|
|
fclose(stdin); fclose(stdout); fclose(stderr);
|
|
close(0); close(1); close(2);
|
|
}
|
|
|
|
signal(SIGQUIT, dump);
|
|
signal(SIGUSR1, sig_soft_stop);
|
|
signal(SIGHUP, sig_dump_state);
|
|
#ifdef DEBUG_MEMORY
|
|
signal(SIGINT, sig_int);
|
|
signal(SIGTERM, sig_term);
|
|
#endif
|
|
|
|
/* on very high loads, a sigpipe sometimes happen just between the
|
|
* getsockopt() which tells "it's OK to write", and the following write :-(
|
|
*/
|
|
#ifndef MSG_NOSIGNAL
|
|
signal(SIGPIPE, SIG_IGN);
|
|
#endif
|
|
|
|
if (start_proxies() < 0)
|
|
exit(1);
|
|
|
|
/* open log & pid files before the chroot */
|
|
if (global.mode & MODE_DAEMON && global.pidfile != NULL) {
|
|
int pidfd;
|
|
unlink(global.pidfile);
|
|
pidfd = open(global.pidfile, O_CREAT | O_WRONLY | O_TRUNC, 0644);
|
|
if (pidfd < 0) {
|
|
Alert("[%s.main()] Cannot create pidfile %s\n", argv[0], global.pidfile);
|
|
exit(1);
|
|
}
|
|
pidfile = fdopen(pidfd, "w");
|
|
}
|
|
|
|
/* chroot if needed */
|
|
if (global.chroot != NULL) {
|
|
if (chroot(global.chroot) == -1) {
|
|
Alert("[%s.main()] Cannot chroot(%s).\n", argv[0], global.chroot);
|
|
exit(1);
|
|
}
|
|
chdir("/");
|
|
}
|
|
|
|
/* setgid / setuid */
|
|
if (global.gid && setgid(global.gid) == -1) {
|
|
Alert("[%s.main()] Cannot set gid %d.\n", argv[0], global.gid);
|
|
exit(1);
|
|
}
|
|
|
|
if (global.uid && setuid(global.uid) == -1) {
|
|
Alert("[%s.main()] Cannot set uid %d.\n", argv[0], global.uid);
|
|
exit(1);
|
|
}
|
|
|
|
if (global.mode & MODE_DAEMON) {
|
|
int ret = 0;
|
|
int proc;
|
|
|
|
/* the father launches the required number of processes */
|
|
for (proc = 0; proc < global.nbproc; proc++) {
|
|
ret = fork();
|
|
if (ret < 0) {
|
|
Alert("[%s.main()] Cannot fork.\n", argv[0]);
|
|
exit(1); /* there has been an error */
|
|
}
|
|
else if (ret == 0) /* child breaks here */
|
|
break;
|
|
if (pidfile != NULL) {
|
|
fprintf(pidfile, "%d\n", ret);
|
|
fflush(pidfile);
|
|
}
|
|
}
|
|
/* close the pidfile both in children and father */
|
|
if (pidfile != NULL)
|
|
fclose(pidfile);
|
|
free(global.pidfile);
|
|
|
|
if (proc == global.nbproc)
|
|
exit(0); /* parent must leave */
|
|
|
|
/* if we're NOT in QUIET mode, we should now close the 3 first FDs to ensure
|
|
* that we can detach from the TTY. We MUST NOT do it in other cases since
|
|
* it would have already be done, and 0-2 would have been affected to listening
|
|
* sockets
|
|
*/
|
|
if (!(global.mode & MODE_QUIET)) {
|
|
/* detach from the tty */
|
|
fclose(stdin); fclose(stdout); fclose(stderr);
|
|
close(0); close(1); close(2); /* close all fd's */
|
|
global.mode |= MODE_QUIET; /* ensure that we won't say anything from now */
|
|
}
|
|
pid = getpid(); /* update child's pid */
|
|
setsid();
|
|
}
|
|
|
|
#if defined(ENABLE_EPOLL)
|
|
if (cfg_polling_mechanism & POLL_USE_EPOLL) {
|
|
if (epoll_loop(POLL_LOOP_ACTION_INIT)) {
|
|
epoll_loop(POLL_LOOP_ACTION_RUN);
|
|
epoll_loop(POLL_LOOP_ACTION_CLEAN);
|
|
cfg_polling_mechanism &= POLL_USE_EPOLL;
|
|
}
|
|
else {
|
|
Warning("epoll() is not available. Using poll()/select() instead.\n");
|
|
cfg_polling_mechanism &= ~POLL_USE_EPOLL;
|
|
}
|
|
}
|
|
#endif
|
|
|
|
#if defined(ENABLE_POLL)
|
|
if (cfg_polling_mechanism & POLL_USE_POLL) {
|
|
if (poll_loop(POLL_LOOP_ACTION_INIT)) {
|
|
poll_loop(POLL_LOOP_ACTION_RUN);
|
|
poll_loop(POLL_LOOP_ACTION_CLEAN);
|
|
cfg_polling_mechanism &= POLL_USE_POLL;
|
|
}
|
|
else {
|
|
Warning("poll() is not available. Using select() instead.\n");
|
|
cfg_polling_mechanism &= ~POLL_USE_POLL;
|
|
}
|
|
}
|
|
#endif
|
|
if (cfg_polling_mechanism & POLL_USE_SELECT) {
|
|
if (select_loop(POLL_LOOP_ACTION_INIT)) {
|
|
select_loop(POLL_LOOP_ACTION_RUN);
|
|
select_loop(POLL_LOOP_ACTION_CLEAN);
|
|
cfg_polling_mechanism &= POLL_USE_SELECT;
|
|
}
|
|
}
|
|
|
|
|
|
/* Free all Hash Keys and all Hash elements */
|
|
appsession_cleanup();
|
|
/* Do some cleanup */
|
|
deinit();
|
|
|
|
exit(0);
|
|
}
|
|
|
|
#if defined(DEBUG_HASH)
|
|
static void print_table(const CHTbl *htbl) {
|
|
|
|
ListElmt *element;
|
|
int i;
|
|
appsess *asession;
|
|
|
|
/*****************************************************************************
|
|
* *
|
|
* Display the chained hash table. *
|
|
* *
|
|
*****************************************************************************/
|
|
|
|
fprintf(stdout, "Table size is %d\n", chtbl_size(htbl));
|
|
|
|
for (i = 0; i < TBLSIZ; i++) {
|
|
fprintf(stdout, "Bucket[%03d]\n", i);
|
|
|
|
for (element = list_head(&htbl->table[i]); element != NULL; element = list_next(element)) {
|
|
//fprintf(stdout, "%c", *(char *)list_data(element));
|
|
asession = (appsess *)list_data(element);
|
|
fprintf(stdout, "ELEM :%s:", asession->sessid);
|
|
fprintf(stdout, " Server :%s: \n", asession->serverid);
|
|
//fprintf(stdout, " Server request_count :%li:\n",asession->request_count);
|
|
}
|
|
|
|
fprintf(stdout, "\n");
|
|
}
|
|
return;
|
|
} /* end print_table */
|
|
#endif
|
|
|
|
static int appsession_init(void)
|
|
{
|
|
static int initialized = 0;
|
|
int idlen;
|
|
struct server *s;
|
|
struct proxy *p = proxy;
|
|
|
|
if (!initialized) {
|
|
if (!appsession_task_init()) {
|
|
apools.sessid = NULL;
|
|
apools.serverid = NULL;
|
|
apools.ser_waste = 0;
|
|
apools.ser_use = 0;
|
|
apools.ser_msize = sizeof(void *);
|
|
apools.ses_waste = 0;
|
|
apools.ses_use = 0;
|
|
apools.ses_msize = sizeof(void *);
|
|
while (p) {
|
|
s = p->srv;
|
|
if (apools.ses_msize < p->appsession_len)
|
|
apools.ses_msize = p->appsession_len;
|
|
while (s) {
|
|
idlen = strlen(s->id);
|
|
if (apools.ser_msize < idlen)
|
|
apools.ser_msize = idlen;
|
|
s = s->next;
|
|
}
|
|
p = p->next;
|
|
}
|
|
apools.ser_msize ++; /* we use strings, so reserve space for '\0' */
|
|
apools.ses_msize ++;
|
|
}
|
|
else {
|
|
fprintf(stderr, "appsession_task_init failed\n");
|
|
return -1;
|
|
}
|
|
initialized ++;
|
|
}
|
|
return 0;
|
|
}
|
|
|
|
static int appsession_task_init(void)
|
|
{
|
|
static int initialized = 0;
|
|
struct task *t;
|
|
if (!initialized) {
|
|
if ((t = pool_alloc(task)) == NULL)
|
|
return -1;
|
|
t->next = t->prev = t->rqnext = NULL;
|
|
t->wq = LIST_HEAD(wait_queue);
|
|
t->state = TASK_IDLE;
|
|
t->context = NULL;
|
|
tv_delayfrom(&t->expire, &now, TBLCHKINT);
|
|
task_queue(t);
|
|
t->process = appsession_refresh;
|
|
initialized ++;
|
|
}
|
|
return 0;
|
|
}
|
|
|
|
static int appsession_refresh(struct task *t) {
|
|
struct proxy *p = proxy;
|
|
CHTbl *htbl;
|
|
ListElmt *element, *last;
|
|
int i;
|
|
appsess *asession;
|
|
void *data;
|
|
|
|
while (p) {
|
|
if (p->appsession_name != NULL) {
|
|
htbl = &p->htbl_proxy;
|
|
/* if we ever give up the use of TBLSIZ, we need to change this */
|
|
for (i = 0; i < TBLSIZ; i++) {
|
|
last = NULL;
|
|
for (element = list_head(&htbl->table[i]); element != NULL; element = list_next(element)) {
|
|
asession = (appsess *)list_data(element);
|
|
if (tv_cmp2_ms(&asession->expire, &now) <= 0) {
|
|
if ((global.mode & MODE_DEBUG) && (!(global.mode & MODE_QUIET) || (global.mode & MODE_VERBOSE))) {
|
|
int len;
|
|
/*
|
|
on Linux NULL pointers are catched by sprintf, on solaris -> segfault
|
|
*/
|
|
len = sprintf(trash, "appsession_refresh: cleaning up expired Session '%s' on Server %s\n",
|
|
asession->sessid, asession->serverid?asession->serverid:"(null)");
|
|
write(1, trash, len);
|
|
}
|
|
/* delete the expired element from within the hash table */
|
|
if ((list_rem_next(&htbl->table[i], last, (void **)&data) == 0)
|
|
&& (htbl->table[i].destroy != NULL)) {
|
|
htbl->table[i].destroy(data);
|
|
}
|
|
if (last == NULL) {/* patient lost his head, get a new one */
|
|
element = list_head(&htbl->table[i]);
|
|
if (element == NULL) break; /* no heads left, go to next patient */
|
|
}
|
|
else
|
|
element = last;
|
|
}/* end if (tv_cmp2_ms(&asession->expire, &now) <= 0) */
|
|
else
|
|
last = element;
|
|
}/* end for (element = list_head(&htbl->table[i]); element != NULL; element = list_next(element)) */
|
|
}
|
|
}
|
|
p = p->next;
|
|
}
|
|
tv_delayfrom(&t->expire, &now, TBLCHKINT); /* check expiration every 5 seconds */
|
|
return TBLCHKINT;
|
|
} /* end appsession_refresh */
|
|
|