From baaee00406291f080f51cc743ed252c1b0ac7851 Mon Sep 17 00:00:00 2001 From: Willy Tarreau Date: Mon, 26 Jun 2006 02:48:02 +0200 Subject: [PATCH] [BIGMOVE] exploded the monolithic haproxy.c file into multiple files. The files are now stored under : - include/haproxy for the generic includes - include/types.h for the structures needed within prototypes - include/proto.h for function prototypes and inline functions - src/*.c for the C files Most include files are now covered by LGPL. A last move still needs to be done to put inline functions under GPL and not LGPL. Version has been set to 1.3.0 in the code but some control still needs to be done before releasing. --- Makefile | 29 +- Makefile.bsd | 4 +- ROADMAP | 40 + TODO | 8 + doc/buffers.fig | 1052 +++ doc/how-it-works.txt | 60 + haproxy.c | 10434 --------------------------- include/appsession.h | 44 - include/haproxy/appsession.h | 58 + include/{ => haproxy}/base64.h | 11 +- include/haproxy/cfgparse.h | 45 + include/{ => haproxy}/chtbl.h | 7 +- include/haproxy/compat.h | 62 + include/haproxy/config.h | 34 + include/haproxy/defaults.h | 94 + include/{ => haproxy}/epoll.h | 54 +- include/{ => haproxy}/hashpjw.h | 15 +- include/{ => haproxy}/list.h | 28 +- include/haproxy/memory.h | 122 + include/{ => haproxy}/mini-clist.h | 10 +- include/haproxy/regex.h | 61 + include/haproxy/standard.h | 92 + include/haproxy/template.h | 33 + include/haproxy/time.h | 176 + include/{ => haproxy}/uri_auth.h | 8 +- include/haproxy/version.h | 39 + include/proto/backend.h | 125 + include/proto/buffers.h | 85 + include/proto/checks.h | 36 + include/proto/client.h | 38 + include/proto/fd.h | 52 + include/proto/log.h | 84 + include/proto/polling.h | 72 + include/proto/proto_http.h | 49 + include/proto/proxy.h | 43 + include/proto/queue.h | 78 + include/proto/server.h | 42 + include/proto/session.h | 38 + include/proto/stream_sock.h | 63 + include/proto/task.h | 101 + include/proto/template.h | 36 + include/types/backend.h | 60 + include/types/buffers.h | 53 + include/types/capture.h | 43 + include/types/client.h | 45 + include/types/fd.h | 60 + include/types/global.h | 75 + include/types/httperr.h | 42 + include/types/log.h | 56 + include/types/polling.h | 74 + include/types/proto_http.h | 60 + include/types/proxy.h | 145 + include/types/queue.h | 47 + include/types/server.h | 87 + include/types/session.h | 166 + include/types/task.h | 58 + include/{ => types}/template.h | 16 +- src/appsession.c | 222 + src/backend.c | 618 ++ src/base64.c | 23 +- src/buffers.c | 116 + src/capture.c | 24 + src/cfgparse.c | 2058 ++++++ src/checks.c | 393 + src/chtbl.c | 301 +- src/client.c | 397 + src/fd.c | 503 ++ src/haproxy.c | 869 +++ src/hashpjw.c | 62 +- src/list.c | 269 +- src/log.c | 459 ++ src/polling.c | 455 ++ src/proto_http.c | 2769 +++++++ src/proxy.c | 357 + src/queue.c | 139 + src/regex.c | 130 + src/server.c | 23 + src/session.c | 73 + src/standard.c | 214 + src/stream_sock.c | 462 ++ src/task.c | 201 + src/time.c | 172 + src/uri_auth.c | 7 +- 83 files changed, 15105 insertions(+), 10860 deletions(-) create mode 100644 doc/buffers.fig create mode 100644 doc/how-it-works.txt delete mode 100644 haproxy.c delete mode 100644 include/appsession.h create mode 100644 include/haproxy/appsession.h rename include/{ => haproxy}/base64.h (66%) create mode 100644 include/haproxy/cfgparse.h rename include/{ => haproxy}/chtbl.h (96%) create mode 100644 include/haproxy/compat.h create mode 100644 include/haproxy/config.h create mode 100644 include/haproxy/defaults.h rename include/{ => haproxy}/epoll.h (53%) rename include/{ => haproxy}/hashpjw.h (83%) rename include/{ => haproxy}/list.h (85%) create mode 100644 include/haproxy/memory.h rename include/{ => haproxy}/mini-clist.h (95%) create mode 100644 include/haproxy/regex.h create mode 100644 include/haproxy/standard.h create mode 100644 include/haproxy/template.h create mode 100644 include/haproxy/time.h rename include/{ => haproxy}/uri_auth.h (94%) create mode 100644 include/haproxy/version.h create mode 100644 include/proto/backend.h create mode 100644 include/proto/buffers.h create mode 100644 include/proto/checks.h create mode 100644 include/proto/client.h create mode 100644 include/proto/fd.h create mode 100644 include/proto/log.h create mode 100644 include/proto/polling.h create mode 100644 include/proto/proto_http.h create mode 100644 include/proto/proxy.h create mode 100644 include/proto/queue.h create mode 100644 include/proto/server.h create mode 100644 include/proto/session.h create mode 100644 include/proto/stream_sock.h create mode 100644 include/proto/task.h create mode 100644 include/proto/template.h create mode 100644 include/types/backend.h create mode 100644 include/types/buffers.h create mode 100644 include/types/capture.h create mode 100644 include/types/client.h create mode 100644 include/types/fd.h create mode 100644 include/types/global.h create mode 100644 include/types/httperr.h create mode 100644 include/types/log.h create mode 100644 include/types/polling.h create mode 100644 include/types/proto_http.h create mode 100644 include/types/proxy.h create mode 100644 include/types/queue.h create mode 100644 include/types/server.h create mode 100644 include/types/session.h create mode 100644 include/types/task.h rename include/{ => types}/template.h (80%) create mode 100644 src/appsession.c create mode 100644 src/backend.c create mode 100644 src/buffers.c create mode 100644 src/capture.c create mode 100644 src/cfgparse.c create mode 100644 src/checks.c create mode 100644 src/client.c create mode 100644 src/fd.c create mode 100644 src/haproxy.c create mode 100644 src/log.c create mode 100644 src/polling.c create mode 100644 src/proto_http.c create mode 100644 src/proxy.c create mode 100644 src/queue.c create mode 100644 src/regex.c create mode 100644 src/server.c create mode 100644 src/session.c create mode 100644 src/standard.c create mode 100644 src/stream_sock.c create mode 100644 src/task.c create mode 100644 src/time.c diff --git a/Makefile b/Makefile index feec783d2..384bc38cf 100644 --- a/Makefile +++ b/Makefile @@ -2,7 +2,7 @@ # You should use it this way : # make TARGET=os CPU=cpu -VERSION := 1.2.14 +VERSION := 1.3.0 # Select target OS. TARGET must match a system for which COPTS and LIBS are # correctly defined below. @@ -91,17 +91,15 @@ ADDLIB = # set some defines when needed. # Known ones are -DENABLE_POLL, -DENABLE_EPOLL, and -DUSE_MY_EPOLL -# - use -DSTATTIME=0 to disable statistics, else specify an interval in -# milliseconds. # - use -DTPROXY to compile with transparent proxy support. -DEFINE = -DSTATTIME=0 -DTPROXY +DEFINE = -DTPROXY # global options TARGET_OPTS=$(COPTS.$(TARGET)) REGEX_OPTS=$(COPTS.$(REGEX)) CPU_OPTS=$(COPTS.$(CPU)) -COPTS=-I. $(ADDINC) $(CPU_OPTS) $(TARGET_OPTS) $(REGEX_OPTS) $(SMALL_OPTS) $(DEFINE) +COPTS=-Iinclude $(ADDINC) $(CPU_OPTS) $(TARGET_OPTS) $(REGEX_OPTS) $(SMALL_OPTS) $(DEFINE) LIBS=$(LIBS.$(TARGET)) $(LIBS.$(REGEX)) $(ADDLIB) CFLAGS = -Wall $(COPTS) $(DEBUG) @@ -109,18 +107,31 @@ LDFLAGS = -g all: haproxy -haproxy: src/list.o src/chtbl.o src/hashpjw.o haproxy.o src/base64.o src/uri_auth.o +OBJS = src/haproxy.o src/list.o src/chtbl.o src/hashpjw.o src/base64.o \ + src/uri_auth.o src/standard.o src/buffers.o src/log.o src/task.o \ + src/time.o src/fd.o src/regex.o src/cfgparse.o src/server.o \ + src/checks.o src/queue.o src/capture.o src/client.o src/proxy.o \ + src/proto_http.o src/stream_sock.o src/appsession.o src/backend.o \ + src/session.o + +haproxy: $(OBJS) $(LD) $(LDFLAGS) -o $@ $^ $(LIBS) +objsize: haproxy + @objdump -t $^|grep ' g '|grep -F '.text'|awk '{print $$5 FS $$6}'|sort + %.o: %.c $(CC) $(CFLAGS) -c -o $@ $< clean: - rm -f {.,src}/*.[oas] {.,src,include,doc}/*{~,.rej} core haproxy test nohup.out gmon.out - rm -f haproxy-$(VERSION).tar.gz haproxy-$(VERSION) + rm -f {.,src}/*.[oas] {.,src,include/*,doc}/*{~,.rej} core haproxy test + rm -f haproxy-$(VERSION).tar.gz haproxy-$(VERSION) nohup.out gmon.out tar: clean ln -s . haproxy-$(VERSION) - tar --exclude=haproxy-$(VERSION)/.git --exclude=haproxy-$(VERSION)/haproxy-$(VERSION) -cf - haproxy-$(VERSION)/* | gzip -c9 >haproxy-$(VERSION).tar.gz + tar --exclude=haproxy-$(VERSION)/.git \ + --exclude=haproxy-$(VERSION)/haproxy-$(VERSION) \ + --exclude=haproxy-$(VERSION)/haproxy-$(VERSION).tar.gz \ + -cf - haproxy-$(VERSION)/* | gzip -c9 >haproxy-$(VERSION).tar.gz rm -f haproxy-$(VERSION) diff --git a/Makefile.bsd b/Makefile.bsd index 3dbb1189d..cf190ef1f 100644 --- a/Makefile.bsd +++ b/Makefile.bsd @@ -62,10 +62,8 @@ ADDLIB = # set some defines when needed. # Known ones are -DENABLE_POLL, -DENABLE_EPOLL, and -DUSE_MY_EPOLL -# - use -DSTATTIME=0 to disable statistics, else specify an interval in -# milliseconds. # - use -DTPROXY to compile with transparent proxy support. -DEFINE = -DSTATTIME=0 -DTPROXY +DEFINE = -DTPROXY # global options TARGET_OPTS=$(COPTS.$(TARGET)) diff --git a/ROADMAP b/ROADMAP index c960c9b45..e529eb1fc 100644 --- a/ROADMAP +++ b/ROADMAP @@ -36,6 +36,46 @@ max(srv->maxconn * px->nbsess / px->maxconn, srv->minconn) 1.3 : + - remove unused STATTIME + + - reference all the include files that must be created, possibly under subdirs : + + - acl.h => more general ACL work + - appcook.h => appsession-related cookies + - backend.h => back-end part of the PR_O_* + backend definitions + - buffers.h => buffer management relying on memory.h + - capture.h => header and cookie capture + - cfgparse.h => configuration parser + - checks.h => health checks + - clireq.h => the client side "request" part of the current sessions. + - compat.h => compatibility with other OSes (TCP_NODELAY, ...) + - config.h => config parameters, renamed CONFIG_HAP_*, includes defaults.h + - controls.h => SN_CACHEABLE, ... + - cookies.h => definitions related to cookie management + SN_SCK_* + - defaults.h => many default values, might disappear soon after cleanup + - frontend.h => front-end part of the PR_O_* + client definitions + listeners + - global.h => shared global variables + - http.h => HTTP state definitions and transitions + - httperr.{hc} => HTTP return codes + - libtask.h => task scheduler + - libtime.h => time-related definitions + - loadbal.h => load balancing algorithms + - log.h => log definitions + - memory.h => pools + - polling.h => definitions of select(), poll(), INTBITS, ... + - queue.h => queue management + - regex.h => filtering + - servers.h => servers definitions (SRV_*, states, ...) + - fd.h => FD_ST* (add FD_DGRAM), RES_*, socket states, etc... + - srvreq.h => the server side "request" part of the current sessions. + - standard.h => general purpose macros and defines (eg: MIN/MAX, ...) + - startup.h => MODE_* + - tuning.h => platform-specific tuning parameters + + + - clarify licence by adding a 'MODULE_LICENCE("GPL")' or something equivalent. + + - handle half-closed connections better (cli/srv would not distinguish DATA/SHUTR/SHUTW, it would be a session flag which would tell shutr/shutw). Check how it got changed in httpterm. diff --git a/TODO b/TODO index 5b656290d..bd59aacdc 100644 --- a/TODO +++ b/TODO @@ -160,3 +160,11 @@ Todo for 1.2 - embedded error pages loaded in memory at startup time (eg: for expired time in connection queue) + +TODO for 1.3 +============ + - check all copyrights + - put haproxy/config.h in every include file. This one will automatically + include version.h, defaults.h and compat.h. + - fix Makefile.bsd + - separate inline functions to put them in files covered by GPL diff --git a/doc/buffers.fig b/doc/buffers.fig new file mode 100644 index 000000000..be6fac3cb --- /dev/null +++ b/doc/buffers.fig @@ -0,0 +1,1052 @@ +#FIG 3.2 Produced by xfig version 3.2.5-alpha5 +Portrait +Center +Metric +A4 +100.00 +Single +-2 +1200 2 +6 630 900 1620 1395 +5 1 0 1 0 4 51 -1 20 0.000 0 1 0 0 900.000 1125.000 900 900 675 1125 900 1350 +6 900 900 1620 1350 +2 1 0 1 0 7 50 -1 -1 0.000 0 0 -1 0 0 2 + 900 900 900 1350 +4 0 0 50 -1 16 8 0.0000 4 120 570 1035 1245 descriptor\001 +4 0 0 50 -1 16 8 0.0000 4 105 165 1035 1080 file\001 +-6 +-6 +6 630 1530 1620 2070 +6 630 1530 1170 2070 +5 1 0 1 0 11 51 -1 20 0.000 0 0 0 0 900.000 1800.000 900 1575 1125 1800 900 2025 +5 1 0 1 0 4 51 -1 20 0.000 0 1 0 0 900.000 1800.000 900 1575 675 1800 900 2025 +2 1 0 1 0 7 50 -1 -1 0.000 0 0 -1 0 0 2 + 900 1575 900 2025 +-6 +4 0 0 50 -1 16 8 0.0000 4 105 360 1260 1710 stream\001 +4 0 0 50 -1 16 8 0.0000 4 105 330 1260 1890 driver\001 +-6 +6 675 2340 2070 2610 +6 675 2340 1575 2610 +2 1 0 1 0 14 50 -1 -1 0.000 0 0 -1 0 0 2 + 1530 2340 1530 2610 +2 1 0 1 0 14 50 -1 -1 0.000 0 0 -1 0 0 2 + 1485 2340 1485 2610 +2 2 0 1 0 6 51 -1 20 0.000 1 0 -1 0 0 5 + 675 2340 1575 2340 1575 2610 675 2610 675 2340 +2 1 0 1 0 14 50 -1 -1 0.000 0 0 -1 0 0 2 + 720 2340 720 2610 +2 1 0 1 0 14 50 -1 -1 0.000 0 0 -1 0 0 2 + 765 2340 765 2610 +-6 +4 0 0 50 -1 16 8 0.0000 4 105 330 1710 2475 buffer\001 +-6 +6 2340 2205 3420 2745 +6 2340 2205 2610 2745 +5 1 0 1 0 14 51 -1 20 0.000 0 0 0 0 2475.000 2475.000 2610 2655 2475 2700 2340 2655 +5 1 0 1 0 14 51 -1 20 0.000 0 1 0 0 2475.000 2475.000 2610 2295 2475 2250 2340 2295 +2 2 0 1 14 14 52 -1 20 0.000 2 0 -1 0 0 5 + 2340 2295 2610 2295 2610 2655 2340 2655 2340 2295 +-6 +4 0 0 50 -1 16 8 0.0000 4 105 645 2745 2430 schedulable\001 +4 0 0 50 -1 16 8 0.0000 4 105 225 2745 2595 task\001 +-6 +6 4455 900 7200 2070 +6 4455 900 4725 1395 +5 1 0 1 0 11 51 -1 20 0.000 0 0 0 0 4455.000 1125.000 4455 900 4680 1125 4455 1350 +2 1 0 1 0 7 50 -1 -1 0.000 0 0 -1 0 0 2 + 4455 900 4455 1350 +-6 +6 5130 1170 5715 2070 +4 0 0 50 -1 16 8 0.0000 4 105 585 5130 1305 functions :\001 +4 0 0 50 -1 16 6 0.0000 4 75 315 5130 1440 -queue\001 +4 0 0 50 -1 16 6 0.0000 4 90 525 5130 1590 -shutdown\001 +4 0 0 50 -1 16 6 0.0000 4 90 300 5130 1740 -flush\001 +4 0 0 50 -1 16 6 0.0000 4 90 285 5130 1890 -send\001 +4 0 0 50 -1 16 6 0.0000 4 60 270 5130 2040 -recv\001 +-6 +6 6030 900 7200 2025 +4 0 0 50 -1 16 8 0.0000 4 105 555 6030 1035 callbacks :\001 +4 0 0 50 -1 16 6 0.0000 4 105 735 6030 1170 -read_complete\001 +4 0 0 50 -1 16 6 0.0000 4 105 780 6030 1320 -write_complete\001 +4 0 0 50 -1 16 6 0.0000 4 105 450 6030 1470 -wake_up\001 +4 0 0 50 -1 16 6 0.0000 4 105 1110 6030 1755 -context (for sessions)\001 +4 0 0 50 -1 16 6 0.0000 4 105 810 6030 1890 -source (=buffer)\001 +4 0 0 50 -1 16 6 0.0000 4 90 525 6030 2025 -condition\001 +4 0 0 50 -1 16 8 0.0000 4 120 1140 6030 1620 args for *_complete :\001 +-6 +2 1 0 1 0 -1 50 -1 -1 0.000 1 0 -1 1 0 3 + 0 0 1.00 30.00 45.00 + 4635 990 4905 990 5985 990 +2 1 0 1 0 -1 50 -1 -1 0.000 1 0 -1 0 1 3 + 0 0 1.00 30.00 45.00 + 4635 1260 4905 1260 5085 1260 +-6 +6 2205 1530 3420 2070 +6 2205 1530 2745 2070 +5 1 0 1 0 11 51 -1 20 0.000 0 1 0 0 2475.000 1800.000 2475 1575 2250 1800 2475 2025 +5 1 0 1 0 11 51 -1 20 0.000 0 0 0 0 2475.000 1800.000 2475 1575 2700 1800 2475 2025 +2 1 0 1 0 7 50 -1 -1 0.000 0 0 -1 0 0 2 + 2475 1575 2475 2025 +-6 +4 0 0 50 -1 16 8 0.0000 4 105 360 2835 1755 stream\001 +4 0 0 50 -1 16 8 0.0000 4 90 555 2835 1935 processor\001 +-6 +6 3825 2205 4905 2745 +6 3825 2205 4365 2745 +5 1 0 1 0 11 51 -1 20 0.000 0 0 0 0 4095.000 2475.000 4230 2295 4320 2475 4230 2655 +5 1 0 1 0 11 51 -1 20 0.000 0 1 0 0 4095.000 2475.000 3960 2295 3870 2475 3960 2655 +5 1 0 1 0 14 51 -1 20 0.000 0 0 0 0 4095.000 2475.000 4230 2655 4095 2700 3960 2655 +5 1 0 1 0 14 51 -1 20 0.000 0 1 0 0 4095.000 2475.000 4230 2295 4095 2250 3960 2295 +2 2 0 1 14 14 52 -1 20 0.000 2 0 -1 0 0 5 + 3960 2295 4230 2295 4230 2655 3960 2655 3960 2295 +-6 +4 0 0 50 -1 16 8 0.0000 4 105 240 4455 2430 flow\001 +4 0 0 50 -1 16 8 0.0000 4 120 450 4455 2610 analyzer\001 +-6 +6 2250 900 3960 1395 +6 2250 900 2520 1395 +5 1 0 1 0 11 51 -1 20 0.000 0 0 0 0 2250.000 1125.000 2250 900 2475 1125 2250 1350 +2 1 0 1 0 7 50 -1 -1 0.000 0 0 -1 0 0 2 + 2250 900 2250 1350 +-6 +4 0 0 50 -1 16 8 0.0000 4 105 1320 2610 1245 callbacks and functions.\001 +4 0 0 50 -1 16 8 0.0000 4 105 1335 2610 1080 stream interface made of\001 +-6 +6 7740 900 8775 3465 +6 7740 900 8640 1170 +2 1 0 1 0 14 50 -1 -1 0.000 0 0 -1 0 0 2 + 8595 900 8595 1170 +2 1 0 1 0 14 50 -1 -1 0.000 0 0 -1 0 0 2 + 8550 900 8550 1170 +2 2 0 1 0 6 51 -1 20 0.000 1 0 -1 0 0 5 + 7740 900 8640 900 8640 1170 7740 1170 7740 900 +2 1 0 1 0 14 50 -1 -1 0.000 0 0 -1 0 0 2 + 7785 900 7785 1170 +2 1 0 1 0 14 50 -1 -1 0.000 0 0 -1 0 0 2 + 7830 900 7830 1170 +4 1 0 50 -1 16 6 0.0000 4 105 420 8190 1080 http_req\001 +-6 +4 0 0 50 -1 16 8 0.0000 4 105 495 7740 1395 variables\001 +4 0 0 50 -1 16 6 0.0000 4 105 300 7740 1485 -flags\001 +4 0 0 50 -1 16 6 0.0000 4 105 720 7740 1755 -producer_task\001 +4 0 0 50 -1 16 6 0.0000 4 105 735 7740 1845 -consumer_task\001 +4 0 0 50 -1 16 6 0.0000 4 105 780 7740 1665 -write_complete\001 +4 0 0 50 -1 16 6 0.0000 4 105 735 7740 1575 -read_complete\001 +4 0 0 50 -1 16 8 0.0000 4 120 780 7740 2160 internal flags :\001 +4 0 0 50 -1 16 6 0.0000 4 90 960 7740 2295 -SHUTR_PENDING\001 +4 0 0 50 -1 16 6 0.0000 4 90 780 7740 2385 -SHUTR_DONE\001 +4 0 0 50 -1 16 6 0.0000 4 90 975 7740 2475 -SHUTW_PENDING\001 +4 0 0 50 -1 16 6 0.0000 4 90 795 7740 2565 -SHUTW_DONE\001 +4 0 0 50 -1 16 6 0.0000 4 75 450 7740 2655 -HOLDW\001 +4 0 0 50 -1 16 6 0.0000 4 90 585 7740 2745 -READ_EN\001 +4 0 0 50 -1 16 6 0.0000 4 90 600 7740 2835 -WRITE_EN\001 +4 0 0 50 -1 16 6 0.0000 4 105 945 7740 1935 -flow_analyzer_task\001 +4 0 0 50 -1 16 8 0.0000 4 105 540 7740 3015 interface :\001 +4 0 0 50 -1 16 6 0.0000 4 90 780 7740 3150 -1 stream reader\001 +4 0 0 50 -1 16 6 0.0000 4 90 780 7740 3285 -1 stream writer\001 +4 0 0 50 -1 16 6 0.0000 4 105 1020 7740 3420 -0..n stream analyzers\001 +-6 +6 3555 3645 5895 6075 +6 3555 3915 4095 4455 +5 1 0 1 0 11 51 -1 20 0.000 0 0 0 0 3825.000 4185.000 3825 3960 4050 4185 3825 4410 +5 1 0 1 0 4 51 -1 20 0.000 0 1 0 0 3825.000 4185.000 3825 3960 3600 4185 3825 4410 +2 1 0 1 0 7 50 -1 -1 0.000 0 0 -1 0 0 2 + 3825 3960 3825 4410 +-6 +6 5355 3915 5895 4455 +5 1 0 1 0 11 51 -1 20 0.000 0 1 0 0 5625.000 4185.000 5625 3960 5400 4185 5625 4410 +5 1 0 1 0 4 51 -1 20 0.000 0 0 0 0 5625.000 4185.000 5625 3960 5850 4185 5625 4410 +2 1 0 1 0 7 50 -1 -1 0.000 0 0 -1 0 0 2 + 5625 3960 5625 4410 +-6 +6 3555 5265 4095 5805 +5 1 0 1 0 11 51 -1 20 0.000 0 0 0 0 3825.000 5535.000 3825 5310 4050 5535 3825 5760 +5 1 0 1 0 4 51 -1 20 0.000 0 1 0 0 3825.000 5535.000 3825 5310 3600 5535 3825 5760 +2 1 0 1 0 7 50 -1 -1 0.000 0 0 -1 0 0 2 + 3825 5310 3825 5760 +-6 +6 5355 5265 5895 5805 +5 1 0 1 0 11 51 -1 20 0.000 0 1 0 0 5625.000 5535.000 5625 5310 5400 5535 5625 5760 +5 1 0 1 0 4 51 -1 20 0.000 0 0 0 0 5625.000 5535.000 5625 5310 5850 5535 5625 5760 +2 1 0 1 0 7 50 -1 -1 0.000 0 0 -1 0 0 2 + 5625 5310 5625 5760 +-6 +6 4455 4590 4995 5130 +5 1 0 1 0 11 51 -1 20 0.000 0 0 0 0 4725.000 4860.000 4860 4680 4950 4860 4860 5040 +5 1 0 1 0 11 51 -1 20 0.000 0 1 0 0 4725.000 4860.000 4590 4680 4500 4860 4590 5040 +5 1 0 1 0 14 51 -1 20 0.000 0 0 0 0 4725.000 4860.000 4860 5040 4725 5085 4590 5040 +5 1 0 1 0 14 51 -1 20 0.000 0 1 0 0 4725.000 4860.000 4860 4680 4725 4635 4590 4680 +2 2 0 1 14 14 52 -1 20 0.000 2 0 -1 0 0 5 + 4590 4680 4860 4680 4860 5040 4590 5040 4590 4680 +-6 +6 4275 5400 5175 5670 +2 1 0 1 0 14 50 -1 -1 0.000 0 0 -1 0 0 2 + 5130 5400 5130 5670 +2 1 0 1 0 14 50 -1 -1 0.000 0 0 -1 0 0 2 + 5085 5400 5085 5670 +2 2 0 1 0 6 51 -1 20 0.000 1 0 -1 0 0 5 + 4275 5400 5175 5400 5175 5670 4275 5670 4275 5400 +2 1 0 1 0 14 50 -1 -1 0.000 0 0 -1 0 0 2 + 4320 5400 4320 5670 +2 1 0 1 0 14 50 -1 -1 0.000 0 0 -1 0 0 2 + 4365 5400 4365 5670 +4 1 0 50 -1 16 6 0.0000 4 105 465 4725 5580 http_resp\001 +-6 +6 4275 4050 5175 4320 +2 1 0 1 0 14 50 -1 -1 0.000 0 0 -1 0 0 2 + 5130 4050 5130 4320 +2 1 0 1 0 14 50 -1 -1 0.000 0 0 -1 0 0 2 + 5085 4050 5085 4320 +2 2 0 1 0 6 51 -1 20 0.000 1 0 -1 0 0 5 + 4275 4050 5175 4050 5175 4320 4275 4320 4275 4050 +2 1 0 1 0 14 50 -1 -1 0.000 0 0 -1 0 0 2 + 4320 4050 4320 4320 +2 1 0 1 0 14 50 -1 -1 0.000 0 0 -1 0 0 2 + 4365 4050 4365 4320 +4 1 0 50 -1 16 6 0.0000 4 105 420 4725 4230 http_req\001 +-6 +2 1 0 1 0 0 50 -1 -1 0.000 1 0 -1 1 0 2 + 0 0 1.00 30.00 45.00 + 5175 4185 5400 4185 +2 1 0 1 0 0 50 -1 -1 0.000 1 0 -1 1 0 2 + 0 0 1.00 30.00 45.00 + 4050 4185 4275 4185 +2 1 0 1 0 14 50 -1 -1 0.000 1 0 -1 1 1 2 + 0 0 1.00 30.00 45.00 + 0 0 1.00 30.00 45.00 + 4725 4635 4725 4320 +2 1 0 1 0 14 50 -1 -1 0.000 1 0 -1 1 1 2 + 0 0 1.00 30.00 45.00 + 0 0 1.00 30.00 45.00 + 4725 5400 4725 5085 +2 1 0 1 0 0 50 -1 -1 0.000 1 0 -1 1 0 2 + 0 0 1.00 30.00 45.00 + 4275 5535 4050 5535 +2 1 0 1 0 0 50 -1 -1 0.000 1 0 -1 1 0 2 + 0 0 1.00 30.00 45.00 + 5400 5535 5175 5535 +4 1 0 50 -1 16 6 0.0000 4 90 285 5625 3870 driver\001 +4 1 0 50 -1 16 6 0.0000 4 105 300 5625 3735 output\001 +4 1 0 50 -1 16 6 0.0000 4 90 285 3825 3870 driver\001 +4 1 0 50 -1 16 6 0.0000 4 105 240 3825 3735 input\001 +4 0 0 50 -1 16 6 0.0000 4 90 405 5040 4950 eg: HTTP\001 +4 1 0 50 -1 16 6 0.0000 4 90 285 5625 6075 driver\001 +4 1 0 50 -1 16 6 0.0000 4 90 285 3825 6075 driver\001 +4 1 0 50 -1 16 6 0.0000 4 105 300 3825 5940 output\001 +4 1 0 50 -1 16 6 0.0000 4 105 240 5625 5940 input\001 +4 0 0 50 -1 16 6 0.0000 4 105 690 5040 4815 flow processor\001 +-6 +6 6480 4050 8820 5400 +5 1 0 1 0 11 51 -1 20 0.000 0 0 0 0 7650.000 4725.000 7785 4545 7875 4725 7785 4905 +5 1 0 1 0 11 51 -1 20 0.000 0 1 0 0 7650.000 4725.000 7515 4545 7425 4725 7515 4905 +5 1 0 1 0 14 51 -1 20 0.000 0 0 0 0 7650.000 4725.000 7785 4905 7650 4950 7515 4905 +5 1 0 1 0 14 51 -1 20 0.000 0 1 0 0 7650.000 4725.000 7785 4545 7650 4500 7515 4545 +6 6480 4455 7020 4995 +5 1 0 1 0 11 51 -1 20 0.000 0 0 0 0 6750.000 4725.000 6750 4500 6975 4725 6750 4950 +5 1 0 1 0 4 51 -1 20 0.000 0 1 0 0 6750.000 4725.000 6750 4500 6525 4725 6750 4950 +2 1 0 1 0 7 50 -1 -1 0.000 0 0 -1 0 0 2 + 6750 4500 6750 4950 +-6 +6 8280 4455 8820 4995 +5 1 0 1 0 11 51 -1 20 0.000 0 1 0 0 8550.000 4725.000 8550 4500 8325 4725 8550 4950 +5 1 0 1 0 4 51 -1 20 0.000 0 0 0 0 8550.000 4725.000 8550 4500 8775 4725 8550 4950 +2 1 0 1 0 7 50 -1 -1 0.000 0 0 -1 0 0 2 + 8550 4500 8550 4950 +-6 +6 7200 4050 8100 4320 +2 1 0 1 0 14 50 -1 -1 0.000 0 0 -1 0 0 2 + 8055 4050 8055 4320 +2 1 0 1 0 14 50 -1 -1 0.000 0 0 -1 0 0 2 + 8010 4050 8010 4320 +2 1 0 1 0 14 50 -1 -1 0.000 0 0 -1 0 0 2 + 7245 4050 7245 4320 +2 2 0 1 0 6 51 -1 20 0.000 1 0 -1 0 0 5 + 7200 4050 8100 4050 8100 4320 7200 4320 7200 4050 +2 1 0 1 0 14 50 -1 -1 0.000 0 0 -1 0 0 2 + 7290 4050 7290 4320 +4 1 0 50 -1 16 6 0.0000 4 105 420 7650 4230 http_req\001 +-6 +6 7200 5130 8100 5400 +2 1 0 1 0 14 50 -1 -1 0.000 0 0 -1 0 0 2 + 8055 5130 8055 5400 +2 1 0 1 0 14 50 -1 -1 0.000 0 0 -1 0 0 2 + 8010 5130 8010 5400 +2 2 0 1 0 6 51 -1 20 0.000 1 0 -1 0 0 5 + 7200 5130 8100 5130 8100 5400 7200 5400 7200 5130 +2 1 0 1 0 14 50 -1 -1 0.000 0 0 -1 0 0 2 + 7245 5130 7245 5400 +2 1 0 1 0 14 50 -1 -1 0.000 0 0 -1 0 0 2 + 7290 5130 7290 5400 +4 1 0 50 -1 16 6 0.0000 4 105 465 7650 5310 http_resp\001 +-6 +2 1 0 1 0 0 50 -1 -1 0.000 1 0 -1 1 0 2 + 0 0 1.00 30.00 45.00 + 8100 4185 8370 4590 +2 1 0 1 0 0 50 -1 -1 0.000 1 0 -1 1 0 2 + 0 0 1.00 30.00 45.00 + 6930 4590 7200 4185 +2 1 0 1 0 14 50 -1 -1 0.000 1 0 -1 1 1 2 + 0 0 1.00 30.00 45.00 + 0 0 1.00 30.00 45.00 + 7650 4500 7650 4320 +2 1 0 1 0 14 50 -1 -1 0.000 1 0 -1 1 1 2 + 0 0 1.00 30.00 45.00 + 0 0 1.00 30.00 45.00 + 7650 5130 7650 4950 +2 1 0 1 0 0 50 -1 -1 0.000 1 0 -1 1 0 2 + 0 0 1.00 30.00 45.00 + 7200 5265 6930 4860 +2 1 0 1 0 0 50 -1 -1 0.000 1 0 -1 1 0 2 + 0 0 1.00 30.00 45.00 + 8370 4860 8100 5265 +2 2 0 1 14 14 52 -1 20 0.000 2 0 -1 0 0 5 + 7515 4545 7785 4545 7785 4905 7515 4905 7515 4545 +4 1 0 50 -1 16 6 0.0000 4 60 285 6750 4230 server\001 +4 1 0 50 -1 16 6 0.0000 4 90 285 6750 4365 socket\001 +4 1 0 50 -1 16 6 0.0000 4 90 255 8550 4230 client\001 +4 1 0 50 -1 16 6 0.0000 4 90 285 8550 4365 socket\001 +4 1 0 50 -1 16 6 0.0000 4 105 210 7650 4770 http\001 +-6 +6 630 4005 2970 5490 +6 630 4680 1170 5220 +5 1 0 1 0 11 51 -1 20 0.000 0 0 0 0 900.000 4950.000 900 4725 1125 4950 900 5175 +5 1 0 1 0 4 51 -1 20 0.000 0 1 0 0 900.000 4950.000 900 4725 675 4950 900 5175 +2 1 0 1 0 7 50 -1 -1 0.000 0 0 -1 0 0 2 + 900 4725 900 5175 +-6 +6 2430 4680 2970 5220 +5 1 0 1 0 11 51 -1 20 0.000 0 1 0 0 2700.000 4950.000 2700 4725 2475 4950 2700 5175 +5 1 0 1 0 4 51 -1 20 0.000 0 0 0 0 2700.000 4950.000 2700 4725 2925 4950 2700 5175 +2 1 0 1 0 7 50 -1 -1 0.000 0 0 -1 0 0 2 + 2700 4725 2700 5175 +-6 +6 1530 4005 2070 4545 +5 1 0 1 0 11 51 -1 20 0.000 0 0 0 0 1800.000 4275.000 1935 4095 2025 4275 1935 4455 +5 1 0 1 0 11 51 -1 20 0.000 0 1 0 0 1800.000 4275.000 1665 4095 1575 4275 1665 4455 +5 1 0 1 0 14 51 -1 20 0.000 0 0 0 0 1800.000 4275.000 1935 4455 1800 4500 1665 4455 +5 1 0 1 0 14 51 -1 20 0.000 0 1 0 0 1800.000 4275.000 1935 4095 1800 4050 1665 4095 +2 2 0 1 14 14 52 -1 20 0.000 2 0 -1 0 0 5 + 1665 4095 1935 4095 1935 4455 1665 4455 1665 4095 +-6 +6 1350 4815 2250 5085 +2 1 0 1 0 14 50 -1 -1 0.000 0 0 -1 0 0 2 + 2205 4815 2205 5085 +2 1 0 1 0 14 50 -1 -1 0.000 0 0 -1 0 0 2 + 2160 4815 2160 5085 +2 2 0 1 0 6 51 -1 20 0.000 1 0 -1 0 0 5 + 1350 4815 2250 4815 2250 5085 1350 5085 1350 4815 +2 1 0 1 0 14 50 -1 -1 0.000 0 0 -1 0 0 2 + 1395 4815 1395 5085 +2 1 0 1 0 14 50 -1 -1 0.000 0 0 -1 0 0 2 + 1440 4815 1440 5085 +4 1 0 50 -1 16 6 0.0000 4 105 420 1800 4995 http_req\001 +-6 +2 1 0 1 0 0 50 -1 -1 0.000 1 0 -1 1 0 2 + 0 0 1.00 30.00 45.00 + 2250 4950 2475 4950 +2 1 0 1 0 14 50 -1 -1 0.000 1 0 -1 1 1 2 + 0 0 1.00 30.00 45.00 + 0 0 1.00 30.00 45.00 + 1800 4815 1800 4500 +2 1 0 1 0 0 50 -1 -1 0.000 1 0 -1 1 0 2 + 0 0 1.00 30.00 45.00 + 1125 4950 1350 4950 +4 0 0 50 -1 16 6 0.0000 4 105 690 2115 4365 eg: HTTP_REQ\001 +4 1 0 50 -1 16 6 0.0000 4 105 300 2700 5355 output\001 +4 1 0 50 -1 16 6 0.0000 4 90 285 2700 5490 driver\001 +4 1 0 50 -1 16 6 0.0000 4 105 240 900 5355 input\001 +4 1 0 50 -1 16 6 0.0000 4 90 285 900 5490 driver\001 +4 0 0 50 -1 16 6 0.0000 4 105 690 2115 4230 flow processor\001 +-6 +6 675 11025 6615 12555 +5 1 0 1 0 11 51 -1 20 0.000 0 0 0 0 3645.000 11790.000 3780 11610 3870 11790 3780 11970 +5 1 0 1 0 11 51 -1 20 0.000 0 1 0 0 3645.000 11790.000 3510 11610 3420 11790 3510 11970 +5 1 0 1 0 14 51 -1 20 0.000 0 0 0 0 3645.000 11790.000 3780 11970 3645 12015 3510 11970 +5 1 0 1 0 14 51 -1 20 0.000 0 1 0 0 3645.000 11790.000 3780 11610 3645 11565 3510 11610 +6 675 11520 1215 12060 +5 1 0 1 0 11 51 -1 20 0.000 0 0 0 0 945.000 11790.000 945 11565 1170 11790 945 12015 +5 1 0 1 0 4 51 -1 20 0.000 0 1 0 0 945.000 11790.000 945 11565 720 11790 945 12015 +2 1 0 1 0 7 50 -1 -1 0.000 0 0 -1 0 0 2 + 945 11565 945 12015 +-6 +6 3195 11115 4095 11385 +2 1 0 1 0 14 50 -1 -1 0.000 0 0 -1 0 0 2 + 4050 11115 4050 11385 +2 1 0 1 0 14 50 -1 -1 0.000 0 0 -1 0 0 2 + 4005 11115 4005 11385 +2 1 0 1 0 14 50 -1 -1 0.000 0 0 -1 0 0 2 + 3240 11115 3240 11385 +2 2 0 1 0 6 51 -1 20 0.000 1 0 -1 0 0 5 + 3195 11115 4095 11115 4095 11385 3195 11385 3195 11115 +2 1 0 1 0 14 50 -1 -1 0.000 0 0 -1 0 0 2 + 3285 11115 3285 11385 +4 1 0 50 -1 16 6 0.0000 4 105 420 3645 11295 http_req\001 +-6 +6 3195 12195 4095 12465 +2 1 0 1 0 14 50 -1 -1 0.000 0 0 -1 0 0 2 + 4050 12195 4050 12465 +2 1 0 1 0 14 50 -1 -1 0.000 0 0 -1 0 0 2 + 4005 12195 4005 12465 +2 2 0 1 0 6 51 -1 20 0.000 1 0 -1 0 0 5 + 3195 12195 4095 12195 4095 12465 3195 12465 3195 12195 +2 1 0 1 0 14 50 -1 -1 0.000 0 0 -1 0 0 2 + 3240 12195 3240 12465 +2 1 0 1 0 14 50 -1 -1 0.000 0 0 -1 0 0 2 + 3285 12195 3285 12465 +4 1 0 50 -1 16 6 0.0000 4 105 465 3645 12375 http_resp\001 +-6 +6 4275 11520 4815 12060 +5 1 0 1 0 11 51 -1 20 0.000 0 1 0 0 4545.000 11790.000 4545 11565 4320 11790 4545 12015 +5 1 0 1 0 11 51 -1 20 0.000 0 0 0 0 4545.000 11790.000 4545 11565 4770 11790 4545 12015 +2 1 0 1 0 7 50 -1 -1 0.000 0 0 -1 0 0 2 + 4545 11565 4545 12015 +-6 +6 2475 11520 3015 12060 +5 1 0 1 0 11 51 -1 20 0.000 0 1 0 0 2745.000 11790.000 2745 11565 2520 11790 2745 12015 +5 1 0 1 0 11 51 -1 20 0.000 0 0 0 0 2745.000 11790.000 2745 11565 2970 11790 2745 12015 +2 1 0 1 0 7 50 -1 -1 0.000 0 0 -1 0 0 2 + 2745 11565 2745 12015 +-6 +6 4995 11115 5895 11385 +2 1 0 1 0 14 50 -1 -1 0.000 0 0 -1 0 0 2 + 5850 11115 5850 11385 +2 1 0 1 0 14 50 -1 -1 0.000 0 0 -1 0 0 2 + 5805 11115 5805 11385 +2 1 0 1 0 14 50 -1 -1 0.000 0 0 -1 0 0 2 + 5040 11115 5040 11385 +2 2 0 1 0 6 51 -1 20 0.000 1 0 -1 0 0 5 + 4995 11115 5895 11115 5895 11385 4995 11385 4995 11115 +2 1 0 1 0 14 50 -1 -1 0.000 0 0 -1 0 0 2 + 5085 11115 5085 11385 +4 1 0 50 -1 16 6 0.0000 4 105 465 5445 11295 https_req\001 +-6 +6 4995 12195 5895 12465 +2 1 0 1 0 14 50 -1 -1 0.000 0 0 -1 0 0 2 + 5850 12195 5850 12465 +2 1 0 1 0 14 50 -1 -1 0.000 0 0 -1 0 0 2 + 5805 12195 5805 12465 +2 2 0 1 0 6 51 -1 20 0.000 1 0 -1 0 0 5 + 4995 12195 5895 12195 5895 12465 4995 12465 4995 12195 +2 1 0 1 0 14 50 -1 -1 0.000 0 0 -1 0 0 2 + 5040 12195 5040 12465 +2 1 0 1 0 14 50 -1 -1 0.000 0 0 -1 0 0 2 + 5085 12195 5085 12465 +4 1 0 50 -1 16 6 0.0000 4 105 510 5445 12375 https_resp\001 +-6 +6 1395 11115 2295 11385 +2 1 0 1 0 14 50 -1 -1 0.000 0 0 -1 0 0 2 + 2250 11115 2250 11385 +2 1 0 1 0 14 50 -1 -1 0.000 0 0 -1 0 0 2 + 2205 11115 2205 11385 +2 1 0 1 0 14 50 -1 -1 0.000 0 0 -1 0 0 2 + 1440 11115 1440 11385 +2 2 0 1 0 6 51 -1 20 0.000 1 0 -1 0 0 5 + 1395 11115 2295 11115 2295 11385 1395 11385 1395 11115 +2 1 0 1 0 14 50 -1 -1 0.000 0 0 -1 0 0 2 + 1485 11115 1485 11385 +4 1 0 50 -1 16 6 0.0000 4 105 465 1845 11295 https_req\001 +-6 +6 1395 12195 2295 12465 +2 1 0 1 0 14 50 -1 -1 0.000 0 0 -1 0 0 2 + 2250 12195 2250 12465 +2 1 0 1 0 14 50 -1 -1 0.000 0 0 -1 0 0 2 + 2205 12195 2205 12465 +2 2 0 1 0 6 51 -1 20 0.000 1 0 -1 0 0 5 + 1395 12195 2295 12195 2295 12465 1395 12465 1395 12195 +2 1 0 1 0 14 50 -1 -1 0.000 0 0 -1 0 0 2 + 1440 12195 1440 12465 +2 1 0 1 0 14 50 -1 -1 0.000 0 0 -1 0 0 2 + 1485 12195 1485 12465 +4 1 0 50 -1 16 6 0.0000 4 105 510 1845 12375 https_resp\001 +-6 +6 6075 11520 6615 12060 +5 1 0 1 0 11 51 -1 20 0.000 0 1 0 0 6345.000 11790.000 6345 11565 6120 11790 6345 12015 +5 1 0 1 0 4 51 -1 20 0.000 0 0 0 0 6345.000 11790.000 6345 11565 6570 11790 6345 12015 +2 1 0 1 0 7 50 -1 -1 0.000 0 0 -1 0 0 2 + 6345 11565 6345 12015 +-6 +6 675 12195 1170 12555 +2 4 0 1 16 17 53 -1 -1 0.000 0 0 7 0 0 5 + 1170 12555 1170 12195 675 12195 675 12555 1170 12555 +4 1 0 50 -1 16 6 0.0000 4 90 450 900 12420 TCPv4_S\001 +-6 +6 6120 12195 6615 12555 +2 4 0 1 16 17 53 -1 -1 0.000 0 0 7 0 0 5 + 6615 12555 6615 12195 6120 12195 6120 12555 6615 12555 +4 1 0 50 -1 16 6 0.0000 4 90 450 6345 12420 TCPv4_S\001 +-6 +2 1 0 1 0 0 50 -1 -1 0.000 1 0 -1 1 0 2 + 0 0 1.00 30.00 45.00 + 1125 11655 1395 11250 +2 1 0 1 0 0 50 -1 -1 0.000 1 0 -1 1 0 2 + 0 0 1.00 30.00 45.00 + 1395 12330 1125 11925 +2 1 0 1 0 14 50 -1 -1 0.000 1 0 -1 1 1 2 + 0 0 1.00 30.00 45.00 + 0 0 1.00 30.00 45.00 + 3645 11565 3645 11385 +2 1 0 1 0 14 50 -1 -1 0.000 1 0 -1 1 1 2 + 0 0 1.00 30.00 45.00 + 0 0 1.00 30.00 45.00 + 3645 12195 3645 12015 +2 1 0 1 0 0 50 -1 -1 0.000 1 0 -1 1 0 2 + 0 0 1.00 30.00 45.00 + 4995 12330 4725 11925 +2 1 0 1 0 0 50 -1 -1 0.000 1 0 -1 1 0 2 + 0 0 1.00 30.00 45.00 + 4725 11655 4995 11250 +2 1 0 1 0 0 50 -1 -1 0.000 1 0 -1 1 0 2 + 0 0 1.00 30.00 45.00 + 4375 11925 4105 12330 +2 1 0 1 0 0 50 -1 -1 0.000 1 0 -1 1 0 2 + 0 0 1.00 30.00 45.00 + 4095 11250 4365 11655 +2 1 0 1 0 0 50 -1 -1 0.000 1 0 -1 1 0 2 + 0 0 1.00 30.00 45.00 + 3195 12330 2925 11925 +2 1 0 1 0 0 50 -1 -1 0.000 1 0 -1 1 0 2 + 0 0 1.00 30.00 45.00 + 2925 11655 3195 11250 +2 1 0 1 0 0 50 -1 -1 0.000 1 0 -1 1 0 2 + 0 0 1.00 30.00 45.00 + 2575 11925 2305 12330 +2 1 0 1 0 0 50 -1 -1 0.000 1 0 -1 1 0 2 + 0 0 1.00 30.00 45.00 + 2295 11250 2565 11655 +2 1 0 1 0 0 50 -1 -1 0.000 1 0 -1 1 0 2 + 0 0 1.00 30.00 45.00 + 5895 11250 6165 11655 +2 1 0 1 0 0 50 -1 -1 0.000 1 0 -1 1 0 2 + 0 0 1.00 30.00 45.00 + 6165 11925 5895 12330 +2 2 0 1 14 14 52 -1 20 0.000 2 0 -1 0 0 5 + 3510 11610 3780 11610 3780 11970 3510 11970 3510 11610 +2 4 0 1 16 17 54 -1 20 0.000 0 0 7 0 0 5 + 3150 12555 3150 11025 675 11025 675 12555 3150 12555 +2 3 0 1 28 30 53 -1 20 0.000 1 0 -1 0 0 11 + 6120 11070 5895 11565 5895 12015 6120 12510 4950 12510 4410 12510 + 4185 12015 4185 11565 4410 11070 4995 11070 6120 11070 +2 4 0 1 16 17 54 -1 20 0.000 0 0 7 0 0 5 + 6615 12555 6615 11025 4140 11025 4140 12555 6615 12555 +2 3 0 1 28 30 53 -1 20 0.000 0 0 -1 0 0 11 + 1170 11070 1395 11565 1395 12015 1170 12510 2340 12510 2880 12510 + 3105 12015 3105 11565 2880 11070 2295 11070 1170 11070 +4 1 0 50 -1 16 6 0.0000 4 60 285 945 11295 server\001 +4 1 0 50 -1 16 6 0.0000 4 90 285 945 11430 socket\001 +4 1 0 50 -1 16 6 0.0000 4 75 210 4545 11430 SSL\001 +4 1 0 50 -1 16 6 0.0000 4 75 210 2745 11430 SSL\001 +4 1 0 50 -1 16 6 0.0000 4 90 255 6345 11295 client\001 +4 1 0 50 -1 16 6 0.0000 4 90 285 6345 11430 socket\001 +4 1 0 50 -1 16 6 0.0000 4 105 210 3645 11835 http\001 +-6 +6 630 6750 2970 8100 +6 630 7155 1170 7695 +5 1 0 1 0 11 51 -1 20 0.000 0 0 0 0 900.000 7425.000 900 7200 1125 7425 900 7650 +5 1 0 1 0 4 51 -1 20 0.000 0 1 0 0 900.000 7425.000 900 7200 675 7425 900 7650 +2 1 0 1 0 7 50 -1 -1 0.000 0 0 -1 0 0 2 + 900 7200 900 7650 +-6 +6 2430 7155 2970 7695 +5 1 0 1 0 11 51 -1 20 0.000 0 1 0 0 2700.000 7425.000 2700 7200 2475 7425 2700 7650 +5 1 0 1 0 4 51 -1 20 0.000 0 0 0 0 2700.000 7425.000 2700 7200 2925 7425 2700 7650 +2 1 0 1 0 7 50 -1 -1 0.000 0 0 -1 0 0 2 + 2700 7200 2700 7650 +-6 +6 1350 6750 2250 7020 +2 1 0 1 0 14 50 -1 -1 0.000 0 0 -1 0 0 2 + 2205 6750 2205 7020 +2 1 0 1 0 14 50 -1 -1 0.000 0 0 -1 0 0 2 + 2160 6750 2160 7020 +2 1 0 1 0 14 50 -1 -1 0.000 0 0 -1 0 0 2 + 1395 6750 1395 7020 +2 2 0 1 0 6 51 -1 20 0.000 1 0 -1 0 0 5 + 1350 6750 2250 6750 2250 7020 1350 7020 1350 6750 +2 1 0 1 0 14 50 -1 -1 0.000 0 0 -1 0 0 2 + 1440 6750 1440 7020 +4 1 0 50 -1 16 6 0.0000 4 105 420 1800 6930 http_req\001 +-6 +6 1305 7020 1845 7830 +5 1 0 1 0 11 51 -1 20 0.000 0 0 0 0 1575.000 7425.000 1710 7245 1800 7425 1710 7605 +5 1 0 1 0 11 51 -1 20 0.000 0 1 0 0 1575.000 7425.000 1440 7245 1350 7425 1440 7605 +5 1 0 1 0 14 51 -1 20 0.000 0 0 0 0 1575.000 7425.000 1710 7605 1575 7650 1440 7605 +5 1 0 1 0 14 51 -1 20 0.000 0 1 0 0 1575.000 7425.000 1710 7245 1575 7200 1440 7245 +2 1 0 1 0 14 50 -1 -1 0.000 1 0 -1 1 1 2 + 0 0 1.00 30.00 45.00 + 0 0 1.00 30.00 45.00 + 1575 7200 1575 7020 +2 1 0 1 0 14 50 -1 -1 0.000 1 0 -1 1 1 2 + 0 0 1.00 30.00 45.00 + 0 0 1.00 30.00 45.00 + 1575 7830 1575 7650 +2 2 0 1 14 14 52 -1 20 0.000 2 0 -1 0 0 5 + 1440 7245 1710 7245 1710 7605 1440 7605 1440 7245 +4 1 0 50 -1 16 6 0.0000 4 105 210 1575 7470 http\001 +-6 +6 1755 7020 2295 7830 +5 1 0 1 0 14 51 -1 20 0.000 0 0 0 0 2025.000 7425.000 2160 7605 2025 7650 1890 7605 +5 1 0 1 0 14 51 -1 20 0.000 0 1 0 0 2025.000 7425.000 2160 7245 2025 7200 1890 7245 +5 1 0 1 0 11 51 -1 20 0.000 0 1 0 0 2025.000 7425.000 1890 7245 1800 7425 1890 7605 +5 1 0 1 0 11 51 -1 20 0.000 0 0 0 0 2025.000 7425.000 2160 7245 2250 7425 2160 7605 +2 1 0 1 0 14 50 -1 -1 0.000 1 0 -1 1 1 2 + 0 0 1.00 30.00 45.00 + 0 0 1.00 30.00 45.00 + 2025 7200 2025 7020 +2 1 0 1 0 14 50 -1 -1 0.000 1 0 -1 1 1 2 + 0 0 1.00 30.00 45.00 + 0 0 1.00 30.00 45.00 + 2025 7830 2025 7650 +2 2 0 1 14 14 52 -1 20 0.000 2 0 -1 0 0 5 + 1890 7245 2160 7245 2160 7605 1890 7605 1890 7245 +4 1 0 50 -1 16 6 0.0000 4 105 390 2025 7470 filtering\001 +-6 +6 1350 7830 2250 8100 +2 1 0 1 0 14 50 -1 -1 0.000 0 0 -1 0 0 2 + 2205 7830 2205 8100 +2 1 0 1 0 14 50 -1 -1 0.000 0 0 -1 0 0 2 + 2160 7830 2160 8100 +2 2 0 1 0 6 51 -1 20 0.000 1 0 -1 0 0 5 + 1350 7830 2250 7830 2250 8100 1350 8100 1350 7830 +2 1 0 1 0 14 50 -1 -1 0.000 0 0 -1 0 0 2 + 1395 7830 1395 8100 +2 1 0 1 0 14 50 -1 -1 0.000 0 0 -1 0 0 2 + 1440 7830 1440 8100 +4 1 0 50 -1 16 6 0.0000 4 105 465 1800 8010 http_resp\001 +-6 +2 1 0 1 0 0 50 -1 -1 0.000 1 0 -1 1 0 2 + 0 0 1.00 30.00 45.00 + 2250 6885 2520 7290 +2 1 0 1 0 0 50 -1 -1 0.000 1 0 -1 1 0 2 + 0 0 1.00 30.00 45.00 + 1080 7290 1350 6885 +2 1 0 1 0 0 50 -1 -1 0.000 1 0 -1 1 0 2 + 0 0 1.00 30.00 45.00 + 1350 7965 1080 7560 +2 1 0 1 0 0 50 -1 -1 0.000 1 0 -1 1 0 2 + 0 0 1.00 30.00 45.00 + 2520 7560 2250 7965 +4 1 0 50 -1 16 6 0.0000 4 60 285 900 6930 server\001 +4 1 0 50 -1 16 6 0.0000 4 90 285 900 7065 socket\001 +4 1 0 50 -1 16 6 0.0000 4 90 255 2700 6930 client\001 +4 1 0 50 -1 16 6 0.0000 4 90 285 2700 7065 socket\001 +-6 +6 4680 9000 8820 10530 +5 1 0 1 0 11 51 -1 20 0.000 0 0 0 0 7650.000 9765.000 7785 9585 7875 9765 7785 9945 +5 1 0 1 0 11 51 -1 20 0.000 0 1 0 0 7650.000 9765.000 7515 9585 7425 9765 7515 9945 +5 1 0 1 0 14 51 -1 20 0.000 0 0 0 0 7650.000 9765.000 7785 9945 7650 9990 7515 9945 +5 1 0 1 0 14 51 -1 20 0.000 0 1 0 0 7650.000 9765.000 7785 9585 7650 9540 7515 9585 +6 4680 9495 5220 10035 +5 1 0 1 0 11 51 -1 20 0.000 0 0 0 0 4950.000 9765.000 4950 9540 5175 9765 4950 9990 +5 1 0 1 0 4 51 -1 20 0.000 0 1 0 0 4950.000 9765.000 4950 9540 4725 9765 4950 9990 +2 1 0 1 0 7 50 -1 -1 0.000 0 0 -1 0 0 2 + 4950 9540 4950 9990 +-6 +6 8280 9495 8820 10035 +5 1 0 1 0 11 51 -1 20 0.000 0 1 0 0 8550.000 9765.000 8550 9540 8325 9765 8550 9990 +5 1 0 1 0 4 51 -1 20 0.000 0 0 0 0 8550.000 9765.000 8550 9540 8775 9765 8550 9990 +2 1 0 1 0 7 50 -1 -1 0.000 0 0 -1 0 0 2 + 8550 9540 8550 9990 +-6 +6 7200 9090 8100 9360 +2 1 0 1 0 14 50 -1 -1 0.000 0 0 -1 0 0 2 + 8055 9090 8055 9360 +2 1 0 1 0 14 50 -1 -1 0.000 0 0 -1 0 0 2 + 8010 9090 8010 9360 +2 1 0 1 0 14 50 -1 -1 0.000 0 0 -1 0 0 2 + 7245 9090 7245 9360 +2 2 0 1 0 6 51 -1 20 0.000 1 0 -1 0 0 5 + 7200 9090 8100 9090 8100 9360 7200 9360 7200 9090 +2 1 0 1 0 14 50 -1 -1 0.000 0 0 -1 0 0 2 + 7290 9090 7290 9360 +4 1 0 50 -1 16 6 0.0000 4 105 420 7650 9270 http_req\001 +-6 +6 7200 10170 8100 10440 +2 1 0 1 0 14 50 -1 -1 0.000 0 0 -1 0 0 2 + 8055 10170 8055 10440 +2 1 0 1 0 14 50 -1 -1 0.000 0 0 -1 0 0 2 + 8010 10170 8010 10440 +2 2 0 1 0 6 51 -1 20 0.000 1 0 -1 0 0 5 + 7200 10170 8100 10170 8100 10440 7200 10440 7200 10170 +2 1 0 1 0 14 50 -1 -1 0.000 0 0 -1 0 0 2 + 7245 10170 7245 10440 +2 1 0 1 0 14 50 -1 -1 0.000 0 0 -1 0 0 2 + 7290 10170 7290 10440 +4 1 0 50 -1 16 6 0.0000 4 105 465 7650 10350 http_resp\001 +-6 +6 6480 9495 7020 10035 +5 1 0 1 0 11 51 -1 20 0.000 0 1 0 0 6750.000 9765.000 6750 9540 6525 9765 6750 9990 +5 1 0 1 0 11 51 -1 20 0.000 0 0 0 0 6750.000 9765.000 6750 9540 6975 9765 6750 9990 +2 1 0 1 0 7 50 -1 -1 0.000 0 0 -1 0 0 2 + 6750 9540 6750 9990 +-6 +6 5400 10170 6300 10440 +2 1 0 1 0 14 50 -1 -1 0.000 0 0 -1 0 0 2 + 6255 10170 6255 10440 +2 1 0 1 0 14 50 -1 -1 0.000 0 0 -1 0 0 2 + 6210 10170 6210 10440 +2 2 0 1 0 6 51 -1 20 0.000 1 0 -1 0 0 5 + 5400 10170 6300 10170 6300 10440 5400 10440 5400 10170 +2 1 0 1 0 14 50 -1 -1 0.000 0 0 -1 0 0 2 + 5445 10170 5445 10440 +2 1 0 1 0 14 50 -1 -1 0.000 0 0 -1 0 0 2 + 5490 10170 5490 10440 +4 1 0 50 -1 16 6 0.0000 4 105 510 5850 10350 https_resp\001 +-6 +6 5400 9090 6300 9360 +2 1 0 1 0 14 50 -1 -1 0.000 0 0 -1 0 0 2 + 6255 9090 6255 9360 +2 1 0 1 0 14 50 -1 -1 0.000 0 0 -1 0 0 2 + 6210 9090 6210 9360 +2 1 0 1 0 14 50 -1 -1 0.000 0 0 -1 0 0 2 + 5445 9090 5445 9360 +2 2 0 1 0 6 51 -1 20 0.000 1 0 -1 0 0 5 + 5400 9090 6300 9090 6300 9360 5400 9360 5400 9090 +2 1 0 1 0 14 50 -1 -1 0.000 0 0 -1 0 0 2 + 5490 9090 5490 9360 +4 1 0 50 -1 16 6 0.0000 4 105 465 5850 9270 https_req\001 +-6 +6 4680 10170 5175 10530 +2 4 0 1 16 17 53 -1 -1 0.000 0 0 7 0 0 5 + 5175 10530 5175 10170 4680 10170 4680 10530 5175 10530 +4 1 0 50 -1 16 6 0.0000 4 90 450 4905 10395 TCPv4_S\001 +-6 +2 1 0 1 0 0 50 -1 -1 0.000 1 0 -1 1 0 2 + 0 0 1.00 30.00 45.00 + 5130 9630 5400 9225 +2 1 0 1 0 0 50 -1 -1 0.000 1 0 -1 1 0 2 + 0 0 1.00 30.00 45.00 + 5400 10305 5130 9900 +2 1 0 1 0 0 50 -1 -1 0.000 1 0 -1 1 0 2 + 0 0 1.00 30.00 45.00 + 8100 9225 8370 9630 +2 1 0 1 0 14 50 -1 -1 0.000 1 0 -1 1 1 2 + 0 0 1.00 30.00 45.00 + 0 0 1.00 30.00 45.00 + 7650 9540 7650 9360 +2 1 0 1 0 14 50 -1 -1 0.000 1 0 -1 1 1 2 + 0 0 1.00 30.00 45.00 + 0 0 1.00 30.00 45.00 + 7650 10170 7650 9990 +2 1 0 1 0 0 50 -1 -1 0.000 1 0 -1 1 0 2 + 0 0 1.00 30.00 45.00 + 7200 10305 6930 9900 +2 1 0 1 0 0 50 -1 -1 0.000 1 0 -1 1 0 2 + 0 0 1.00 30.00 45.00 + 8370 9900 8100 10305 +2 1 0 1 0 0 50 -1 -1 0.000 1 0 -1 1 0 2 + 0 0 1.00 30.00 45.00 + 6930 9630 7200 9225 +2 1 0 1 0 0 50 -1 -1 0.000 1 0 -1 1 0 2 + 0 0 1.00 30.00 45.00 + 6580 9900 6310 10305 +2 1 0 1 0 0 50 -1 -1 0.000 1 0 -1 1 0 2 + 0 0 1.00 30.00 45.00 + 6300 9225 6570 9630 +2 2 0 1 14 14 52 -1 20 0.000 2 0 -1 0 0 5 + 7515 9585 7785 9585 7785 9945 7515 9945 7515 9585 +2 4 0 1 16 17 54 -1 20 0.000 0 0 7 0 0 5 + 7155 10530 7155 9000 4680 9000 4680 10530 7155 10530 +2 3 0 1 28 30 53 -1 20 0.000 1 0 -1 0 0 11 + 5175 9045 5400 9540 5400 9990 5175 10485 6345 10485 6885 10485 + 7110 9990 7110 9540 6885 9045 6300 9045 5175 9045 +4 1 0 50 -1 16 6 0.0000 4 60 285 4950 9270 server\001 +4 1 0 50 -1 16 6 0.0000 4 90 285 4950 9405 socket\001 +4 1 0 50 -1 16 6 0.0000 4 90 255 8550 9270 client\001 +4 1 0 50 -1 16 6 0.0000 4 90 285 8550 9405 socket\001 +4 1 0 50 -1 16 6 0.0000 4 75 210 6750 9405 SSL\001 +4 1 0 50 -1 16 6 0.0000 4 105 210 7650 9810 http\001 +-6 +6 675 9000 4275 10575 +6 1800 9900 2250 10125 +2 2 0 1 29 30 51 -1 20 0.000 0 0 -1 0 0 5 + 1800 9900 2250 9900 2250 10125 1800 10125 1800 9900 +4 1 0 50 -1 16 6 0.0000 4 75 210 2025 10035 SSL\001 +-6 +6 2700 9900 3150 10125 +2 2 0 1 29 30 51 -1 20 0.000 0 0 -1 0 0 5 + 2700 9900 3150 9900 3150 10125 2700 10125 2700 9900 +4 1 0 50 -1 16 6 0.0000 4 75 210 2925 10035 SSL\001 +-6 +6 3600 9900 4050 10125 +2 2 0 1 29 30 51 -1 20 0.000 0 0 -1 0 0 5 + 3600 9900 4050 9900 4050 10125 3600 10125 3600 9900 +4 1 0 50 -1 16 6 0.0000 4 75 210 3825 10035 SSL\001 +-6 +6 900 9900 1350 10125 +2 2 0 1 29 30 51 -1 20 0.000 0 0 -1 0 0 5 + 900 9900 1350 9900 1350 10125 900 10125 900 9900 +4 1 0 50 -1 16 6 0.0000 4 75 210 1125 10035 SSL\001 +-6 +6 2520 10350 3330 10575 +2 2 0 1 16 17 51 -1 20 0.000 0 0 -1 0 0 5 + 2520 10350 3330 10350 3330 10575 2520 10575 2520 10350 +4 1 0 50 -1 16 6 0.0000 4 90 510 2925 10485 UNIX_STR\001 +-6 +6 1125 9450 1575 9675 +2 2 0 1 9 11 51 -1 20 0.000 0 0 -1 0 0 5 + 1125 9450 1575 9450 1575 9675 1125 9675 1125 9450 +4 1 0 50 -1 16 6 0.0000 4 90 315 1350 9585 deflate\001 +-6 +6 2025 9450 2475 9675 +2 2 0 1 9 11 51 -1 20 0.000 0 0 -1 0 0 5 + 2025 9450 2475 9450 2475 9675 2025 9675 2025 9450 +4 1 0 50 -1 16 6 0.0000 4 90 315 2250 9585 deflate\001 +-6 +6 2925 9450 3375 9675 +2 2 0 1 9 11 51 -1 20 0.000 0 0 -1 0 0 5 + 2925 9450 3375 9450 3375 9675 2925 9675 2925 9450 +4 1 0 50 -1 16 6 0.0000 4 90 315 3150 9585 deflate\001 +-6 +6 3825 9450 4275 9675 +2 2 0 1 9 11 51 -1 20 0.000 0 0 -1 0 0 5 + 3825 9450 4275 9450 4275 9675 3825 9675 3825 9450 +4 1 0 50 -1 16 6 0.0000 4 90 315 4050 9585 deflate\001 +-6 +6 675 10350 1530 10575 +2 2 0 1 16 17 51 -1 20 0.000 0 0 -1 0 0 5 + 675 10350 1530 10350 1530 10575 675 10575 675 10350 +4 1 0 50 -1 16 6 0.0000 4 75 315 1125 10485 TCPv4\001 +-6 +6 1620 10350 2430 10575 +2 2 0 1 16 17 51 -1 20 0.000 0 0 -1 0 0 5 + 1620 10350 2430 10350 2430 10575 1620 10575 1620 10350 +4 1 0 50 -1 16 6 0.0000 4 75 315 2025 10485 TCPv6\001 +-6 +6 3420 10350 4275 10575 +2 2 0 1 16 17 51 -1 20 0.000 0 0 -1 0 0 5 + 3420 10350 4275 10350 4275 10575 3420 10575 3420 10350 +4 1 0 50 -1 16 6 0.0000 4 75 330 3825 10485 PIPES\001 +-6 +6 675 9000 4275 9225 +2 2 0 1 12 14 51 -1 20 0.000 0 0 -1 0 0 5 + 675 9000 4275 9000 4275 9225 675 9225 675 9000 +4 1 0 50 -1 16 6 0.0000 4 105 1950 2475 9135 HTTP flow analyzer using stream interfaces\001 +-6 +2 1 0 1 20 -1 50 -1 -1 0.000 1 0 -1 0 1 2 + 0 0 1.00 30.00 45.00 + 765 10350 765 9225 +2 1 0 1 20 14 50 -1 -1 0.000 1 0 -1 1 0 2 + 0 0 1.00 30.00 45.00 + 810 10350 810 9225 +2 1 0 1 20 14 50 -1 -1 0.000 1 0 -1 0 1 2 + 0 0 1.00 30.00 45.00 + 990 9900 990 9225 +2 1 0 1 20 14 50 -1 -1 0.000 1 0 -1 1 0 2 + 0 0 1.00 30.00 45.00 + 1035 9900 1035 9225 +2 1 0 1 20 14 50 -1 -1 0.000 1 0 -1 1 0 2 + 0 0 1.00 30.00 45.00 + 1170 10350 1170 10125 +2 1 0 1 20 14 50 -1 -1 0.000 1 0 -1 0 1 2 + 0 0 1.00 30.00 45.00 + 1215 9900 1215 9675 +2 1 0 1 20 14 50 -1 -1 0.000 1 0 -1 1 0 2 + 0 0 1.00 30.00 45.00 + 1260 9900 1260 9675 +2 1 0 1 20 14 50 -1 -1 0.000 1 0 -1 1 0 2 + 0 0 1.00 30.00 45.00 + 1395 9450 1395 9225 +2 1 0 1 20 14 50 -1 -1 0.000 1 0 -1 0 1 2 + 0 0 1.00 30.00 45.00 + 1440 10350 1440 9675 +2 1 0 1 20 14 50 -1 -1 0.000 1 0 -1 1 0 2 + 0 0 1.00 30.00 45.00 + 1485 10350 1485 9675 +2 1 0 1 20 14 50 -1 -1 0.000 1 0 -1 0 1 2 + 0 0 1.00 30.00 45.00 + 1665 10350 1665 9225 +2 1 0 1 20 14 50 -1 -1 0.000 1 0 -1 1 0 2 + 0 0 1.00 30.00 45.00 + 1710 10350 1710 9225 +2 1 0 1 20 14 50 -1 -1 0.000 1 0 -1 0 1 2 + 0 0 1.00 30.00 45.00 + 1890 9900 1890 9225 +2 1 0 1 20 14 50 -1 -1 0.000 1 0 -1 1 0 2 + 0 0 1.00 30.00 45.00 + 1935 9900 1935 9225 +2 1 0 1 20 14 50 -1 -1 0.000 1 0 -1 1 0 2 + 0 0 1.00 30.00 45.00 + 2070 10350 2070 10125 +2 1 0 1 20 14 50 -1 -1 0.000 1 0 -1 0 1 2 + 0 0 1.00 30.00 45.00 + 2115 9900 2115 9675 +2 1 0 1 20 14 50 -1 -1 0.000 1 0 -1 1 0 2 + 0 0 1.00 30.00 45.00 + 2160 9900 2160 9675 +2 1 0 1 20 14 50 -1 -1 0.000 1 0 -1 1 0 2 + 0 0 1.00 30.00 45.00 + 2295 9450 2295 9225 +2 1 0 1 20 14 50 -1 -1 0.000 1 0 -1 0 1 2 + 0 0 1.00 30.00 45.00 + 2340 10350 2340 9675 +2 1 0 1 20 14 50 -1 -1 0.000 1 0 -1 1 0 2 + 0 0 1.00 30.00 45.00 + 2385 10350 2385 9675 +2 1 0 1 20 14 50 -1 -1 0.000 1 0 -1 0 1 2 + 0 0 1.00 30.00 45.00 + 2565 10350 2565 9225 +2 1 0 1 20 14 50 -1 -1 0.000 1 0 -1 1 0 2 + 0 0 1.00 30.00 45.00 + 2610 10350 2610 9225 +2 1 0 1 20 14 50 -1 -1 0.000 1 0 -1 0 1 2 + 0 0 1.00 30.00 45.00 + 2790 9900 2790 9225 +2 1 0 1 20 14 50 -1 -1 0.000 1 0 -1 1 0 2 + 0 0 1.00 30.00 45.00 + 2835 9900 2835 9225 +2 1 0 1 20 14 50 -1 -1 0.000 1 0 -1 0 1 2 + 0 0 1.00 30.00 45.00 + 3015 9900 3015 9675 +2 1 0 1 20 14 50 -1 -1 0.000 1 0 -1 1 0 2 + 0 0 1.00 30.00 45.00 + 3060 9900 3060 9675 +2 1 0 1 20 14 50 -1 -1 0.000 1 0 -1 1 0 2 + 0 0 1.00 30.00 45.00 + 2970 10350 2970 10125 +2 1 0 1 20 14 50 -1 -1 0.000 1 0 -1 0 1 2 + 0 0 1.00 30.00 45.00 + 3240 10350 3240 9675 +2 1 0 1 20 14 50 -1 -1 0.000 1 0 -1 1 0 2 + 0 0 1.00 30.00 45.00 + 3285 10350 3285 9675 +2 1 0 1 20 14 50 -1 -1 0.000 1 0 -1 1 0 2 + 0 0 1.00 30.00 45.00 + 3195 9450 3195 9225 +2 1 0 1 20 14 50 -1 -1 0.000 1 0 -1 0 1 2 + 0 0 1.00 30.00 45.00 + 3465 10350 3465 9225 +2 1 0 1 20 14 50 -1 -1 0.000 1 0 -1 1 0 2 + 0 0 1.00 30.00 45.00 + 3510 10350 3510 9225 +2 1 0 1 20 14 50 -1 -1 0.000 1 0 -1 0 1 2 + 0 0 1.00 30.00 45.00 + 3690 9900 3690 9225 +2 1 0 1 20 14 50 -1 -1 0.000 1 0 -1 1 0 2 + 0 0 1.00 30.00 45.00 + 3735 9900 3735 9225 +2 1 0 1 20 14 50 -1 -1 0.000 1 0 -1 1 0 2 + 0 0 1.00 30.00 45.00 + 3870 10350 3870 10125 +2 1 0 1 20 14 50 -1 -1 0.000 1 0 -1 0 1 2 + 0 0 1.00 30.00 45.00 + 3915 9900 3915 9675 +2 1 0 1 20 14 50 -1 -1 0.000 1 0 -1 1 0 2 + 0 0 1.00 30.00 45.00 + 3960 9900 3960 9675 +2 1 0 1 20 14 50 -1 -1 0.000 1 0 -1 0 1 2 + 0 0 1.00 30.00 45.00 + 4140 10350 4140 9675 +2 1 0 1 20 14 50 -1 -1 0.000 1 0 -1 1 0 2 + 0 0 1.00 30.00 45.00 + 4185 10350 4185 9675 +2 1 0 1 20 14 50 -1 -1 0.000 1 0 -1 1 0 2 + 0 0 1.00 30.00 45.00 + 4095 9450 4095 9225 +2 1 0 1 20 14 50 -1 -1 0.000 1 0 -1 0 1 2 + 0 0 1.00 30.00 45.00 + 1350 9450 1350 9225 +2 1 0 1 20 14 50 -1 -1 0.000 1 0 -1 0 1 2 + 0 0 1.00 30.00 45.00 + 2250 9450 2250 9225 +2 1 0 1 20 14 50 -1 -1 0.000 1 0 -1 0 1 2 + 0 0 1.00 30.00 45.00 + 3150 9450 3150 9225 +2 1 0 1 20 14 50 -1 -1 0.000 1 0 -1 0 1 2 + 0 0 1.00 30.00 45.00 + 4050 9450 4050 9225 +2 1 0 1 20 14 50 -1 -1 0.000 1 0 -1 0 1 2 + 0 0 1.00 30.00 45.00 + 3825 10350 3825 10125 +2 1 0 1 20 14 50 -1 -1 0.000 1 0 -1 0 1 2 + 0 0 1.00 30.00 45.00 + 2925 10350 2925 10125 +2 1 0 1 20 14 50 -1 -1 0.000 1 0 -1 0 1 2 + 0 0 1.00 30.00 45.00 + 2025 10350 2025 10125 +2 1 0 1 20 14 50 -1 -1 0.000 1 0 -1 0 1 2 + 0 0 1.00 30.00 45.00 + 1125 10350 1125 10125 +-6 +6 3780 6750 6120 8100 +5 1 0 1 0 11 51 -1 20 0.000 0 0 0 0 4725.000 7425.000 4860 7245 4950 7425 4860 7605 +5 1 0 1 0 11 51 -1 20 0.000 0 1 0 0 4725.000 7425.000 4590 7245 4500 7425 4590 7605 +5 1 0 1 0 14 51 -1 20 0.000 0 0 0 0 4725.000 7425.000 4860 7605 4725 7650 4590 7605 +5 1 0 1 0 14 51 -1 20 0.000 0 1 0 0 4725.000 7425.000 4860 7245 4725 7200 4590 7245 +5 1 0 1 0 14 51 -1 20 0.000 0 0 0 0 5175.000 7425.000 5310 7605 5175 7650 5040 7605 +5 1 0 1 0 14 51 -1 20 0.000 0 1 0 0 5175.000 7425.000 5310 7245 5175 7200 5040 7245 +5 1 0 1 0 11 51 -1 20 0.000 0 1 0 0 5175.000 7425.000 5040 7245 4950 7425 5040 7605 +5 1 0 1 0 11 51 -1 20 0.000 0 0 0 0 5175.000 7425.000 5310 7245 5400 7425 5310 7605 +6 3780 7155 4320 7695 +5 1 0 1 0 11 51 -1 20 0.000 0 0 0 0 4050.000 7425.000 4050 7200 4275 7425 4050 7650 +5 1 0 1 0 4 51 -1 20 0.000 0 1 0 0 4050.000 7425.000 4050 7200 3825 7425 4050 7650 +2 1 0 1 0 7 50 -1 -1 0.000 0 0 -1 0 0 2 + 4050 7200 4050 7650 +-6 +6 5580 7155 6120 7695 +5 1 0 1 0 11 51 -1 20 0.000 0 1 0 0 5850.000 7425.000 5850 7200 5625 7425 5850 7650 +5 1 0 1 0 4 51 -1 20 0.000 0 0 0 0 5850.000 7425.000 5850 7200 6075 7425 5850 7650 +2 1 0 1 0 7 50 -1 -1 0.000 0 0 -1 0 0 2 + 5850 7200 5850 7650 +-6 +6 4500 6750 5400 7020 +2 1 0 1 0 14 50 -1 -1 0.000 0 0 -1 0 0 2 + 5355 6750 5355 7020 +2 1 0 1 0 14 50 -1 -1 0.000 0 0 -1 0 0 2 + 5310 6750 5310 7020 +2 1 0 1 0 14 50 -1 -1 0.000 0 0 -1 0 0 2 + 4545 6750 4545 7020 +2 2 0 1 0 6 51 -1 20 0.000 1 0 -1 0 0 5 + 4500 6750 5400 6750 5400 7020 4500 7020 4500 6750 +2 1 0 1 0 14 50 -1 -1 0.000 0 0 -1 0 0 2 + 4590 6750 4590 7020 +4 1 0 50 -1 16 6 0.0000 4 105 420 4950 6930 http_req\001 +-6 +6 4500 7830 5400 8100 +2 1 0 1 0 14 50 -1 -1 0.000 0 0 -1 0 0 2 + 5355 7830 5355 8100 +2 1 0 1 0 14 50 -1 -1 0.000 0 0 -1 0 0 2 + 5310 7830 5310 8100 +2 2 0 1 0 6 51 -1 20 0.000 1 0 -1 0 0 5 + 4500 7830 5400 7830 5400 8100 4500 8100 4500 7830 +2 1 0 1 0 14 50 -1 -1 0.000 0 0 -1 0 0 2 + 4545 7830 4545 8100 +2 1 0 1 0 14 50 -1 -1 0.000 0 0 -1 0 0 2 + 4590 7830 4590 8100 +4 1 0 50 -1 16 6 0.0000 4 105 465 4950 8010 http_resp\001 +-6 +2 1 0 1 0 0 50 -1 -1 0.000 1 0 -1 1 0 2 + 0 0 1.00 30.00 45.00 + 5400 6885 5670 7290 +2 1 0 1 0 0 50 -1 -1 0.000 1 0 -1 1 0 2 + 0 0 1.00 30.00 45.00 + 4230 7290 4500 6885 +2 1 0 1 0 0 50 -1 -1 0.000 1 0 -1 1 0 2 + 0 0 1.00 30.00 45.00 + 4500 7965 4230 7560 +2 1 0 1 0 0 50 -1 -1 0.000 1 0 -1 1 0 2 + 0 0 1.00 30.00 45.00 + 5670 7560 5400 7965 +2 1 0 1 0 14 50 -1 -1 0.000 1 0 -1 1 1 2 + 0 0 1.00 30.00 45.00 + 0 0 1.00 30.00 45.00 + 4725 7200 4725 7020 +2 2 0 1 14 14 52 -1 20 0.000 2 0 -1 0 0 5 + 4590 7245 4860 7245 4860 7605 4590 7605 4590 7245 +2 1 0 1 0 14 50 -1 -1 0.000 1 0 -1 1 1 2 + 0 0 1.00 30.00 45.00 + 0 0 1.00 30.00 45.00 + 5175 7830 5175 7650 +2 2 0 1 14 14 52 -1 20 0.000 2 0 -1 0 0 5 + 5040 7245 5310 7245 5310 7605 5040 7605 5040 7245 +4 1 0 50 -1 16 6 0.0000 4 60 285 4050 6930 server\001 +4 1 0 50 -1 16 6 0.0000 4 90 285 4050 7065 socket\001 +4 1 0 50 -1 16 6 0.0000 4 90 255 5850 6930 client\001 +4 1 0 50 -1 16 6 0.0000 4 90 285 5850 7065 socket\001 +4 1 0 50 -1 16 6 0.0000 4 105 210 4725 7425 http\001 +4 1 0 50 -1 16 6 0.0000 4 75 150 4725 7515 req\001 +4 1 0 50 -1 16 6 0.0000 4 105 210 5175 7425 http\001 +4 1 0 50 -1 16 6 0.0000 4 75 195 5175 7515 resp\001 +-6 +4 0 0 53 -1 19 11 0.0000 4 180 5520 675 8775 Multi-layer protocol encapsulation using intermediate buffers :\001 +4 0 0 53 -1 19 11 0.0000 4 180 4200 675 6525 Multiple protocol processing on the same flow :\001 +4 0 0 53 -1 19 11 0.0000 4 180 2085 675 3600 Principles of operation :\001 diff --git a/doc/how-it-works.txt b/doc/how-it-works.txt new file mode 100644 index 000000000..2d1cb89a0 --- /dev/null +++ b/doc/how-it-works.txt @@ -0,0 +1,60 @@ +How it works ? (unfinished and inexact) + +For TCP and HTTP : + +- listeners create listening sockets with a READ callback pointing to the + protocol-specific accept() function. + +- the protocol-specific accept() function then accept()'s the connection and + instantiates a "server TCP socket" (which is dedicated to the client side), + and configures it (non_block, get_original_dst, ...). + +For TCP : +- in case of pure TCP, a request buffer is created, as well as a "client TCP + socket", which tries to connect to the server. + +- once the connection is established, the response buffer is allocated and + connected to both ends. + +- both sockets are set to "autonomous mode" so that they only wake up their + supervising session when they encounter a special condition (error or close). + + +For HTTP : +- in case of HTTP, a request buffer is created with the "HOLD" flag set and + a read limit to support header rewriting (may be this one will be removed + eventually because it's better to limit only to the buffer size and report + an error when rewritten data overflows) + +- a "flow analyzer" is attached to the buffer (or possibly multiple flow + analyzers). For the request, the flow analyzer is "http_lb_req". The flow + analyzer is a function which gets called when new data is present and + blocked. It has a timeout (request timeout). It can also be bypassed on + demand. + +- when the "http_lb_req" has received the whole request, it creates a client + socket with all the parameters needed to try to connect to the server. When + the connection establishes, the response buffer is allocated on the fly, + put to HOLD mode, and a an "http_lb_resp" flow analyzer is attached to the + buffer. + + +For client-side HTTPS : + +- the accept() function must completely instantiate a TCP socket + an SSL + reader. It is when the SSL session is complete that we call the + protocol-specific accept(), and create its buffer. + + + + +Conclusions +----------- + +- we need a generic TCP accept() function with a lot of flags set by the + listener, to tell it what info we need to get at the accept() time, and + what flags will have to be set on the socket. + +- once the TCP accept() function ends, it wakes up the protocol supervisor + which is in charge of creating the buffers, etc, switch states, etc... + diff --git a/haproxy.c b/haproxy.c deleted file mode 100644 index 34cb0bb76..000000000 --- a/haproxy.c +++ /dev/null @@ -1,10434 +0,0 @@ -/* - * HA-Proxy : High Availability-enabled HTTP/TCP proxy - * 2000-2006 - Willy Tarreau - willy AT meta-x DOT org. - * - * This program is free software; you can redistribute it and/or - * modify it under the terms of the GNU General Public License - * as published by the Free Software Foundation; either version - * 2 of the License, or (at your option) any later version. - * - * Please refer to RFC2068 or RFC2616 for informations about HTTP protocol, and - * RFC2965 for informations about cookies usage. More generally, the IETF HTTP - * Working Group's web site should be consulted for protocol related changes : - * - * http://ftp.ics.uci.edu/pub/ietf/http/ - * - * Pending bugs (may be not fixed because never reproduced) : - * - solaris only : sometimes, an HTTP proxy with only a dispatch address causes - * the proxy to terminate (no core) if the client breaks the connection during - * the response. Seen on 1.1.8pre4, but never reproduced. May not be related to - * the snprintf() bug since requests were simple (GET / HTTP/1.0), but may be - * related to missing setsid() (fixed in 1.1.15) - * - a proxy with an invalid config will prevent the startup even if disabled. - * - * ChangeLog has moved to the CHANGELOG file. - * - * TODO: - * - handle properly intermediate incomplete server headers. Done ? - * - handle hot-reconfiguration - * - fix client/server state transition when server is in connect or headers state - * and client suddenly disconnects. The server *should* switch to SHUT_WR, but - * still handle HTTP headers. - * - remove MAX_NEWHDR - * - cut this huge file into several ones - * - */ - -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include -#include - -#ifdef USE_PCRE -#include -#include -#else -#include -#endif - -#if defined(TPROXY) && defined(NETFILTER) -#include -#endif - -#if defined(__dietlibc__) -#include -#endif - -#if defined(ENABLE_POLL) -#include -#endif - -#if defined(ENABLE_EPOLL) -#if !defined(USE_MY_EPOLL) -#include -#else -#include "include/epoll.h" -#endif -#endif - -#ifdef DEBUG_FULL -#include -#endif - -#include -#include -#include "include/appsession.h" -#include "include/mini-clist.h" - -#ifndef HAPROXY_VERSION -#define HAPROXY_VERSION "1.2.14" -#endif - -#ifndef HAPROXY_DATE -#define HAPROXY_DATE "2006/05/21" -#endif - -/* this is for libc5 for example */ -#ifndef TCP_NODELAY -#define TCP_NODELAY 1 -#endif - -#ifndef SHUT_RD -#define SHUT_RD 0 -#endif - -#ifndef SHUT_WR -#define SHUT_WR 1 -#endif - -/* - * BUFSIZE defines the size of a read and write buffer. It is the maximum - * amount of bytes which can be stored by the proxy for each session. However, - * when reading HTTP headers, the proxy needs some spare space to add or rewrite - * headers if needed. The size of this spare is defined with MAXREWRITE. So it - * is not possible to process headers longer than BUFSIZE-MAXREWRITE bytes. By - * default, BUFSIZE=16384 bytes and MAXREWRITE=BUFSIZE/2, so the maximum length - * of headers accepted is 8192 bytes, which is in line with Apache's limits. - */ -#ifndef BUFSIZE -#define BUFSIZE 16384 -#endif - -// reserved buffer space for header rewriting -#ifndef MAXREWRITE -#define MAXREWRITE (BUFSIZE / 2) -#endif - -#define REQURI_LEN 1024 -#define CAPTURE_LEN 64 - -// max # args on a configuration line -#define MAX_LINE_ARGS 40 - -// max # of added headers per request -#define MAX_NEWHDR 10 - -// max # of matches per regexp -#define MAX_MATCH 10 - -// cookie delimitor in "prefix" mode. This character is inserted between the -// persistence cookie and the original value. The '~' is allowed by RFC2965, -// and should not be too common in server names. -#ifndef COOKIE_DELIM -#define COOKIE_DELIM '~' -#endif - -#define CONN_RETRIES 3 - -#define CHK_CONNTIME 2000 -#define DEF_CHKINTR 2000 -#define DEF_FALLTIME 3 -#define DEF_RISETIME 2 -#define DEF_CHECK_REQ "OPTIONS / HTTP/1.0\r\n\r\n" - -/* Default connections limit. - * - * A system limit can be enforced at build time in order to avoid using haproxy - * beyond reasonable system limits. For this, just define SYSTEM_MAXCONN to the - * absolute limit accepted by the system. If the configuration specifies a - * higher value, it will be capped to SYSTEM_MAXCONN and a warning will be - * emitted. The only way to override this limit will be to set it via the - * command-line '-n' argument. - */ -#ifndef SYSTEM_MAXCONN -#define DEFAULT_MAXCONN 2000 -#else -#define DEFAULT_MAXCONN SYSTEM_MAXCONN -#endif - -#ifdef CONFIG_PRODUCT_NAME -#define PRODUCT_NAME CONFIG_PRODUCT_NAME -#else -#define PRODUCT_NAME "HAProxy" -#endif - -/* how many bits are needed to code the size of an int (eg: 32bits -> 5) */ -#define INTBITS 5 - -/* show stats this every millisecond, 0 to disable */ -#ifndef STATTIME -#define STATTIME 2000 -#endif - -/* this reduces the number of calls to select() by choosing appropriate - * sheduler precision in milliseconds. It should be near the minimum - * time that is needed by select() to collect all events. All timeouts - * are rounded up by adding this value prior to pass it to select(). - */ -#define SCHEDULER_RESOLUTION 9 - -#define TIME_ETERNITY -1 -/* returns the lowest delay amongst and , and respects TIME_ETERNITY */ -#define MINTIME(old, new) (((new)<0)?(old):(((old)<0||(new)<(old))?(new):(old))) -#define SETNOW(a) (*a=now) - -/****** string-specific macros and functions ******/ -/* if a > max, then bound to . The macro returns the new */ -#define UBOUND(a, max) ({ typeof(a) b = (max); if ((a) > b) (a) = b; (a); }) - -/* if a < min, then bound to . The macro returns the new */ -#define LBOUND(a, min) ({ typeof(a) b = (min); if ((a) < b) (a) = b; (a); }) - -/* returns 1 only if only zero or one bit is set in X, which means that X is a - * power of 2, and 0 otherwise */ -#define POWEROF2(x) (((x) & ((x)-1)) == 0) -/* - * copies at most chars from to . Last char is always - * set to 0, unless is 0. The number of chars copied is returned - * (excluding the terminating zero). - * This code has been optimized for size and speed : on x86, it's 45 bytes - * long, uses only registers, and consumes only 4 cycles per char. - */ -int strlcpy2(char *dst, const char *src, int size) { - char *orig = dst; - if (size) { - while (--size && (*dst = *src)) { - src++; dst++; - } - *dst = 0; - } - return dst - orig; -} - -/* - * This function simply returns a statically allocated string containing - * the ascii representation for number 'n' in decimal. - */ -char *ultoa(unsigned long n) { - /* enough to store 2^63=18446744073709551615 */ - static char itoa_str[21]; - char *pos; - - pos = itoa_str + sizeof(itoa_str) - 1; - *pos-- = '\0'; - - do { - *pos-- = '0' + n % 10; - n /= 10; - } while (n && pos >= itoa_str); - return pos + 1; -} - -/* - * Returns a pointer to an area of <__len> bytes taken from the pool or - * dynamically allocated. In the first case, <__pool> is updated to point to - * the next element in the list. - */ -#define pool_alloc_from(__pool, __len) ({ \ - void *__p; \ - if ((__p = (__pool)) == NULL) \ - __p = malloc(((__len) >= sizeof (void *)) ? (__len) : sizeof(void *)); \ - else { \ - __pool = *(void **)(__pool); \ - } \ - __p; \ -}) - -/* - * Puts a memory area back to the corresponding pool. - * Items are chained directly through a pointer that - * is written in the beginning of the memory area, so - * there's no need for any carrier cell. This implies - * that each memory area is at least as big as one - * pointer. - */ -#define pool_free_to(__pool, __ptr) ({ \ - *(void **)(__ptr) = (void *)(__pool); \ - __pool = (void *)(__ptr); \ -}) - - -#define MEM_OPTIM -#ifdef MEM_OPTIM -/* - * Returns a pointer to type taken from the - * pool or dynamically allocated. In the - * first case, is updated to point to the - * next element in the list. - */ -#define pool_alloc(type) ({ \ - void *__p; \ - if ((__p = pool_##type) == NULL) \ - __p = malloc(sizeof_##type); \ - else { \ - pool_##type = *(void **)pool_##type; \ - } \ - __p; \ -}) - -/* - * Puts a memory area back to the corresponding pool. - * Items are chained directly through a pointer that - * is written in the beginning of the memory area, so - * there's no need for any carrier cell. This implies - * that each memory area is at least as big as one - * pointer. - */ -#define pool_free(type, ptr) ({ \ - *(void **)ptr = (void *)pool_##type; \ - pool_##type = (void *)ptr; \ -}) - -#else -#define pool_alloc(type) (calloc(1,sizeof_##type)); -#define pool_free(type, ptr) (free(ptr)); -#endif /* MEM_OPTIM */ - -#define sizeof_task sizeof(struct task) -#define sizeof_session sizeof(struct session) -#define sizeof_pendconn sizeof(struct pendconn) -#define sizeof_buffer sizeof(struct buffer) -#define sizeof_fdtab sizeof(struct fdtab) -#define sizeof_requri REQURI_LEN -#define sizeof_capture CAPTURE_LEN -#define sizeof_curappsession CAPTURE_LEN /* current_session pool */ -#define sizeof_appsess sizeof(struct appsessions) - -/* different possible states for the sockets */ -#define FD_STCLOSE 0 -#define FD_STLISTEN 1 -#define FD_STCONN 2 -#define FD_STREADY 3 -#define FD_STERROR 4 - -/* values for task->state */ -#define TASK_IDLE 0 -#define TASK_RUNNING 1 - -/* values for proxy->state */ -#define PR_STNEW 0 -#define PR_STIDLE 1 -#define PR_STRUN 2 -#define PR_STSTOPPED 3 -#define PR_STPAUSED 4 -#define PR_STERROR 5 - -/* values for proxy->mode */ -#define PR_MODE_TCP 0 -#define PR_MODE_HTTP 1 -#define PR_MODE_HEALTH 2 - -/* possible actions for the *poll() loops */ -#define POLL_LOOP_ACTION_INIT 0 -#define POLL_LOOP_ACTION_RUN 1 -#define POLL_LOOP_ACTION_CLEAN 2 - -/* poll mechanisms available */ -#define POLL_USE_SELECT (1<<0) -#define POLL_USE_POLL (1<<1) -#define POLL_USE_EPOLL (1<<2) - -/* bits for proxy->options */ -#define PR_O_REDISP 0x00000001 /* allow reconnection to dispatch in case of errors */ -#define PR_O_TRANSP 0x00000002 /* transparent mode : use original DEST as dispatch */ -#define PR_O_COOK_RW 0x00000004 /* rewrite all direct cookies with the right serverid */ -#define PR_O_COOK_IND 0x00000008 /* keep only indirect cookies */ -#define PR_O_COOK_INS 0x00000010 /* insert cookies when not accessing a server directly */ -#define PR_O_COOK_PFX 0x00000020 /* rewrite all cookies by prefixing the right serverid */ -#define PR_O_COOK_ANY (PR_O_COOK_RW | PR_O_COOK_IND | PR_O_COOK_INS | PR_O_COOK_PFX) -#define PR_O_BALANCE_RR 0x00000040 /* balance in round-robin mode */ -#define PR_O_KEEPALIVE 0x00000080 /* follow keep-alive sessions */ -#define PR_O_FWDFOR 0x00000100 /* insert x-forwarded-for with client address */ -#define PR_O_BIND_SRC 0x00000200 /* bind to a specific source address when connect()ing */ -#define PR_O_NULLNOLOG 0x00000400 /* a connect without request will not be logged */ -#define PR_O_COOK_NOC 0x00000800 /* add a 'Cache-control' header with the cookie */ -#define PR_O_COOK_POST 0x00001000 /* don't insert cookies for requests other than a POST */ -#define PR_O_HTTP_CHK 0x00002000 /* use HTTP 'OPTIONS' method to check server health */ -#define PR_O_PERSIST 0x00004000 /* server persistence stays effective even when server is down */ -#define PR_O_LOGASAP 0x00008000 /* log as soon as possible, without waiting for the session to complete */ -#define PR_O_HTTP_CLOSE 0x00010000 /* force 'connection: close' in both directions */ -#define PR_O_CHK_CACHE 0x00020000 /* require examination of cacheability of the 'set-cookie' field */ -#define PR_O_TCP_CLI_KA 0x00040000 /* enable TCP keep-alive on client-side sessions */ -#define PR_O_TCP_SRV_KA 0x00080000 /* enable TCP keep-alive on server-side sessions */ -#define PR_O_USE_ALL_BK 0x00100000 /* load-balance between backup servers */ -#define PR_O_FORCE_CLO 0x00200000 /* enforce the connection close immediately after server response */ -#define PR_O_BALANCE_SH 0x00400000 /* balance on source IP hash */ -#define PR_O_BALANCE (PR_O_BALANCE_RR | PR_O_BALANCE_SH) -#define PR_O_ABRT_CLOSE 0x00800000 /* immediately abort request when client closes */ - -/* various session flags, bits values 0x01 to 0x20 (shift 0) */ -#define SN_DIRECT 0x00000001 /* connection made on the server matching the client cookie */ -#define SN_CLDENY 0x00000002 /* a client header matches a deny regex */ -#define SN_CLALLOW 0x00000004 /* a client header matches an allow regex */ -#define SN_SVDENY 0x00000008 /* a server header matches a deny regex */ -#define SN_SVALLOW 0x00000010 /* a server header matches an allow regex */ -#define SN_POST 0x00000020 /* the request was an HTTP POST */ - -/* session flags dedicated to cookies : bits values 0x40, 0x80 (0-3 shift 6) */ -#define SN_CK_NONE 0x00000000 /* this session had no cookie */ -#define SN_CK_INVALID 0x00000040 /* this session had a cookie which matches no server */ -#define SN_CK_DOWN 0x00000080 /* this session had cookie matching a down server */ -#define SN_CK_VALID 0x000000C0 /* this session had cookie matching a valid server */ -#define SN_CK_MASK 0x000000C0 /* mask to get this session's cookie flags */ -#define SN_CK_SHIFT 6 /* bit shift */ - -/* session termination conditions, bits values 0x100 to 0x700 (0-7 shift 8) */ -#define SN_ERR_NONE 0x00000000 -#define SN_ERR_CLITO 0x00000100 /* client time-out */ -#define SN_ERR_CLICL 0x00000200 /* client closed (read/write error) */ -#define SN_ERR_SRVTO 0x00000300 /* server time-out, connect time-out */ -#define SN_ERR_SRVCL 0x00000400 /* server closed (connect/read/write error) */ -#define SN_ERR_PRXCOND 0x00000500 /* the proxy decided to close (deny...) */ -#define SN_ERR_RESOURCE 0x00000600 /* the proxy encountered a lack of a local resources (fd, mem, ...) */ -#define SN_ERR_INTERNAL 0x00000700 /* the proxy encountered an internal error */ -#define SN_ERR_MASK 0x00000700 /* mask to get only session error flags */ -#define SN_ERR_SHIFT 8 /* bit shift */ - -/* session state at termination, bits values 0x1000 to 0x7000 (0-7 shift 12) */ -#define SN_FINST_R 0x00001000 /* session ended during client request */ -#define SN_FINST_C 0x00002000 /* session ended during server connect */ -#define SN_FINST_H 0x00003000 /* session ended during server headers */ -#define SN_FINST_D 0x00004000 /* session ended during data phase */ -#define SN_FINST_L 0x00005000 /* session ended while pushing last data to client */ -#define SN_FINST_Q 0x00006000 /* session ended while waiting in queue for a server slot */ -#define SN_FINST_MASK 0x00007000 /* mask to get only final session state flags */ -#define SN_FINST_SHIFT 12 /* bit shift */ - -/* cookie information, bits values 0x10000 to 0x80000 (0-8 shift 16) */ -#define SN_SCK_NONE 0x00000000 /* no set-cookie seen for the server cookie */ -#define SN_SCK_DELETED 0x00010000 /* existing set-cookie deleted or changed */ -#define SN_SCK_INSERTED 0x00020000 /* new set-cookie inserted or changed existing one */ -#define SN_SCK_SEEN 0x00040000 /* set-cookie seen for the server cookie */ -#define SN_SCK_MASK 0x00070000 /* mask to get the set-cookie field */ -#define SN_SCK_ANY 0x00080000 /* at least one set-cookie seen (not to be counted) */ -#define SN_SCK_SHIFT 16 /* bit shift */ - -/* cacheability management, bits values 0x100000 to 0x300000 (0-3 shift 20) */ -#define SN_CACHEABLE 0x00100000 /* at least part of the response is cacheable */ -#define SN_CACHE_COOK 0x00200000 /* a cookie in the response is cacheable */ -#define SN_CACHE_SHIFT 20 /* bit shift */ - -/* various other session flags, bits values 0x400000 and above */ -#define SN_MONITOR 0x00400000 /* this session comes from a monitoring system */ -#define SN_ASSIGNED 0x00800000 /* no need to assign a server to this session */ -#define SN_ADDR_SET 0x01000000 /* this session's server address has been set */ -#define SN_SELF_GEN 0x02000000 /* the proxy generates data for the client (eg: stats) */ - -/* various data sources for the responses */ -#define DATA_SRC_NONE 0 -#define DATA_SRC_STATS 1 - -/* data transmission states for the responses */ -#define DATA_ST_INIT 0 -#define DATA_ST_DATA 1 - -/* different possible states for the client side */ -#define CL_STHEADERS 0 -#define CL_STDATA 1 -#define CL_STSHUTR 2 -#define CL_STSHUTW 3 -#define CL_STCLOSE 4 - -/* different possible states for the server side */ -#define SV_STIDLE 0 -#define SV_STCONN 1 -#define SV_STHEADERS 2 -#define SV_STDATA 3 -#define SV_STSHUTR 4 -#define SV_STSHUTW 5 -#define SV_STCLOSE 6 - -/* result of an I/O event */ -#define RES_SILENT 0 /* didn't happen */ -#define RES_DATA 1 /* data were sent or received */ -#define RES_NULL 2 /* result is 0 (read == 0), or connect without need for writing */ -#define RES_ERROR 3 /* result -1 or error on the socket (eg: connect()) */ - -/* modes of operation (global.mode) */ -#define MODE_DEBUG 1 -#define MODE_STATS 2 -#define MODE_LOG 4 -#define MODE_DAEMON 8 -#define MODE_QUIET 16 -#define MODE_CHECK 32 -#define MODE_VERBOSE 64 -#define MODE_STARTING 128 -#define MODE_FOREGROUND 256 - -/* server flags */ -#define SRV_RUNNING 1 /* the server is UP */ -#define SRV_BACKUP 2 /* this server is a backup server */ -#define SRV_MAPPORTS 4 /* this server uses mapped ports */ -#define SRV_BIND_SRC 8 /* this server uses a specific source address */ -#define SRV_CHECKED 16 /* this server needs to be checked */ - -/* function which act on servers need to return various errors */ -#define SRV_STATUS_OK 0 /* everything is OK. */ -#define SRV_STATUS_INTERNAL 1 /* other unrecoverable errors. */ -#define SRV_STATUS_NOSRV 2 /* no server is available */ -#define SRV_STATUS_FULL 3 /* the/all server(s) are saturated */ -#define SRV_STATUS_QUEUED 4 /* the/all server(s) are saturated but the connection was queued */ - -/* what to do when a header matches a regex */ -#define ACT_ALLOW 0 /* allow the request */ -#define ACT_REPLACE 1 /* replace the matching header */ -#define ACT_REMOVE 2 /* remove the matching header */ -#define ACT_DENY 3 /* deny the request */ -#define ACT_PASS 4 /* pass this header without allowing or denying the request */ - -/* configuration sections */ -#define CFG_NONE 0 -#define CFG_GLOBAL 1 -#define CFG_LISTEN 2 - -/* fields that need to be logged. They appear as flags in session->logs.logwait */ -#define LW_DATE 1 /* date */ -#define LW_CLIP 2 /* CLient IP */ -#define LW_SVIP 4 /* SerVer IP */ -#define LW_SVID 8 /* server ID */ -#define LW_REQ 16 /* http REQuest */ -#define LW_RESP 32 /* http RESPonse */ -#define LW_PXIP 64 /* proxy IP */ -#define LW_PXID 128 /* proxy ID */ -#define LW_BYTES 256 /* bytes read from server */ -#define LW_COOKIE 512 /* captured cookie */ -#define LW_REQHDR 1024 /* request header(s) */ -#define LW_RSPHDR 2048 /* response header(s) */ - -#define ERR_NONE 0 /* no error */ -#define ERR_RETRYABLE 1 /* retryable error, may be cumulated */ -#define ERR_FATAL 2 /* fatal error, may be cumulated */ - -/*********************************************************************/ - -#define LIST_HEAD(a) ((void *)(&(a))) - -/*********************************************************************/ - -/* describes a chunk of string */ -struct chunk { - char *str; /* beginning of the string itself. Might not be 0-terminated */ - int len; /* size of the string from first to last char. <0 = uninit. */ -}; - -struct cap_hdr { - struct cap_hdr *next; - char *name; /* header name, case insensitive */ - int namelen; /* length of the header name, to speed-up lookups */ - int len; /* capture length, not including terminal zero */ - int index; /* index in the output array */ - void *pool; /* pool of pre-allocated memory area of (len+1) bytes */ -}; - -struct hdr_exp { - struct hdr_exp *next; - regex_t *preg; /* expression to look for */ - int action; /* ACT_ALLOW, ACT_REPLACE, ACT_REMOVE, ACT_DENY */ - char *replace; /* expression to set instead */ -}; - -struct buffer { - unsigned int l; /* data length */ - char *r, *w, *h, *lr; /* read ptr, write ptr, last header ptr, last read */ - char *rlim; /* read limit, used for header rewriting */ - unsigned long long total; /* total data read */ - char data[BUFSIZE]; -}; - -struct pendconn { - struct list list; /* chaining ... */ - struct session *sess; /* the session waiting for a connection */ - struct server *srv; /* the server we are waiting for */ -}; - -struct server { - struct server *next; - int state; /* server state (SRV_*) */ - int cklen; /* the len of the cookie, to speed up checks */ - char *cookie; /* the id set in the cookie */ - char *id; /* just for identification */ - struct list pendconns; /* pending connections */ - int nbpend, nbpend_max; /* number of pending connections */ - struct task *queue_mgt; /* the task associated to the queue processing */ - struct sockaddr_in addr; /* the address to connect to */ - struct sockaddr_in source_addr; /* the address to which we want to bind for connect() */ - short check_port; /* the port to use for the health checks */ - int health; /* 0->rise-1 = bad; rise->rise+fall-1 = good */ - int rise, fall; /* time in iterations */ - int inter; /* time in milliseconds */ - int result; /* 0 = connect OK, -1 = connect KO */ - int curfd; /* file desc used for current test, or -1 if not in test */ - unsigned char uweight, eweight; /* user-specified weight-1, and effective weight-1 */ - unsigned int wscore; /* weight score, used during srv map computation */ - int cur_sess, cur_sess_max; /* number of currently active sessions (including syn_sent) */ - unsigned int cum_sess; /* cumulated number of sessions really sent to this server */ - unsigned int maxconn, minconn; /* max # of active sessions (0 = unlimited), min# for dynamic limit. */ - unsigned failed_checks, down_trans; /* failed checks and up-down transitions */ - unsigned failed_conns, failed_resp; /* failed connect() and responses */ - unsigned failed_secu; /* blocked responses because of security concerns */ - struct proxy *proxy; /* the proxy this server belongs to */ -}; - -/* The base for all tasks */ -struct task { - struct task *next, *prev; /* chaining ... */ - struct task *rqnext; /* chaining in run queue ... */ - struct task *wq; /* the wait queue this task is in */ - int state; /* task state : IDLE or RUNNING */ - struct timeval expire; /* next expiration time for this task, use only for fast sorting */ - int (*process)(struct task *t); /* the function which processes the task */ - void *context; /* the task's context */ -}; - -/* WARNING: if new fields are added, they must be initialized in event_accept() */ -struct session { - struct task *task; /* the task associated with this session */ - /* application specific below */ - struct timeval crexpire; /* expiration date for a client read */ - struct timeval cwexpire; /* expiration date for a client write */ - struct timeval srexpire; /* expiration date for a server read */ - struct timeval swexpire; /* expiration date for a server write */ - struct timeval cnexpire; /* expiration date for a connect */ - char res_cr, res_cw, res_sr, res_sw;/* results of some events */ - struct proxy *proxy; /* the proxy this socket belongs to */ - int cli_fd; /* the client side fd */ - int srv_fd; /* the server side fd */ - int cli_state; /* state of the client side */ - int srv_state; /* state of the server side */ - int conn_retries; /* number of connect retries left */ - int flags; /* some flags describing the session */ - struct buffer *req; /* request buffer */ - struct buffer *rep; /* response buffer */ - struct sockaddr_storage cli_addr; /* the client address */ - struct sockaddr_in srv_addr; /* the address to connect to */ - struct server *srv; /* the server being used */ - struct pendconn *pend_pos; /* if not NULL, points to the position in the pending queue */ - char **req_cap; /* array of captured request headers (may be NULL) */ - char **rsp_cap; /* array of captured response headers (may be NULL) */ - struct chunk req_line; /* points to first line */ - struct chunk auth_hdr; /* points to 'Authorization:' header */ - struct { - int logwait; /* log fields waiting to be collected : LW_* */ - struct timeval tv_accept; /* date of the accept() (beginning of the session) */ - long t_request; /* delay before the end of the request arrives, -1 if never occurs */ - long t_queue; /* delay before the session gets out of the connect queue, -1 if never occurs */ - long t_connect; /* delay before the connect() to the server succeeds, -1 if never occurs */ - long t_data; /* delay before the first data byte from the server ... */ - unsigned long t_close; /* total session duration */ - unsigned long srv_queue_size; /* number of sessions waiting for a connect slot on this server at accept() time (in direct assignment) */ - unsigned long prx_queue_size; /* overall number of sessions waiting for a connect slot on this instance at accept() time */ - char *uri; /* first line if log needed, NULL otherwise */ - char *cli_cookie; /* cookie presented by the client, in capture mode */ - char *srv_cookie; /* cookie presented by the server, in capture mode */ - int status; /* HTTP status from the server, negative if from proxy */ - long long bytes; /* number of bytes transferred from the server */ - } logs; - short int data_source; /* where to get the data we generate ourselves */ - short int data_state; /* where to get the data we generate ourselves */ - union { - struct { - struct proxy *px; - struct server *sv; - short px_st, sv_st; /* DATA_ST_INIT or DATA_ST_DATA */ - } stats; - } data_ctx; - unsigned int uniq_id; /* unique ID used for the traces */ -}; - -struct listener { - int fd; /* the listen socket */ - struct sockaddr_storage addr; /* the address we listen to */ - struct listener *next; /* next address or NULL */ -}; - -struct proxy { - struct listener *listen; /* the listen addresses and sockets */ - struct in_addr mon_net, mon_mask; /* don't forward connections from this net (network order) FIXME: should support IPv6 */ - int state; /* proxy state */ - struct sockaddr_in dispatch_addr; /* the default address to connect to */ - struct server *srv; /* known servers */ - int srv_act, srv_bck; /* # of running servers */ - int tot_wact, tot_wbck; /* total weights of active and backup servers */ - struct server **srv_map; /* the server map used to apply weights */ - int srv_map_sz; /* the size of the effective server map */ - int srv_rr_idx; /* next server to be elected in round robin mode */ - char *cookie_name; /* name of the cookie to look for */ - int cookie_len; /* strlen(cookie_name), computed only once */ - char *appsession_name; /* name of the cookie to look for */ - int appsession_name_len; /* strlen(appsession_name), computed only once */ - int appsession_len; /* length of the appsession cookie value to be used */ - int appsession_timeout; - CHTbl htbl_proxy; /* Per Proxy hashtable */ - char *capture_name; /* beginning of the name of the cookie to capture */ - int capture_namelen; /* length of the cookie name to match */ - int capture_len; /* length of the string to be captured */ - struct uri_auth *uri_auth; /* if non-NULL, the (list of) per-URI authentications */ - int clitimeout; /* client I/O timeout (in milliseconds) */ - int srvtimeout; /* server I/O timeout (in milliseconds) */ - int contimeout; /* connect timeout (in milliseconds) */ - char *id; /* proxy id */ - struct list pendconns; /* pending connections with no server assigned yet */ - int nbpend, nbpend_max; /* number of pending connections with no server assigned yet */ - int totpend; /* total number of pending connections on this instance (for stats) */ - unsigned int nbconn, nbconn_max; /* # of active sessions */ - unsigned int cum_conn; /* cumulated number of processed sessions */ - unsigned int maxconn; /* max # of active sessions */ - unsigned failed_conns, failed_resp; /* failed connect() and responses */ - unsigned failed_secu; /* blocked responses because of security concerns */ - int conn_retries; /* maximum number of connect retries */ - int options; /* PR_O_REDISP, PR_O_TRANSP, ... */ - int mode; /* mode = PR_MODE_TCP, PR_MODE_HTTP or PR_MODE_HEALTH */ - struct sockaddr_in source_addr; /* the address to which we want to bind for connect() */ - struct proxy *next; - struct sockaddr_in logsrv1, logsrv2; /* 2 syslog servers */ - signed char logfac1, logfac2; /* log facility for both servers. -1 = disabled */ - int loglev1, loglev2; /* log level for each server, 7 by default */ - int to_log; /* things to be logged (LW_*) */ - struct timeval stop_time; /* date to stop listening, when stopping != 0 */ - int nb_reqadd, nb_rspadd; - struct hdr_exp *req_exp; /* regular expressions for request headers */ - struct hdr_exp *rsp_exp; /* regular expressions for response headers */ - int nb_req_cap, nb_rsp_cap; /* # of headers to be captured */ - struct cap_hdr *req_cap; /* chained list of request headers to be captured */ - struct cap_hdr *rsp_cap; /* chained list of response headers to be captured */ - void *req_cap_pool, *rsp_cap_pool; /* pools of pre-allocated char ** used to build the sessions */ - char *req_add[MAX_NEWHDR], *rsp_add[MAX_NEWHDR]; /* headers to be added */ - int grace; /* grace time after stop request */ - char *check_req; /* HTTP request to use if PR_O_HTTP_CHK is set, else NULL */ - int check_len; /* Length of the HTTP request */ - struct { - char *msg400; /* message for error 400 */ - int len400; /* message length for error 400 */ - char *msg403; /* message for error 403 */ - int len403; /* message length for error 403 */ - char *msg408; /* message for error 408 */ - int len408; /* message length for error 408 */ - char *msg500; /* message for error 500 */ - int len500; /* message length for error 500 */ - char *msg502; /* message for error 502 */ - int len502; /* message length for error 502 */ - char *msg503; /* message for error 503 */ - int len503; /* message length for error 503 */ - char *msg504; /* message for error 504 */ - int len504; /* message length for error 504 */ - } errmsg; -}; - -/* info about one given fd */ -struct fdtab { - int (*read)(int fd); /* read function */ - int (*write)(int fd); /* write function */ - struct task *owner; /* the session (or proxy) associated with this fd */ - int state; /* the state of this fd */ -}; - -/*********************************************************************/ - -int cfg_maxpconn = DEFAULT_MAXCONN; /* # of simultaneous connections per proxy (-N) */ -int cfg_maxconn = 0; /* # of simultaneous connections, (-n) */ -char *cfg_cfgfile = NULL; /* configuration file */ -char *progname = NULL; /* program name */ -int pid; /* current process id */ - -/* global options */ -static struct { - int uid; - int gid; - int nbproc; - int maxconn; - int maxsock; /* max # of sockets */ - int rlimit_nofile; /* default ulimit-n value : 0=unset */ - int rlimit_memmax; /* default ulimit-d in megs value : 0=unset */ - int mode; - char *chroot; - char *pidfile; - int logfac1, logfac2; - int loglev1, loglev2; - struct sockaddr_in logsrv1, logsrv2; -} global = { - logfac1 : -1, - logfac2 : -1, - loglev1 : 7, /* max syslog level : debug */ - loglev2 : 7, - /* others NULL OK */ -}; - -/*********************************************************************/ - -fd_set *StaticReadEvent, - *StaticWriteEvent; - -int cfg_polling_mechanism = 0; /* POLL_USE_{SELECT|POLL|EPOLL} */ - -void **pool_session = NULL, - **pool_pendconn = NULL, - **pool_buffer = NULL, - **pool_fdtab = NULL, - **pool_requri = NULL, - **pool_task = NULL, - **pool_capture = NULL, - **pool_appsess = NULL; - -struct proxy *proxy = NULL; /* list of all existing proxies */ -struct fdtab *fdtab = NULL; /* array of all the file descriptors */ -struct task *rq = NULL; /* global run queue */ -struct task wait_queue[2] = { /* global wait queue */ - { - prev:LIST_HEAD(wait_queue[0]), /* expirable tasks */ - next:LIST_HEAD(wait_queue[0]), - }, - { - prev:LIST_HEAD(wait_queue[1]), /* non-expirable tasks */ - next:LIST_HEAD(wait_queue[1]), - }, -}; - -static int totalconn = 0; /* total # of terminated sessions */ -static int actconn = 0; /* # of active sessions */ -static int maxfd = 0; /* # of the highest fd + 1 */ -static int listeners = 0; /* # of listeners */ -static int stopping = 0; /* non zero means stopping in progress */ -static struct timeval now = {0,0}; /* the current date at any moment */ -static struct timeval start_date; /* the process's start date */ -static struct proxy defproxy; /* fake proxy used to assign default values on all instances */ - -/* Here we store informations about the pids of the processes we may pause - * or kill. We will send them a signal every 10 ms until we can bind to all - * our ports. With 200 retries, that's about 2 seconds. - */ -#define MAX_START_RETRIES 200 -static int nb_oldpids = 0; -static int *oldpids = NULL; -static int oldpids_sig; /* use USR1 or TERM */ - -#if defined(ENABLE_EPOLL) -/* FIXME: this is dirty, but at the moment, there's no other solution to remove - * the old FDs from outside the loop. Perhaps we should export a global 'poll' - * structure with pointers to functions such as init_fd() and close_fd(), plus - * a private structure with several pointers to places such as below. - */ - -static fd_set *PrevReadEvent = NULL, *PrevWriteEvent = NULL; -#endif - -static regmatch_t pmatch[MAX_MATCH]; /* rm_so, rm_eo for regular expressions */ -/* this is used to drain data, and as a temporary buffer for sprintf()... */ -static char trash[BUFSIZE]; - -const int zero = 0; -const int one = 1; - -/* - * Syslog facilities and levels. Conforming to RFC3164. - */ - -#define MAX_SYSLOG_LEN 1024 -#define NB_LOG_FACILITIES 24 -const char *log_facilities[NB_LOG_FACILITIES] = { - "kern", "user", "mail", "daemon", - "auth", "syslog", "lpr", "news", - "uucp", "cron", "auth2", "ftp", - "ntp", "audit", "alert", "cron2", - "local0", "local1", "local2", "local3", - "local4", "local5", "local6", "local7" -}; - - -#define NB_LOG_LEVELS 8 -const char *log_levels[NB_LOG_LEVELS] = { - "emerg", "alert", "crit", "err", - "warning", "notice", "info", "debug" -}; - -#define SYSLOG_PORT 514 - -const char *monthname[12] = {"Jan", "Feb", "Mar", "Apr", "May", "Jun", - "Jul", "Aug", "Sep", "Oct", "Nov", "Dec" }; - -const char sess_term_cond[8] = "-cCsSPRI"; /* normal, CliTo, CliErr, SrvTo, SrvErr, PxErr, Resource, Internal */ -const char sess_fin_state[8] = "-RCHDLQ7"; /* cliRequest, srvConnect, srvHeader, Data, Last, Queue, unknown */ -const char sess_cookie[4] = "NIDV"; /* No cookie, Invalid cookie, cookie for a Down server, Valid cookie */ -const char sess_set_cookie[8] = "N1I3PD5R"; /* No set-cookie, unknown, Set-Cookie Inserted, unknown, - Set-cookie seen and left unchanged (passive), Set-cookie Deleted, - unknown, Set-cookie Rewritten */ - -#define MAX_HOSTNAME_LEN 32 -static char hostname[MAX_HOSTNAME_LEN] = ""; - -const char *HTTP_302 = - "HTTP/1.0 302 Found\r\n" - "Cache-Control: no-cache\r\n" - "Connection: close\r\n" - "Location: "; /* not terminated since it will be concatenated with the URL */ - -/* same as 302 except that the browser MUST retry with the GET method */ -const char *HTTP_303 = - "HTTP/1.0 303 See Other\r\n" - "Cache-Control: no-cache\r\n" - "Connection: close\r\n" - "Location: "; /* not terminated since it will be concatenated with the URL */ - -const char *HTTP_400 = - "HTTP/1.0 400 Bad request\r\n" - "Cache-Control: no-cache\r\n" - "Connection: close\r\n" - "\r\n" - "

400 Bad request

\nYour browser sent an invalid request.\n\n"; - -/* Warning: this one is an sprintf() fmt string, with as its only argument */ -const char *HTTP_401_fmt = - "HTTP/1.0 401 Unauthorized\r\n" - "Cache-Control: no-cache\r\n" - "Connection: close\r\n" - "WWW-Authenticate: Basic realm=\"%s\"\r\n" - "\r\n" - "

401 Unauthorized

\nYou need a valid user and password to access this content.\n\n"; - -const char *HTTP_403 = - "HTTP/1.0 403 Forbidden\r\n" - "Cache-Control: no-cache\r\n" - "Connection: close\r\n" - "\r\n" - "

403 Forbidden

\nRequest forbidden by administrative rules.\n\n"; - -const char *HTTP_408 = - "HTTP/1.0 408 Request Time-out\r\n" - "Cache-Control: no-cache\r\n" - "Connection: close\r\n" - "\r\n" - "

408 Request Time-out

\nYour browser didn't send a complete request in time.\n\n"; - -const char *HTTP_500 = - "HTTP/1.0 500 Server Error\r\n" - "Cache-Control: no-cache\r\n" - "Connection: close\r\n" - "\r\n" - "

500 Server Error

\nAn internal server error occured.\n\n"; - -const char *HTTP_502 = - "HTTP/1.0 502 Bad Gateway\r\n" - "Cache-Control: no-cache\r\n" - "Connection: close\r\n" - "\r\n" - "

502 Bad Gateway

\nThe server returned an invalid or incomplete response.\n\n"; - -const char *HTTP_503 = - "HTTP/1.0 503 Service Unavailable\r\n" - "Cache-Control: no-cache\r\n" - "Connection: close\r\n" - "\r\n" - "

503 Service Unavailable

\nNo server is available to handle this request.\n\n"; - -const char *HTTP_504 = - "HTTP/1.0 504 Gateway Time-out\r\n" - "Cache-Control: no-cache\r\n" - "Connection: close\r\n" - "\r\n" - "

504 Gateway Time-out

\nThe server didn't respond in time.\n\n"; - -/*********************************************************************/ -/* statistics ******************************************************/ -/*********************************************************************/ - -#if STATTIME > 0 -static int stats_tsk_lsrch, stats_tsk_rsrch, - stats_tsk_good, stats_tsk_right, stats_tsk_left, - stats_tsk_new, stats_tsk_nsrch; -#endif - - -/*********************************************************************/ -/* debugging *******************************************************/ -/*********************************************************************/ -#ifdef DEBUG_FULL -static char *cli_stnames[5] = {"HDR", "DAT", "SHR", "SHW", "CLS" }; -static char *srv_stnames[7] = {"IDL", "CON", "HDR", "DAT", "SHR", "SHW", "CLS" }; -#endif - -/*********************************************************************/ -/* function prototypes *********************************************/ -/*********************************************************************/ - -int event_accept(int fd); -int event_cli_read(int fd); -int event_cli_write(int fd); -int event_srv_read(int fd); -int event_srv_write(int fd); -int process_session(struct task *t); - -static int appsession_task_init(void); -static int appsession_init(void); -static int appsession_refresh(struct task *t); - -/*********************************************************************/ -/* general purpose functions ***************************************/ -/*********************************************************************/ - -void display_version() { - printf("HA-Proxy version " HAPROXY_VERSION " " HAPROXY_DATE"\n"); - printf("Copyright 2000-2006 Willy Tarreau \n\n"); -} - -/* - * This function prints the command line usage and exits - */ -void usage(char *name) { - display_version(); - fprintf(stderr, - "Usage : %s -f [ -vdV" -#if STATTIME > 0 - "sl" -#endif - "D ] [ -n ] [ -N ]\n" - " [ -p ] [ -m ]\n" - " -v displays version\n" - " -d enters debug mode ; -db only disables background mode.\n" - " -V enters verbose mode (disables quiet mode)\n" -#if STATTIME > 0 - " -s enables statistics output\n" - " -l enables long statistics format\n" -#endif - " -D goes daemon ; implies -q\n" - " -q quiet mode : don't display messages\n" - " -c check mode : only check config file and exit\n" - " -n sets the maximum total # of connections (%d)\n" - " -m limits the usable amount of memory (in MB)\n" - " -N sets the default, per-proxy maximum # of connections (%d)\n" - " -p writes pids of all children to this file\n" -#if defined(ENABLE_EPOLL) - " -de disables epoll() usage even when available\n" -#endif -#if defined(ENABLE_POLL) - " -dp disables poll() usage even when available\n" -#endif - " -sf/-st [pid ]* finishes/terminates old pids. Must be last arguments.\n" - "\n", - name, DEFAULT_MAXCONN, cfg_maxpconn); - exit(1); -} - - -/* - * Displays the message on stderr with the date and pid. Overrides the quiet - * mode during startup. - */ -void Alert(char *fmt, ...) { - va_list argp; - struct timeval tv; - struct tm *tm; - - if (!(global.mode & MODE_QUIET) || (global.mode & (MODE_VERBOSE | MODE_STARTING))) { - va_start(argp, fmt); - - gettimeofday(&tv, NULL); - tm=localtime(&tv.tv_sec); - fprintf(stderr, "[ALERT] %03d/%02d%02d%02d (%d) : ", - tm->tm_yday, tm->tm_hour, tm->tm_min, tm->tm_sec, (int)getpid()); - vfprintf(stderr, fmt, argp); - fflush(stderr); - va_end(argp); - } -} - - -/* - * Displays the message on stderr with the date and pid. - */ -void Warning(char *fmt, ...) { - va_list argp; - struct timeval tv; - struct tm *tm; - - if (!(global.mode & MODE_QUIET) || (global.mode & MODE_VERBOSE)) { - va_start(argp, fmt); - - gettimeofday(&tv, NULL); - tm=localtime(&tv.tv_sec); - fprintf(stderr, "[WARNING] %03d/%02d%02d%02d (%d) : ", - tm->tm_yday, tm->tm_hour, tm->tm_min, tm->tm_sec, (int)getpid()); - vfprintf(stderr, fmt, argp); - fflush(stderr); - va_end(argp); - } -} - -/* - * Displays the message on only if quiet mode is not set. - */ -void qfprintf(FILE *out, char *fmt, ...) { - va_list argp; - - if (!(global.mode & MODE_QUIET) || (global.mode & MODE_VERBOSE)) { - va_start(argp, fmt); - vfprintf(out, fmt, argp); - fflush(out); - va_end(argp); - } -} - - -/* - * converts to a struct sockaddr_in* which is locally allocated. - * The format is "addr:port", where "addr" can be empty or "*" to indicate - * INADDR_ANY. - */ -struct sockaddr_in *str2sa(char *str) { - static struct sockaddr_in sa; - char *c; - int port; - - memset(&sa, 0, sizeof(sa)); - str=strdup(str); - - if ((c=strrchr(str,':')) != NULL) { - *c++=0; - port=atol(c); - } - else - port=0; - - if (*str == '*' || *str == '\0') { /* INADDR_ANY */ - sa.sin_addr.s_addr = INADDR_ANY; - } - else if (!inet_pton(AF_INET, str, &sa.sin_addr)) { - struct hostent *he; - - if ((he = gethostbyname(str)) == NULL) { - Alert("Invalid server name: '%s'\n", str); - } - else - sa.sin_addr = *(struct in_addr *) *(he->h_addr_list); - } - sa.sin_port=htons(port); - sa.sin_family=AF_INET; - - free(str); - return &sa; -} - -/* - * converts to a two struct in_addr* which are locally allocated. - * The format is "addr[/mask]", where "addr" cannot be empty, and mask - * is optionnal and either in the dotted or CIDR notation. - * Note: "addr" can also be a hostname. Returns 1 if OK, 0 if error. - */ -int str2net(char *str, struct in_addr *addr, struct in_addr *mask) { - char *c; - unsigned long len; - - memset(mask, 0, sizeof(*mask)); - memset(addr, 0, sizeof(*addr)); - str=strdup(str); - - if ((c = strrchr(str, '/')) != NULL) { - *c++ = 0; - /* c points to the mask */ - if (strchr(c, '.') != NULL) { /* dotted notation */ - if (!inet_pton(AF_INET, c, mask)) - return 0; - } - else { /* mask length */ - char *err; - len = strtol(c, &err, 10); - if (!*c || (err && *err) || (unsigned)len > 32) - return 0; - if (len) - mask->s_addr = htonl(0xFFFFFFFFUL << (32 - len)); - else - mask->s_addr = 0; - } - } - else { - mask->s_addr = 0xFFFFFFFF; - } - if (!inet_pton(AF_INET, str, addr)) { - struct hostent *he; - - if ((he = gethostbyname(str)) == NULL) { - return 0; - } - else - *addr = *(struct in_addr *) *(he->h_addr_list); - } - free(str); - return 1; -} - - -/* - * converts to a list of listeners which are dynamically allocated. - * The format is "{addr|'*'}:port[-end][,{addr|'*'}:port[-end]]*", where : - * - can be empty or "*" to indicate INADDR_ANY ; - * - is a numerical port from 1 to 65535 ; - * - indicates to use the range from to instead (inclusive). - * This can be repeated as many times as necessary, separated by a coma. - * The argument is a pointer to a current list which should be appended - * to the tail of the new list. The pointer to the new list is returned. - */ -struct listener *str2listener(char *str, struct listener *tail) { - struct listener *l; - char *c, *next, *range, *dupstr; - int port, end; - - next = dupstr = strdup(str); - - while (next && *next) { - struct sockaddr_storage ss; - - str = next; - /* 1) look for the end of the first address */ - if ((next = strrchr(str, ',')) != NULL) { - *next++ = 0; - } - - /* 2) look for the addr/port delimiter, it's the last colon. */ - if ((range = strrchr(str, ':')) == NULL) { - Alert("Missing port number: '%s'\n", str); - goto fail; - } - - *range++ = 0; - - if (strrchr(str, ':') != NULL) { - /* IPv6 address contains ':' */ - memset(&ss, 0, sizeof(ss)); - ss.ss_family = AF_INET6; - - if (!inet_pton(ss.ss_family, str, &((struct sockaddr_in6 *)&ss)->sin6_addr)) { - Alert("Invalid server address: '%s'\n", str); - goto fail; - } - } - else { - memset(&ss, 0, sizeof(ss)); - ss.ss_family = AF_INET; - - if (*str == '*' || *str == '\0') { /* INADDR_ANY */ - ((struct sockaddr_in *)&ss)->sin_addr.s_addr = INADDR_ANY; - } - else if (!inet_pton(ss.ss_family, str, &((struct sockaddr_in *)&ss)->sin_addr)) { - struct hostent *he; - - if ((he = gethostbyname(str)) == NULL) { - Alert("Invalid server name: '%s'\n", str); - goto fail; - } - else - ((struct sockaddr_in *)&ss)->sin_addr = - *(struct in_addr *) *(he->h_addr_list); - } - } - - /* 3) look for the port-end delimiter */ - if ((c = strchr(range, '-')) != NULL) { - *c++ = 0; - end = atol(c); - } - else { - end = atol(range); - } - - port = atol(range); - - if (port < 1 || port > 65535) { - Alert("Invalid port '%d' specified for address '%s'.\n", port, str); - goto fail; - } - - if (end < 1 || end > 65535) { - Alert("Invalid port '%d' specified for address '%s'.\n", end, str); - goto fail; - } - - for (; port <= end; port++) { - l = (struct listener *)calloc(1, sizeof(struct listener)); - l->next = tail; - tail = l; - - l->fd = -1; - l->addr = ss; - if (ss.ss_family == AF_INET6) - ((struct sockaddr_in6 *)(&l->addr))->sin6_port = htons(port); - else - ((struct sockaddr_in *)(&l->addr))->sin_port = htons(port); - - } /* end for(port) */ - } /* end while(next) */ - free(dupstr); - return tail; - fail: - free(dupstr); - return NULL; -} - - -#define FD_SETS_ARE_BITFIELDS -#ifdef FD_SETS_ARE_BITFIELDS -/* - * This map is used with all the FD_* macros to check whether a particular bit - * is set or not. Each bit represents an ACSII code. FD_SET() sets those bytes - * which should be encoded. When FD_ISSET() returns non-zero, it means that the - * byte should be encoded. Be careful to always pass bytes from 0 to 255 - * exclusively to the macros. - */ -fd_set hdr_encode_map[(sizeof(fd_set) > (256/8)) ? 1 : ((256/8) / sizeof(fd_set))]; -fd_set url_encode_map[(sizeof(fd_set) > (256/8)) ? 1 : ((256/8) / sizeof(fd_set))]; - -#else -#error "Check if your OS uses bitfields for fd_sets" -#endif - -/* will try to encode the string replacing all characters tagged in - * with the hexadecimal representation of their ASCII-code (2 digits) - * prefixed by , and will store the result between (included - *) and (excluded), and will always terminate the string with a '\0' - * before . The position of the '\0' is returned if the conversion - * completes. If bytes are missing between and , then the - * conversion will be incomplete and truncated. If <= , the '\0' - * cannot even be stored so we return without writing the 0. - * The input string must also be zero-terminated. - */ -char hextab[16] = "0123456789ABCDEF"; -char *encode_string(char *start, char *stop, - const char escape, const fd_set *map, - const char *string) -{ - if (start < stop) { - stop--; /* reserve one byte for the final '\0' */ - while (start < stop && *string != 0) { - if (!FD_ISSET((unsigned char)(*string), map)) - *start++ = *string; - else { - if (start + 3 >= stop) - break; - *start++ = escape; - *start++ = hextab[(*string >> 4) & 15]; - *start++ = hextab[*string & 15]; - } - string++; - } - *start = '\0'; - } - return start; -} - -/* - * This function sends a syslog message to both log servers of a proxy, - * or to global log servers if the proxy is NULL. - * It also tries not to waste too much time computing the message header. - * It doesn't care about errors nor does it report them. - */ -void send_log(struct proxy *p, int level, char *message, ...) { - static int logfd = -1; /* syslog UDP socket */ - static long tvsec = -1; /* to force the string to be initialized */ - struct timeval tv; - va_list argp; - static char logmsg[MAX_SYSLOG_LEN]; - static char *dataptr = NULL; - int fac_level; - int hdr_len, data_len; - struct sockaddr_in *sa[2]; - int facilities[2], loglevel[2]; - int nbloggers = 0; - char *log_ptr; - - if (logfd < 0) { - if ((logfd = socket(AF_INET, SOCK_DGRAM, IPPROTO_UDP)) < 0) - return; - } - - if (level < 0 || progname == NULL || message == NULL) - return; - - gettimeofday(&tv, NULL); - if (tv.tv_sec != tvsec || dataptr == NULL) { - /* this string is rebuild only once a second */ - struct tm *tm = localtime(&tv.tv_sec); - tvsec = tv.tv_sec; - - hdr_len = snprintf(logmsg, sizeof(logmsg), - "<<<<>%s %2d %02d:%02d:%02d %s[%d]: ", - monthname[tm->tm_mon], - tm->tm_mday, tm->tm_hour, tm->tm_min, tm->tm_sec, - progname, pid); - /* WARNING: depending upon implementations, snprintf may return - * either -1 or the number of bytes that would be needed to store - * the total message. In both cases, we must adjust it. - */ - if (hdr_len < 0 || hdr_len > sizeof(logmsg)) - hdr_len = sizeof(logmsg); - - dataptr = logmsg + hdr_len; - } - - va_start(argp, message); - data_len = vsnprintf(dataptr, logmsg + sizeof(logmsg) - dataptr, message, argp); - if (data_len < 0 || data_len > (logmsg + sizeof(logmsg) - dataptr)) - data_len = logmsg + sizeof(logmsg) - dataptr; - va_end(argp); - dataptr[data_len - 1] = '\n'; /* force a break on ultra-long lines */ - - if (p == NULL) { - if (global.logfac1 >= 0) { - sa[nbloggers] = &global.logsrv1; - facilities[nbloggers] = global.logfac1; - loglevel[nbloggers] = global.loglev1; - nbloggers++; - } - if (global.logfac2 >= 0) { - sa[nbloggers] = &global.logsrv2; - facilities[nbloggers] = global.logfac2; - loglevel[nbloggers] = global.loglev2; - nbloggers++; - } - } else { - if (p->logfac1 >= 0) { - sa[nbloggers] = &p->logsrv1; - facilities[nbloggers] = p->logfac1; - loglevel[nbloggers] = p->loglev1; - nbloggers++; - } - if (p->logfac2 >= 0) { - sa[nbloggers] = &p->logsrv2; - facilities[nbloggers] = p->logfac2; - loglevel[nbloggers] = p->loglev2; - nbloggers++; - } - } - - while (nbloggers-- > 0) { - /* we can filter the level of the messages that are sent to each logger */ - if (level > loglevel[nbloggers]) - continue; - - /* For each target, we may have a different facility. - * We can also have a different log level for each message. - * This induces variations in the message header length. - * Since we don't want to recompute it each time, nor copy it every - * time, we only change the facility in the pre-computed header, - * and we change the pointer to the header accordingly. - */ - fac_level = (facilities[nbloggers] << 3) + level; - log_ptr = logmsg + 3; /* last digit of the log level */ - do { - *log_ptr = '0' + fac_level % 10; - fac_level /= 10; - log_ptr--; - } while (fac_level && log_ptr > logmsg); - *log_ptr = '<'; - - /* the total syslog message now starts at logptr, for dataptr+data_len-logptr */ - -#ifndef MSG_NOSIGNAL - sendto(logfd, log_ptr, dataptr + data_len - log_ptr, MSG_DONTWAIT, - (struct sockaddr *)sa[nbloggers], sizeof(**sa)); -#else - sendto(logfd, log_ptr, dataptr + data_len - log_ptr, MSG_DONTWAIT | MSG_NOSIGNAL, - (struct sockaddr *)sa[nbloggers], sizeof(**sa)); -#endif - } -} - - -/* sets to the current time */ -static inline struct timeval *tv_now(struct timeval *tv) { - if (tv) - gettimeofday(tv, NULL); - return tv; -} - -/* - * adds ms to , set the result to and returns a pointer - */ -static struct timeval *tv_delayfrom(struct timeval *tv, struct timeval *from, int ms) { - if (!tv || !from) - return NULL; - tv->tv_usec = from->tv_usec + (ms%1000)*1000; - tv->tv_sec = from->tv_sec + (ms/1000); - while (tv->tv_usec >= 1000000) { - tv->tv_usec -= 1000000; - tv->tv_sec++; - } - return tv; -} - -/* - * compares and : returns 0 if equal, -1 if tv1 < tv2, 1 if tv1 > tv2 - * Must not be used when either argument is eternity. Use tv_cmp2() for that. - */ -static inline int tv_cmp(struct timeval *tv1, struct timeval *tv2) { - if (tv1->tv_sec < tv2->tv_sec) - return -1; - else if (tv1->tv_sec > tv2->tv_sec) - return 1; - else if (tv1->tv_usec < tv2->tv_usec) - return -1; - else if (tv1->tv_usec > tv2->tv_usec) - return 1; - else - return 0; -} - -/* - * returns the absolute difference, in ms, between tv1 and tv2 - * Must not be used when either argument is eternity. - */ -unsigned long tv_delta(struct timeval *tv1, struct timeval *tv2) { - int cmp; - unsigned long ret; - - - cmp = tv_cmp(tv1, tv2); - if (!cmp) - return 0; /* same dates, null diff */ - else if (cmp < 0) { - struct timeval *tmp = tv1; - tv1 = tv2; - tv2 = tmp; - } - ret = (tv1->tv_sec - tv2->tv_sec) * 1000; - if (tv1->tv_usec > tv2->tv_usec) - ret += (tv1->tv_usec - tv2->tv_usec) / 1000; - else - ret -= (tv2->tv_usec - tv1->tv_usec) / 1000; - return (unsigned long) ret; -} - -/* - * returns the difference, in ms, between tv1 and tv2 - * Must not be used when either argument is eternity. - */ -static inline unsigned long tv_diff(struct timeval *tv1, struct timeval *tv2) { - unsigned long ret; - - ret = (tv2->tv_sec - tv1->tv_sec) * 1000; - if (tv2->tv_usec > tv1->tv_usec) - ret += (tv2->tv_usec - tv1->tv_usec) / 1000; - else - ret -= (tv1->tv_usec - tv2->tv_usec) / 1000; - return (unsigned long) ret; -} - -/* - * compares and modulo 1ms: returns 0 if equal, -1 if tv1 < tv2, 1 if tv1 > tv2 - * Must not be used when either argument is eternity. Use tv_cmp2_ms() for that. - */ -static int tv_cmp_ms(struct timeval *tv1, struct timeval *tv2) { - if (tv1->tv_sec == tv2->tv_sec) { - if (tv2->tv_usec >= tv1->tv_usec + 1000) - return -1; - else if (tv1->tv_usec >= tv2->tv_usec + 1000) - return 1; - else - return 0; - } - else if ((tv2->tv_sec > tv1->tv_sec + 1) || - ((tv2->tv_sec == tv1->tv_sec + 1) && (tv2->tv_usec + 1000000 >= tv1->tv_usec + 1000))) - return -1; - else if ((tv1->tv_sec > tv2->tv_sec + 1) || - ((tv1->tv_sec == tv2->tv_sec + 1) && (tv1->tv_usec + 1000000 >= tv2->tv_usec + 1000))) - return 1; - else - return 0; -} - -/* - * returns the remaining time between tv1=now and event=tv2 - * if tv2 is passed, 0 is returned. - * Must not be used when either argument is eternity. - */ -static inline unsigned long tv_remain(struct timeval *tv1, struct timeval *tv2) { - unsigned long ret; - - if (tv_cmp_ms(tv1, tv2) >= 0) - return 0; /* event elapsed */ - - ret = (tv2->tv_sec - tv1->tv_sec) * 1000; - if (tv2->tv_usec > tv1->tv_usec) - ret += (tv2->tv_usec - tv1->tv_usec) / 1000; - else - ret -= (tv1->tv_usec - tv2->tv_usec) / 1000; - return (unsigned long) ret; -} - - -/* - * zeroes a struct timeval - */ - -static inline struct timeval *tv_eternity(struct timeval *tv) { - tv->tv_sec = tv->tv_usec = 0; - return tv; -} - -/* - * returns 1 if tv is null, else 0 - */ -static inline int tv_iseternity(struct timeval *tv) { - if (tv->tv_sec == 0 && tv->tv_usec == 0) - return 1; - else - return 0; -} - -/* - * compares and : returns 0 if equal, -1 if tv1 < tv2, 1 if tv1 > tv2, - * considering that 0 is the eternity. - */ -static int tv_cmp2(struct timeval *tv1, struct timeval *tv2) { - if (tv_iseternity(tv1)) - if (tv_iseternity(tv2)) - return 0; /* same */ - else - return 1; /* tv1 later than tv2 */ - else if (tv_iseternity(tv2)) - return -1; /* tv2 later than tv1 */ - - if (tv1->tv_sec > tv2->tv_sec) - return 1; - else if (tv1->tv_sec < tv2->tv_sec) - return -1; - else if (tv1->tv_usec > tv2->tv_usec) - return 1; - else if (tv1->tv_usec < tv2->tv_usec) - return -1; - else - return 0; -} - -/* - * compares and modulo 1 ms: returns 0 if equal, -1 if tv1 < tv2, 1 if tv1 > tv2, - * considering that 0 is the eternity. - */ -static int tv_cmp2_ms(struct timeval *tv1, struct timeval *tv2) { - if (tv_iseternity(tv1)) - if (tv_iseternity(tv2)) - return 0; /* same */ - else - return 1; /* tv1 later than tv2 */ - else if (tv_iseternity(tv2)) - return -1; /* tv2 later than tv1 */ - - if (tv1->tv_sec == tv2->tv_sec) { - if (tv1->tv_usec >= tv2->tv_usec + 1000) - return 1; - else if (tv2->tv_usec >= tv1->tv_usec + 1000) - return -1; - else - return 0; - } - else if ((tv1->tv_sec > tv2->tv_sec + 1) || - ((tv1->tv_sec == tv2->tv_sec + 1) && (tv1->tv_usec + 1000000 >= tv2->tv_usec + 1000))) - return 1; - else if ((tv2->tv_sec > tv1->tv_sec + 1) || - ((tv2->tv_sec == tv1->tv_sec + 1) && (tv2->tv_usec + 1000000 >= tv1->tv_usec + 1000))) - return -1; - else - return 0; -} - -/* - * returns the remaining time between tv1=now and event=tv2 - * if tv2 is passed, 0 is returned. - * Returns TIME_ETERNITY if tv2 is eternity. - */ -static unsigned long tv_remain2(struct timeval *tv1, struct timeval *tv2) { - unsigned long ret; - - if (tv_iseternity(tv2)) - return TIME_ETERNITY; - - if (tv_cmp_ms(tv1, tv2) >= 0) - return 0; /* event elapsed */ - - ret = (tv2->tv_sec - tv1->tv_sec) * 1000; - if (tv2->tv_usec > tv1->tv_usec) - ret += (tv2->tv_usec - tv1->tv_usec) / 1000; - else - ret -= (tv1->tv_usec - tv2->tv_usec) / 1000; - return (unsigned long) ret; -} - -/* - * returns the first event between tv1 and tv2 into tvmin. - * a zero tv is ignored. tvmin is returned. - */ -static inline struct timeval *tv_min(struct timeval *tvmin, - struct timeval *tv1, struct timeval *tv2) { - - if (tv_cmp2(tv1, tv2) <= 0) - *tvmin = *tv1; - else - *tvmin = *tv2; - - return tvmin; -} - - - -/***********************************************************/ -/* fd management ***************************************/ -/***********************************************************/ - - - -/* Deletes an FD from the fdsets, and recomputes the maxfd limit. - * The file descriptor is also closed. - */ -static void fd_delete(int fd) { - FD_CLR(fd, StaticReadEvent); - FD_CLR(fd, StaticWriteEvent); -#if defined(ENABLE_EPOLL) - if (PrevReadEvent) { - FD_CLR(fd, PrevReadEvent); - FD_CLR(fd, PrevWriteEvent); - } -#endif - - close(fd); - fdtab[fd].state = FD_STCLOSE; - - while ((maxfd-1 >= 0) && (fdtab[maxfd-1].state == FD_STCLOSE)) - maxfd--; -} - -/* recomputes the maxfd limit from the fd */ -static inline void fd_insert(int fd) { - if (fd+1 > maxfd) - maxfd = fd+1; -} - -/*************************************************************/ -/* task management ***************************************/ -/*************************************************************/ - -/* puts the task in run queue , and returns */ -static inline struct task *task_wakeup(struct task **q, struct task *t) { - if (t->state == TASK_RUNNING) - return t; - else { - t->rqnext = *q; - t->state = TASK_RUNNING; - return *q = t; - } -} - -/* removes the task from the queue - * MUST be 's first task. - * set the run queue to point to the next one, and return it - */ -static inline struct task *task_sleep(struct task **q, struct task *t) { - if (t->state == TASK_RUNNING) { - *q = t->rqnext; - t->state = TASK_IDLE; /* tell that s has left the run queue */ - } - return *q; /* return next running task */ -} - -/* - * removes the task from its wait queue. It must have already been removed - * from the run queue. A pointer to the task itself is returned. - */ -static inline struct task *task_delete(struct task *t) { - t->prev->next = t->next; - t->next->prev = t->prev; - return t; -} - -/* - * frees a task. Its context must have been freed since it will be lost. - */ -static inline void task_free(struct task *t) { - pool_free(task, t); -} - -/* inserts into its assigned wait queue, where it may already be. In this case, it - * may be only moved or left where it was, depending on its timing requirements. - * is returned. - */ -struct task *task_queue(struct task *task) { - struct task *list = task->wq; - struct task *start_from; - - /* This is a very dirty hack to queue non-expirable tasks in another queue - * in order to avoid pulluting the tail of the standard queue. This will go - * away with the new O(log(n)) scheduler anyway. - */ - if (tv_iseternity(&task->expire)) { - /* if the task was queued in the standard wait queue, we must dequeue it */ - if (task->prev) { - if (task->wq == LIST_HEAD(wait_queue[1])) - return task; - else { - task_delete(task); - task->prev = NULL; - } - } - list = task->wq = LIST_HEAD(wait_queue[1]); - } else { - /* if the task was queued in the eternity queue, we must dequeue it */ - if (task->prev && (task->wq == LIST_HEAD(wait_queue[1]))) { - task_delete(task); - task->prev = NULL; - list = task->wq = LIST_HEAD(wait_queue[0]); - } - } - - /* next, test if the task was already in a list */ - if (task->prev == NULL) { - // start_from = list; - start_from = list->prev; -#if STATTIME > 0 - stats_tsk_new++; -#endif - /* insert the unlinked into the list, searching back from the last entry */ - while (start_from != list && tv_cmp2(&task->expire, &start_from->expire) < 0) { - start_from = start_from->prev; -#if STATTIME > 0 - stats_tsk_nsrch++; -#endif - } - - // while (start_from->next != list && tv_cmp2(&task->expire, &start_from->next->expire) > 0) { - // start_from = start_from->next; - // stats_tsk_nsrch++; - // } - } - else if (task->prev == list || - tv_cmp2(&task->expire, &task->prev->expire) >= 0) { /* walk right */ - start_from = task->next; - if (start_from == list || tv_cmp2(&task->expire, &start_from->expire) <= 0) { -#if STATTIME > 0 - stats_tsk_good++; -#endif - return task; /* it's already in the right place */ - } - -#if STATTIME > 0 - stats_tsk_right++; -#endif - - /* if the task is not at the right place, there's little chance that - * it has only shifted a bit, and it will nearly always be queued - * at the end of the list because of constant timeouts - * (observed in real case). - */ -#ifndef WE_REALLY_THINK_THAT_THIS_TASK_MAY_HAVE_SHIFTED - start_from = list->prev; /* assume we'll queue to the end of the list */ - while (start_from != list && tv_cmp2(&task->expire, &start_from->expire) < 0) { - start_from = start_from->prev; -#if STATTIME > 0 - stats_tsk_lsrch++; -#endif - } -#else /* WE_REALLY_... */ - /* insert the unlinked into the list, searching after position */ - while (start_from->next != list && tv_cmp2(&task->expire, &start_from->next->expire) > 0) { - start_from = start_from->next; -#if STATTIME > 0 - stats_tsk_rsrch++; -#endif - } -#endif /* WE_REALLY_... */ - - /* we need to unlink it now */ - task_delete(task); - } - else { /* walk left. */ -#if STATTIME > 0 - stats_tsk_left++; -#endif -#ifdef LEFT_TO_TOP /* not very good */ - start_from = list; - while (start_from->next != list && tv_cmp2(&task->expire, &start_from->next->expire) > 0) { - start_from = start_from->next; -#if STATTIME > 0 - stats_tsk_lsrch++; -#endif - } -#else - start_from = task->prev->prev; /* valid because of the previous test above */ - while (start_from != list && tv_cmp2(&task->expire, &start_from->expire) < 0) { - start_from = start_from->prev; -#if STATTIME > 0 - stats_tsk_lsrch++; -#endif - } -#endif - /* we need to unlink it now */ - task_delete(task); - } - task->prev = start_from; - task->next = start_from->next; - task->next->prev = task; - start_from->next = task; - return task; -} - - -/*********************************************************************/ -/* pending connections queues **************************************/ -/*********************************************************************/ - -/* - * Detaches pending connection

, decreases the pending count, and frees - * the pending connection. The connection might have been queued to a specific - * server as well as to the proxy. The session also gets marked unqueued. - */ -static void pendconn_free(struct pendconn *p) { - LIST_DEL(&p->list); - p->sess->pend_pos = NULL; - if (p->srv) - p->srv->nbpend--; - else - p->sess->proxy->nbpend--; - p->sess->proxy->totpend--; - pool_free(pendconn, p); -} - -/* Returns the first pending connection for server , which may be NULL if - * nothing is pending. - */ -static inline struct pendconn *pendconn_from_srv(struct server *s) { - if (!s->nbpend) - return NULL; - - return LIST_ELEM(s->pendconns.n, struct pendconn *, list); -} - -/* Returns the first pending connection for proxy , which may be NULL if - * nothing is pending. - */ -static inline struct pendconn *pendconn_from_px(struct proxy *px) { - if (!px->nbpend) - return NULL; - - return LIST_ELEM(px->pendconns.n, struct pendconn *, list); -} - -/* Detaches the next pending connection from either a server or a proxy, and - * returns its associated session. If no pending connection is found, NULL is - * returned. Note that neither nor can be NULL. - */ -static struct session *pendconn_get_next_sess(struct server *srv, struct proxy *px) { - struct pendconn *p; - struct session *sess; - - p = pendconn_from_srv(srv); - if (!p) { - p = pendconn_from_px(px); - if (!p) - return NULL; - p->sess->srv = srv; - } - sess = p->sess; - pendconn_free(p); - return sess; -} - -/* Adds the session to the pending connection list of server ->srv - * or to the one of ->proxy if srv is NULL. All counters and back pointers - * are updated accordingly. Returns NULL if no memory is available, otherwise the - * pendconn itself. - */ -static struct pendconn *pendconn_add(struct session *sess) { - struct pendconn *p; - - p = pool_alloc(pendconn); - if (!p) - return NULL; - - sess->pend_pos = p; - p->sess = sess; - p->srv = sess->srv; - if (sess->srv) { - LIST_ADDQ(&sess->srv->pendconns, &p->list); - sess->logs.srv_queue_size += sess->srv->nbpend; - sess->srv->nbpend++; - if (sess->srv->nbpend > sess->srv->nbpend_max) - sess->srv->nbpend_max = sess->srv->nbpend; - } else { - LIST_ADDQ(&sess->proxy->pendconns, &p->list); - sess->logs.prx_queue_size += sess->proxy->nbpend; - sess->proxy->nbpend++; - if (sess->proxy->nbpend > sess->proxy->nbpend_max) - sess->proxy->nbpend_max = sess->proxy->nbpend; - } - sess->proxy->totpend++; - return p; -} - -/* returns the effective dynamic maxconn for a server, considering the minconn - * and the proxy's usage relative to its saturation. - */ -static unsigned int srv_dynamic_maxconn(struct server *s) { - return s->minconn ? - ((s->maxconn * s->proxy->nbconn / s->proxy->maxconn) < s->minconn) ? s->minconn : - (s->maxconn * s->proxy->nbconn / s->proxy->maxconn) : s->maxconn; -} - -/* returns 0 if nothing has to be done for server regarding queued connections, - * and non-zero otherwise. Suited for and if/else usage. - */ -static inline int may_dequeue_tasks(struct server *s, struct proxy *p) { - return (s && (s->nbpend || p->nbpend) && - (!s->maxconn || s->cur_sess < srv_dynamic_maxconn(s)) && - s->queue_mgt); -} - - - -/*********************************************************************/ -/* more specific functions ***************************************/ -/*********************************************************************/ - -/* some prototypes */ -static int maintain_proxies(void); - -/* This either returns the sockname or the original destination address. Code - * inspired from Patrick Schaaf's example of nf_getsockname() implementation. - */ -static int get_original_dst(int fd, struct sockaddr_in *sa, socklen_t *salen) { -#if defined(TPROXY) && defined(SO_ORIGINAL_DST) - return getsockopt(fd, SOL_IP, SO_ORIGINAL_DST, (void *)sa, salen); -#else -#if defined(TPROXY) && defined(USE_GETSOCKNAME) - return getsockname(fd, (struct sockaddr *)sa, salen); -#else - return -1; -#endif -#endif -} - -/* - * frees the context associated to a session. It must have been removed first. - */ -static void session_free(struct session *s) { - if (s->pend_pos) - pendconn_free(s->pend_pos); - if (s->req) - pool_free(buffer, s->req); - if (s->rep) - pool_free(buffer, s->rep); - - if (s->rsp_cap != NULL) { - struct cap_hdr *h; - for (h = s->proxy->rsp_cap; h; h = h->next) { - if (s->rsp_cap[h->index] != NULL) - pool_free_to(h->pool, s->rsp_cap[h->index]); - } - pool_free_to(s->proxy->rsp_cap_pool, s->rsp_cap); - } - if (s->req_cap != NULL) { - struct cap_hdr *h; - for (h = s->proxy->req_cap; h; h = h->next) { - if (s->req_cap[h->index] != NULL) - pool_free_to(h->pool, s->req_cap[h->index]); - } - pool_free_to(s->proxy->req_cap_pool, s->req_cap); - } - - if (s->logs.uri) - pool_free(requri, s->logs.uri); - if (s->logs.cli_cookie) - pool_free(capture, s->logs.cli_cookie); - if (s->logs.srv_cookie) - pool_free(capture, s->logs.srv_cookie); - - pool_free(session, s); -} - - -/* - * This function recounts the number of usable active and backup servers for - * proxy

. These numbers are returned into the p->srv_act and p->srv_bck. - * This function also recomputes the total active and backup weights. - */ -static void recount_servers(struct proxy *px) { - struct server *srv; - - px->srv_act = 0; px->srv_bck = px->tot_wact = px->tot_wbck = 0; - for (srv = px->srv; srv != NULL; srv = srv->next) { - if (srv->state & SRV_RUNNING) { - if (srv->state & SRV_BACKUP) { - px->srv_bck++; - px->tot_wbck += srv->eweight + 1; - } else { - px->srv_act++; - px->tot_wact += srv->eweight + 1; - } - } - } -} - -/* This function recomputes the server map for proxy px. It - * relies on px->tot_wact and px->tot_wbck, so it must be - * called after recount_servers(). It also expects px->srv_map - * to be initialized to the largest value needed. - */ -static void recalc_server_map(struct proxy *px) { - int o, tot, flag; - struct server *cur, *best; - - if (px->srv_act) { - flag = SRV_RUNNING; - tot = px->tot_wact; - } else if (px->srv_bck) { - flag = SRV_RUNNING | SRV_BACKUP; - if (px->options & PR_O_USE_ALL_BK) - tot = px->tot_wbck; - else - tot = 1; /* the first server is enough */ - } else { - px->srv_map_sz = 0; - return; - } - - /* this algorithm gives priority to the first server, which means that - * it will respect the declaration order for equivalent weights, and - * that whatever the weights, the first server called will always be - * the first declard. This is an important asumption for the backup - * case, where we want the first server only. - */ - for (cur = px->srv; cur; cur = cur->next) - cur->wscore = 0; - - for (o = 0; o < tot; o++) { - int max = 0; - best = NULL; - for (cur = px->srv; cur; cur = cur->next) { - if ((cur->state & (SRV_RUNNING | SRV_BACKUP)) == flag) { - int v; - - /* If we are forced to return only one server, we don't want to - * go further, because we would return the wrong one due to - * divide overflow. - */ - if (tot == 1) { - best = cur; - break; - } - - cur->wscore += cur->eweight + 1; - v = (cur->wscore + tot) / tot; /* result between 0 and 3 */ - if (best == NULL || v > max) { - max = v; - best = cur; - } - } - } - px->srv_map[o] = best; - best->wscore -= tot; - } - px->srv_map_sz = tot; -} - -/* - * This function tries to find a running server with free connection slots for - * the proxy following the round-robin method. - * If any server is found, it will be returned and px->srv_rr_idx will be updated - * to point to the next server. If no valid server is found, NULL is returned. - */ -static inline struct server *get_server_rr_with_conns(struct proxy *px) { - int newidx; - struct server *srv; - - if (px->srv_map_sz == 0) - return NULL; - - if (px->srv_rr_idx < 0 || px->srv_rr_idx >= px->srv_map_sz) - px->srv_rr_idx = 0; - newidx = px->srv_rr_idx; - - do { - srv = px->srv_map[newidx++]; - if (!srv->maxconn || srv->cur_sess < srv_dynamic_maxconn(srv)) { - px->srv_rr_idx = newidx; - return srv; - } - if (newidx == px->srv_map_sz) - newidx = 0; - } while (newidx != px->srv_rr_idx); - - return NULL; -} - - -/* - * This function tries to find a running server for the proxy following - * the round-robin method. - * If any server is found, it will be returned and px->srv_rr_idx will be updated - * to point to the next server. If no valid server is found, NULL is returned. - */ -static inline struct server *get_server_rr(struct proxy *px) { - if (px->srv_map_sz == 0) - return NULL; - - if (px->srv_rr_idx < 0 || px->srv_rr_idx >= px->srv_map_sz) - px->srv_rr_idx = 0; - return px->srv_map[px->srv_rr_idx++]; -} - - -/* - * This function tries to find a running server for the proxy following - * the source hash method. Depending on the number of active/backup servers, - * it will either look for active servers, or for backup servers. - * If any server is found, it will be returned. If no valid server is found, - * NULL is returned. - */ -static inline struct server *get_server_sh(struct proxy *px, char *addr, int len) { - unsigned int h, l; - - if (px->srv_map_sz == 0) - return NULL; - - l = h = 0; - if (px->srv_act > 1 || (px->srv_act == 0 && px->srv_bck > 1)) { - while ((l + sizeof (int)) <= len) { - h ^= ntohl(*(unsigned int *)(&addr[l])); - l += sizeof (int); - } - h %= px->srv_map_sz; - } - return px->srv_map[h]; -} - - -/* - * This function marks the session as 'assigned' in direct or dispatch modes, - * or tries to assign one in balance mode, according to the algorithm. It does - * nothing if the session had already been assigned a server. - * - * It may return : - * SRV_STATUS_OK if everything is OK. s->srv will be valid. - * SRV_STATUS_NOSRV if no server is available. s->srv = NULL. - * SRV_STATUS_FULL if all servers are saturated. s->srv = NULL. - * SRV_STATUS_INTERNAL for other unrecoverable errors. - * - * Upon successful return, the session flag SN_ASSIGNED to indicate that it does - * not need to be called anymore. This usually means that s->srv can be trusted - * in balance and direct modes. This flag is not cleared, so it's to the caller - * to clear it if required (eg: redispatch). - * - */ - -int assign_server(struct session *s) { -#ifdef DEBUG_FULL - fprintf(stderr,"assign_server : s=%p\n",s); -#endif - - if (s->pend_pos) - return SRV_STATUS_INTERNAL; - - if (!(s->flags & SN_ASSIGNED)) { - if ((s->proxy->options & PR_O_BALANCE) && !(s->flags & SN_DIRECT)) { - if (!s->proxy->srv_act && !s->proxy->srv_bck) - return SRV_STATUS_NOSRV; - - if (s->proxy->options & PR_O_BALANCE_RR) { - s->srv = get_server_rr_with_conns(s->proxy); - if (!s->srv) - return SRV_STATUS_FULL; - } - else if (s->proxy->options & PR_O_BALANCE_SH) { - int len; - - if (s->cli_addr.ss_family == AF_INET) - len = 4; - else if (s->cli_addr.ss_family == AF_INET6) - len = 16; - else /* unknown IP family */ - return SRV_STATUS_INTERNAL; - - s->srv = get_server_sh(s->proxy, - (void *)&((struct sockaddr_in *)&s->cli_addr)->sin_addr, - len); - } - else /* unknown balancing algorithm */ - return SRV_STATUS_INTERNAL; - } - s->flags |= SN_ASSIGNED; - } - return SRV_STATUS_OK; -} - -/* - * This function assigns a server address to a session, and sets SN_ADDR_SET. - * The address is taken from the currently assigned server, or from the - * dispatch or transparent address. - * - * It may return : - * SRV_STATUS_OK if everything is OK. - * SRV_STATUS_INTERNAL for other unrecoverable errors. - * - * Upon successful return, the session flag SN_ADDR_SET is set. This flag is - * not cleared, so it's to the caller to clear it if required. - * - */ -int assign_server_address(struct session *s) { -#ifdef DEBUG_FULL - fprintf(stderr,"assign_server_address : s=%p\n",s); -#endif - - if (s->flags & SN_DIRECT || s->proxy->options & PR_O_BALANCE) { - /* A server is necessarily known for this session */ - if (!(s->flags & SN_ASSIGNED)) - return SRV_STATUS_INTERNAL; - - s->srv_addr = s->srv->addr; - - /* if this server remaps proxied ports, we'll use - * the port the client connected to with an offset. */ - if (s->srv->state & SRV_MAPPORTS) { - struct sockaddr_in sockname; - socklen_t namelen = sizeof(sockname); - - if (!(s->proxy->options & PR_O_TRANSP) || - get_original_dst(s->cli_fd, (struct sockaddr_in *)&sockname, &namelen) == -1) - getsockname(s->cli_fd, (struct sockaddr *)&sockname, &namelen); - s->srv_addr.sin_port = htons(ntohs(s->srv_addr.sin_port) + ntohs(sockname.sin_port)); - } - } - else if (*(int *)&s->proxy->dispatch_addr.sin_addr) { - /* connect to the defined dispatch addr */ - s->srv_addr = s->proxy->dispatch_addr; - } - else if (s->proxy->options & PR_O_TRANSP) { - /* in transparent mode, use the original dest addr if no dispatch specified */ - socklen_t salen = sizeof(s->srv_addr); - - if (get_original_dst(s->cli_fd, &s->srv_addr, &salen) == -1) { - qfprintf(stderr, "Cannot get original server address.\n"); - return SRV_STATUS_INTERNAL; - } - } - - s->flags |= SN_ADDR_SET; - return SRV_STATUS_OK; -} - -/* This function assigns a server to session if required, and can add the - * connection to either the assigned server's queue or to the proxy's queue. - * - * Returns : - * - * SRV_STATUS_OK if everything is OK. - * SRV_STATUS_NOSRV if no server is available. s->srv = NULL. - * SRV_STATUS_QUEUED if the connection has been queued. - * SRV_STATUS_FULL if the server(s) is/are saturated and the - * connection could not be queued. - * SRV_STATUS_INTERNAL for other unrecoverable errors. - * - */ -int assign_server_and_queue(struct session *s) { - struct pendconn *p; - int err; - - if (s->pend_pos) - return SRV_STATUS_INTERNAL; - - if (s->flags & SN_ASSIGNED) { - /* a server does not need to be assigned, perhaps because we're in - * direct mode, or in dispatch or transparent modes where the server - * is not needed. - */ - if (s->srv && - s->srv->maxconn && s->srv->cur_sess >= srv_dynamic_maxconn(s->srv)) { - p = pendconn_add(s); - if (p) - return SRV_STATUS_QUEUED; - else - return SRV_STATUS_FULL; - } - return SRV_STATUS_OK; - } - - /* a server needs to be assigned */ - err = assign_server(s); - switch (err) { - case SRV_STATUS_OK: - /* in balance mode, we might have servers with connection limits */ - if (s->srv && - s->srv->maxconn && s->srv->cur_sess >= srv_dynamic_maxconn(s->srv)) { - p = pendconn_add(s); - if (p) - return SRV_STATUS_QUEUED; - else - return SRV_STATUS_FULL; - } - return SRV_STATUS_OK; - - case SRV_STATUS_FULL: - /* queue this session into the proxy's queue */ - p = pendconn_add(s); - if (p) - return SRV_STATUS_QUEUED; - else - return SRV_STATUS_FULL; - - case SRV_STATUS_NOSRV: - case SRV_STATUS_INTERNAL: - return err; - default: - return SRV_STATUS_INTERNAL; - } -} - - -/* - * This function initiates a connection to the server assigned to this session - * (s->srv, s->srv_addr). It will assign a server if none is assigned yet. - * It can return one of : - * - SN_ERR_NONE if everything's OK - * - SN_ERR_SRVTO if there are no more servers - * - SN_ERR_SRVCL if the connection was refused by the server - * - SN_ERR_PRXCOND if the connection has been limited by the proxy (maxconn) - * - SN_ERR_RESOURCE if a system resource is lacking (eg: fd limits, ports, ...) - * - SN_ERR_INTERNAL for any other purely internal errors - * Additionnally, in the case of SN_ERR_RESOURCE, an emergency log will be emitted. - */ -int connect_server(struct session *s) { - int fd, err; - - if (!(s->flags & SN_ADDR_SET)) { - err = assign_server_address(s); - if (err != SRV_STATUS_OK) - return SN_ERR_INTERNAL; - } - - if ((fd = s->srv_fd = socket(AF_INET, SOCK_STREAM, IPPROTO_TCP)) == -1) { - qfprintf(stderr, "Cannot get a server socket.\n"); - - if (errno == ENFILE) - send_log(s->proxy, LOG_EMERG, - "Proxy %s reached system FD limit at %d. Please check system tunables.\n", - s->proxy->id, maxfd); - else if (errno == EMFILE) - send_log(s->proxy, LOG_EMERG, - "Proxy %s reached process FD limit at %d. Please check 'ulimit-n' and restart.\n", - s->proxy->id, maxfd); - else if (errno == ENOBUFS || errno == ENOMEM) - send_log(s->proxy, LOG_EMERG, - "Proxy %s reached system memory limit at %d sockets. Please check system tunables.\n", - s->proxy->id, maxfd); - /* this is a resource error */ - return SN_ERR_RESOURCE; - } - - if (fd >= global.maxsock) { - /* do not log anything there, it's a normal condition when this option - * is used to serialize connections to a server ! - */ - Alert("socket(): not enough free sockets. Raise -n argument. Giving up.\n"); - close(fd); - return SN_ERR_PRXCOND; /* it is a configuration limit */ - } - - if ((fcntl(fd, F_SETFL, O_NONBLOCK)==-1) || - (setsockopt(fd, IPPROTO_TCP, TCP_NODELAY, (char *) &one, sizeof(one)) == -1)) { - qfprintf(stderr,"Cannot set client socket to non blocking mode.\n"); - close(fd); - return SN_ERR_INTERNAL; - } - - if (s->proxy->options & PR_O_TCP_SRV_KA) - setsockopt(fd, SOL_SOCKET, SO_KEEPALIVE, (char *) &one, sizeof(one)); - - /* allow specific binding : - * - server-specific at first - * - proxy-specific next - */ - if (s->srv != NULL && s->srv->state & SRV_BIND_SRC) { - setsockopt(fd, SOL_SOCKET, SO_REUSEADDR, (char *) &one, sizeof(one)); - if (bind(fd, (struct sockaddr *)&s->srv->source_addr, sizeof(s->srv->source_addr)) == -1) { - Alert("Cannot bind to source address before connect() for server %s/%s. Aborting.\n", - s->proxy->id, s->srv->id); - close(fd); - send_log(s->proxy, LOG_EMERG, - "Cannot bind to source address before connect() for server %s/%s.\n", - s->proxy->id, s->srv->id); - return SN_ERR_RESOURCE; - } - } - else if (s->proxy->options & PR_O_BIND_SRC) { - setsockopt(fd, SOL_SOCKET, SO_REUSEADDR, (char *) &one, sizeof(one)); - if (bind(fd, (struct sockaddr *)&s->proxy->source_addr, sizeof(s->proxy->source_addr)) == -1) { - Alert("Cannot bind to source address before connect() for proxy %s. Aborting.\n", s->proxy->id); - close(fd); - send_log(s->proxy, LOG_EMERG, - "Cannot bind to source address before connect() for server %s/%s.\n", - s->proxy->id, s->srv->id); - return SN_ERR_RESOURCE; - } - } - - if ((connect(fd, (struct sockaddr *)&s->srv_addr, sizeof(s->srv_addr)) == -1) && - (errno != EINPROGRESS) && (errno != EALREADY) && (errno != EISCONN)) { - - if (errno == EAGAIN || errno == EADDRINUSE) { - char *msg; - if (errno == EAGAIN) /* no free ports left, try again later */ - msg = "no free ports"; - else - msg = "local address already in use"; - - qfprintf(stderr,"Cannot connect: %s.\n",msg); - close(fd); - send_log(s->proxy, LOG_EMERG, - "Connect() failed for server %s/%s: %s.\n", - s->proxy->id, s->srv->id, msg); - return SN_ERR_RESOURCE; - } else if (errno == ETIMEDOUT) { - //qfprintf(stderr,"Connect(): ETIMEDOUT"); - close(fd); - return SN_ERR_SRVTO; - } else { - // (errno == ECONNREFUSED || errno == ENETUNREACH || errno == EACCES || errno == EPERM) - //qfprintf(stderr,"Connect(): %d", errno); - close(fd); - return SN_ERR_SRVCL; - } - } - - fdtab[fd].owner = s->task; - fdtab[fd].read = &event_srv_read; - fdtab[fd].write = &event_srv_write; - fdtab[fd].state = FD_STCONN; /* connection in progress */ - - FD_SET(fd, StaticWriteEvent); /* for connect status */ -#if defined(DEBUG_FULL) && defined(ENABLE_EPOLL) - if (PrevReadEvent) { - assert(!(FD_ISSET(fd, PrevReadEvent))); - assert(!(FD_ISSET(fd, PrevWriteEvent))); - } -#endif - - fd_insert(fd); - if (s->srv) { - s->srv->cur_sess++; - if (s->srv->cur_sess > s->srv->cur_sess_max) - s->srv->cur_sess_max = s->srv->cur_sess; - } - - if (s->proxy->contimeout) - tv_delayfrom(&s->cnexpire, &now, s->proxy->contimeout); - else - tv_eternity(&s->cnexpire); - return SN_ERR_NONE; /* connection is OK */ -} - -/* - * this function is called on a read event from a client socket. - * It returns 0. - */ -int event_cli_read(int fd) { - struct task *t = fdtab[fd].owner; - struct session *s = t->context; - struct buffer *b = s->req; - int ret, max; - -#ifdef DEBUG_FULL - fprintf(stderr,"event_cli_read : fd=%d, s=%p\n", fd, s); -#endif - - if (fdtab[fd].state != FD_STERROR) { -#ifdef FILL_BUFFERS - while (1) -#else - do -#endif - { - if (b->l == 0) { /* let's realign the buffer to optimize I/O */ - b->r = b->w = b->h = b->lr = b->data; - max = b->rlim - b->data; - } - else if (b->r > b->w) { - max = b->rlim - b->r; - } - else { - max = b->w - b->r; - /* FIXME: theorically, if w>0, we shouldn't have rlim < data+size anymore - * since it means that the rewrite protection has been removed. This - * implies that the if statement can be removed. - */ - if (max > b->rlim - b->data) - max = b->rlim - b->data; - } - - if (max == 0) { /* not anymore room to store data */ - FD_CLR(fd, StaticReadEvent); - break; - } - -#ifndef MSG_NOSIGNAL - { - int skerr; - socklen_t lskerr = sizeof(skerr); - - getsockopt(fd, SOL_SOCKET, SO_ERROR, &skerr, &lskerr); - if (skerr) - ret = -1; - else - ret = recv(fd, b->r, max, 0); - } -#else - ret = recv(fd, b->r, max, MSG_NOSIGNAL); -#endif - if (ret > 0) { - b->r += ret; - b->l += ret; - s->res_cr = RES_DATA; - - if (b->r == b->data + BUFSIZE) { - b->r = b->data; /* wrap around the buffer */ - } - - b->total += ret; - /* we hope to read more data or to get a close on next round */ - continue; - } - else if (ret == 0) { - s->res_cr = RES_NULL; - break; - } - else if (errno == EAGAIN) {/* ignore EAGAIN */ - break; - } - else { - s->res_cr = RES_ERROR; - fdtab[fd].state = FD_STERROR; - break; - } - } /* while(1) */ -#ifndef FILL_BUFFERS - while (0); -#endif - } - else { - s->res_cr = RES_ERROR; - fdtab[fd].state = FD_STERROR; - } - - if (s->res_cr != RES_SILENT) { - if (s->proxy->clitimeout && FD_ISSET(fd, StaticReadEvent)) - tv_delayfrom(&s->crexpire, &now, s->proxy->clitimeout); - else - tv_eternity(&s->crexpire); - - task_wakeup(&rq, t); - } - - return 0; -} - - -/* - * this function is called on a read event from a server socket. - * It returns 0. - */ -int event_srv_read(int fd) { - struct task *t = fdtab[fd].owner; - struct session *s = t->context; - struct buffer *b = s->rep; - int ret, max; - -#ifdef DEBUG_FULL - fprintf(stderr,"event_srv_read : fd=%d, s=%p\n", fd, s); -#endif - - if (fdtab[fd].state != FD_STERROR) { -#ifdef FILL_BUFFERS - while (1) -#else - do -#endif - { - if (b->l == 0) { /* let's realign the buffer to optimize I/O */ - b->r = b->w = b->h = b->lr = b->data; - max = b->rlim - b->data; - } - else if (b->r > b->w) { - max = b->rlim - b->r; - } - else { - max = b->w - b->r; - /* FIXME: theorically, if w>0, we shouldn't have rlim < data+size anymore - * since it means that the rewrite protection has been removed. This - * implies that the if statement can be removed. - */ - if (max > b->rlim - b->data) - max = b->rlim - b->data; - } - - if (max == 0) { /* not anymore room to store data */ - FD_CLR(fd, StaticReadEvent); - break; - } - -#ifndef MSG_NOSIGNAL - { - int skerr; - socklen_t lskerr = sizeof(skerr); - - getsockopt(fd, SOL_SOCKET, SO_ERROR, &skerr, &lskerr); - if (skerr) - ret = -1; - else - ret = recv(fd, b->r, max, 0); - } -#else - ret = recv(fd, b->r, max, MSG_NOSIGNAL); -#endif - if (ret > 0) { - b->r += ret; - b->l += ret; - s->res_sr = RES_DATA; - - if (b->r == b->data + BUFSIZE) { - b->r = b->data; /* wrap around the buffer */ - } - - b->total += ret; - /* we hope to read more data or to get a close on next round */ - continue; - } - else if (ret == 0) { - s->res_sr = RES_NULL; - break; - } - else if (errno == EAGAIN) {/* ignore EAGAIN */ - break; - } - else { - s->res_sr = RES_ERROR; - fdtab[fd].state = FD_STERROR; - break; - } - } /* while(1) */ -#ifndef FILL_BUFFERS - while (0); -#endif - } - else { - s->res_sr = RES_ERROR; - fdtab[fd].state = FD_STERROR; - } - - if (s->res_sr != RES_SILENT) { - if (s->proxy->srvtimeout && FD_ISSET(fd, StaticReadEvent)) - tv_delayfrom(&s->srexpire, &now, s->proxy->srvtimeout); - else - tv_eternity(&s->srexpire); - - task_wakeup(&rq, t); - } - - return 0; -} - -/* - * this function is called on a write event from a client socket. - * It returns 0. - */ -int event_cli_write(int fd) { - struct task *t = fdtab[fd].owner; - struct session *s = t->context; - struct buffer *b = s->rep; - int ret, max; - -#ifdef DEBUG_FULL - fprintf(stderr,"event_cli_write : fd=%d, s=%p\n", fd, s); -#endif - - if (b->l == 0) { /* let's realign the buffer to optimize I/O */ - b->r = b->w = b->h = b->lr = b->data; - // max = BUFSIZE; BUG !!!! - max = 0; - } - else if (b->r > b->w) { - max = b->r - b->w; - } - else - max = b->data + BUFSIZE - b->w; - - if (fdtab[fd].state != FD_STERROR) { - if (max == 0) { - s->res_cw = RES_NULL; - task_wakeup(&rq, t); - tv_eternity(&s->cwexpire); - FD_CLR(fd, StaticWriteEvent); - return 0; - } - -#ifndef MSG_NOSIGNAL - { - int skerr; - socklen_t lskerr = sizeof(skerr); - - getsockopt(fd, SOL_SOCKET, SO_ERROR, &skerr, &lskerr); - if (skerr) - ret = -1; - else - ret = send(fd, b->w, max, MSG_DONTWAIT); - } -#else - ret = send(fd, b->w, max, MSG_DONTWAIT | MSG_NOSIGNAL); -#endif - - if (ret > 0) { - b->l -= ret; - b->w += ret; - - s->res_cw = RES_DATA; - - if (b->w == b->data + BUFSIZE) { - b->w = b->data; /* wrap around the buffer */ - } - } - else if (ret == 0) { - /* nothing written, just make as if we were never called */ -// s->res_cw = RES_NULL; - return 0; - } - else if (errno == EAGAIN) /* ignore EAGAIN */ - return 0; - else { - s->res_cw = RES_ERROR; - fdtab[fd].state = FD_STERROR; - } - } - else { - s->res_cw = RES_ERROR; - fdtab[fd].state = FD_STERROR; - } - - if (s->proxy->clitimeout) { - tv_delayfrom(&s->cwexpire, &now, s->proxy->clitimeout); - /* FIXME: to prevent the client from expiring read timeouts during writes, - * we refresh it. A solution would be to merge read+write timeouts into a - * unique one, although that needs some study particularly on full-duplex - * TCP connections. */ - s->crexpire = s->cwexpire; - } - else - tv_eternity(&s->cwexpire); - - task_wakeup(&rq, t); - return 0; -} - - -/* - * this function is called on a write event from a server socket. - * It returns 0. - */ -int event_srv_write(int fd) { - struct task *t = fdtab[fd].owner; - struct session *s = t->context; - struct buffer *b = s->req; - int ret, max; - -#ifdef DEBUG_FULL - fprintf(stderr,"event_srv_write : fd=%d, s=%p\n", fd, s); -#endif - - if (b->l == 0) { /* let's realign the buffer to optimize I/O */ - b->r = b->w = b->h = b->lr = b->data; - // max = BUFSIZE; BUG !!!! - max = 0; - } - else if (b->r > b->w) { - max = b->r - b->w; - } - else - max = b->data + BUFSIZE - b->w; - - if (fdtab[fd].state != FD_STERROR) { - if (max == 0) { - /* may be we have received a connection acknowledgement in TCP mode without data */ - if (s->srv_state == SV_STCONN) { - int skerr; - socklen_t lskerr = sizeof(skerr); - getsockopt(fd, SOL_SOCKET, SO_ERROR, &skerr, &lskerr); - if (skerr) { - s->res_sw = RES_ERROR; - fdtab[fd].state = FD_STERROR; - task_wakeup(&rq, t); - tv_eternity(&s->swexpire); - FD_CLR(fd, StaticWriteEvent); - return 0; - } - } - - s->res_sw = RES_NULL; - task_wakeup(&rq, t); - fdtab[fd].state = FD_STREADY; - tv_eternity(&s->swexpire); - FD_CLR(fd, StaticWriteEvent); - return 0; - } - -#ifndef MSG_NOSIGNAL - { - int skerr; - socklen_t lskerr = sizeof(skerr); - getsockopt(fd, SOL_SOCKET, SO_ERROR, &skerr, &lskerr); - if (skerr) - ret = -1; - else - ret = send(fd, b->w, max, MSG_DONTWAIT); - } -#else - ret = send(fd, b->w, max, MSG_DONTWAIT | MSG_NOSIGNAL); -#endif - fdtab[fd].state = FD_STREADY; - if (ret > 0) { - b->l -= ret; - b->w += ret; - - s->res_sw = RES_DATA; - - if (b->w == b->data + BUFSIZE) { - b->w = b->data; /* wrap around the buffer */ - } - } - else if (ret == 0) { - /* nothing written, just make as if we were never called */ - // s->res_sw = RES_NULL; - return 0; - } - else if (errno == EAGAIN) /* ignore EAGAIN */ - return 0; - else { - s->res_sw = RES_ERROR; - fdtab[fd].state = FD_STERROR; - } - } - else { - s->res_sw = RES_ERROR; - fdtab[fd].state = FD_STERROR; - } - - /* We don't want to re-arm read/write timeouts if we're trying to connect, - * otherwise it could loop indefinitely ! - */ - if (s->srv_state != SV_STCONN) { - if (s->proxy->srvtimeout) { - tv_delayfrom(&s->swexpire, &now, s->proxy->srvtimeout); - /* FIXME: to prevent the server from expiring read timeouts during writes, - * we refresh it. A solution would be to merge read+write+connect timeouts - * into a unique one since we don't mind expiring on read or write, and none - * of them is enabled while waiting for connect(), although that needs some - * study particularly on full-duplex TCP connections. */ - s->srexpire = s->swexpire; - } - else - tv_eternity(&s->swexpire); - } - - task_wakeup(&rq, t); - return 0; -} - - -/* returns 1 if the buffer is empty, 0 otherwise */ -static inline int buffer_isempty(struct buffer *buf) { - return buf->l == 0; -} - - -/* returns 1 if the buffer is full, 0 otherwise */ -static inline int buffer_isfull(struct buffer *buf) { - return buf->l == BUFSIZE; -} - - -/* flushes any content from buffer */ -void buffer_flush(struct buffer *buf) { - buf->r = buf->h = buf->lr = buf->w = buf->data; - buf->l = 0; -} - - -/* returns the maximum number of bytes writable at once in this buffer */ -int buffer_max(struct buffer *buf) { - if (buf->l == BUFSIZE) - return 0; - else if (buf->r >= buf->w) - return buf->data + BUFSIZE - buf->r; - else - return buf->w - buf->r; -} - - -/* - * Tries to realign the given buffer, and returns how many bytes can be written - * there at once without overwriting anything. - */ -int buffer_realign(struct buffer *buf) { - if (buf->l == 0) { - /* let's realign the buffer to optimize I/O */ - buf->r = buf->w = buf->h = buf->lr = buf->data; - } - return buffer_max(buf); -} - - -/* writes bytes from message to buffer . Returns 0 in case of - * success, or the number of bytes available otherwise. - * FIXME-20060521: handle unaligned data. - */ -int buffer_write(struct buffer *buf, const char *msg, int len) { - int max; - - max = buffer_realign(buf); - - if (len > max) - return max; - - memcpy(buf->r, msg, len); - buf->l += len; - buf->r += len; - if (buf->r == buf->data + BUFSIZE) - buf->r = buf->data; - return 0; -} - - -/* - * returns a message to the client ; the connection is shut down for read, - * and the request is cleared so that no server connection can be initiated. - * The client must be in a valid state for this (HEADER, DATA ...). - * Nothing is performed on the server side. - * The reply buffer doesn't need to be empty before this. - */ -void client_retnclose(struct session *s, int len, const char *msg) { - FD_CLR(s->cli_fd, StaticReadEvent); - FD_SET(s->cli_fd, StaticWriteEvent); - tv_eternity(&s->crexpire); - if (s->proxy->clitimeout) - tv_delayfrom(&s->cwexpire, &now, s->proxy->clitimeout); - else - tv_eternity(&s->cwexpire); - shutdown(s->cli_fd, SHUT_RD); - s->cli_state = CL_STSHUTR; - buffer_flush(s->rep); - buffer_write(s->rep, msg, len); - s->req->l = 0; -} - - -/* - * returns a message into the rep buffer, and flushes the req buffer. - * The reply buffer doesn't need to be empty before this. - */ -void client_return(struct session *s, int len, const char *msg) { - buffer_flush(s->rep); - buffer_write(s->rep, msg, len); - s->req->l = 0; -} - -/* - * Produces data for the session depending on its source. Expects to be - * called with s->cli_state == CL_STSHUTR. Right now, only statistics can be - * produced. It stops by itself by unsetting the SN_SELF_GEN flag from the - * session, which it uses to keep on being called when there is free space in - * the buffer, of simply by letting an empty buffer upon return. It returns 1 - * if it changes the session state from CL_STSHUTR, otherwise 0. - */ -int produce_content(struct session *s) { - struct buffer *rep = s->rep; - struct proxy *px; - struct server *sv; - int msglen; - - if (s->data_source == DATA_SRC_NONE) { - s->flags &= ~SN_SELF_GEN; - return 1; - } - else if (s->data_source == DATA_SRC_STATS) { - msglen = 0; - - if (s->data_state == DATA_ST_INIT) { /* the function had not been called yet */ - unsigned int up; - - s->flags |= SN_SELF_GEN; // more data will follow - - /* send the start of the HTTP response */ - msglen += snprintf(trash + msglen, sizeof(trash) - msglen, - "HTTP/1.0 200 OK\r\n" - "Cache-Control: no-cache\r\n" - "Connection: close\r\n" - "\r\n\r\n"); - - s->logs.status = 200; - client_retnclose(s, msglen, trash); // send the start of the response. - msglen = 0; - - if (!(s->flags & SN_ERR_MASK)) // this is not really an error but it is - s->flags |= SN_ERR_PRXCOND; // to mark that it comes from the proxy - if (!(s->flags & SN_FINST_MASK)) - s->flags |= SN_FINST_R; - - /* WARNING! This must fit in the first buffer !!! */ - msglen += snprintf(trash + msglen, sizeof(trash) - msglen, - "Statistics Report for " PRODUCT_NAME "\n" - "\n" - ""); - - if (buffer_write(rep, trash, msglen) != 0) - return 0; - msglen = 0; - - up = (now.tv_sec - start_date.tv_sec); - - /* WARNING! this has to fit the first packet too */ - msglen += snprintf(trash + msglen, sizeof(trash) - msglen, - "

" PRODUCT_NAME "

\n" - "

Statistics Report for pid %d

\n" - "
\n" - "

> General process information

\n" - "
\n" - "

pid = %d (nbproc = %d)
\n" - "uptime = %dd %dh%02dm%02ds
\n" - "system limits : memmax = %s%s ; ulimit-n = %d
\n" - "maxsock = %d
\n" - "maxconn = %d (current conns = %d)
\n" - "

\n" - "\n" - "" - "" - "" - "" - "" - "" - "" - "" - "" - "
 active UP  backup UP
active UP, going down backup UP, going down
active DOWN, going up backup DOWN, going up
active or backup DOWN  not checked
\n" - "
\n" - "", - pid, pid, global.nbproc, - up / 86400, (up % 86400) / 3600, - (up % 3600) / 60, (up % 60), - global.rlimit_memmax ? ultoa(global.rlimit_memmax) : "unlimited", - global.rlimit_memmax ? " MB" : "", - global.rlimit_nofile, - global.maxsock, - global.maxconn, - actconn - ); - - if (buffer_write(rep, trash, msglen) != 0) - return 0; - msglen = 0; - - s->data_state = DATA_ST_DATA; - memset(&s->data_ctx, 0, sizeof(s->data_ctx)); - - px = s->data_ctx.stats.px = proxy; - s->data_ctx.stats.px_st = DATA_ST_INIT; - } - - while (s->data_ctx.stats.px) { - int dispatch_sess, dispatch_cum; - int failed_checks, down_trans; - int failed_secu, failed_conns, failed_resp; - - if (s->data_ctx.stats.px_st == DATA_ST_INIT) { - /* we are on a new proxy */ - px = s->data_ctx.stats.px; - - /* skip the disabled proxies */ - if (px->state == PR_STSTOPPED) - goto next_proxy; - - if (s->proxy->uri_auth && s->proxy->uri_auth->scope) { - /* we have a limited scope, we have to check the proxy name */ - struct stat_scope *scope; - int len; - - len = strlen(px->id); - scope = s->proxy->uri_auth->scope; - - while (scope) { - /* match exact proxy name */ - if (scope->px_len == len && !memcmp(px->id, scope->px_id, len)) - break; - - /* match '.' which means 'self' proxy */ - if (!strcmp(scope->px_id, ".") && px == s->proxy) - break; - scope = scope->next; - } - - /* proxy name not found */ - if (scope == NULL) - goto next_proxy; - } - - msglen += snprintf(trash + msglen, sizeof(trash) - msglen, - "

> Proxy instance %s : " - "%d conns (maxconn=%d), %d queued (%d unassigned), %d total conns

\n" - "", - px->id, - px->nbconn, px->maxconn, px->totpend, px->nbpend, px->cum_conn); - - msglen += snprintf(trash + msglen, sizeof(trash) - msglen, - "\n" - "" - "" - "" - "" - "\n" - "" - "" - "" - "" - "\n"); - - if (buffer_write(rep, trash, msglen) != 0) - return 0; - msglen = 0; - - s->data_ctx.stats.sv = px->srv; - s->data_ctx.stats.px_st = DATA_ST_DATA; - } - - px = s->data_ctx.stats.px; - - /* stats.sv has been initialized above */ - while (s->data_ctx.stats.sv != NULL) { - static char *act_tab_bg[5] = { /*down*/"#FF9090", /*rising*/"#FFD020", /*failing*/"#FFFFA0", /*up*/"#C0FFC0", /*unchecked*/"#E0E0E0" }; - static char *bck_tab_bg[5] = { /*down*/"#FF9090", /*rising*/"#FF80ff", /*failing*/"#C060FF", /*up*/"#B0D0FF", /*unchecked*/"#E0E0E0" }; - static char *srv_hlt_st[5] = { "DOWN", "DN %d/%d ↑", "UP %d/%d ↓", "UP", "no check" }; - int sv_state; /* 0=DOWN, 1=going up, 2=going down, 3=UP */ - - sv = s->data_ctx.stats.sv; - - /* FIXME: produce some small strings for "UP/DOWN x/y &#xxxx;" */ - if (!(sv->state & SRV_CHECKED)) - sv_state = 4; - else if (sv->state & SRV_RUNNING) - if (sv->health == sv->rise + sv->fall - 1) - sv_state = 3; /* UP */ - else - sv_state = 2; /* going down */ - else - if (sv->health) - sv_state = 1; /* going up */ - else - sv_state = 0; /* DOWN */ - - /* name, weight */ - msglen += snprintf(trash, sizeof(trash), - "", - (sv->state & SRV_BACKUP) ? "-" : "Y", - (sv->state & SRV_BACKUP) ? "Y" : "-"); - - /* queue : current, max */ - msglen += snprintf(trash + msglen, sizeof(trash) - msglen, - "", - sv->nbpend, sv->nbpend_max); - - /* sessions : current, max, limit, cumul */ - msglen += snprintf(trash + msglen, sizeof(trash) - msglen, - "", - sv->cur_sess, sv->cur_sess_max, sv->maxconn ? ultoa(sv->maxconn) : "-", sv->cum_sess); - - /* errors : connect, response, security */ - msglen += snprintf(trash + msglen, sizeof(trash) - msglen, - "\n", - sv->failed_conns, sv->failed_resp, sv->failed_secu); - - /* check failures : unique, fatal */ - if (sv->state & SRV_CHECKED) - msglen += snprintf(trash + msglen, sizeof(trash) - msglen, - "\n", - sv->failed_checks, sv->down_trans); - else - msglen += snprintf(trash + msglen, sizeof(trash) - msglen, - "\n"); - - if (buffer_write(rep, trash, msglen) != 0) - return 0; - msglen = 0; - - s->data_ctx.stats.sv = sv->next; - } /* while sv */ - - /* now we are past the last server, we'll dump information about the dispatcher */ - - /* We have to count down from the proxy to the servers to tell how - * many sessions are on the dispatcher, and how many checks have - * failed. We cannot count this during the servers dump because it - * might be interrupted multiple times. - */ - dispatch_sess = px->nbconn; - dispatch_cum = px->cum_conn; - failed_secu = px->failed_secu; - failed_conns = px->failed_conns; - failed_resp = px->failed_resp; - failed_checks = down_trans = 0; - - sv = px->srv; - while (sv) { - dispatch_sess -= sv->cur_sess; - dispatch_cum -= sv->cum_sess; - failed_conns -= sv->failed_conns; - failed_resp -= sv->failed_resp; - failed_secu -= sv->failed_secu; - if (sv->state & SRV_CHECKED) { - failed_checks += sv->failed_checks; - down_trans += sv->down_trans; - } - sv = sv->next; - } - - /* name, weight, status, act, bck */ - msglen += snprintf(trash + msglen, sizeof(trash), - "" - "" - "", - px->state == PR_STRUN ? "UP" : "DOWN"); - - /* queue : current, max */ - msglen += snprintf(trash + msglen, sizeof(trash) - msglen, - "", - px->nbpend, px->nbpend_max); - - /* sessions : current, max, limit, cumul. */ - msglen += snprintf(trash + msglen, sizeof(trash) - msglen, - "", - dispatch_sess, px->nbconn_max, px->maxconn, dispatch_cum); - - /* errors : connect, response, security */ - msglen += snprintf(trash + msglen, sizeof(trash) - msglen, - "\n", - failed_conns, failed_resp, failed_secu); - - /* check failures : unique, fatal */ - msglen += snprintf(trash + msglen, sizeof(trash) - msglen, - "\n"); - - - /* now the summary for the whole proxy */ - /* name, weight, status, act, bck */ - msglen += snprintf(trash + msglen, sizeof(trash), - "" - "" - "", - (px->state == PR_STRUN && ((px->srv == NULL) || px->srv_act || px->srv_bck)) ? "UP" : "DOWN", - px->srv_act, px->srv_bck); - - /* queue : current, max */ - msglen += snprintf(trash + msglen, sizeof(trash) - msglen, - "", - px->totpend, px->nbpend_max); - - /* sessions : current, max, limit, cumul */ - msglen += snprintf(trash + msglen, sizeof(trash) - msglen, - "", - px->nbconn, px->nbconn_max, px->maxconn, px->cum_conn); - - /* errors : connect, response, security */ - msglen += snprintf(trash + msglen, sizeof(trash) - msglen, - "\n", - px->failed_conns, px->failed_resp, px->failed_secu); - - /* check failures : unique, fatal */ - msglen += snprintf(trash + msglen, sizeof(trash) - msglen, - "\n", - failed_checks, down_trans); - - msglen += snprintf(trash + msglen, sizeof(trash) - msglen, "
ServerQueueSessionsErrors
NameWeightStatusAct.Bck.Curr.Max.Curr.Max.LimitCumul.Conn.Resp.Sec.CheckDown
%s%d", - (sv->state & SRV_BACKUP) ? bck_tab_bg[sv_state] : act_tab_bg[sv_state], - sv->id, sv->uweight+1); - /* status */ - msglen += snprintf(trash + msglen, sizeof(trash) - msglen, srv_hlt_st[sv_state], - (sv->state & SRV_RUNNING) ? (sv->health - sv->rise + 1) : (sv->health), - (sv->state & SRV_RUNNING) ? (sv->fall) : (sv->rise)); - - /* act, bck */ - msglen += snprintf(trash + msglen, sizeof(trash) - msglen, - "%s%s%d%d%d%d%s%d%d%d%d%d%d
--
Dispatcher-%s--%d%d%d%d%d%d%d%d%d--
Total-%s%d%d%d%d%d%d%d%d%d%d%d%d%d

\n"); - - if (buffer_write(rep, trash, msglen) != 0) - return 0; - msglen = 0; - - s->data_ctx.stats.px_st = DATA_ST_INIT; - next_proxy: - s->data_ctx.stats.px = px->next; - } /* proxy loop */ - /* here, we just have reached the sv == NULL and px == NULL */ - s->flags &= ~SN_SELF_GEN; - return 1; - } - else { - /* unknown data source */ - s->logs.status = 500; - client_retnclose(s, s->proxy->errmsg.len500, s->proxy->errmsg.msg500); - if (!(s->flags & SN_ERR_MASK)) - s->flags |= SN_ERR_PRXCOND; - if (!(s->flags & SN_FINST_MASK)) - s->flags |= SN_FINST_R; - s->flags &= SN_SELF_GEN; - return 1; - } -} - - -/* - * send a log for the session when we have enough info about it - */ -void sess_log(struct session *s) { - char pn[INET6_ADDRSTRLEN + strlen(":65535")]; - struct proxy *p = s->proxy; - int log; - char *uri; - char *pxid; - char *srv; - struct tm *tm; - - /* This is a first attempt at a better logging system. - * For now, we rely on send_log() to provide the date, although it obviously - * is the date of the log and not of the request, and most fields are not - * computed. - */ - - log = p->to_log & ~s->logs.logwait; - - if (s->cli_addr.ss_family == AF_INET) - inet_ntop(AF_INET, - (const void *)&((struct sockaddr_in *)&s->cli_addr)->sin_addr, - pn, sizeof(pn)); - else - inet_ntop(AF_INET6, - (const void *)&((struct sockaddr_in6 *)(&s->cli_addr))->sin6_addr, - pn, sizeof(pn)); - - uri = (log & LW_REQ) ? s->logs.uri ? s->logs.uri : "" : ""; - pxid = p->id; - srv = (p->to_log & LW_SVID) ? - (s->data_source != DATA_SRC_STATS) ? - (s->srv != NULL) ? s->srv->id : "" : "" : "-"; - - tm = localtime(&s->logs.tv_accept.tv_sec); - if (p->to_log & LW_REQ) { - char tmpline[MAX_SYSLOG_LEN], *h; - int hdr; - - h = tmpline; - if (p->to_log & LW_REQHDR && (h < tmpline + sizeof(tmpline) - 10)) { - *(h++) = ' '; - *(h++) = '{'; - for (hdr = 0; hdr < p->nb_req_cap; hdr++) { - if (hdr) - *(h++) = '|'; - if (s->req_cap[hdr] != NULL) - h = encode_string(h, tmpline + sizeof(tmpline) - 7, '#', hdr_encode_map, s->req_cap[hdr]); - } - *(h++) = '}'; - } - - if (p->to_log & LW_RSPHDR && (h < tmpline + sizeof(tmpline) - 7)) { - *(h++) = ' '; - *(h++) = '{'; - for (hdr = 0; hdr < p->nb_rsp_cap; hdr++) { - if (hdr) - *(h++) = '|'; - if (s->rsp_cap[hdr] != NULL) - h = encode_string(h, tmpline + sizeof(tmpline) - 4, '#', hdr_encode_map, s->rsp_cap[hdr]); - } - *(h++) = '}'; - } - - if (h < tmpline + sizeof(tmpline) - 4) { - *(h++) = ' '; - *(h++) = '"'; - h = encode_string(h, tmpline + sizeof(tmpline) - 1, '#', url_encode_map, uri); - *(h++) = '"'; - } - *h = '\0'; - - send_log(p, LOG_INFO, "%s:%d [%02d/%s/%04d:%02d:%02d:%02d] %s %s %d/%d/%d/%d/%s%d %d %s%lld %s %s %c%c%c%c %d/%d/%d %d/%d%s\n", - pn, - (s->cli_addr.ss_family == AF_INET) ? - ntohs(((struct sockaddr_in *)&s->cli_addr)->sin_port) : - ntohs(((struct sockaddr_in6 *)&s->cli_addr)->sin6_port), - tm->tm_mday, monthname[tm->tm_mon], tm->tm_year+1900, - tm->tm_hour, tm->tm_min, tm->tm_sec, - pxid, srv, - s->logs.t_request, - (s->logs.t_queue >= 0) ? s->logs.t_queue - s->logs.t_request : -1, - (s->logs.t_connect >= 0) ? s->logs.t_connect - s->logs.t_queue : -1, - (s->logs.t_data >= 0) ? s->logs.t_data - s->logs.t_connect : -1, - (p->to_log & LW_BYTES) ? "" : "+", s->logs.t_close, - s->logs.status, - (p->to_log & LW_BYTES) ? "" : "+", s->logs.bytes, - s->logs.cli_cookie ? s->logs.cli_cookie : "-", - s->logs.srv_cookie ? s->logs.srv_cookie : "-", - sess_term_cond[(s->flags & SN_ERR_MASK) >> SN_ERR_SHIFT], - sess_fin_state[(s->flags & SN_FINST_MASK) >> SN_FINST_SHIFT], - (p->options & PR_O_COOK_ANY) ? sess_cookie[(s->flags & SN_CK_MASK) >> SN_CK_SHIFT] : '-', - (p->options & PR_O_COOK_ANY) ? sess_set_cookie[(s->flags & SN_SCK_MASK) >> SN_SCK_SHIFT] : '-', - s->srv ? s->srv->cur_sess : 0, p->nbconn, actconn, - s->logs.srv_queue_size, s->logs.prx_queue_size, tmpline); - } - else { - send_log(p, LOG_INFO, "%s:%d [%02d/%s/%04d:%02d:%02d:%02d] %s %s %d/%d/%s%d %s%lld %c%c %d/%d/%d %d/%d\n", - pn, - (s->cli_addr.ss_family == AF_INET) ? - ntohs(((struct sockaddr_in *)&s->cli_addr)->sin_port) : - ntohs(((struct sockaddr_in6 *)&s->cli_addr)->sin6_port), - tm->tm_mday, monthname[tm->tm_mon], tm->tm_year+1900, - tm->tm_hour, tm->tm_min, tm->tm_sec, - pxid, srv, - (s->logs.t_queue >= 0) ? s->logs.t_queue : -1, - (s->logs.t_connect >= 0) ? s->logs.t_connect - s->logs.t_queue : -1, - (p->to_log & LW_BYTES) ? "" : "+", s->logs.t_close, - (p->to_log & LW_BYTES) ? "" : "+", s->logs.bytes, - sess_term_cond[(s->flags & SN_ERR_MASK) >> SN_ERR_SHIFT], - sess_fin_state[(s->flags & SN_FINST_MASK) >> SN_FINST_SHIFT], - s->srv ? s->srv->cur_sess : 0, p->nbconn, actconn, - s->logs.srv_queue_size, s->logs.prx_queue_size); - } - - s->logs.logwait = 0; -} - - -/* - * this function is called on a read event from a listen socket, corresponding - * to an accept. It tries to accept as many connections as possible. - * It returns 0. - */ -int event_accept(int fd) { - struct proxy *p = (struct proxy *)fdtab[fd].owner; - struct session *s; - struct task *t; - int cfd; - int max_accept; - - if (global.nbproc > 1) - max_accept = 8; /* let other processes catch some connections too */ - else - max_accept = -1; - - while (p->nbconn < p->maxconn && max_accept--) { - struct sockaddr_storage addr; - socklen_t laddr = sizeof(addr); - - if ((cfd = accept(fd, (struct sockaddr *)&addr, &laddr)) == -1) { - switch (errno) { - case EAGAIN: - case EINTR: - case ECONNABORTED: - return 0; /* nothing more to accept */ - case ENFILE: - send_log(p, LOG_EMERG, - "Proxy %s reached system FD limit at %d. Please check system tunables.\n", - p->id, maxfd); - return 0; - case EMFILE: - send_log(p, LOG_EMERG, - "Proxy %s reached process FD limit at %d. Please check 'ulimit-n' and restart.\n", - p->id, maxfd); - return 0; - case ENOBUFS: - case ENOMEM: - send_log(p, LOG_EMERG, - "Proxy %s reached system memory limit at %d sockets. Please check system tunables.\n", - p->id, maxfd); - return 0; - default: - return 0; - } - } - - if ((s = pool_alloc(session)) == NULL) { /* disable this proxy for a while */ - Alert("out of memory in event_accept().\n"); - FD_CLR(fd, StaticReadEvent); - p->state = PR_STIDLE; - close(cfd); - return 0; - } - - /* if this session comes from a known monitoring system, we want to ignore - * it as soon as possible, which means closing it immediately for TCP. - */ - s->flags = 0; - if (addr.ss_family == AF_INET && - p->mon_mask.s_addr && - (((struct sockaddr_in *)&addr)->sin_addr.s_addr & p->mon_mask.s_addr) == p->mon_net.s_addr) { - if (p->mode == PR_MODE_TCP) { - close(cfd); - pool_free(session, s); - continue; - } - s->flags |= SN_MONITOR; - } - - if ((t = pool_alloc(task)) == NULL) { /* disable this proxy for a while */ - Alert("out of memory in event_accept().\n"); - FD_CLR(fd, StaticReadEvent); - p->state = PR_STIDLE; - close(cfd); - pool_free(session, s); - return 0; - } - - s->cli_addr = addr; - if (cfd >= global.maxsock) { - Alert("accept(): not enough free sockets. Raise -n argument. Giving up.\n"); - close(cfd); - pool_free(task, t); - pool_free(session, s); - return 0; - } - - if ((fcntl(cfd, F_SETFL, O_NONBLOCK) == -1) || - (setsockopt(cfd, IPPROTO_TCP, TCP_NODELAY, - (char *) &one, sizeof(one)) == -1)) { - Alert("accept(): cannot set the socket in non blocking mode. Giving up\n"); - close(cfd); - pool_free(task, t); - pool_free(session, s); - return 0; - } - - if (p->options & PR_O_TCP_CLI_KA) - setsockopt(cfd, SOL_SOCKET, SO_KEEPALIVE, (char *) &one, sizeof(one)); - - t->next = t->prev = t->rqnext = NULL; /* task not in run queue yet */ - t->wq = LIST_HEAD(wait_queue[0]); /* but already has a wait queue assigned */ - t->state = TASK_IDLE; - t->process = process_session; - t->context = s; - - s->task = t; - s->proxy = p; - s->cli_state = (p->mode == PR_MODE_HTTP) ? CL_STHEADERS : CL_STDATA; /* no HTTP headers for non-HTTP proxies */ - s->srv_state = SV_STIDLE; - s->req = s->rep = NULL; /* will be allocated later */ - - s->res_cr = s->res_cw = s->res_sr = s->res_sw = RES_SILENT; - s->cli_fd = cfd; - s->srv_fd = -1; - s->req_line.len = -1; - s->auth_hdr.len = -1; - s->srv = NULL; - s->pend_pos = NULL; - s->conn_retries = p->conn_retries; - - if (s->flags & SN_MONITOR) - s->logs.logwait = 0; - else - s->logs.logwait = p->to_log; - - s->logs.tv_accept = now; - s->logs.t_request = -1; - s->logs.t_queue = -1; - s->logs.t_connect = -1; - s->logs.t_data = -1; - s->logs.t_close = 0; - s->logs.uri = NULL; - s->logs.cli_cookie = NULL; - s->logs.srv_cookie = NULL; - s->logs.status = -1; - s->logs.bytes = 0; - s->logs.prx_queue_size = 0; /* we get the number of pending conns before us */ - s->logs.srv_queue_size = 0; /* we will get this number soon */ - - s->data_source = DATA_SRC_NONE; - - s->uniq_id = totalconn; - p->cum_conn++; - - if (p->nb_req_cap > 0) { - if ((s->req_cap = - pool_alloc_from(p->req_cap_pool, p->nb_req_cap*sizeof(char *))) - == NULL) { /* no memory */ - close(cfd); /* nothing can be done for this fd without memory */ - pool_free(task, t); - pool_free(session, s); - return 0; - } - memset(s->req_cap, 0, p->nb_req_cap*sizeof(char *)); - } - else - s->req_cap = NULL; - - if (p->nb_rsp_cap > 0) { - if ((s->rsp_cap = - pool_alloc_from(p->rsp_cap_pool, p->nb_rsp_cap*sizeof(char *))) - == NULL) { /* no memory */ - if (s->req_cap != NULL) - pool_free_to(p->req_cap_pool, s->req_cap); - close(cfd); /* nothing can be done for this fd without memory */ - pool_free(task, t); - pool_free(session, s); - return 0; - } - memset(s->rsp_cap, 0, p->nb_rsp_cap*sizeof(char *)); - } - else - s->rsp_cap = NULL; - - if ((p->mode == PR_MODE_TCP || p->mode == PR_MODE_HTTP) - && (p->logfac1 >= 0 || p->logfac2 >= 0)) { - struct sockaddr_storage sockname; - socklen_t namelen = sizeof(sockname); - - if (addr.ss_family != AF_INET || - !(s->proxy->options & PR_O_TRANSP) || - get_original_dst(cfd, (struct sockaddr_in *)&sockname, &namelen) == -1) - getsockname(cfd, (struct sockaddr *)&sockname, &namelen); - - if (p->to_log) { - /* we have the client ip */ - if (s->logs.logwait & LW_CLIP) - if (!(s->logs.logwait &= ~LW_CLIP)) - sess_log(s); - } - else if (s->cli_addr.ss_family == AF_INET) { - char pn[INET_ADDRSTRLEN], sn[INET_ADDRSTRLEN]; - if (inet_ntop(AF_INET, (const void *)&((struct sockaddr_in *)&sockname)->sin_addr, - sn, sizeof(sn)) && - inet_ntop(AF_INET, (const void *)&((struct sockaddr_in *)&s->cli_addr)->sin_addr, - pn, sizeof(pn))) { - send_log(p, LOG_INFO, "Connect from %s:%d to %s:%d (%s/%s)\n", - pn, ntohs(((struct sockaddr_in *)&s->cli_addr)->sin_port), - sn, ntohs(((struct sockaddr_in *)&sockname)->sin_port), - p->id, (p->mode == PR_MODE_HTTP) ? "HTTP" : "TCP"); - } - } - else { - char pn[INET6_ADDRSTRLEN], sn[INET6_ADDRSTRLEN]; - if (inet_ntop(AF_INET6, (const void *)&((struct sockaddr_in6 *)&sockname)->sin6_addr, - sn, sizeof(sn)) && - inet_ntop(AF_INET6, (const void *)&((struct sockaddr_in6 *)&s->cli_addr)->sin6_addr, - pn, sizeof(pn))) { - send_log(p, LOG_INFO, "Connect from %s:%d to %s:%d (%s/%s)\n", - pn, ntohs(((struct sockaddr_in6 *)&s->cli_addr)->sin6_port), - sn, ntohs(((struct sockaddr_in6 *)&sockname)->sin6_port), - p->id, (p->mode == PR_MODE_HTTP) ? "HTTP" : "TCP"); - } - } - } - - if ((global.mode & MODE_DEBUG) && (!(global.mode & MODE_QUIET) || (global.mode & MODE_VERBOSE))) { - struct sockaddr_in sockname; - socklen_t namelen = sizeof(sockname); - int len; - if (addr.ss_family != AF_INET || - !(s->proxy->options & PR_O_TRANSP) || - get_original_dst(cfd, (struct sockaddr_in *)&sockname, &namelen) == -1) - getsockname(cfd, (struct sockaddr *)&sockname, &namelen); - - if (s->cli_addr.ss_family == AF_INET) { - char pn[INET_ADDRSTRLEN]; - inet_ntop(AF_INET, - (const void *)&((struct sockaddr_in *)&s->cli_addr)->sin_addr, - pn, sizeof(pn)); - - len = sprintf(trash, "%08x:%s.accept(%04x)=%04x from [%s:%d]\n", - s->uniq_id, p->id, (unsigned short)fd, (unsigned short)cfd, - pn, ntohs(((struct sockaddr_in *)&s->cli_addr)->sin_port)); - } - else { - char pn[INET6_ADDRSTRLEN]; - inet_ntop(AF_INET6, - (const void *)&((struct sockaddr_in6 *)(&s->cli_addr))->sin6_addr, - pn, sizeof(pn)); - - len = sprintf(trash, "%08x:%s.accept(%04x)=%04x from [%s:%d]\n", - s->uniq_id, p->id, (unsigned short)fd, (unsigned short)cfd, - pn, ntohs(((struct sockaddr_in6 *)(&s->cli_addr))->sin6_port)); - } - - write(1, trash, len); - } - - if ((s->req = pool_alloc(buffer)) == NULL) { /* no memory */ - if (s->rsp_cap != NULL) - pool_free_to(p->rsp_cap_pool, s->rsp_cap); - if (s->req_cap != NULL) - pool_free_to(p->req_cap_pool, s->req_cap); - close(cfd); /* nothing can be done for this fd without memory */ - pool_free(task, t); - pool_free(session, s); - return 0; - } - - s->req->l = 0; - s->req->total = 0; - s->req->h = s->req->r = s->req->lr = s->req->w = s->req->data; /* r and w will be reset further */ - s->req->rlim = s->req->data + BUFSIZE; - if (s->cli_state == CL_STHEADERS) /* reserve some space for header rewriting */ - s->req->rlim -= MAXREWRITE; - - if ((s->rep = pool_alloc(buffer)) == NULL) { /* no memory */ - pool_free(buffer, s->req); - if (s->rsp_cap != NULL) - pool_free_to(p->rsp_cap_pool, s->rsp_cap); - if (s->req_cap != NULL) - pool_free_to(p->req_cap_pool, s->req_cap); - close(cfd); /* nothing can be done for this fd without memory */ - pool_free(task, t); - pool_free(session, s); - return 0; - } - s->rep->l = 0; - s->rep->total = 0; - s->rep->h = s->rep->r = s->rep->lr = s->rep->w = s->rep->rlim = s->rep->data; - - fdtab[cfd].read = &event_cli_read; - fdtab[cfd].write = &event_cli_write; - fdtab[cfd].owner = t; - fdtab[cfd].state = FD_STREADY; - - if ((p->mode == PR_MODE_HTTP && (s->flags & SN_MONITOR)) || - (p->mode == PR_MODE_HEALTH && (p->options & PR_O_HTTP_CHK))) - /* Either we got a request from a monitoring system on an HTTP instance, - * or we're in health check mode with the 'httpchk' option enabled. In - * both cases, we return a fake "HTTP/1.0 200 OK" response and we exit. - */ - client_retnclose(s, 19, "HTTP/1.0 200 OK\r\n\r\n"); /* forge a 200 response */ - else if (p->mode == PR_MODE_HEALTH) { /* health check mode, no client reading */ - client_retnclose(s, 3, "OK\n"); /* forge an "OK" response */ - } - else { - FD_SET(cfd, StaticReadEvent); - } - -#if defined(DEBUG_FULL) && defined(ENABLE_EPOLL) - if (PrevReadEvent) { - assert(!(FD_ISSET(cfd, PrevReadEvent))); - assert(!(FD_ISSET(cfd, PrevWriteEvent))); - } -#endif - fd_insert(cfd); - - tv_eternity(&s->cnexpire); - tv_eternity(&s->srexpire); - tv_eternity(&s->swexpire); - tv_eternity(&s->crexpire); - tv_eternity(&s->cwexpire); - - if (s->proxy->clitimeout) { - if (FD_ISSET(cfd, StaticReadEvent)) - tv_delayfrom(&s->crexpire, &now, s->proxy->clitimeout); - if (FD_ISSET(cfd, StaticWriteEvent)) - tv_delayfrom(&s->cwexpire, &now, s->proxy->clitimeout); - } - - tv_min(&t->expire, &s->crexpire, &s->cwexpire); - - task_queue(t); - - if (p->mode != PR_MODE_HEALTH) - task_wakeup(&rq, t); - - p->nbconn++; - if (p->nbconn > p->nbconn_max) - p->nbconn_max = p->nbconn; - actconn++; - totalconn++; - - // fprintf(stderr, "accepting from %p => %d conn, %d total, task=%p\n", p, actconn, totalconn, t); - } /* end of while (p->nbconn < p->maxconn) */ - return 0; -} - - -/* - * This function is used only for server health-checks. It handles - * the connection acknowledgement. If the proxy requires HTTP health-checks, - * it sends the request. In other cases, it returns 1 if the socket is OK, - * or -1 if an error occured. - */ -int event_srv_chk_w(int fd) { - struct task *t = fdtab[fd].owner; - struct server *s = t->context; - int skerr; - socklen_t lskerr = sizeof(skerr); - - skerr = 1; - if ((getsockopt(fd, SOL_SOCKET, SO_ERROR, &skerr, &lskerr) == -1) - || (skerr != 0)) { - /* in case of TCP only, this tells us if the connection failed */ - s->result = -1; - fdtab[fd].state = FD_STERROR; - FD_CLR(fd, StaticWriteEvent); - } - else if (s->result != -1) { - /* we don't want to mark 'UP' a server on which we detected an error earlier */ - if (s->proxy->options & PR_O_HTTP_CHK) { - int ret; - /* we want to check if this host replies to "OPTIONS / HTTP/1.0" - * so we'll send the request, and won't wake the checker up now. - */ -#ifndef MSG_NOSIGNAL - ret = send(fd, s->proxy->check_req, s->proxy->check_len, MSG_DONTWAIT); -#else - ret = send(fd, s->proxy->check_req, s->proxy->check_len, MSG_DONTWAIT | MSG_NOSIGNAL); -#endif - if (ret == s->proxy->check_len) { - FD_SET(fd, StaticReadEvent); /* prepare for reading reply */ - FD_CLR(fd, StaticWriteEvent); /* nothing more to write */ - return 0; - } - else { - s->result = -1; - FD_CLR(fd, StaticWriteEvent); - } - } - else { - /* good TCP connection is enough */ - s->result = 1; - } - } - - task_wakeup(&rq, t); - return 0; -} - - -/* - * This function is used only for server health-checks. It handles - * the server's reply to an HTTP request. It returns 1 if the server replies - * 2xx or 3xx (valid responses), or -1 in other cases. - */ -int event_srv_chk_r(int fd) { - char reply[64]; - int len, result; - struct task *t = fdtab[fd].owner; - struct server *s = t->context; - int skerr; - socklen_t lskerr = sizeof(skerr); - - result = len = -1; - - getsockopt(fd, SOL_SOCKET, SO_ERROR, &skerr, &lskerr); - if (!skerr) { -#ifndef MSG_NOSIGNAL - len = recv(fd, reply, sizeof(reply), 0); -#else - /* Warning! Linux returns EAGAIN on SO_ERROR if data are still available - * but the connection was closed on the remote end. Fortunately, recv still - * works correctly and we don't need to do the getsockopt() on linux. - */ - len = recv(fd, reply, sizeof(reply), MSG_NOSIGNAL); -#endif - - if ((len >= sizeof("HTTP/1.0 000")) && - !memcmp(reply, "HTTP/1.", 7) && - (reply[9] == '2' || reply[9] == '3')) /* 2xx or 3xx */ - result = 1; - } - - if (result == -1) - fdtab[fd].state = FD_STERROR; - - if (s->result != -1) - s->result = result; - - FD_CLR(fd, StaticReadEvent); - task_wakeup(&rq, t); - return 0; -} - - -/* - * this function writes the string at position which must be in buffer , - * and moves just after the end of . - * 's parameters (l, r, w, h, lr) are recomputed to be valid after the shift. - * the shift value (positive or negative) is returned. - * If there's no space left, the move is not done. - * - */ -int buffer_replace(struct buffer *b, char *pos, char *end, char *str) { - int delta; - int len; - - len = strlen(str); - delta = len - (end - pos); - - if (delta + b->r >= b->data + BUFSIZE) - return 0; /* no space left */ - - /* first, protect the end of the buffer */ - memmove(end + delta, end, b->data + b->l - end); - - /* now, copy str over pos */ - memcpy(pos, str,len); - - /* we only move data after the displaced zone */ - if (b->r > pos) b->r += delta; - if (b->w > pos) b->w += delta; - if (b->h > pos) b->h += delta; - if (b->lr > pos) b->lr += delta; - b->l += delta; - - return delta; -} - -/* same except that the string length is given, which allows str to be NULL if - * len is 0. - */ -int buffer_replace2(struct buffer *b, char *pos, char *end, char *str, int len) { - int delta; - - delta = len - (end - pos); - - if (delta + b->r >= b->data + BUFSIZE) - return 0; /* no space left */ - - if (b->data + b->l < end) - /* The data has been stolen, we could have crashed. Maybe we should abort() ? */ - return 0; - - /* first, protect the end of the buffer */ - memmove(end + delta, end, b->data + b->l - end); - - /* now, copy str over pos */ - if (len) - memcpy(pos, str, len); - - /* we only move data after the displaced zone */ - if (b->r > pos) b->r += delta; - if (b->w > pos) b->w += delta; - if (b->h > pos) b->h += delta; - if (b->lr > pos) b->lr += delta; - b->l += delta; - - return delta; -} - - -int exp_replace(char *dst, char *src, char *str, regmatch_t *matches) { - char *old_dst = dst; - - while (*str) { - if (*str == '\\') { - str++; - if (isdigit((int)*str)) { - int len, num; - - num = *str - '0'; - str++; - - if (matches[num].rm_eo > -1 && matches[num].rm_so > -1) { - len = matches[num].rm_eo - matches[num].rm_so; - memcpy(dst, src + matches[num].rm_so, len); - dst += len; - } - - } - else if (*str == 'x') { - unsigned char hex1, hex2; - str++; - - hex1 = toupper(*str++) - '0'; - hex2 = toupper(*str++) - '0'; - - if (hex1 > 9) hex1 -= 'A' - '9' - 1; - if (hex2 > 9) hex2 -= 'A' - '9' - 1; - *dst++ = (hex1<<4) + hex2; - } - else - *dst++ = *str++; - } - else - *dst++ = *str++; - } - *dst = 0; - return dst - old_dst; -} - -static int ishex(char s) -{ - return (s >= '0' && s <= '9') || (s >= 'A' && s <= 'F') || (s >= 'a' && s <= 'f'); -} - -/* returns NULL if the replacement string is valid, or the pointer to the first error */ -char *check_replace_string(char *str) -{ - char *err = NULL; - while (*str) { - if (*str == '\\') { - err = str; /* in case of a backslash, we return the pointer to it */ - str++; - if (!*str) - return err; - else if (isdigit((int)*str)) - err = NULL; - else if (*str == 'x') { - str++; - if (!ishex(*str)) - return err; - str++; - if (!ishex(*str)) - return err; - err = NULL; - } - else { - Warning("'\\%c' : deprecated use of a backslash before something not '\\','x' or a digit.\n", *str); - err = NULL; - } - } - str++; - } - return err; -} - -/* - * manages the client FSM and its socket. BTW, it also tries to handle the - * cookie. It returns 1 if a state has changed (and a resync may be needed), - * 0 else. - */ -int process_cli(struct session *t) { - int s = t->srv_state; - int c = t->cli_state; - struct buffer *req = t->req; - struct buffer *rep = t->rep; - int method_checked = 0; - appsess *asession_temp = NULL; - appsess local_asession; - -#ifdef DEBUG_FULL - fprintf(stderr,"process_cli: c=%s s=%s set(r,w)=%d,%d exp(r,w)=%d.%d,%d.%d\n", - cli_stnames[c], srv_stnames[s], - FD_ISSET(t->cli_fd, StaticReadEvent), FD_ISSET(t->cli_fd, StaticWriteEvent), - t->crexpire.tv_sec, t->crexpire.tv_usec, - t->cwexpire.tv_sec, t->cwexpire.tv_usec); -#endif - //fprintf(stderr,"process_cli: c=%d, s=%d, cr=%d, cw=%d, sr=%d, sw=%d\n", c, s, - //FD_ISSET(t->cli_fd, StaticReadEvent), FD_ISSET(t->cli_fd, StaticWriteEvent), - //FD_ISSET(t->srv_fd, StaticReadEvent), FD_ISSET(t->srv_fd, StaticWriteEvent) - //); - if (c == CL_STHEADERS) { - /* now parse the partial (or complete) headers */ - while (req->lr < req->r) { /* this loop only sees one header at each iteration */ - char *ptr; - int delete_header; - char *request_line = NULL; - - ptr = req->lr; - - /* look for the end of the current header */ - while (ptr < req->r && *ptr != '\n' && *ptr != '\r') - ptr++; - - if (ptr == req->h) { /* empty line, end of headers */ - int line, len; - - /* - * first, let's check that it's not a leading empty line, in - * which case we'll ignore and remove it (according to RFC2616). - */ - if (req->h == req->data) { - /* to get a complete header line, we need the ending \r\n, \n\r, \r or \n too */ - if (ptr > req->r - 2) { - /* this is a partial header, let's wait for more to come */ - req->lr = ptr; - break; - } - - /* now we know that *ptr is either \r or \n, - * and that there are at least 1 char after it. - */ - if ((ptr[0] == ptr[1]) || (ptr[1] != '\r' && ptr[1] != '\n')) - req->lr = ptr + 1; /* \r\r, \n\n, \r[^\n], \n[^\r] */ - else - req->lr = ptr + 2; /* \r\n or \n\r */ - /* ignore empty leading lines */ - buffer_replace2(req, req->h, req->lr, NULL, 0); - req->h = req->lr; - continue; - } - - /* we can only get here after an end of headers */ - /* we'll have something else to do here : add new headers ... */ - - if (t->flags & SN_CLDENY) { - /* no need to go further */ - t->logs.status = 403; - t->logs.t_request = tv_diff(&t->logs.tv_accept, &now); /* let's log the request time */ - client_retnclose(t, t->proxy->errmsg.len403, t->proxy->errmsg.msg403); - if (!(t->flags & SN_ERR_MASK)) - t->flags |= SN_ERR_PRXCOND; - if (!(t->flags & SN_FINST_MASK)) - t->flags |= SN_FINST_R; - return 1; - } - - /* Right now, we know that we have processed the entire headers - * and that unwanted requests have been filtered out. We can do - * whatever we want. - */ - - if (t->proxy->uri_auth != NULL - && t->req_line.len >= t->proxy->uri_auth->uri_len + 4) { /* +4 for "GET /" */ - if (!memcmp(t->req_line.str + 4, - t->proxy->uri_auth->uri_prefix, t->proxy->uri_auth->uri_len) - && !memcmp(t->req_line.str, "GET ", 4)) { - struct user_auth *user; - int authenticated; - - /* we are in front of a interceptable URI. Let's check - * if there's an authentication and if it's valid. - */ - user = t->proxy->uri_auth->users; - if (!user) { - /* no user auth required, it's OK */ - authenticated = 1; - } else { - authenticated = 0; - - /* a user list is defined, we have to check. - * skip 21 chars for "Authorization: Basic ". - */ - if (t->auth_hdr.len < 21 || memcmp(t->auth_hdr.str + 14, " Basic ", 7)) - user = NULL; - - while (user) { - if ((t->auth_hdr.len == user->user_len + 21) - && !memcmp(t->auth_hdr.str+21, user->user_pwd, user->user_len)) { - authenticated = 1; - break; - } - user = user->next; - } - } - - if (!authenticated) { - int msglen; - - /* no need to go further */ - - msglen = sprintf(trash, HTTP_401_fmt, t->proxy->uri_auth->auth_realm); - t->logs.status = 401; - client_retnclose(t, msglen, trash); - if (!(t->flags & SN_ERR_MASK)) - t->flags |= SN_ERR_PRXCOND; - if (!(t->flags & SN_FINST_MASK)) - t->flags |= SN_FINST_R; - return 1; - } - - t->cli_state = CL_STSHUTR; - req->rlim = req->data + BUFSIZE; /* no more rewrite needed */ - t->logs.t_request = tv_diff(&t->logs.tv_accept, &now); - t->data_source = DATA_SRC_STATS; - t->data_state = DATA_ST_INIT; - produce_content(t); - return 1; - } - } - - - for (line = 0; line < t->proxy->nb_reqadd; line++) { - len = sprintf(trash, "%s\r\n", t->proxy->req_add[line]); - buffer_replace2(req, req->h, req->h, trash, len); - } - - if (t->proxy->options & PR_O_FWDFOR) { - if (t->cli_addr.ss_family == AF_INET) { - unsigned char *pn; - pn = (unsigned char *)&((struct sockaddr_in *)&t->cli_addr)->sin_addr; - len = sprintf(trash, "X-Forwarded-For: %d.%d.%d.%d\r\n", - pn[0], pn[1], pn[2], pn[3]); - buffer_replace2(req, req->h, req->h, trash, len); - } - else if (t->cli_addr.ss_family == AF_INET6) { - char pn[INET6_ADDRSTRLEN]; - inet_ntop(AF_INET6, - (const void *)&((struct sockaddr_in6 *)(&t->cli_addr))->sin6_addr, - pn, sizeof(pn)); - len = sprintf(trash, "X-Forwarded-For: %s\r\n", pn); - buffer_replace2(req, req->h, req->h, trash, len); - } - } - - /* add a "connection: close" line if needed */ - if (t->proxy->options & PR_O_HTTP_CLOSE) - buffer_replace2(req, req->h, req->h, "Connection: close\r\n", 19); - - if (!memcmp(req->data, "POST ", 5)) { - /* this is a POST request, which is not cacheable by default */ - t->flags |= SN_POST; - } - - t->cli_state = CL_STDATA; - req->rlim = req->data + BUFSIZE; /* no more rewrite needed */ - - t->logs.t_request = tv_diff(&t->logs.tv_accept, &now); - /* FIXME: we'll set the client in a wait state while we try to - * connect to the server. Is this really needed ? wouldn't it be - * better to release the maximum of system buffers instead ? - * The solution is to enable the FD but set its time-out to - * eternity as long as the server-side does not enable data xfer. - * CL_STDATA also has to take care of this, which is done below. - */ - //FD_CLR(t->cli_fd, StaticReadEvent); - //tv_eternity(&t->crexpire); - - /* FIXME: if we break here (as up to 1.1.23), having the client - * shutdown its connection can lead to an abort further. - * it's better to either return 1 or even jump directly to the - * data state which will save one schedule. - */ - //break; - - if (!t->proxy->clitimeout || - (t->srv_state < SV_STDATA && t->proxy->srvtimeout)) - /* If the client has no timeout, or if the server is not ready yet, - * and we know for sure that it can expire, then it's cleaner to - * disable the timeout on the client side so that too low values - * cannot make the sessions abort too early. - * - * FIXME-20050705: the server needs a way to re-enable this time-out - * when it switches its state, otherwise a client can stay connected - * indefinitely. This now seems to be OK. - */ - tv_eternity(&t->crexpire); - - goto process_data; - } - - /* to get a complete header line, we need the ending \r\n, \n\r, \r or \n too */ - if (ptr > req->r - 2) { - /* this is a partial header, let's wait for more to come */ - req->lr = ptr; - break; - } - - /* now we know that *ptr is either \r or \n, - * and that there are at least 1 char after it. - */ - if ((ptr[0] == ptr[1]) || (ptr[1] != '\r' && ptr[1] != '\n')) - req->lr = ptr + 1; /* \r\r, \n\n, \r[^\n], \n[^\r] */ - else - req->lr = ptr + 2; /* \r\n or \n\r */ - - /* - * now we know that we have a full header ; we can do whatever - * we want with these pointers : - * req->h = beginning of header - * ptr = end of header (first \r or \n) - * req->lr = beginning of next line (next rep->h) - * req->r = end of data (not used at this stage) - */ - - if (!method_checked && (t->proxy->appsession_name != NULL) && - ((memcmp(req->h, "GET ", 4) == 0) || (memcmp(req->h, "POST ", 4) == 0)) && - ((request_line = memchr(req->h, ';', req->lr - req->h)) != NULL)) { - - /* skip ; */ - request_line++; - - /* look if we have a jsessionid */ - - if (strncasecmp(request_line, t->proxy->appsession_name, t->proxy->appsession_name_len) == 0) { - - /* skip jsessionid= */ - request_line += t->proxy->appsession_name_len + 1; - - /* First try if we allready have an appsession */ - asession_temp = &local_asession; - - if ((asession_temp->sessid = pool_alloc_from(apools.sessid, apools.ses_msize)) == NULL) { - Alert("Not enough memory process_cli():asession_temp->sessid:calloc().\n"); - send_log(t->proxy, LOG_ALERT, "Not enough Memory process_cli():asession_temp->sessid:calloc().\n"); - return 0; - } - - /* Copy the sessionid */ - memcpy(asession_temp->sessid, request_line, t->proxy->appsession_len); - asession_temp->sessid[t->proxy->appsession_len] = 0; - asession_temp->serverid = NULL; - - /* only do insert, if lookup fails */ - if (chtbl_lookup(&(t->proxy->htbl_proxy), (void *)&asession_temp)) { - if ((asession_temp = pool_alloc(appsess)) == NULL) { - Alert("Not enough memory process_cli():asession:calloc().\n"); - send_log(t->proxy, LOG_ALERT, "Not enough memory process_cli():asession:calloc().\n"); - return 0; - } - asession_temp->sessid = local_asession.sessid; - asession_temp->serverid = local_asession.serverid; - chtbl_insert(&(t->proxy->htbl_proxy), (void *) asession_temp); - } /* end if (chtbl_lookup()) */ - else { - /*free wasted memory;*/ - pool_free_to(apools.sessid, local_asession.sessid); - } - - tv_delayfrom(&asession_temp->expire, &now, t->proxy->appsession_timeout); - asession_temp->request_count++; - -#if defined(DEBUG_HASH) - print_table(&(t->proxy->htbl_proxy)); -#endif - - if (asession_temp->serverid == NULL) { - Alert("Found Application Session without matching server.\n"); - } else { - struct server *srv = t->proxy->srv; - while (srv) { - if (strcmp(srv->id, asession_temp->serverid) == 0) { - if (srv->state & SRV_RUNNING || t->proxy->options & PR_O_PERSIST) { - /* we found the server and it's usable */ - t->flags &= ~SN_CK_MASK; - t->flags |= SN_CK_VALID | SN_DIRECT | SN_ASSIGNED; - t->srv = srv; - break; - } else { - t->flags &= ~SN_CK_MASK; - t->flags |= SN_CK_DOWN; - } - } /* end if (strcmp()) */ - srv = srv->next; - }/* end while(srv) */ - }/* end else of if (asession_temp->serverid == NULL) */ - }/* end if (strncasecmp(request_line,t->proxy->appsession_name,apssesion_name_len) == 0) */ - else { - //fprintf(stderr,">>>>>>>>>>>>>>>>>>>>>>NO SESSION\n"); - } - method_checked = 1; - } /* end if (!method_checked ...) */ - else{ - //printf("No Methode-Header with Session-String\n"); - } - - if (t->logs.logwait & LW_REQ) { - /* we have a complete HTTP request that we must log */ - int urilen; - - if ((t->logs.uri = pool_alloc(requri)) == NULL) { - Alert("HTTP logging : out of memory.\n"); - t->logs.status = 500; - client_retnclose(t, t->proxy->errmsg.len500, t->proxy->errmsg.msg500); - if (!(t->flags & SN_ERR_MASK)) - t->flags |= SN_ERR_PRXCOND; - if (!(t->flags & SN_FINST_MASK)) - t->flags |= SN_FINST_R; - return 1; - } - - urilen = ptr - req->h; - if (urilen >= REQURI_LEN) - urilen = REQURI_LEN - 1; - memcpy(t->logs.uri, req->h, urilen); - t->logs.uri[urilen] = 0; - - if (!(t->logs.logwait &= ~LW_REQ)) - sess_log(t); - } - else if (t->logs.logwait & LW_REQHDR) { - struct cap_hdr *h; - int len; - for (h = t->proxy->req_cap; h; h = h->next) { - if ((h->namelen + 2 <= ptr - req->h) && - (req->h[h->namelen] == ':') && - (strncasecmp(req->h, h->name, h->namelen) == 0)) { - - if (t->req_cap[h->index] == NULL) - t->req_cap[h->index] = pool_alloc_from(h->pool, h->len + 1); - - len = ptr - (req->h + h->namelen + 2); - if (len > h->len) - len = h->len; - - memcpy(t->req_cap[h->index], req->h + h->namelen + 2, len); - t->req_cap[h->index][len]=0; - } - } - - } - - delete_header = 0; - - if ((global.mode & MODE_DEBUG) && (!(global.mode & MODE_QUIET) || (global.mode & MODE_VERBOSE))) { - int len, max; - len = sprintf(trash, "%08x:%s.clihdr[%04x:%04x]: ", t->uniq_id, t->proxy->id, (unsigned short)t->cli_fd, (unsigned short)t->srv_fd); - max = ptr - req->h; - UBOUND(max, sizeof(trash) - len - 1); - len += strlcpy2(trash + len, req->h, max + 1); - trash[len++] = '\n'; - write(1, trash, len); - } - - - /* remove "connection: " if needed */ - if (!delete_header && (t->proxy->options & PR_O_HTTP_CLOSE) - && (strncasecmp(req->h, "Connection: ", 12) == 0)) { - delete_header = 1; - } - - /* try headers regexps */ - if (!delete_header && t->proxy->req_exp != NULL - && !(t->flags & SN_CLDENY)) { - struct hdr_exp *exp; - char term; - - term = *ptr; - *ptr = '\0'; - exp = t->proxy->req_exp; - do { - if (regexec(exp->preg, req->h, MAX_MATCH, pmatch, 0) == 0) { - switch (exp->action) { - case ACT_ALLOW: - if (!(t->flags & SN_CLDENY)) - t->flags |= SN_CLALLOW; - break; - case ACT_REPLACE: - if (!(t->flags & SN_CLDENY)) { - int len = exp_replace(trash, req->h, exp->replace, pmatch); - ptr += buffer_replace2(req, req->h, ptr, trash, len); - } - break; - case ACT_REMOVE: - if (!(t->flags & SN_CLDENY)) - delete_header = 1; - break; - case ACT_DENY: - if (!(t->flags & SN_CLALLOW)) - t->flags |= SN_CLDENY; - break; - case ACT_PASS: /* we simply don't deny this one */ - break; - } - break; - } - } while ((exp = exp->next) != NULL); - *ptr = term; /* restore the string terminator */ - } - - /* Now look for cookies. Conforming to RFC2109, we have to support - * attributes whose name begin with a '$', and associate them with - * the right cookie, if we want to delete this cookie. - * So there are 3 cases for each cookie read : - * 1) it's a special attribute, beginning with a '$' : ignore it. - * 2) it's a server id cookie that we *MAY* want to delete : save - * some pointers on it (last semi-colon, beginning of cookie...) - * 3) it's an application cookie : we *MAY* have to delete a previous - * "special" cookie. - * At the end of loop, if a "special" cookie remains, we may have to - * remove it. If no application cookie persists in the header, we - * *MUST* delete it - */ - if (!delete_header && - (t->proxy->cookie_name != NULL || t->proxy->capture_name != NULL || t->proxy->appsession_name !=NULL) - && !(t->flags & SN_CLDENY) && (ptr >= req->h + 8) - && (strncasecmp(req->h, "Cookie: ", 8) == 0)) { - char *p1, *p2, *p3, *p4; - char *del_colon, *del_cookie, *colon; - int app_cookies; - - p1 = req->h + 8; /* first char after 'Cookie: ' */ - colon = p1; - /* del_cookie == NULL => nothing to be deleted */ - del_colon = del_cookie = NULL; - app_cookies = 0; - - while (p1 < ptr) { - /* skip spaces and colons, but keep an eye on these ones */ - while (p1 < ptr) { - if (*p1 == ';' || *p1 == ',') - colon = p1; - else if (!isspace((int)*p1)) - break; - p1++; - } - - if (p1 == ptr) - break; - - /* p1 is at the beginning of the cookie name */ - p2 = p1; - while (p2 < ptr && *p2 != '=') - p2++; - - if (p2 == ptr) - break; - - p3 = p2 + 1; /* skips the '=' sign */ - if (p3 == ptr) - break; - - p4 = p3; - while (p4 < ptr && !isspace((int)*p4) && *p4 != ';' && *p4 != ',') - p4++; - - /* here, we have the cookie name between p1 and p2, - * and its value between p3 and p4. - * we can process it : - * - * Cookie: NAME=VALUE; - * | || || | - * | || || +--> p4 - * | || |+-------> p3 - * | || +--------> p2 - * | |+------------> p1 - * | +-------------> colon - * +--------------------> req->h - */ - - if (*p1 == '$') { - /* skip this one */ - } - else { - /* first, let's see if we want to capture it */ - if (t->proxy->capture_name != NULL && - t->logs.cli_cookie == NULL && - (p4 - p1 >= t->proxy->capture_namelen) && - memcmp(p1, t->proxy->capture_name, t->proxy->capture_namelen) == 0) { - int log_len = p4 - p1; - - if ((t->logs.cli_cookie = pool_alloc(capture)) == NULL) { - Alert("HTTP logging : out of memory.\n"); - } else { - if (log_len > t->proxy->capture_len) - log_len = t->proxy->capture_len; - memcpy(t->logs.cli_cookie, p1, log_len); - t->logs.cli_cookie[log_len] = 0; - } - } - - if ((p2 - p1 == t->proxy->cookie_len) && (t->proxy->cookie_name != NULL) && - (memcmp(p1, t->proxy->cookie_name, p2 - p1) == 0)) { - /* Cool... it's the right one */ - struct server *srv = t->proxy->srv; - char *delim; - - /* if we're in cookie prefix mode, we'll search the delimitor so that we - * have the server ID betweek p3 and delim, and the original cookie between - * delim+1 and p4. Otherwise, delim==p4 : - * - * Cookie: NAME=SRV~VALUE; - * | || || | | - * | || || | +--> p4 - * | || || +--------> delim - * | || |+-----------> p3 - * | || +------------> p2 - * | |+----------------> p1 - * | +-----------------> colon - * +------------------------> req->h - */ - - if (t->proxy->options & PR_O_COOK_PFX) { - for (delim = p3; delim < p4; delim++) - if (*delim == COOKIE_DELIM) - break; - } - else - delim = p4; - - - /* Here, we'll look for the first running server which supports the cookie. - * This allows to share a same cookie between several servers, for example - * to dedicate backup servers to specific servers only. - * However, to prevent clients from sticking to cookie-less backup server - * when they have incidentely learned an empty cookie, we simply ignore - * empty cookies and mark them as invalid. - */ - if (delim == p3) - srv = NULL; - - while (srv) { - if ((srv->cklen == delim - p3) && !memcmp(p3, srv->cookie, delim - p3)) { - if (srv->state & SRV_RUNNING || t->proxy->options & PR_O_PERSIST) { - /* we found the server and it's usable */ - t->flags &= ~SN_CK_MASK; - t->flags |= SN_CK_VALID | SN_DIRECT | SN_ASSIGNED; - t->srv = srv; - break; - } else { - /* we found a server, but it's down */ - t->flags &= ~SN_CK_MASK; - t->flags |= SN_CK_DOWN; - } - } - srv = srv->next; - } - - if (!srv && !(t->flags & SN_CK_DOWN)) { - /* no server matched this cookie */ - t->flags &= ~SN_CK_MASK; - t->flags |= SN_CK_INVALID; - } - - /* depending on the cookie mode, we may have to either : - * - delete the complete cookie if we're in insert+indirect mode, so that - * the server never sees it ; - * - remove the server id from the cookie value, and tag the cookie as an - * application cookie so that it does not get accidentely removed later, - * if we're in cookie prefix mode - */ - if ((t->proxy->options & PR_O_COOK_PFX) && (delim != p4)) { - buffer_replace2(req, p3, delim + 1, NULL, 0); - p4 -= (delim + 1 - p3); - ptr -= (delim + 1 - p3); - del_cookie = del_colon = NULL; - app_cookies++; /* protect the header from deletion */ - } - else if (del_cookie == NULL && - (t->proxy->options & (PR_O_COOK_INS | PR_O_COOK_IND)) == (PR_O_COOK_INS | PR_O_COOK_IND)) { - del_cookie = p1; - del_colon = colon; - } - } else { - /* now we know that we must keep this cookie since it's - * not ours. But if we wanted to delete our cookie - * earlier, we cannot remove the complete header, but we - * can remove the previous block itself. - */ - app_cookies++; - - if (del_cookie != NULL) { - buffer_replace2(req, del_cookie, p1, NULL, 0); - p4 -= (p1 - del_cookie); - ptr -= (p1 - del_cookie); - del_cookie = del_colon = NULL; - } - } - - if ((t->proxy->appsession_name != NULL) && - (memcmp(p1, t->proxy->appsession_name, p2 - p1) == 0)) { - /* first, let's see if the cookie is our appcookie*/ - - /* Cool... it's the right one */ - - asession_temp = &local_asession; - - if ((asession_temp->sessid = pool_alloc_from(apools.sessid, apools.ses_msize)) == NULL) { - Alert("Not enough memory process_cli():asession->sessid:malloc().\n"); - send_log(t->proxy, LOG_ALERT, "Not enough memory process_cli():asession->sessid:malloc().\n"); - return 0; - } - - memcpy(asession_temp->sessid, p3, t->proxy->appsession_len); - asession_temp->sessid[t->proxy->appsession_len] = 0; - asession_temp->serverid = NULL; - - /* only do insert, if lookup fails */ - if (chtbl_lookup(&(t->proxy->htbl_proxy), (void *) &asession_temp) != 0) { - if ((asession_temp = pool_alloc(appsess)) == NULL) { - Alert("Not enough memory process_cli():asession:calloc().\n"); - send_log(t->proxy, LOG_ALERT, "Not enough memory process_cli():asession:calloc().\n"); - return 0; - } - - asession_temp->sessid = local_asession.sessid; - asession_temp->serverid = local_asession.serverid; - chtbl_insert(&(t->proxy->htbl_proxy), (void *) asession_temp); - } - else{ - /* free wasted memory */ - pool_free_to(apools.sessid, local_asession.sessid); - } - - if (asession_temp->serverid == NULL) { - Alert("Found Application Session without matching server.\n"); - } else { - struct server *srv = t->proxy->srv; - while (srv) { - if (strcmp(srv->id, asession_temp->serverid) == 0) { - if (srv->state & SRV_RUNNING || t->proxy->options & PR_O_PERSIST) { - /* we found the server and it's usable */ - t->flags &= ~SN_CK_MASK; - t->flags |= SN_CK_VALID | SN_DIRECT | SN_ASSIGNED; - t->srv = srv; - break; - } else { - t->flags &= ~SN_CK_MASK; - t->flags |= SN_CK_DOWN; - } - } - srv = srv->next; - }/* end while(srv) */ - }/* end else if server == NULL */ - - tv_delayfrom(&asession_temp->expire, &now, t->proxy->appsession_timeout); - }/* end if ((t->proxy->appsession_name != NULL) ... */ - } - - /* we'll have to look for another cookie ... */ - p1 = p4; - } /* while (p1 < ptr) */ - - /* There's no more cookie on this line. - * We may have marked the last one(s) for deletion. - * We must do this now in two ways : - * - if there is no app cookie, we simply delete the header ; - * - if there are app cookies, we must delete the end of the - * string properly, including the colon/semi-colon before - * the cookie name. - */ - if (del_cookie != NULL) { - if (app_cookies) { - buffer_replace2(req, del_colon, ptr, NULL, 0); - /* WARNING! becomes invalid for now. If some code - * below needs to rely on it before the end of the global - * header loop, we need to correct it with this code : - */ - ptr = del_colon; - } - else - delete_header = 1; - } - } /* end of cookie processing on this header */ - - /* let's look if we have to delete this header */ - if (delete_header && !(t->flags & SN_CLDENY)) { - buffer_replace2(req, req->h, req->lr, NULL, 0); - /* WARNING: ptr is not valid anymore, since the header may have - * been deleted or truncated ! */ - } else { - /* try to catch the first line as the request */ - if (t->req_line.len < 0) { - t->req_line.str = req->h; - t->req_line.len = ptr - req->h; - } - - /* We might also need the 'Authorization: ' header */ - if (t->auth_hdr.len < 0 && - t->proxy->uri_auth != NULL && - ptr > req->h + 15 && - !strncasecmp("Authorization: ", req->h, 15)) { - t->auth_hdr.str = req->h; - t->auth_hdr.len = ptr - req->h; - } - } - - req->h = req->lr; - } /* while (req->lr < req->r) */ - - /* end of header processing (even if incomplete) */ - - if ((req->l < req->rlim - req->data) && ! FD_ISSET(t->cli_fd, StaticReadEvent)) { - /* fd in StaticReadEvent was disabled, perhaps because of a previous buffer - * full. We cannot loop here since event_cli_read will disable it only if - * req->l == rlim-data - */ - FD_SET(t->cli_fd, StaticReadEvent); - if (t->proxy->clitimeout) - tv_delayfrom(&t->crexpire, &now, t->proxy->clitimeout); - else - tv_eternity(&t->crexpire); - } - - /* Since we are in header mode, if there's no space left for headers, we - * won't be able to free more later, so the session will never terminate. - */ - if (req->l >= req->rlim - req->data) { - t->logs.status = 400; - client_retnclose(t, t->proxy->errmsg.len400, t->proxy->errmsg.msg400); - if (!(t->flags & SN_ERR_MASK)) - t->flags |= SN_ERR_PRXCOND; - if (!(t->flags & SN_FINST_MASK)) - t->flags |= SN_FINST_R; - return 1; - } - else if (t->res_cr == RES_ERROR || t->res_cr == RES_NULL) { - /* read error, or last read : give up. */ - tv_eternity(&t->crexpire); - fd_delete(t->cli_fd); - t->cli_state = CL_STCLOSE; - if (!(t->flags & SN_ERR_MASK)) - t->flags |= SN_ERR_CLICL; - if (!(t->flags & SN_FINST_MASK)) - t->flags |= SN_FINST_R; - return 1; - } - else if (tv_cmp2_ms(&t->crexpire, &now) <= 0) { - - /* read timeout : give up with an error message. - */ - t->logs.status = 408; - client_retnclose(t, t->proxy->errmsg.len408, t->proxy->errmsg.msg408); - if (!(t->flags & SN_ERR_MASK)) - t->flags |= SN_ERR_CLITO; - if (!(t->flags & SN_FINST_MASK)) - t->flags |= SN_FINST_R; - return 1; - } - - return t->cli_state != CL_STHEADERS; - } - else if (c == CL_STDATA) { - process_data: - /* FIXME: this error handling is partly buggy because we always report - * a 'DATA' phase while we don't know if the server was in IDLE, CONN - * or HEADER phase. BTW, it's not logical to expire the client while - * we're waiting for the server to connect. - */ - /* read or write error */ - if (t->res_cw == RES_ERROR || t->res_cr == RES_ERROR) { - tv_eternity(&t->crexpire); - tv_eternity(&t->cwexpire); - fd_delete(t->cli_fd); - t->cli_state = CL_STCLOSE; - if (!(t->flags & SN_ERR_MASK)) - t->flags |= SN_ERR_CLICL; - if (!(t->flags & SN_FINST_MASK)) { - if (t->pend_pos) - t->flags |= SN_FINST_Q; - else if (s == SV_STCONN) - t->flags |= SN_FINST_C; - else - t->flags |= SN_FINST_D; - } - return 1; - } - /* last read, or end of server write */ - else if (t->res_cr == RES_NULL || s == SV_STSHUTW || s == SV_STCLOSE) { - FD_CLR(t->cli_fd, StaticReadEvent); - tv_eternity(&t->crexpire); - shutdown(t->cli_fd, SHUT_RD); - t->cli_state = CL_STSHUTR; - return 1; - } - /* last server read and buffer empty */ - else if ((s == SV_STSHUTR || s == SV_STCLOSE) && (rep->l == 0)) { - FD_CLR(t->cli_fd, StaticWriteEvent); - tv_eternity(&t->cwexpire); - shutdown(t->cli_fd, SHUT_WR); - /* We must ensure that the read part is still alive when switching - * to shutw */ - FD_SET(t->cli_fd, StaticReadEvent); - if (t->proxy->clitimeout) - tv_delayfrom(&t->crexpire, &now, t->proxy->clitimeout); - t->cli_state = CL_STSHUTW; - //fprintf(stderr,"%p:%s(%d), c=%d, s=%d\n", t, __FUNCTION__, __LINE__, t->cli_state, t->cli_state); - return 1; - } - /* read timeout */ - else if (tv_cmp2_ms(&t->crexpire, &now) <= 0) { - FD_CLR(t->cli_fd, StaticReadEvent); - tv_eternity(&t->crexpire); - shutdown(t->cli_fd, SHUT_RD); - t->cli_state = CL_STSHUTR; - if (!(t->flags & SN_ERR_MASK)) - t->flags |= SN_ERR_CLITO; - if (!(t->flags & SN_FINST_MASK)) { - if (t->pend_pos) - t->flags |= SN_FINST_Q; - else if (s == SV_STCONN) - t->flags |= SN_FINST_C; - else - t->flags |= SN_FINST_D; - } - return 1; - } - /* write timeout */ - else if (tv_cmp2_ms(&t->cwexpire, &now) <= 0) { - FD_CLR(t->cli_fd, StaticWriteEvent); - tv_eternity(&t->cwexpire); - shutdown(t->cli_fd, SHUT_WR); - /* We must ensure that the read part is still alive when switching - * to shutw */ - FD_SET(t->cli_fd, StaticReadEvent); - if (t->proxy->clitimeout) - tv_delayfrom(&t->crexpire, &now, t->proxy->clitimeout); - - t->cli_state = CL_STSHUTW; - if (!(t->flags & SN_ERR_MASK)) - t->flags |= SN_ERR_CLITO; - if (!(t->flags & SN_FINST_MASK)) { - if (t->pend_pos) - t->flags |= SN_FINST_Q; - else if (s == SV_STCONN) - t->flags |= SN_FINST_C; - else - t->flags |= SN_FINST_D; - } - return 1; - } - - if (req->l >= req->rlim - req->data) { - /* no room to read more data */ - if (FD_ISSET(t->cli_fd, StaticReadEvent)) { - /* stop reading until we get some space */ - FD_CLR(t->cli_fd, StaticReadEvent); - tv_eternity(&t->crexpire); - } - } - else { - /* there's still some space in the buffer */ - if (! FD_ISSET(t->cli_fd, StaticReadEvent)) { - FD_SET(t->cli_fd, StaticReadEvent); - if (!t->proxy->clitimeout || - (t->srv_state < SV_STDATA && t->proxy->srvtimeout)) - /* If the client has no timeout, or if the server not ready yet, and we - * know for sure that it can expire, then it's cleaner to disable the - * timeout on the client side so that too low values cannot make the - * sessions abort too early. - */ - tv_eternity(&t->crexpire); - else - tv_delayfrom(&t->crexpire, &now, t->proxy->clitimeout); - } - } - - if ((rep->l == 0) || - ((s < SV_STDATA) /* FIXME: this may be optimized && (rep->w == rep->h)*/)) { - if (FD_ISSET(t->cli_fd, StaticWriteEvent)) { - FD_CLR(t->cli_fd, StaticWriteEvent); /* stop writing */ - tv_eternity(&t->cwexpire); - } - } - else { /* buffer not empty */ - if (! FD_ISSET(t->cli_fd, StaticWriteEvent)) { - FD_SET(t->cli_fd, StaticWriteEvent); /* restart writing */ - if (t->proxy->clitimeout) { - tv_delayfrom(&t->cwexpire, &now, t->proxy->clitimeout); - /* FIXME: to prevent the client from expiring read timeouts during writes, - * we refresh it. */ - t->crexpire = t->cwexpire; - } - else - tv_eternity(&t->cwexpire); - } - } - return 0; /* other cases change nothing */ - } - else if (c == CL_STSHUTR) { - if (t->res_cw == RES_ERROR) { - tv_eternity(&t->cwexpire); - fd_delete(t->cli_fd); - t->cli_state = CL_STCLOSE; - if (!(t->flags & SN_ERR_MASK)) - t->flags |= SN_ERR_CLICL; - if (!(t->flags & SN_FINST_MASK)) { - if (t->pend_pos) - t->flags |= SN_FINST_Q; - else if (s == SV_STCONN) - t->flags |= SN_FINST_C; - else - t->flags |= SN_FINST_D; - } - return 1; - } - else if ((s == SV_STSHUTR || s == SV_STCLOSE) && (rep->l == 0) - && !(t->flags & SN_SELF_GEN)) { - tv_eternity(&t->cwexpire); - fd_delete(t->cli_fd); - t->cli_state = CL_STCLOSE; - return 1; - } - else if (tv_cmp2_ms(&t->cwexpire, &now) <= 0) { - tv_eternity(&t->cwexpire); - fd_delete(t->cli_fd); - t->cli_state = CL_STCLOSE; - if (!(t->flags & SN_ERR_MASK)) - t->flags |= SN_ERR_CLITO; - if (!(t->flags & SN_FINST_MASK)) { - if (t->pend_pos) - t->flags |= SN_FINST_Q; - else if (s == SV_STCONN) - t->flags |= SN_FINST_C; - else - t->flags |= SN_FINST_D; - } - return 1; - } - - if (t->flags & SN_SELF_GEN) { - produce_content(t); - if (rep->l == 0) { - tv_eternity(&t->cwexpire); - fd_delete(t->cli_fd); - t->cli_state = CL_STCLOSE; - return 1; - } - } - - if ((rep->l == 0) - || ((s == SV_STHEADERS) /* FIXME: this may be optimized && (rep->w == rep->h)*/)) { - if (FD_ISSET(t->cli_fd, StaticWriteEvent)) { - FD_CLR(t->cli_fd, StaticWriteEvent); /* stop writing */ - tv_eternity(&t->cwexpire); - } - } - else { /* buffer not empty */ - if (! FD_ISSET(t->cli_fd, StaticWriteEvent)) { - FD_SET(t->cli_fd, StaticWriteEvent); /* restart writing */ - if (t->proxy->clitimeout) { - tv_delayfrom(&t->cwexpire, &now, t->proxy->clitimeout); - /* FIXME: to prevent the client from expiring read timeouts during writes, - * we refresh it. */ - t->crexpire = t->cwexpire; - } - else - tv_eternity(&t->cwexpire); - } - } - return 0; - } - else if (c == CL_STSHUTW) { - if (t->res_cr == RES_ERROR) { - tv_eternity(&t->crexpire); - fd_delete(t->cli_fd); - t->cli_state = CL_STCLOSE; - if (!(t->flags & SN_ERR_MASK)) - t->flags |= SN_ERR_CLICL; - if (!(t->flags & SN_FINST_MASK)) { - if (t->pend_pos) - t->flags |= SN_FINST_Q; - else if (s == SV_STCONN) - t->flags |= SN_FINST_C; - else - t->flags |= SN_FINST_D; - } - return 1; - } - else if (t->res_cr == RES_NULL || s == SV_STSHUTW || s == SV_STCLOSE) { - tv_eternity(&t->crexpire); - fd_delete(t->cli_fd); - t->cli_state = CL_STCLOSE; - return 1; - } - else if (tv_cmp2_ms(&t->crexpire, &now) <= 0) { - tv_eternity(&t->crexpire); - fd_delete(t->cli_fd); - t->cli_state = CL_STCLOSE; - if (!(t->flags & SN_ERR_MASK)) - t->flags |= SN_ERR_CLITO; - if (!(t->flags & SN_FINST_MASK)) { - if (t->pend_pos) - t->flags |= SN_FINST_Q; - else if (s == SV_STCONN) - t->flags |= SN_FINST_C; - else - t->flags |= SN_FINST_D; - } - return 1; - } - else if (req->l >= req->rlim - req->data) { - /* no room to read more data */ - - /* FIXME-20050705: is it possible for a client to maintain a session - * after the timeout by sending more data after it receives a close ? - */ - - if (FD_ISSET(t->cli_fd, StaticReadEvent)) { - /* stop reading until we get some space */ - FD_CLR(t->cli_fd, StaticReadEvent); - tv_eternity(&t->crexpire); - //fprintf(stderr,"%p:%s(%d), c=%d, s=%d\n", t, __FUNCTION__, __LINE__, t->cli_state, t->cli_state); - } - } - else { - /* there's still some space in the buffer */ - if (! FD_ISSET(t->cli_fd, StaticReadEvent)) { - FD_SET(t->cli_fd, StaticReadEvent); - if (t->proxy->clitimeout) - tv_delayfrom(&t->crexpire, &now, t->proxy->clitimeout); - else - tv_eternity(&t->crexpire); - //fprintf(stderr,"%p:%s(%d), c=%d, s=%d\n", t, __FUNCTION__, __LINE__, t->cli_state, t->cli_state); - } - } - return 0; - } - else { /* CL_STCLOSE: nothing to do */ - if ((global.mode & MODE_DEBUG) && (!(global.mode & MODE_QUIET) || (global.mode & MODE_VERBOSE))) { - int len; - len = sprintf(trash, "%08x:%s.clicls[%04x:%04x]\n", t->uniq_id, t->proxy->id, (unsigned short)t->cli_fd, (unsigned short)t->srv_fd); - write(1, trash, len); - } - return 0; - } - return 0; -} - -/* This function turns the server state into the SV_STCLOSE, and sets - * indicators accordingly. Note that if is 0, no message is - * returned. - */ -void srv_close_with_err(struct session *t, int err, int finst, int status, int msglen, char *msg) { - t->srv_state = SV_STCLOSE; - if (status > 0) { - t->logs.status = status; - if (t->proxy->mode == PR_MODE_HTTP) - client_return(t, msglen, msg); - } - if (!(t->flags & SN_ERR_MASK)) - t->flags |= err; - if (!(t->flags & SN_FINST_MASK)) - t->flags |= finst; -} - -/* - * This function checks the retry count during the connect() job. - * It updates the session's srv_state and retries, so that the caller knows - * what it has to do. It uses the last connection error to set the log when - * it expires. It returns 1 when it has expired, and 0 otherwise. - */ -int srv_count_retry_down(struct session *t, int conn_err) { - /* we are in front of a retryable error */ - t->conn_retries--; - if (t->conn_retries < 0) { - /* if not retryable anymore, let's abort */ - tv_eternity(&t->cnexpire); - srv_close_with_err(t, conn_err, SN_FINST_C, - 503, t->proxy->errmsg.len503, t->proxy->errmsg.msg503); - if (t->srv) - t->srv->failed_conns++; - t->proxy->failed_conns++; - - /* We used to have a free connection slot. Since we'll never use it, - * we have to inform the server that it may be used by another session. - */ - if (may_dequeue_tasks(t->srv, t->proxy)) - task_wakeup(&rq, t->srv->queue_mgt); - return 1; - } - return 0; -} - -/* - * This function performs the retryable part of the connect() job. - * It updates the session's srv_state and retries, so that the caller knows - * what it has to do. It returns 1 when it breaks out of the loop, or 0 if - * it needs to redispatch. - */ -int srv_retryable_connect(struct session *t) { - int conn_err; - - /* This loop ensures that we stop before the last retry in case of a - * redispatchable server. - */ - do { - /* initiate a connection to the server */ - conn_err = connect_server(t); - switch (conn_err) { - - case SN_ERR_NONE: - //fprintf(stderr,"0: c=%d, s=%d\n", c, s); - t->srv_state = SV_STCONN; - return 1; - - case SN_ERR_INTERNAL: - tv_eternity(&t->cnexpire); - srv_close_with_err(t, SN_ERR_INTERNAL, SN_FINST_C, - 500, t->proxy->errmsg.len500, t->proxy->errmsg.msg500); - if (t->srv) - t->srv->failed_conns++; - t->proxy->failed_conns++; - /* release other sessions waiting for this server */ - if (may_dequeue_tasks(t->srv, t->proxy)) - task_wakeup(&rq, t->srv->queue_mgt); - return 1; - } - /* ensure that we have enough retries left */ - if (srv_count_retry_down(t, conn_err)) { - /* let's try to offer this slot to anybody */ - if (may_dequeue_tasks(t->srv, t->proxy)) - task_wakeup(&rq, t->srv->queue_mgt); - return 1; - } - } while (t->srv == NULL || t->conn_retries > 0 || !(t->proxy->options & PR_O_REDISP)); - - /* We're on our last chance, and the REDISP option was specified. - * We will ignore cookie and force to balance or use the dispatcher. - */ - /* let's try to offer this slot to anybody */ - if (may_dequeue_tasks(t->srv, t->proxy)) - task_wakeup(&rq, t->srv->queue_mgt); - - if (t->srv) - t->srv->failed_conns++; - t->proxy->failed_conns++; - - t->flags &= ~(SN_DIRECT | SN_ASSIGNED | SN_ADDR_SET); - t->srv = NULL; /* it's left to the dispatcher to choose a server */ - if ((t->flags & SN_CK_MASK) == SN_CK_VALID) { - t->flags &= ~SN_CK_MASK; - t->flags |= SN_CK_DOWN; - } - return 0; -} - -/* This function performs the "redispatch" part of a connection attempt. It - * will assign a server if required, queue the connection if required, and - * handle errors that might arise at this level. It can change the server - * state. It will return 1 if it encounters an error, switches the server - * state, or has to queue a connection. Otherwise, it will return 0 indicating - * that the connection is ready to use. - */ - -int srv_redispatch_connect(struct session *t) { - int conn_err; - - /* We know that we don't have any connection pending, so we will - * try to get a new one, and wait in this state if it's queued - */ - conn_err = assign_server_and_queue(t); - switch (conn_err) { - case SRV_STATUS_OK: - break; - - case SRV_STATUS_NOSRV: - /* note: it is guaranteed that t->srv == NULL here */ - tv_eternity(&t->cnexpire); - srv_close_with_err(t, SN_ERR_SRVTO, SN_FINST_C, - 503, t->proxy->errmsg.len503, t->proxy->errmsg.msg503); - if (t->srv) - t->srv->failed_conns++; - t->proxy->failed_conns++; - - return 1; - - case SRV_STATUS_QUEUED: - /* FIXME-20060503 : we should use the queue timeout instead */ - if (t->proxy->contimeout) - tv_delayfrom(&t->cnexpire, &now, t->proxy->contimeout); - else - tv_eternity(&t->cnexpire); - t->srv_state = SV_STIDLE; - /* do nothing else and do not wake any other session up */ - return 1; - - case SRV_STATUS_FULL: - case SRV_STATUS_INTERNAL: - default: - tv_eternity(&t->cnexpire); - srv_close_with_err(t, SN_ERR_INTERNAL, SN_FINST_C, - 500, t->proxy->errmsg.len500, t->proxy->errmsg.msg500); - if (t->srv) - t->srv->failed_conns++; - t->proxy->failed_conns++; - - /* release other sessions waiting for this server */ - if (may_dequeue_tasks(t->srv, t->proxy)) - task_wakeup(&rq, t->srv->queue_mgt); - return 1; - } - /* if we get here, it's because we got SRV_STATUS_OK, which also - * means that the connection has not been queued. - */ - return 0; -} - - -/* - * manages the server FSM and its socket. It returns 1 if a state has changed - * (and a resync may be needed), 0 else. - */ -int process_srv(struct session *t) { - int s = t->srv_state; - int c = t->cli_state; - struct buffer *req = t->req; - struct buffer *rep = t->rep; - appsess *asession_temp = NULL; - appsess local_asession; - int conn_err; - -#ifdef DEBUG_FULL - fprintf(stderr,"process_srv: c=%s, s=%s\n", cli_stnames[c], srv_stnames[s]); -#endif - //fprintf(stderr,"process_srv: c=%d, s=%d, cr=%d, cw=%d, sr=%d, sw=%d\n", c, s, - //FD_ISSET(t->cli_fd, StaticReadEvent), FD_ISSET(t->cli_fd, StaticWriteEvent), - //FD_ISSET(t->srv_fd, StaticReadEvent), FD_ISSET(t->srv_fd, StaticWriteEvent) - //); - if (s == SV_STIDLE) { - if (c == CL_STHEADERS) - return 0; /* stay in idle, waiting for data to reach the client side */ - else if (c == CL_STCLOSE || c == CL_STSHUTW || - (c == CL_STSHUTR && - (t->req->l == 0 || t->proxy->options & PR_O_ABRT_CLOSE))) { /* give up */ - tv_eternity(&t->cnexpire); - if (t->pend_pos) - t->logs.t_queue = tv_diff(&t->logs.tv_accept, &now); - /* note that this must not return any error because it would be able to - * overwrite the client_retnclose() output. - */ - srv_close_with_err(t, SN_ERR_CLICL, t->pend_pos ? SN_FINST_Q : SN_FINST_C, 0, 0, NULL); - - return 1; - } - else { - /* Right now, we will need to create a connection to the server. - * We might already have tried, and got a connection pending, in - * which case we will not do anything till it's pending. It's up - * to any other session to release it and wake us up again. - */ - if (t->pend_pos) { - if (tv_cmp2_ms(&t->cnexpire, &now) > 0) - return 0; - else { - /* we've been waiting too long here */ - tv_eternity(&t->cnexpire); - t->logs.t_queue = tv_diff(&t->logs.tv_accept, &now); - srv_close_with_err(t, SN_ERR_SRVTO, SN_FINST_Q, - 503, t->proxy->errmsg.len503, t->proxy->errmsg.msg503); - if (t->srv) - t->srv->failed_conns++; - t->proxy->failed_conns++; - return 1; - } - } - - do { - /* first, get a connection */ - if (srv_redispatch_connect(t)) - return t->srv_state != SV_STIDLE; - - /* try to (re-)connect to the server, and fail if we expire the - * number of retries. - */ - if (srv_retryable_connect(t)) { - t->logs.t_queue = tv_diff(&t->logs.tv_accept, &now); - return t->srv_state != SV_STIDLE; - } - - } while (1); - } - } - else if (s == SV_STCONN) { /* connection in progress */ - if (c == CL_STCLOSE || c == CL_STSHUTW || - (c == CL_STSHUTR && - (t->req->l == 0 || t->proxy->options & PR_O_ABRT_CLOSE))) { /* give up */ - tv_eternity(&t->cnexpire); - fd_delete(t->srv_fd); - if (t->srv) - t->srv->cur_sess--; - - /* note that this must not return any error because it would be able to - * overwrite the client_retnclose() output. - */ - srv_close_with_err(t, SN_ERR_CLICL, SN_FINST_C, 0, 0, NULL); - return 1; - } - if (t->res_sw == RES_SILENT && tv_cmp2_ms(&t->cnexpire, &now) > 0) { - //fprintf(stderr,"1: c=%d, s=%d, now=%d.%06d, exp=%d.%06d\n", c, s, now.tv_sec, now.tv_usec, t->cnexpire.tv_sec, t->cnexpire.tv_usec); - return 0; /* nothing changed */ - } - else if (t->res_sw == RES_SILENT || t->res_sw == RES_ERROR) { - /* timeout, asynchronous connect error or first write error */ - //fprintf(stderr,"2: c=%d, s=%d\n", c, s); - - fd_delete(t->srv_fd); - if (t->srv) - t->srv->cur_sess--; - - if (t->res_sw == RES_SILENT) - conn_err = SN_ERR_SRVTO; // it was a connect timeout. - else - conn_err = SN_ERR_SRVCL; // it was an asynchronous connect error. - - /* ensure that we have enough retries left */ - if (srv_count_retry_down(t, conn_err)) - return 1; - - do { - /* Now we will try to either reconnect to the same server or - * connect to another server. If the connection gets queued - * because all servers are saturated, then we will go back to - * the SV_STIDLE state. - */ - if (srv_retryable_connect(t)) { - t->logs.t_queue = tv_diff(&t->logs.tv_accept, &now); - return t->srv_state != SV_STCONN; - } - - /* we need to redispatch the connection to another server */ - if (srv_redispatch_connect(t)) - return t->srv_state != SV_STCONN; - } while (1); - } - else { /* no error or write 0 */ - t->logs.t_connect = tv_diff(&t->logs.tv_accept, &now); - - //fprintf(stderr,"3: c=%d, s=%d\n", c, s); - if (req->l == 0) /* nothing to write */ { - FD_CLR(t->srv_fd, StaticWriteEvent); - tv_eternity(&t->swexpire); - } else /* need the right to write */ { - FD_SET(t->srv_fd, StaticWriteEvent); - if (t->proxy->srvtimeout) { - tv_delayfrom(&t->swexpire, &now, t->proxy->srvtimeout); - /* FIXME: to prevent the server from expiring read timeouts during writes, - * we refresh it. */ - t->srexpire = t->swexpire; - } - else - tv_eternity(&t->swexpire); - } - - if (t->proxy->mode == PR_MODE_TCP) { /* let's allow immediate data connection in this case */ - FD_SET(t->srv_fd, StaticReadEvent); - if (t->proxy->srvtimeout) - tv_delayfrom(&t->srexpire, &now, t->proxy->srvtimeout); - else - tv_eternity(&t->srexpire); - - t->srv_state = SV_STDATA; - if (t->srv) - t->srv->cum_sess++; - rep->rlim = rep->data + BUFSIZE; /* no rewrite needed */ - - /* if the user wants to log as soon as possible, without counting - bytes from the server, then this is the right moment. */ - if (t->proxy->to_log && !(t->logs.logwait & LW_BYTES)) { - t->logs.t_close = t->logs.t_connect; /* to get a valid end date */ - sess_log(t); - } - } - else { - t->srv_state = SV_STHEADERS; - if (t->srv) - t->srv->cum_sess++; - rep->rlim = rep->data + BUFSIZE - MAXREWRITE; /* rewrite needed */ - } - tv_eternity(&t->cnexpire); - return 1; - } - } - else if (s == SV_STHEADERS) { /* receiving server headers */ - /* now parse the partial (or complete) headers */ - while (rep->lr < rep->r) { /* this loop only sees one header at each iteration */ - char *ptr; - int delete_header; - - ptr = rep->lr; - - /* look for the end of the current header */ - while (ptr < rep->r && *ptr != '\n' && *ptr != '\r') - ptr++; - - if (ptr == rep->h) { - int line, len; - - /* we can only get here after an end of headers */ - - /* first, we'll block if security checks have caught nasty things */ - if (t->flags & SN_CACHEABLE) { - if ((t->flags & SN_CACHE_COOK) && - (t->flags & SN_SCK_ANY) && - (t->proxy->options & PR_O_CHK_CACHE)) { - - /* we're in presence of a cacheable response containing - * a set-cookie header. We'll block it as requested by - * the 'checkcache' option, and send an alert. - */ - tv_eternity(&t->srexpire); - tv_eternity(&t->swexpire); - fd_delete(t->srv_fd); - if (t->srv) { - t->srv->cur_sess--; - t->srv->failed_secu++; - } - t->proxy->failed_secu++; - t->srv_state = SV_STCLOSE; - t->logs.status = 502; - client_return(t, t->proxy->errmsg.len502, t->proxy->errmsg.msg502); - if (!(t->flags & SN_ERR_MASK)) - t->flags |= SN_ERR_PRXCOND; - if (!(t->flags & SN_FINST_MASK)) - t->flags |= SN_FINST_H; - - Alert("Blocking cacheable cookie in response from instance %s, server %s.\n", t->proxy->id, t->srv->id); - send_log(t->proxy, LOG_ALERT, "Blocking cacheable cookie in response from instance %s, server %s.\n", t->proxy->id, t->srv->id); - - /* We used to have a free connection slot. Since we'll never use it, - * we have to inform the server that it may be used by another session. - */ - if (may_dequeue_tasks(t->srv, t->proxy)) - task_wakeup(&rq, t->srv->queue_mgt); - - return 1; - } - } - - /* next, we'll block if an 'rspideny' or 'rspdeny' filter matched */ - if (t->flags & SN_SVDENY) { - tv_eternity(&t->srexpire); - tv_eternity(&t->swexpire); - fd_delete(t->srv_fd); - if (t->srv) { - t->srv->cur_sess--; - t->srv->failed_secu++; - } - t->proxy->failed_secu++; - t->srv_state = SV_STCLOSE; - t->logs.status = 502; - client_return(t, t->proxy->errmsg.len502, t->proxy->errmsg.msg502); - if (!(t->flags & SN_ERR_MASK)) - t->flags |= SN_ERR_PRXCOND; - if (!(t->flags & SN_FINST_MASK)) - t->flags |= SN_FINST_H; - /* We used to have a free connection slot. Since we'll never use it, - * we have to inform the server that it may be used by another session. - */ - if (may_dequeue_tasks(t->srv, t->proxy)) - task_wakeup(&rq, t->srv->queue_mgt); - - return 1; - } - - /* we'll have something else to do here : add new headers ... */ - - if ((t->srv) && !(t->flags & SN_DIRECT) && (t->proxy->options & PR_O_COOK_INS) && - (!(t->proxy->options & PR_O_COOK_POST) || (t->flags & SN_POST))) { - /* the server is known, it's not the one the client requested, we have to - * insert a set-cookie here, except if we want to insert only on POST - * requests and this one isn't. Note that servers which don't have cookies - * (eg: some backup servers) will return a full cookie removal request. - */ - len = sprintf(trash, "Set-Cookie: %s=%s; path=/\r\n", - t->proxy->cookie_name, - t->srv->cookie ? t->srv->cookie : "; Expires=Thu, 01-Jan-1970 00:00:01 GMT"); - - t->flags |= SN_SCK_INSERTED; - - /* Here, we will tell an eventual cache on the client side that we don't - * want it to cache this reply because HTTP/1.0 caches also cache cookies ! - * Some caches understand the correct form: 'no-cache="set-cookie"', but - * others don't (eg: apache <= 1.3.26). So we use 'private' instead. - */ - if (t->proxy->options & PR_O_COOK_NOC) - //len += sprintf(newhdr + len, "Cache-control: no-cache=\"set-cookie\"\r\n"); - len += sprintf(trash + len, "Cache-control: private\r\n"); - - if (rep->data + rep->l < rep->h) - /* The data has been stolen, we will crash cleanly instead of corrupting memory */ - *(int *)0 = 0; - buffer_replace2(rep, rep->h, rep->h, trash, len); - } - - /* headers to be added */ - for (line = 0; line < t->proxy->nb_rspadd; line++) { - len = sprintf(trash, "%s\r\n", t->proxy->rsp_add[line]); - buffer_replace2(rep, rep->h, rep->h, trash, len); - } - - /* add a "connection: close" line if needed */ - if (t->proxy->options & PR_O_HTTP_CLOSE) - buffer_replace2(rep, rep->h, rep->h, "Connection: close\r\n", 19); - - t->srv_state = SV_STDATA; - rep->rlim = rep->data + BUFSIZE; /* no more rewrite needed */ - t->logs.t_data = tv_diff(&t->logs.tv_accept, &now); - - /* client connection already closed or option 'httpclose' required : - * we close the server's outgoing connection right now. - */ - if ((req->l == 0) && - (c == CL_STSHUTR || c == CL_STCLOSE || t->proxy->options & PR_O_FORCE_CLO)) { - FD_CLR(t->srv_fd, StaticWriteEvent); - tv_eternity(&t->swexpire); - - /* We must ensure that the read part is still alive when switching - * to shutw */ - FD_SET(t->srv_fd, StaticReadEvent); - if (t->proxy->srvtimeout) - tv_delayfrom(&t->srexpire, &now, t->proxy->srvtimeout); - - shutdown(t->srv_fd, SHUT_WR); - t->srv_state = SV_STSHUTW; - } - - /* if the user wants to log as soon as possible, without counting - bytes from the server, then this is the right moment. */ - if (t->proxy->to_log && !(t->logs.logwait & LW_BYTES)) { - t->logs.t_close = t->logs.t_data; /* to get a valid end date */ - t->logs.bytes = rep->h - rep->data; - sess_log(t); - } - break; - } - - /* to get a complete header line, we need the ending \r\n, \n\r, \r or \n too */ - if (ptr > rep->r - 2) { - /* this is a partial header, let's wait for more to come */ - rep->lr = ptr; - break; - } - - // fprintf(stderr,"h=%p, ptr=%p, lr=%p, r=%p, *h=", rep->h, ptr, rep->lr, rep->r); - // write(2, rep->h, ptr - rep->h); fprintf(stderr,"\n"); - - /* now we know that *ptr is either \r or \n, - * and that there are at least 1 char after it. - */ - if ((ptr[0] == ptr[1]) || (ptr[1] != '\r' && ptr[1] != '\n')) - rep->lr = ptr + 1; /* \r\r, \n\n, \r[^\n], \n[^\r] */ - else - rep->lr = ptr + 2; /* \r\n or \n\r */ - - /* - * now we know that we have a full header ; we can do whatever - * we want with these pointers : - * rep->h = beginning of header - * ptr = end of header (first \r or \n) - * rep->lr = beginning of next line (next rep->h) - * rep->r = end of data (not used at this stage) - */ - - - if (t->logs.status == -1) { - t->logs.logwait &= ~LW_RESP; - t->logs.status = atoi(rep->h + 9); - switch (t->logs.status) { - case 200: - case 203: - case 206: - case 300: - case 301: - case 410: - /* RFC2616 @13.4: - * "A response received with a status code of - * 200, 203, 206, 300, 301 or 410 MAY be stored - * by a cache (...) unless a cache-control - * directive prohibits caching." - * - * RFC2616 @9.5: POST method : - * "Responses to this method are not cacheable, - * unless the response includes appropriate - * Cache-Control or Expires header fields." - */ - if (!(t->flags & SN_POST) && (t->proxy->options & PR_O_CHK_CACHE)) - t->flags |= SN_CACHEABLE | SN_CACHE_COOK; - break; - default: - break; - } - } - else if (t->logs.logwait & LW_RSPHDR) { - struct cap_hdr *h; - int len; - for (h = t->proxy->rsp_cap; h; h = h->next) { - if ((h->namelen + 2 <= ptr - rep->h) && - (rep->h[h->namelen] == ':') && - (strncasecmp(rep->h, h->name, h->namelen) == 0)) { - - if (t->rsp_cap[h->index] == NULL) - t->rsp_cap[h->index] = pool_alloc_from(h->pool, h->len + 1); - - len = ptr - (rep->h + h->namelen + 2); - if (len > h->len) - len = h->len; - - memcpy(t->rsp_cap[h->index], rep->h + h->namelen + 2, len); - t->rsp_cap[h->index][len]=0; - } - } - - } - - delete_header = 0; - - if ((global.mode & MODE_DEBUG) && (!(global.mode & MODE_QUIET) || (global.mode & MODE_VERBOSE))) { - int len, max; - len = sprintf(trash, "%08x:%s.srvhdr[%04x:%04x]: ", t->uniq_id, t->proxy->id, (unsigned short)t->cli_fd, (unsigned short)t->srv_fd); - max = ptr - rep->h; - UBOUND(max, sizeof(trash) - len - 1); - len += strlcpy2(trash + len, rep->h, max + 1); - trash[len++] = '\n'; - write(1, trash, len); - } - - /* remove "connection: " if needed */ - if (!delete_header && (t->proxy->options & PR_O_HTTP_CLOSE) - && (strncasecmp(rep->h, "Connection: ", 12) == 0)) { - delete_header = 1; - } - - /* try headers regexps */ - if (!delete_header && t->proxy->rsp_exp != NULL - && !(t->flags & SN_SVDENY)) { - struct hdr_exp *exp; - char term; - - term = *ptr; - *ptr = '\0'; - exp = t->proxy->rsp_exp; - do { - if (regexec(exp->preg, rep->h, MAX_MATCH, pmatch, 0) == 0) { - switch (exp->action) { - case ACT_ALLOW: - if (!(t->flags & SN_SVDENY)) - t->flags |= SN_SVALLOW; - break; - case ACT_REPLACE: - if (!(t->flags & SN_SVDENY)) { - int len = exp_replace(trash, rep->h, exp->replace, pmatch); - ptr += buffer_replace2(rep, rep->h, ptr, trash, len); - } - break; - case ACT_REMOVE: - if (!(t->flags & SN_SVDENY)) - delete_header = 1; - break; - case ACT_DENY: - if (!(t->flags & SN_SVALLOW)) - t->flags |= SN_SVDENY; - break; - case ACT_PASS: /* we simply don't deny this one */ - break; - } - break; - } - } while ((exp = exp->next) != NULL); - *ptr = term; /* restore the string terminator */ - } - - /* check for cache-control: or pragma: headers */ - if (!delete_header && (t->flags & SN_CACHEABLE)) { - if (strncasecmp(rep->h, "Pragma: no-cache", 16) == 0) - t->flags &= ~SN_CACHEABLE & ~SN_CACHE_COOK; - else if (strncasecmp(rep->h, "Cache-control: ", 15) == 0) { - if (strncasecmp(rep->h + 15, "no-cache", 8) == 0) { - if (rep->h + 23 == ptr || rep->h[23] == ',') - t->flags &= ~SN_CACHEABLE & ~SN_CACHE_COOK; - else { - if (strncasecmp(rep->h + 23, "=\"set-cookie", 12) == 0 - && (rep->h[35] == '"' || rep->h[35] == ',')) - t->flags &= ~SN_CACHE_COOK; - } - } else if ((strncasecmp(rep->h + 15, "private", 7) == 0 && - (rep->h + 22 == ptr || rep->h[22] == ',')) - || (strncasecmp(rep->h + 15, "no-store", 8) == 0 && - (rep->h + 23 == ptr || rep->h[23] == ','))) { - t->flags &= ~SN_CACHEABLE & ~SN_CACHE_COOK; - } else if (strncasecmp(rep->h + 15, "max-age=0", 9) == 0 && - (rep->h + 24 == ptr || rep->h[24] == ',')) { - t->flags &= ~SN_CACHEABLE & ~SN_CACHE_COOK; - } else if (strncasecmp(rep->h + 15, "s-maxage=0", 10) == 0 && - (rep->h + 25 == ptr || rep->h[25] == ',')) { - t->flags &= ~SN_CACHEABLE & ~SN_CACHE_COOK; - } else if (strncasecmp(rep->h + 15, "public", 6) == 0 && - (rep->h + 21 == ptr || rep->h[21] == ',')) { - t->flags |= SN_CACHEABLE | SN_CACHE_COOK; - } - } - } - - /* check for server cookies */ - if (!delete_header /*&& (t->proxy->options & PR_O_COOK_ANY)*/ - && (t->proxy->cookie_name != NULL || t->proxy->capture_name != NULL || t->proxy->appsession_name !=NULL) - && (strncasecmp(rep->h, "Set-Cookie: ", 12) == 0)) { - char *p1, *p2, *p3, *p4; - - t->flags |= SN_SCK_ANY; - - p1 = rep->h + 12; /* first char after 'Set-Cookie: ' */ - - while (p1 < ptr) { /* in fact, we'll break after the first cookie */ - while (p1 < ptr && (isspace((int)*p1))) - p1++; - - if (p1 == ptr || *p1 == ';') /* end of cookie */ - break; - - /* p1 is at the beginning of the cookie name */ - p2 = p1; - - while (p2 < ptr && *p2 != '=' && *p2 != ';') - p2++; - - if (p2 == ptr || *p2 == ';') /* next cookie */ - break; - - p3 = p2 + 1; /* skips the '=' sign */ - if (p3 == ptr) - break; - - p4 = p3; - while (p4 < ptr && !isspace((int)*p4) && *p4 != ';') - p4++; - - /* here, we have the cookie name between p1 and p2, - * and its value between p3 and p4. - * we can process it. - */ - - /* first, let's see if we want to capture it */ - if (t->proxy->capture_name != NULL && - t->logs.srv_cookie == NULL && - (p4 - p1 >= t->proxy->capture_namelen) && - memcmp(p1, t->proxy->capture_name, t->proxy->capture_namelen) == 0) { - int log_len = p4 - p1; - - if ((t->logs.srv_cookie = pool_alloc(capture)) == NULL) { - Alert("HTTP logging : out of memory.\n"); - } - - if (log_len > t->proxy->capture_len) - log_len = t->proxy->capture_len; - memcpy(t->logs.srv_cookie, p1, log_len); - t->logs.srv_cookie[log_len] = 0; - } - - if ((p2 - p1 == t->proxy->cookie_len) && (t->proxy->cookie_name != NULL) && - (memcmp(p1, t->proxy->cookie_name, p2 - p1) == 0)) { - /* Cool... it's the right one */ - t->flags |= SN_SCK_SEEN; - - /* If the cookie is in insert mode on a known server, we'll delete - * this occurrence because we'll insert another one later. - * We'll delete it too if the "indirect" option is set and we're in - * a direct access. */ - if (((t->srv) && (t->proxy->options & PR_O_COOK_INS)) || - ((t->flags & SN_DIRECT) && (t->proxy->options & PR_O_COOK_IND))) { - /* this header must be deleted */ - delete_header = 1; - t->flags |= SN_SCK_DELETED; - } - else if ((t->srv) && (t->proxy->options & PR_O_COOK_RW)) { - /* replace bytes p3->p4 with the cookie name associated - * with this server since we know it. - */ - buffer_replace2(rep, p3, p4, t->srv->cookie, t->srv->cklen); - t->flags |= SN_SCK_INSERTED | SN_SCK_DELETED; - } - else if ((t->srv) && (t->proxy->options & PR_O_COOK_PFX)) { - /* insert the cookie name associated with this server - * before existing cookie, and insert a delimitor between them.. - */ - buffer_replace2(rep, p3, p3, t->srv->cookie, t->srv->cklen + 1); - p3[t->srv->cklen] = COOKIE_DELIM; - t->flags |= SN_SCK_INSERTED | SN_SCK_DELETED; - } - break; - } - - /* first, let's see if the cookie is our appcookie*/ - if ((t->proxy->appsession_name != NULL) && - (memcmp(p1, t->proxy->appsession_name, p2 - p1) == 0)) { - - /* Cool... it's the right one */ - - size_t server_id_len = strlen(t->srv->id) + 1; - asession_temp = &local_asession; - - if ((asession_temp->sessid = pool_alloc_from(apools.sessid, apools.ses_msize)) == NULL) { - Alert("Not enought Memory process_srv():asession->sessid:malloc().\n"); - send_log(t->proxy, LOG_ALERT, "Not enought Memory process_srv():asession->sessid:malloc().\n"); - } - memcpy(asession_temp->sessid, p3, t->proxy->appsession_len); - asession_temp->sessid[t->proxy->appsession_len] = 0; - asession_temp->serverid = NULL; - - /* only do insert, if lookup fails */ - if (chtbl_lookup(&(t->proxy->htbl_proxy), (void *) &asession_temp) != 0) { - if ((asession_temp = pool_alloc(appsess)) == NULL) { - Alert("Not enought Memory process_srv():asession:calloc().\n"); - send_log(t->proxy, LOG_ALERT, "Not enought Memory process_srv():asession:calloc().\n"); - return 0; - } - asession_temp->sessid = local_asession.sessid; - asession_temp->serverid = local_asession.serverid; - chtbl_insert(&(t->proxy->htbl_proxy), (void *) asession_temp); - }/* end if (chtbl_lookup()) */ - else { - /* free wasted memory */ - pool_free_to(apools.sessid, local_asession.sessid); - } /* end else from if (chtbl_lookup()) */ - - if (asession_temp->serverid == NULL) { - if ((asession_temp->serverid = pool_alloc_from(apools.serverid, apools.ser_msize)) == NULL) { - Alert("Not enought Memory process_srv():asession->sessid:malloc().\n"); - send_log(t->proxy, LOG_ALERT, "Not enought Memory process_srv():asession->sessid:malloc().\n"); - } - asession_temp->serverid[0] = '\0'; - } - - if (asession_temp->serverid[0] == '\0') - memcpy(asession_temp->serverid,t->srv->id,server_id_len); - - tv_delayfrom(&asession_temp->expire, &now, t->proxy->appsession_timeout); - -#if defined(DEBUG_HASH) - print_table(&(t->proxy->htbl_proxy)); -#endif - break; - }/* end if ((t->proxy->appsession_name != NULL) ... */ - else { - // fprintf(stderr,"Ignoring unknown cookie : "); - // write(2, p1, p2-p1); - // fprintf(stderr," = "); - // write(2, p3, p4-p3); - // fprintf(stderr,"\n"); - } - break; /* we don't want to loop again since there cannot be another cookie on the same line */ - } /* we're now at the end of the cookie value */ - } /* end of cookie processing */ - - /* check for any set-cookie in case we check for cacheability */ - if (!delete_header && !(t->flags & SN_SCK_ANY) && - (t->proxy->options & PR_O_CHK_CACHE) && - (strncasecmp(rep->h, "Set-Cookie: ", 12) == 0)) { - t->flags |= SN_SCK_ANY; - } - - /* let's look if we have to delete this header */ - if (delete_header && !(t->flags & SN_SVDENY)) - buffer_replace2(rep, rep->h, rep->lr, "", 0); - - rep->h = rep->lr; - } /* while (rep->lr < rep->r) */ - - /* end of header processing (even if incomplete) */ - - if ((rep->l < rep->rlim - rep->data) && ! FD_ISSET(t->srv_fd, StaticReadEvent)) { - /* fd in StaticReadEvent was disabled, perhaps because of a previous buffer - * full. We cannot loop here since event_srv_read will disable it only if - * rep->l == rlim-data - */ - FD_SET(t->srv_fd, StaticReadEvent); - if (t->proxy->srvtimeout) - tv_delayfrom(&t->srexpire, &now, t->proxy->srvtimeout); - else - tv_eternity(&t->srexpire); - } - - /* read error, write error */ - if (t->res_sw == RES_ERROR || t->res_sr == RES_ERROR) { - tv_eternity(&t->srexpire); - tv_eternity(&t->swexpire); - fd_delete(t->srv_fd); - if (t->srv) { - t->srv->cur_sess--; - t->srv->failed_resp++; - } - t->proxy->failed_resp++; - - t->srv_state = SV_STCLOSE; - t->logs.status = 502; - client_return(t, t->proxy->errmsg.len502, t->proxy->errmsg.msg502); - if (!(t->flags & SN_ERR_MASK)) - t->flags |= SN_ERR_SRVCL; - if (!(t->flags & SN_FINST_MASK)) - t->flags |= SN_FINST_H; - /* We used to have a free connection slot. Since we'll never use it, - * we have to inform the server that it may be used by another session. - */ - if (may_dequeue_tasks(t->srv, t->proxy)) - task_wakeup(&rq, t->srv->queue_mgt); - - return 1; - } - /* end of client write or end of server read. - * since we are in header mode, if there's no space left for headers, we - * won't be able to free more later, so the session will never terminate. - */ - else if (t->res_sr == RES_NULL || c == CL_STSHUTW || c == CL_STCLOSE || rep->l >= rep->rlim - rep->data) { - FD_CLR(t->srv_fd, StaticReadEvent); - tv_eternity(&t->srexpire); - shutdown(t->srv_fd, SHUT_RD); - t->srv_state = SV_STSHUTR; - //fprintf(stderr,"%p:%s(%d), c=%d, s=%d\n", t, __FUNCTION__, __LINE__, t->cli_state, t->cli_state); - return 1; - } - /* read timeout : return a 504 to the client. - */ - else if (FD_ISSET(t->srv_fd, StaticReadEvent) && tv_cmp2_ms(&t->srexpire, &now) <= 0) { - tv_eternity(&t->srexpire); - tv_eternity(&t->swexpire); - fd_delete(t->srv_fd); - if (t->srv) { - t->srv->cur_sess--; - t->srv->failed_resp++; - } - t->proxy->failed_resp++; - t->srv_state = SV_STCLOSE; - t->logs.status = 504; - client_return(t, t->proxy->errmsg.len504, t->proxy->errmsg.msg504); - if (!(t->flags & SN_ERR_MASK)) - t->flags |= SN_ERR_SRVTO; - if (!(t->flags & SN_FINST_MASK)) - t->flags |= SN_FINST_H; - /* We used to have a free connection slot. Since we'll never use it, - * we have to inform the server that it may be used by another session. - */ - if (may_dequeue_tasks(t->srv, t->proxy)) - task_wakeup(&rq, t->srv->queue_mgt); - - return 1; - } - /* last client read and buffer empty */ - /* FIXME!!! here, we don't want to switch to SHUTW if the - * client shuts read too early, because we may still have - * some work to do on the headers. - * The side-effect is that if the client completely closes its - * connection during SV_STHEADER, the connection to the server - * is kept until a response comes back or the timeout is reached. - */ - else if ((/*c == CL_STSHUTR ||*/ c == CL_STCLOSE) && (req->l == 0)) { - FD_CLR(t->srv_fd, StaticWriteEvent); - tv_eternity(&t->swexpire); - - /* We must ensure that the read part is still alive when switching - * to shutw */ - FD_SET(t->srv_fd, StaticReadEvent); - if (t->proxy->srvtimeout) - tv_delayfrom(&t->srexpire, &now, t->proxy->srvtimeout); - - shutdown(t->srv_fd, SHUT_WR); - t->srv_state = SV_STSHUTW; - return 1; - } - /* write timeout */ - /* FIXME!!! here, we don't want to switch to SHUTW if the - * client shuts read too early, because we may still have - * some work to do on the headers. - */ - else if (FD_ISSET(t->srv_fd, StaticWriteEvent) && tv_cmp2_ms(&t->swexpire, &now) <= 0) { - FD_CLR(t->srv_fd, StaticWriteEvent); - tv_eternity(&t->swexpire); - shutdown(t->srv_fd, SHUT_WR); - /* We must ensure that the read part is still alive when switching - * to shutw */ - FD_SET(t->srv_fd, StaticReadEvent); - if (t->proxy->srvtimeout) - tv_delayfrom(&t->srexpire, &now, t->proxy->srvtimeout); - - /* We must ensure that the read part is still alive when switching - * to shutw */ - FD_SET(t->srv_fd, StaticReadEvent); - if (t->proxy->srvtimeout) - tv_delayfrom(&t->srexpire, &now, t->proxy->srvtimeout); - - t->srv_state = SV_STSHUTW; - if (!(t->flags & SN_ERR_MASK)) - t->flags |= SN_ERR_SRVTO; - if (!(t->flags & SN_FINST_MASK)) - t->flags |= SN_FINST_H; - return 1; - } - - if (req->l == 0) { - if (FD_ISSET(t->srv_fd, StaticWriteEvent)) { - FD_CLR(t->srv_fd, StaticWriteEvent); /* stop writing */ - tv_eternity(&t->swexpire); - } - } - else { /* client buffer not empty */ - if (! FD_ISSET(t->srv_fd, StaticWriteEvent)) { - FD_SET(t->srv_fd, StaticWriteEvent); /* restart writing */ - if (t->proxy->srvtimeout) { - tv_delayfrom(&t->swexpire, &now, t->proxy->srvtimeout); - /* FIXME: to prevent the server from expiring read timeouts during writes, - * we refresh it. */ - t->srexpire = t->swexpire; - } - else - tv_eternity(&t->swexpire); - } - } - - /* be nice with the client side which would like to send a complete header - * FIXME: COMPLETELY BUGGY !!! not all headers may be processed because the client - * would read all remaining data at once ! The client should not write past rep->lr - * when the server is in header state. - */ - //return header_processed; - return t->srv_state != SV_STHEADERS; - } - else if (s == SV_STDATA) { - /* read or write error */ - if (t->res_sw == RES_ERROR || t->res_sr == RES_ERROR) { - tv_eternity(&t->srexpire); - tv_eternity(&t->swexpire); - fd_delete(t->srv_fd); - if (t->srv) { - t->srv->cur_sess--; - t->srv->failed_resp++; - } - t->proxy->failed_resp++; - t->srv_state = SV_STCLOSE; - if (!(t->flags & SN_ERR_MASK)) - t->flags |= SN_ERR_SRVCL; - if (!(t->flags & SN_FINST_MASK)) - t->flags |= SN_FINST_D; - /* We used to have a free connection slot. Since we'll never use it, - * we have to inform the server that it may be used by another session. - */ - if (may_dequeue_tasks(t->srv, t->proxy)) - task_wakeup(&rq, t->srv->queue_mgt); - - return 1; - } - /* last read, or end of client write */ - else if (t->res_sr == RES_NULL || c == CL_STSHUTW || c == CL_STCLOSE) { - FD_CLR(t->srv_fd, StaticReadEvent); - tv_eternity(&t->srexpire); - shutdown(t->srv_fd, SHUT_RD); - t->srv_state = SV_STSHUTR; - //fprintf(stderr,"%p:%s(%d), c=%d, s=%d\n", t, __FUNCTION__, __LINE__, t->cli_state, t->cli_state); - return 1; - } - /* end of client read and no more data to send */ - else if ((c == CL_STSHUTR || c == CL_STCLOSE) && (req->l == 0)) { - FD_CLR(t->srv_fd, StaticWriteEvent); - tv_eternity(&t->swexpire); - shutdown(t->srv_fd, SHUT_WR); - /* We must ensure that the read part is still alive when switching - * to shutw */ - FD_SET(t->srv_fd, StaticReadEvent); - if (t->proxy->srvtimeout) - tv_delayfrom(&t->srexpire, &now, t->proxy->srvtimeout); - - t->srv_state = SV_STSHUTW; - return 1; - } - /* read timeout */ - else if (tv_cmp2_ms(&t->srexpire, &now) <= 0) { - FD_CLR(t->srv_fd, StaticReadEvent); - tv_eternity(&t->srexpire); - shutdown(t->srv_fd, SHUT_RD); - t->srv_state = SV_STSHUTR; - if (!(t->flags & SN_ERR_MASK)) - t->flags |= SN_ERR_SRVTO; - if (!(t->flags & SN_FINST_MASK)) - t->flags |= SN_FINST_D; - return 1; - } - /* write timeout */ - else if (tv_cmp2_ms(&t->swexpire, &now) <= 0) { - FD_CLR(t->srv_fd, StaticWriteEvent); - tv_eternity(&t->swexpire); - shutdown(t->srv_fd, SHUT_WR); - /* We must ensure that the read part is still alive when switching - * to shutw */ - FD_SET(t->srv_fd, StaticReadEvent); - if (t->proxy->srvtimeout) - tv_delayfrom(&t->srexpire, &now, t->proxy->srvtimeout); - t->srv_state = SV_STSHUTW; - if (!(t->flags & SN_ERR_MASK)) - t->flags |= SN_ERR_SRVTO; - if (!(t->flags & SN_FINST_MASK)) - t->flags |= SN_FINST_D; - return 1; - } - - /* recompute request time-outs */ - if (req->l == 0) { - if (FD_ISSET(t->srv_fd, StaticWriteEvent)) { - FD_CLR(t->srv_fd, StaticWriteEvent); /* stop writing */ - tv_eternity(&t->swexpire); - } - } - else { /* buffer not empty, there are still data to be transferred */ - if (! FD_ISSET(t->srv_fd, StaticWriteEvent)) { - FD_SET(t->srv_fd, StaticWriteEvent); /* restart writing */ - if (t->proxy->srvtimeout) { - tv_delayfrom(&t->swexpire, &now, t->proxy->srvtimeout); - /* FIXME: to prevent the server from expiring read timeouts during writes, - * we refresh it. */ - t->srexpire = t->swexpire; - } - else - tv_eternity(&t->swexpire); - } - } - - /* recompute response time-outs */ - if (rep->l == BUFSIZE) { /* no room to read more data */ - if (FD_ISSET(t->srv_fd, StaticReadEvent)) { - FD_CLR(t->srv_fd, StaticReadEvent); - tv_eternity(&t->srexpire); - } - } - else { - if (! FD_ISSET(t->srv_fd, StaticReadEvent)) { - FD_SET(t->srv_fd, StaticReadEvent); - if (t->proxy->srvtimeout) - tv_delayfrom(&t->srexpire, &now, t->proxy->srvtimeout); - else - tv_eternity(&t->srexpire); - } - } - - return 0; /* other cases change nothing */ - } - else if (s == SV_STSHUTR) { - if (t->res_sw == RES_ERROR) { - //FD_CLR(t->srv_fd, StaticWriteEvent); - tv_eternity(&t->swexpire); - fd_delete(t->srv_fd); - if (t->srv) { - t->srv->cur_sess--; - t->srv->failed_resp++; - } - t->proxy->failed_resp++; - //close(t->srv_fd); - t->srv_state = SV_STCLOSE; - if (!(t->flags & SN_ERR_MASK)) - t->flags |= SN_ERR_SRVCL; - if (!(t->flags & SN_FINST_MASK)) - t->flags |= SN_FINST_D; - /* We used to have a free connection slot. Since we'll never use it, - * we have to inform the server that it may be used by another session. - */ - if (may_dequeue_tasks(t->srv, t->proxy)) - task_wakeup(&rq, t->srv->queue_mgt); - - return 1; - } - else if ((c == CL_STSHUTR || c == CL_STCLOSE) && (req->l == 0)) { - //FD_CLR(t->srv_fd, StaticWriteEvent); - tv_eternity(&t->swexpire); - fd_delete(t->srv_fd); - if (t->srv) - t->srv->cur_sess--; - //close(t->srv_fd); - t->srv_state = SV_STCLOSE; - /* We used to have a free connection slot. Since we'll never use it, - * we have to inform the server that it may be used by another session. - */ - if (may_dequeue_tasks(t->srv, t->proxy)) - task_wakeup(&rq, t->srv->queue_mgt); - - return 1; - } - else if (tv_cmp2_ms(&t->swexpire, &now) <= 0) { - //FD_CLR(t->srv_fd, StaticWriteEvent); - tv_eternity(&t->swexpire); - fd_delete(t->srv_fd); - if (t->srv) - t->srv->cur_sess--; - //close(t->srv_fd); - t->srv_state = SV_STCLOSE; - if (!(t->flags & SN_ERR_MASK)) - t->flags |= SN_ERR_SRVTO; - if (!(t->flags & SN_FINST_MASK)) - t->flags |= SN_FINST_D; - /* We used to have a free connection slot. Since we'll never use it, - * we have to inform the server that it may be used by another session. - */ - if (may_dequeue_tasks(t->srv, t->proxy)) - task_wakeup(&rq, t->srv->queue_mgt); - - return 1; - } - else if (req->l == 0) { - if (FD_ISSET(t->srv_fd, StaticWriteEvent)) { - FD_CLR(t->srv_fd, StaticWriteEvent); /* stop writing */ - tv_eternity(&t->swexpire); - } - } - else { /* buffer not empty */ - if (! FD_ISSET(t->srv_fd, StaticWriteEvent)) { - FD_SET(t->srv_fd, StaticWriteEvent); /* restart writing */ - if (t->proxy->srvtimeout) { - tv_delayfrom(&t->swexpire, &now, t->proxy->srvtimeout); - /* FIXME: to prevent the server from expiring read timeouts during writes, - * we refresh it. */ - t->srexpire = t->swexpire; - } - else - tv_eternity(&t->swexpire); - } - } - return 0; - } - else if (s == SV_STSHUTW) { - if (t->res_sr == RES_ERROR) { - //FD_CLR(t->srv_fd, StaticReadEvent); - tv_eternity(&t->srexpire); - fd_delete(t->srv_fd); - if (t->srv) { - t->srv->cur_sess--; - t->srv->failed_resp++; - } - t->proxy->failed_resp++; - //close(t->srv_fd); - t->srv_state = SV_STCLOSE; - if (!(t->flags & SN_ERR_MASK)) - t->flags |= SN_ERR_SRVCL; - if (!(t->flags & SN_FINST_MASK)) - t->flags |= SN_FINST_D; - /* We used to have a free connection slot. Since we'll never use it, - * we have to inform the server that it may be used by another session. - */ - if (may_dequeue_tasks(t->srv, t->proxy)) - task_wakeup(&rq, t->srv->queue_mgt); - - return 1; - } - else if (t->res_sr == RES_NULL || c == CL_STSHUTW || c == CL_STCLOSE) { - //FD_CLR(t->srv_fd, StaticReadEvent); - tv_eternity(&t->srexpire); - fd_delete(t->srv_fd); - if (t->srv) - t->srv->cur_sess--; - //close(t->srv_fd); - t->srv_state = SV_STCLOSE; - /* We used to have a free connection slot. Since we'll never use it, - * we have to inform the server that it may be used by another session. - */ - if (may_dequeue_tasks(t->srv, t->proxy)) - task_wakeup(&rq, t->srv->queue_mgt); - - return 1; - } - else if (tv_cmp2_ms(&t->srexpire, &now) <= 0) { - //FD_CLR(t->srv_fd, StaticReadEvent); - tv_eternity(&t->srexpire); - fd_delete(t->srv_fd); - if (t->srv) - t->srv->cur_sess--; - //close(t->srv_fd); - t->srv_state = SV_STCLOSE; - if (!(t->flags & SN_ERR_MASK)) - t->flags |= SN_ERR_SRVTO; - if (!(t->flags & SN_FINST_MASK)) - t->flags |= SN_FINST_D; - /* We used to have a free connection slot. Since we'll never use it, - * we have to inform the server that it may be used by another session. - */ - if (may_dequeue_tasks(t->srv, t->proxy)) - task_wakeup(&rq, t->srv->queue_mgt); - - return 1; - } - else if (rep->l == BUFSIZE) { /* no room to read more data */ - if (FD_ISSET(t->srv_fd, StaticReadEvent)) { - FD_CLR(t->srv_fd, StaticReadEvent); - tv_eternity(&t->srexpire); - } - } - else { - if (! FD_ISSET(t->srv_fd, StaticReadEvent)) { - FD_SET(t->srv_fd, StaticReadEvent); - if (t->proxy->srvtimeout) - tv_delayfrom(&t->srexpire, &now, t->proxy->srvtimeout); - else - tv_eternity(&t->srexpire); - } - } - return 0; - } - else { /* SV_STCLOSE : nothing to do */ - if ((global.mode & MODE_DEBUG) && (!(global.mode & MODE_QUIET) || (global.mode & MODE_VERBOSE))) { - int len; - len = sprintf(trash, "%08x:%s.srvcls[%04x:%04x]\n", t->uniq_id, t->proxy->id, (unsigned short)t->cli_fd, (unsigned short)t->srv_fd); - write(1, trash, len); - } - return 0; - } - return 0; -} - - -/* Processes the client and server jobs of a session task, then - * puts it back to the wait queue in a clean state, or - * cleans up its resources if it must be deleted. Returns - * the time the task accepts to wait, or TIME_ETERNITY for - * infinity. - */ -int process_session(struct task *t) { - struct session *s = t->context; - int fsm_resync = 0; - - do { - fsm_resync = 0; - //fprintf(stderr,"before_cli:cli=%d, srv=%d\n", s->cli_state, s->srv_state); - fsm_resync |= process_cli(s); - //fprintf(stderr,"cli/srv:cli=%d, srv=%d\n", s->cli_state, s->srv_state); - fsm_resync |= process_srv(s); - //fprintf(stderr,"after_srv:cli=%d, srv=%d\n", s->cli_state, s->srv_state); - } while (fsm_resync); - - if (s->cli_state != CL_STCLOSE || s->srv_state != SV_STCLOSE) { - struct timeval min1, min2; - s->res_cw = s->res_cr = s->res_sw = s->res_sr = RES_SILENT; - - tv_min(&min1, &s->crexpire, &s->cwexpire); - tv_min(&min2, &s->srexpire, &s->swexpire); - tv_min(&min1, &min1, &s->cnexpire); - tv_min(&t->expire, &min1, &min2); - - /* restore t to its place in the task list */ - task_queue(t); - -#ifdef DEBUG_FULL - /* DEBUG code : this should never ever happen, otherwise it indicates - * that a task still has something to do and will provoke a quick loop. - */ - if (tv_remain2(&now, &t->expire) <= 0) - exit(100); -#endif - - return tv_remain2(&now, &t->expire); /* nothing more to do */ - } - - s->proxy->nbconn--; - actconn--; - - if ((global.mode & MODE_DEBUG) && (!(global.mode & MODE_QUIET) || (global.mode & MODE_VERBOSE))) { - int len; - len = sprintf(trash, "%08x:%s.closed[%04x:%04x]\n", s->uniq_id, s->proxy->id, (unsigned short)s->cli_fd, (unsigned short)s->srv_fd); - write(1, trash, len); - } - - s->logs.t_close = tv_diff(&s->logs.tv_accept, &now); - if (s->rep != NULL) - s->logs.bytes = s->rep->total; - - /* let's do a final log if we need it */ - if (s->logs.logwait && (!(s->proxy->options & PR_O_NULLNOLOG) || s->req->total)) - sess_log(s); - - /* the task MUST not be in the run queue anymore */ - task_delete(t); - session_free(s); - task_free(t); - return TIME_ETERNITY; /* rest in peace for eternity */ -} - - -/* Sets server down, notifies by all available means, recounts the - * remaining servers on the proxy and transfers queued sessions whenever - * possible to other servers. - */ -void set_server_down(struct server *s) { - struct pendconn *pc, *pc_bck, *pc_end; - struct session *sess; - int xferred; - - s->state &= ~SRV_RUNNING; - - if (s->health == s->rise) { - recount_servers(s->proxy); - recalc_server_map(s->proxy); - - /* we might have sessions queued on this server and waiting for - * a connection. Those which are redispatchable will be queued - * to another server or to the proxy itself. - */ - xferred = 0; - FOREACH_ITEM_SAFE(pc, pc_bck, &s->pendconns, pc_end, struct pendconn *, list) { - sess = pc->sess; - if ((sess->proxy->options & PR_O_REDISP)) { - /* The REDISP option was specified. We will ignore - * cookie and force to balance or use the dispatcher. - */ - sess->flags &= ~(SN_DIRECT | SN_ASSIGNED | SN_ADDR_SET); - sess->srv = NULL; /* it's left to the dispatcher to choose a server */ - if ((sess->flags & SN_CK_MASK) == SN_CK_VALID) { - sess->flags &= ~SN_CK_MASK; - sess->flags |= SN_CK_DOWN; - } - pendconn_free(pc); - task_wakeup(&rq, sess->task); - xferred++; - } - } - - sprintf(trash, "%sServer %s/%s is DOWN. %d active and %d backup servers left.%s" - " %d sessions active, %d requeued, %d remaining in queue.\n", - s->state & SRV_BACKUP ? "Backup " : "", - s->proxy->id, s->id, s->proxy->srv_act, s->proxy->srv_bck, - (s->proxy->srv_bck && !s->proxy->srv_act) ? " Running on backup." : "", - s->cur_sess, xferred, s->nbpend); - - Warning("%s", trash); - send_log(s->proxy, LOG_ALERT, "%s", trash); - - if (s->proxy->srv_bck == 0 && s->proxy->srv_act == 0) { - Alert("Proxy %s has no server available !\n", s->proxy->id); - send_log(s->proxy, LOG_EMERG, "Proxy %s has no server available !\n", s->proxy->id); - } - s->down_trans++; - } - s->health = 0; /* failure */ -} - - - -/* - * manages a server health-check. Returns - * the time the task accepts to wait, or TIME_ETERNITY for infinity. - */ -int process_chk(struct task *t) { - struct server *s = t->context; - struct sockaddr_in sa; - int fd; - - //fprintf(stderr, "process_chk: task=%p\n", t); - - new_chk: - fd = s->curfd; - if (fd < 0) { /* no check currently running */ - //fprintf(stderr, "process_chk: 2\n"); - if (tv_cmp2_ms(&t->expire, &now) > 0) { /* not good time yet */ - task_queue(t); /* restore t to its place in the task list */ - return tv_remain2(&now, &t->expire); - } - - /* we don't send any health-checks when the proxy is stopped or when - * the server should not be checked. - */ - if (!(s->state & SRV_CHECKED) || s->proxy->state == PR_STSTOPPED) { - while (tv_cmp2_ms(&t->expire, &now) <= 0) - tv_delayfrom(&t->expire, &t->expire, s->inter); - task_queue(t); /* restore t to its place in the task list */ - return tv_remain2(&now, &t->expire); - } - - /* we'll initiate a new check */ - s->result = 0; /* no result yet */ - if ((fd = socket(AF_INET, SOCK_STREAM, IPPROTO_TCP)) != -1) { - if ((fd < global.maxsock) && - (fcntl(fd, F_SETFL, O_NONBLOCK) != -1) && - (setsockopt(fd, IPPROTO_TCP, TCP_NODELAY, (char *) &one, sizeof(one)) != -1)) { - //fprintf(stderr, "process_chk: 3\n"); - - /* we'll connect to the check port on the server */ - sa = s->addr; - sa.sin_port = htons(s->check_port); - - /* allow specific binding : - * - server-specific at first - * - proxy-specific next - */ - if (s->state & SRV_BIND_SRC) { - setsockopt(fd, SOL_SOCKET, SO_REUSEADDR, (char *) &one, sizeof(one)); - if (bind(fd, (struct sockaddr *)&s->source_addr, sizeof(s->source_addr)) == -1) { - Alert("Cannot bind to source address before connect() for server %s/%s. Aborting.\n", - s->proxy->id, s->id); - s->result = -1; - } - } - else if (s->proxy->options & PR_O_BIND_SRC) { - setsockopt(fd, SOL_SOCKET, SO_REUSEADDR, (char *) &one, sizeof(one)); - if (bind(fd, (struct sockaddr *)&s->proxy->source_addr, sizeof(s->proxy->source_addr)) == -1) { - Alert("Cannot bind to source address before connect() for proxy %s. Aborting.\n", - s->proxy->id); - s->result = -1; - } - } - - if (!s->result) { - if ((connect(fd, (struct sockaddr *)&sa, sizeof(sa)) != -1) || (errno == EINPROGRESS)) { - /* OK, connection in progress or established */ - - //fprintf(stderr, "process_chk: 4\n"); - - s->curfd = fd; /* that's how we know a test is in progress ;-) */ - fdtab[fd].owner = t; - fdtab[fd].read = &event_srv_chk_r; - fdtab[fd].write = &event_srv_chk_w; - fdtab[fd].state = FD_STCONN; /* connection in progress */ - FD_SET(fd, StaticWriteEvent); /* for connect status */ -#ifdef DEBUG_FULL - assert (!FD_ISSET(fd, StaticReadEvent)); -#endif - fd_insert(fd); - /* FIXME: we allow up to for a connection to establish, but we should use another parameter */ - tv_delayfrom(&t->expire, &now, s->inter); - task_queue(t); /* restore t to its place in the task list */ - return tv_remain(&now, &t->expire); - } - else if (errno != EALREADY && errno != EISCONN && errno != EAGAIN) { - s->result = -1; /* a real error */ - } - } - } - close(fd); /* socket creation error */ - } - - if (!s->result) { /* nothing done */ - //fprintf(stderr, "process_chk: 6\n"); - while (tv_cmp2_ms(&t->expire, &now) <= 0) - tv_delayfrom(&t->expire, &t->expire, s->inter); - goto new_chk; /* may be we should initialize a new check */ - } - - /* here, we have seen a failure */ - if (s->health > s->rise) { - s->health--; /* still good */ - s->failed_checks++; - } - else - set_server_down(s); - - //fprintf(stderr, "process_chk: 7\n"); - /* FIXME: we allow up to for a connection to establish, but we should use another parameter */ - while (tv_cmp2_ms(&t->expire, &now) <= 0) - tv_delayfrom(&t->expire, &t->expire, s->inter); - goto new_chk; - } - else { - //fprintf(stderr, "process_chk: 8\n"); - /* there was a test running */ - if (s->result > 0) { /* good server detected */ - //fprintf(stderr, "process_chk: 9\n"); - s->health++; /* was bad, stays for a while */ - if (s->health >= s->rise) { - s->state |= SRV_RUNNING; - - if (s->health == s->rise) { - int xferred; - - recount_servers(s->proxy); - recalc_server_map(s->proxy); - - /* check if we can handle some connections queued at the proxy. We - * will take as many as we can handle. - */ - for (xferred = 0; !s->maxconn || xferred < srv_dynamic_maxconn(s); xferred++) { - struct session *sess; - struct pendconn *p; - - p = pendconn_from_px(s->proxy); - if (!p) - break; - p->sess->srv = s; - sess = p->sess; - pendconn_free(p); - task_wakeup(&rq, sess->task); - } - - sprintf(trash, - "%sServer %s/%s is UP. %d active and %d backup servers online.%s" - " %d sessions requeued, %d total in queue.\n", - s->state & SRV_BACKUP ? "Backup " : "", - s->proxy->id, s->id, s->proxy->srv_act, s->proxy->srv_bck, - (s->proxy->srv_bck && !s->proxy->srv_act) ? " Running on backup." : "", - xferred, s->nbpend); - - Warning("%s", trash); - send_log(s->proxy, LOG_NOTICE, "%s", trash); - } - - s->health = s->rise + s->fall - 1; /* OK now */ - } - s->curfd = -1; /* no check running anymore */ - //FD_CLR(fd, StaticWriteEvent); - fd_delete(fd); - while (tv_cmp2_ms(&t->expire, &now) <= 0) - tv_delayfrom(&t->expire, &t->expire, s->inter); - goto new_chk; - } - else if (s->result < 0 || tv_cmp2_ms(&t->expire, &now) <= 0) { - //fprintf(stderr, "process_chk: 10\n"); - /* failure or timeout detected */ - if (s->health > s->rise) { - s->health--; /* still good */ - s->failed_checks++; - } - else - set_server_down(s); - s->curfd = -1; - //FD_CLR(fd, StaticWriteEvent); - fd_delete(fd); - while (tv_cmp2_ms(&t->expire, &now) <= 0) - tv_delayfrom(&t->expire, &t->expire, s->inter); - goto new_chk; - } - /* if result is 0 and there's no timeout, we have to wait again */ - } - //fprintf(stderr, "process_chk: 11\n"); - s->result = 0; - task_queue(t); /* restore t to its place in the task list */ - return tv_remain2(&now, &t->expire); -} - - - -/* - * Manages a server's connection queue. If woken up, will try to dequeue as - * many pending sessions as possible, and wake them up. The task has nothing - * else to do, so it always returns TIME_ETERNITY. - */ -int process_srv_queue(struct task *t) { - struct server *s = (struct server*)t->context; - struct proxy *p = s->proxy; - int xferred; - - /* First, check if we can handle some connections queued at the proxy. We - * will take as many as we can handle. - */ - for (xferred = 0; s->cur_sess + xferred < srv_dynamic_maxconn(s); xferred++) { - struct session *sess; - - sess = pendconn_get_next_sess(s, p); - if (sess == NULL) - break; - task_wakeup(&rq, sess->task); - } - - return TIME_ETERNITY; -} - -#if STATTIME > 0 -int stats(void); -#endif - -/* - * This does 4 things : - * - wake up all expired tasks - * - call all runnable tasks - * - call maintain_proxies() to enable/disable the listeners - * - return the delay till next event in ms, -1 = wait indefinitely - * Note: this part should be rewritten with the O(ln(n)) scheduler. - * - */ - -int process_runnable_tasks() { - int next_time; - int time2; - struct task *t, *tnext; - - next_time = TIME_ETERNITY; /* set the timer to wait eternally first */ - - /* look for expired tasks and add them to the run queue. - */ - tnext = ((struct task *)LIST_HEAD(wait_queue[0]))->next; - while ((t = tnext) != LIST_HEAD(wait_queue[0])) { /* we haven't looped ? */ - tnext = t->next; - if (t->state & TASK_RUNNING) - continue; - - if (tv_iseternity(&t->expire)) - continue; - - /* wakeup expired entries. It doesn't matter if they are - * already running because of a previous event - */ - if (tv_cmp_ms(&t->expire, &now) <= 0) { - task_wakeup(&rq, t); - } - else { - /* first non-runnable task. Use its expiration date as an upper bound */ - int temp_time = tv_remain(&now, &t->expire); - if (temp_time) - next_time = temp_time; - break; - } - } - - /* process each task in the run queue now. Each task may be deleted - * since we only use the run queue's head. Note that any task can be - * woken up by any other task and it will be processed immediately - * after as it will be queued on the run queue's head. - */ - while ((t = rq) != NULL) { - int temp_time; - - task_sleep(&rq, t); - temp_time = t->process(t); - next_time = MINTIME(temp_time, next_time); - } - - /* maintain all proxies in a consistent state. This should quickly become a task */ - time2 = maintain_proxies(); - return MINTIME(time2, next_time); -} - - -#if defined(ENABLE_EPOLL) - -/* - * Main epoll() loop. - */ - -/* does 3 actions : - * 0 (POLL_LOOP_ACTION_INIT) : initializes necessary private structures - * 1 (POLL_LOOP_ACTION_RUN) : runs the loop - * 2 (POLL_LOOP_ACTION_CLEAN) : cleans up - * - * returns 0 if initialization failed, !0 otherwise. - */ - -int epoll_loop(int action) { - int next_time; - int status; - int fd; - - int fds, count; - int pr, pw, sr, sw; - unsigned rn, ro, wn, wo; /* read new, read old, write new, write old */ - struct epoll_event ev; - - /* private data */ - static struct epoll_event *epoll_events = NULL; - static int epoll_fd; - - if (action == POLL_LOOP_ACTION_INIT) { - epoll_fd = epoll_create(global.maxsock + 1); - if (epoll_fd < 0) - return 0; - else { - epoll_events = (struct epoll_event*) - calloc(1, sizeof(struct epoll_event) * global.maxsock); - PrevReadEvent = (fd_set *) - calloc(1, sizeof(fd_set) * (global.maxsock + FD_SETSIZE - 1) / FD_SETSIZE); - PrevWriteEvent = (fd_set *) - calloc(1, sizeof(fd_set) * (global.maxsock + FD_SETSIZE - 1) / FD_SETSIZE); - } - return 1; - } - else if (action == POLL_LOOP_ACTION_CLEAN) { - if (PrevWriteEvent) free(PrevWriteEvent); - if (PrevReadEvent) free(PrevReadEvent); - if (epoll_events) free(epoll_events); - close(epoll_fd); - epoll_fd = 0; - return 1; - } - - /* OK, it's POLL_LOOP_ACTION_RUN */ - - tv_now(&now); - - while (1) { - next_time = process_runnable_tasks(); - - /* stop when there's no connection left and we don't allow them anymore */ - if (!actconn && listeners == 0) - break; - -#if STATTIME > 0 - { - int time2; - time2 = stats(); - next_time = MINTIME(time2, next_time); - } -#endif - - for (fds = 0; (fds << INTBITS) < maxfd; fds++) { - - rn = ((int*)StaticReadEvent)[fds]; ro = ((int*)PrevReadEvent)[fds]; - wn = ((int*)StaticWriteEvent)[fds]; wo = ((int*)PrevWriteEvent)[fds]; - - if ((ro^rn) | (wo^wn)) { - for (count = 0, fd = fds << INTBITS; count < (1<> count) & 1; - pw = (wo >> count) & 1; - sr = (rn >> count) & 1; - sw = (wn >> count) & 1; -#else - pr = FD_ISSET(fd&((1< 0 - { - int time2; - time2 = stats(); - next_time = MINTIME(time2, next_time); - } -#endif - - - nbfd = 0; - for (fds = 0; (fds << INTBITS) < maxfd; fds++) { - - rn = ((int*)StaticReadEvent)[fds]; - wn = ((int*)StaticWriteEvent)[fds]; - - if ((rn|wn)) { - for (count = 0, fd = fds << INTBITS; count < (1<> count) & 1; - sw = (wn >> count) & 1; -#else - sr = FD_ISSET(fd&((1< 0 && count < nbfd; count++) { - fd = poll_events[count].fd; - - if (!(poll_events[count].revents & ( POLLOUT | POLLIN | POLLERR | POLLHUP ))) - continue; - - /* ok, we found one active fd */ - status--; - - if (FD_ISSET(fd, StaticReadEvent)) { - if (fdtab[fd].state == FD_STCLOSE) - continue; - if (poll_events[count].revents & ( POLLIN | POLLERR | POLLHUP )) - fdtab[fd].read(fd); - } - - if (FD_ISSET(fd, StaticWriteEvent)) { - if (fdtab[fd].state == FD_STCLOSE) - continue; - if (poll_events[count].revents & ( POLLOUT | POLLERR | POLLHUP )) - fdtab[fd].write(fd); - } - } - } - return 1; -} -#endif - - - -/* - * Main select() loop. - */ - -/* does 3 actions : - * 0 (POLL_LOOP_ACTION_INIT) : initializes necessary private structures - * 1 (POLL_LOOP_ACTION_RUN) : runs the loop - * 2 (POLL_LOOP_ACTION_CLEAN) : cleans up - * - * returns 0 if initialization failed, !0 otherwise. - */ - - -int select_loop(int action) { - int next_time; - int status; - int fd,i; - struct timeval delta; - int readnotnull, writenotnull; - static fd_set *ReadEvent = NULL, *WriteEvent = NULL; - - if (action == POLL_LOOP_ACTION_INIT) { - ReadEvent = (fd_set *) - calloc(1, sizeof(fd_set) * (global.maxsock + FD_SETSIZE - 1) / FD_SETSIZE); - WriteEvent = (fd_set *) - calloc(1, sizeof(fd_set) * (global.maxsock + FD_SETSIZE - 1) / FD_SETSIZE); - return 1; - } - else if (action == POLL_LOOP_ACTION_CLEAN) { - if (WriteEvent) free(WriteEvent); - if (ReadEvent) free(ReadEvent); - return 1; - } - - /* OK, it's POLL_LOOP_ACTION_RUN */ - - tv_now(&now); - - while (1) { - next_time = process_runnable_tasks(); - - /* stop when there's no connection left and we don't allow them anymore */ - if (!actconn && listeners == 0) - break; - -#if STATTIME > 0 - { - int time2; - time2 = stats(); - next_time = MINTIME(time2, next_time); - } -#endif - - if (next_time > 0) { /* FIXME */ - /* Convert to timeval */ - /* to avoid eventual select loops due to timer precision */ - next_time += SCHEDULER_RESOLUTION; - delta.tv_sec = next_time / 1000; - delta.tv_usec = (next_time % 1000) * 1000; - } - else if (next_time == 0) { /* allow select to return immediately when needed */ - delta.tv_sec = delta.tv_usec = 0; - } - - - /* let's restore fdset state */ - - readnotnull = 0; writenotnull = 0; - for (i = 0; i < (maxfd + FD_SETSIZE - 1)/(8*sizeof(int)); i++) { - readnotnull |= (*(((int*)ReadEvent)+i) = *(((int*)StaticReadEvent)+i)) != 0; - writenotnull |= (*(((int*)WriteEvent)+i) = *(((int*)StaticWriteEvent)+i)) != 0; - } - - // /* just a verification code, needs to be removed for performance */ - // for (i=0; i= 0) ? &delta : NULL); - - /* this is an experiment on the separation of the select work */ - // status = (readnotnull ? select(maxfd, ReadEvent, NULL, NULL, (next_time >= 0) ? &delta : NULL) : 0); - // status |= (writenotnull ? select(maxfd, NULL, WriteEvent, NULL, (next_time >= 0) ? &delta : NULL) : 0); - - tv_now(&now); - - if (status > 0) { /* must proceed with events */ - - int fds; - char count; - - for (fds = 0; (fds << INTBITS) < maxfd; fds++) - if ((((int *)(ReadEvent))[fds] | ((int *)(WriteEvent))[fds]) != 0) - for (count = 1< 0 -/* - * Display proxy statistics regularly. It is designed to be called from the - * select_loop(). - */ -int stats(void) { - static int lines; - static struct timeval nextevt; - static struct timeval lastevt; - static struct timeval starttime = {0,0}; - unsigned long totaltime, deltatime; - int ret; - - if (tv_cmp(&now, &nextevt) > 0) { - deltatime = (tv_diff(&lastevt, &now)?:1); - totaltime = (tv_diff(&starttime, &now)?:1); - - if (global.mode & MODE_STATS) { - if ((lines++ % 16 == 0) && !(global.mode & MODE_LOG)) - qfprintf(stderr, - "\n active total tsknew tskgood tskleft tskrght tsknsch tsklsch tskrsch\n"); - if (lines>1) { - qfprintf(stderr,"%07d %07d %07d %07d %07d %07d %07d %07d %07d\n", - actconn, totalconn, - stats_tsk_new, stats_tsk_good, - stats_tsk_left, stats_tsk_right, - stats_tsk_nsrch, stats_tsk_lsrch, stats_tsk_rsrch); - } - } - - tv_delayfrom(&nextevt, &now, STATTIME); - - lastevt=now; - } - ret = tv_remain(&now, &nextevt); - return ret; -} -#endif - - -/* - * this function enables proxies when there are enough free sessions, - * or stops them when the table is full. It is designed to be called from the - * select_loop(). It returns the time left before next expiration event - * during stop time, TIME_ETERNITY otherwise. - */ -static int maintain_proxies(void) { - struct proxy *p; - struct listener *l; - int tleft; /* time left */ - - p = proxy; - tleft = TIME_ETERNITY; /* infinite time */ - - /* if there are enough free sessions, we'll activate proxies */ - if (actconn < global.maxconn) { - while (p) { - if (p->nbconn < p->maxconn) { - if (p->state == PR_STIDLE) { - for (l = p->listen; l != NULL; l = l->next) { - FD_SET(l->fd, StaticReadEvent); - } - p->state = PR_STRUN; - } - } - else { - if (p->state == PR_STRUN) { - for (l = p->listen; l != NULL; l = l->next) { - FD_CLR(l->fd, StaticReadEvent); - } - p->state = PR_STIDLE; - } - } - p = p->next; - } - } - else { /* block all proxies */ - while (p) { - if (p->state == PR_STRUN) { - for (l = p->listen; l != NULL; l = l->next) { - FD_CLR(l->fd, StaticReadEvent); - } - p->state = PR_STIDLE; - } - p = p->next; - } - } - - if (stopping) { - p = proxy; - while (p) { - if (p->state != PR_STSTOPPED) { - int t; - t = tv_remain2(&now, &p->stop_time); - if (t == 0) { - Warning("Proxy %s stopped.\n", p->id); - send_log(p, LOG_WARNING, "Proxy %s stopped.\n", p->id); - - for (l = p->listen; l != NULL; l = l->next) { - fd_delete(l->fd); - listeners--; - } - p->state = PR_STSTOPPED; - } - else { - tleft = MINTIME(t, tleft); - } - } - p = p->next; - } - } - return tleft; -} - -/* - * this function disables health-check servers so that the process will quickly be ignored - * by load balancers. Note that if a proxy was already in the PAUSED state, then its grace - * time will not be used since it would already not listen anymore to the socket. - */ -static void soft_stop(void) { - struct proxy *p; - - stopping = 1; - p = proxy; - tv_now(&now); /* else, the old time before select will be used */ - while (p) { - if (p->state != PR_STSTOPPED) { - Warning("Stopping proxy %s in %d ms.\n", p->id, p->grace); - send_log(p, LOG_WARNING, "Stopping proxy %s in %d ms.\n", p->id, p->grace); - tv_delayfrom(&p->stop_time, &now, p->grace); - } - p = p->next; - } -} - -/* - * Linux unbinds the listen socket after a SHUT_RD, and ignores SHUT_WR. - * Solaris refuses either shutdown(). - * OpenBSD ignores SHUT_RD but closes upon SHUT_WR and refuses to rebind. - * So a common validation path involves SHUT_WR && listen && SHUT_RD. - * If disabling at least one listener returns an error, then the proxy - * state is set to PR_STERROR because we don't know how to resume from this. - */ -static void pause_proxy(struct proxy *p) { - struct listener *l; - for (l = p->listen; l != NULL; l = l->next) { - if (shutdown(l->fd, SHUT_WR) == 0 && listen(l->fd, p->maxconn) == 0 && - shutdown(l->fd, SHUT_RD) == 0) { - FD_CLR(l->fd, StaticReadEvent); - if (p->state != PR_STERROR) - p->state = PR_STPAUSED; - } - else - p->state = PR_STERROR; - } -} - -/* - * This function temporarily disables listening so that another new instance - * can start listening. It is designed to be called upon reception of a - * SIGTTOU, after which either a SIGUSR1 can be sent to completely stop - * the proxy, or a SIGTTIN can be sent to listen again. - */ -static void pause_proxies(void) { - int err; - struct proxy *p; - - err = 0; - p = proxy; - tv_now(&now); /* else, the old time before select will be used */ - while (p) { - if (p->state != PR_STERROR && p->state != PR_STSTOPPED && p->state != PR_STPAUSED) { - Warning("Pausing proxy %s.\n", p->id); - send_log(p, LOG_WARNING, "Pausing proxy %s.\n", p->id); - pause_proxy(p); - if (p->state != PR_STPAUSED) { - err |= 1; - Warning("Proxy %s failed to enter pause mode.\n", p->id); - send_log(p, LOG_WARNING, "Proxy %s failed to enter pause mode.\n", p->id); - } - } - p = p->next; - } - if (err) { - Warning("Some proxies refused to pause, performing soft stop now.\n"); - send_log(p, LOG_WARNING, "Some proxies refused to pause, performing soft stop now.\n"); - soft_stop(); - } -} - - -/* - * This function reactivates listening. This can be used after a call to - * sig_pause(), for example when a new instance has failed starting up. - * It is designed to be called upon reception of a SIGTTIN. - */ -static void listen_proxies(void) { - struct proxy *p; - struct listener *l; - - p = proxy; - tv_now(&now); /* else, the old time before select will be used */ - while (p) { - if (p->state == PR_STPAUSED) { - Warning("Enabling proxy %s.\n", p->id); - send_log(p, LOG_WARNING, "Enabling proxy %s.\n", p->id); - - for (l = p->listen; l != NULL; l = l->next) { - if (listen(l->fd, p->maxconn) == 0) { - if (actconn < global.maxconn && p->nbconn < p->maxconn) { - FD_SET(l->fd, StaticReadEvent); - p->state = PR_STRUN; - } - else - p->state = PR_STIDLE; - } else { - int port; - - if (l->addr.ss_family == AF_INET6) - port = ntohs(((struct sockaddr_in6 *)(&l->addr))->sin6_port); - else - port = ntohs(((struct sockaddr_in *)(&l->addr))->sin_port); - - Warning("Port %d busy while trying to enable proxy %s.\n", - port, p->id); - send_log(p, LOG_WARNING, "Port %d busy while trying to enable proxy %s.\n", - port, p->id); - /* Another port might have been enabled. Let's stop everything. */ - pause_proxy(p); - break; - } - } - } - p = p->next; - } -} - - -/* - * upon SIGUSR1, let's have a soft stop. - */ -void sig_soft_stop(int sig) { - soft_stop(); - signal(sig, SIG_IGN); -} - -/* - * upon SIGTTOU, we pause everything - */ -void sig_pause(int sig) { - pause_proxies(); - signal(sig, sig_pause); -} - -/* - * upon SIGTTIN, let's have a soft stop. - */ -void sig_listen(int sig) { - listen_proxies(); - signal(sig, sig_listen); -} - -/* - * this function dumps every server's state when the process receives SIGHUP. - */ -void sig_dump_state(int sig) { - struct proxy *p = proxy; - - Warning("SIGHUP received, dumping servers states.\n"); - while (p) { - struct server *s = p->srv; - - send_log(p, LOG_NOTICE, "SIGHUP received, dumping servers states for proxy %s.\n", p->id); - while (s) { - snprintf(trash, sizeof(trash), - "SIGHUP: Server %s/%s is %s. Conn: %d act, %d pend, %d tot.", - p->id, s->id, - (s->state & SRV_RUNNING) ? "UP" : "DOWN", - s->cur_sess, s->nbpend, s->cum_sess); - Warning("%s\n", trash); - send_log(p, LOG_NOTICE, "%s\n", trash); - s = s->next; - } - - if (p->srv_act == 0) { - snprintf(trash, sizeof(trash), - "SIGHUP: Proxy %s %s ! Conn: %d act, %d pend (%d unass), %d tot.", - p->id, - (p->srv_bck) ? "is running on backup servers" : "has no server available", - p->nbconn, p->totpend, p->nbpend, p->cum_conn); - } else { - snprintf(trash, sizeof(trash), - "SIGHUP: Proxy %s has %d active servers and %d backup servers available." - " Conn: %d act, %d pend (%d unass), %d tot.", - p->id, p->srv_act, p->srv_bck, - p->nbconn, p->totpend, p->nbpend, p->cum_conn); - } - Warning("%s\n", trash); - send_log(p, LOG_NOTICE, "%s\n", trash); - - p = p->next; - } - signal(sig, sig_dump_state); -} - -void dump(int sig) { - struct task *t, *tnext; - struct session *s; - - tnext = ((struct task *)LIST_HEAD(wait_queue[0]))->next; - while ((t = tnext) != LIST_HEAD(wait_queue[0])) { /* we haven't looped ? */ - tnext = t->next; - s = t->context; - qfprintf(stderr,"[dump] wq: task %p, still %ld ms, " - "cli=%d, srv=%d, cr=%d, cw=%d, sr=%d, sw=%d, " - "req=%d, rep=%d, clifd=%d\n", - s, tv_remain(&now, &t->expire), - s->cli_state, - s->srv_state, - FD_ISSET(s->cli_fd, StaticReadEvent), - FD_ISSET(s->cli_fd, StaticWriteEvent), - FD_ISSET(s->srv_fd, StaticReadEvent), - FD_ISSET(s->srv_fd, StaticWriteEvent), - s->req->l, s->rep?s->rep->l:0, s->cli_fd - ); - } -} - -#ifdef DEBUG_MEMORY -static void fast_stop(void) -{ - struct proxy *p; - p = proxy; - while (p) { - p->grace = 0; - p = p->next; - } - soft_stop(); -} - -void sig_int(int sig) { - /* This would normally be a hard stop, - but we want to be sure about deallocation, - and so on, so we do a soft stop with - 0 GRACE time - */ - fast_stop(); - /* If we are killed twice, we decide to die*/ - signal(sig, SIG_DFL); -} - -void sig_term(int sig) { - /* This would normally be a hard stop, - but we want to be sure about deallocation, - and so on, so we do a soft stop with - 0 GRACE time - */ - fast_stop(); - /* If we are killed twice, we decide to die*/ - signal(sig, SIG_DFL); -} -#endif - -/* returns the pointer to an error in the replacement string, or NULL if OK */ -char *chain_regex(struct hdr_exp **head, regex_t *preg, int action, char *replace) { - struct hdr_exp *exp; - - if (replace != NULL) { - char *err; - err = check_replace_string(replace); - if (err) - return err; - } - - while (*head != NULL) - head = &(*head)->next; - - exp = calloc(1, sizeof(struct hdr_exp)); - - exp->preg = preg; - exp->replace = replace; - exp->action = action; - *head = exp; - - return NULL; -} - - -/* - * parse a line in a section. Returns 0 if OK, -1 if error. - */ -int cfg_parse_global(char *file, int linenum, char **args) { - - if (!strcmp(args[0], "global")) { /* new section */ - /* no option, nothing special to do */ - return 0; - } - else if (!strcmp(args[0], "daemon")) { - global.mode |= MODE_DAEMON; - } - else if (!strcmp(args[0], "debug")) { - global.mode |= MODE_DEBUG; - } - else if (!strcmp(args[0], "noepoll")) { - cfg_polling_mechanism &= ~POLL_USE_EPOLL; - } - else if (!strcmp(args[0], "nopoll")) { - cfg_polling_mechanism &= ~POLL_USE_POLL; - } - else if (!strcmp(args[0], "quiet")) { - global.mode |= MODE_QUIET; - } - else if (!strcmp(args[0], "stats")) { - global.mode |= MODE_STATS; - } - else if (!strcmp(args[0], "uid")) { - if (global.uid != 0) { - Alert("parsing [%s:%d] : '%s' already specified. Continuing.\n", file, linenum, args[0]); - return 0; - } - if (*(args[1]) == 0) { - Alert("parsing [%s:%d] : '%s' expects an integer argument.\n", file, linenum, args[0]); - return -1; - } - global.uid = atol(args[1]); - } - else if (!strcmp(args[0], "gid")) { - if (global.gid != 0) { - Alert("parsing [%s:%d] : '%s' already specified. Continuing.\n", file, linenum, args[0]); - return 0; - } - if (*(args[1]) == 0) { - Alert("parsing [%s:%d] : '%s' expects an integer argument.\n", file, linenum, args[0]); - return -1; - } - global.gid = atol(args[1]); - } - else if (!strcmp(args[0], "nbproc")) { - if (global.nbproc != 0) { - Alert("parsing [%s:%d] : '%s' already specified. Continuing.\n", file, linenum, args[0]); - return 0; - } - if (*(args[1]) == 0) { - Alert("parsing [%s:%d] : '%s' expects an integer argument.\n", file, linenum, args[0]); - return -1; - } - global.nbproc = atol(args[1]); - } - else if (!strcmp(args[0], "maxconn")) { - if (global.maxconn != 0) { - Alert("parsing [%s:%d] : '%s' already specified. Continuing.\n", file, linenum, args[0]); - return 0; - } - if (*(args[1]) == 0) { - Alert("parsing [%s:%d] : '%s' expects an integer argument.\n", file, linenum, args[0]); - return -1; - } - global.maxconn = atol(args[1]); -#ifdef SYSTEM_MAXCONN - if (global.maxconn > DEFAULT_MAXCONN && cfg_maxconn <= DEFAULT_MAXCONN) { - Alert("parsing [%s:%d] : maxconn value %d too high for this system.\nLimiting to %d. Please use '-n' to force the value.\n", file, linenum, global.maxconn, DEFAULT_MAXCONN); - global.maxconn = DEFAULT_MAXCONN; - } -#endif /* SYSTEM_MAXCONN */ - } - else if (!strcmp(args[0], "ulimit-n")) { - if (global.rlimit_nofile != 0) { - Alert("parsing [%s:%d] : '%s' already specified. Continuing.\n", file, linenum, args[0]); - return 0; - } - if (*(args[1]) == 0) { - Alert("parsing [%s:%d] : '%s' expects an integer argument.\n", file, linenum, args[0]); - return -1; - } - global.rlimit_nofile = atol(args[1]); - } - else if (!strcmp(args[0], "chroot")) { - if (global.chroot != NULL) { - Alert("parsing [%s:%d] : '%s' already specified. Continuing.\n", file, linenum, args[0]); - return 0; - } - if (*(args[1]) == 0) { - Alert("parsing [%s:%d] : '%s' expects a directory as an argument.\n", file, linenum, args[0]); - return -1; - } - global.chroot = strdup(args[1]); - } - else if (!strcmp(args[0], "pidfile")) { - if (global.pidfile != NULL) { - Alert("parsing [%s:%d] : '%s' already specified. Continuing.\n", file, linenum, args[0]); - return 0; - } - if (*(args[1]) == 0) { - Alert("parsing [%s:%d] : '%s' expects a file name as an argument.\n", file, linenum, args[0]); - return -1; - } - global.pidfile = strdup(args[1]); - } - else if (!strcmp(args[0], "log")) { /* syslog server address */ - struct sockaddr_in *sa; - int facility, level; - - if (*(args[1]) == 0 || *(args[2]) == 0) { - Alert("parsing [%s:%d] : '%s' expects

and as arguments.\n", file, linenum, args[0]); - return -1; - } - - for (facility = 0; facility < NB_LOG_FACILITIES; facility++) - if (!strcmp(log_facilities[facility], args[2])) - break; - - if (facility >= NB_LOG_FACILITIES) { - Alert("parsing [%s:%d] : unknown log facility '%s'\n", file, linenum, args[2]); - exit(1); - } - - level = 7; /* max syslog level = debug */ - if (*(args[3])) { - while (level >= 0 && strcmp(log_levels[level], args[3])) - level--; - if (level < 0) { - Alert("parsing [%s:%d] : unknown optional log level '%s'\n", file, linenum, args[3]); - exit(1); - } - } - - sa = str2sa(args[1]); - if (!sa->sin_port) - sa->sin_port = htons(SYSLOG_PORT); - - if (global.logfac1 == -1) { - global.logsrv1 = *sa; - global.logfac1 = facility; - global.loglev1 = level; - } - else if (global.logfac2 == -1) { - global.logsrv2 = *sa; - global.logfac2 = facility; - global.loglev2 = level; - } - else { - Alert("parsing [%s:%d] : too many syslog servers\n", file, linenum); - return -1; - } - - } - else { - Alert("parsing [%s:%d] : unknown keyword '%s' in '%s' section\n", file, linenum, args[0], "global"); - return -1; - } - return 0; -} - - -void init_default_instance() { - memset(&defproxy, 0, sizeof(defproxy)); - defproxy.mode = PR_MODE_TCP; - defproxy.state = PR_STNEW; - defproxy.maxconn = cfg_maxpconn; - defproxy.conn_retries = CONN_RETRIES; - defproxy.logfac1 = defproxy.logfac2 = -1; /* log disabled */ -} - -/* - * parse a line in a section. Returns 0 if OK, -1 if error. - */ -int cfg_parse_listen(char *file, int linenum, char **args) { - static struct proxy *curproxy = NULL; - struct server *newsrv = NULL; - char *err; - int rc; - - if (!strcmp(args[0], "listen")) { /* new proxy */ - if (!*args[1]) { - Alert("parsing [%s:%d] : '%s' expects an argument and\n" - " optionnally supports [addr1]:port1[-end1]{,[addr]:port[-end]}...\n", - file, linenum, args[0]); - return -1; - } - - if ((curproxy = (struct proxy *)calloc(1, sizeof(struct proxy))) == NULL) { - Alert("parsing [%s:%d] : out of memory.\n", file, linenum); - return -1; - } - - curproxy->next = proxy; - proxy = curproxy; - LIST_INIT(&curproxy->pendconns); - - curproxy->id = strdup(args[1]); - - /* parse the listener address if any */ - if (*args[2]) { - curproxy->listen = str2listener(args[2], curproxy->listen); - if (!curproxy->listen) - return -1; - global.maxsock++; - } - - /* set default values */ - curproxy->state = defproxy.state; - curproxy->maxconn = defproxy.maxconn; - curproxy->conn_retries = defproxy.conn_retries; - curproxy->options = defproxy.options; - - if (defproxy.check_req) - curproxy->check_req = strdup(defproxy.check_req); - curproxy->check_len = defproxy.check_len; - - if (defproxy.cookie_name) - curproxy->cookie_name = strdup(defproxy.cookie_name); - curproxy->cookie_len = defproxy.cookie_len; - - if (defproxy.capture_name) - curproxy->capture_name = strdup(defproxy.capture_name); - curproxy->capture_namelen = defproxy.capture_namelen; - curproxy->capture_len = defproxy.capture_len; - - if (defproxy.errmsg.msg400) - curproxy->errmsg.msg400 = strdup(defproxy.errmsg.msg400); - curproxy->errmsg.len400 = defproxy.errmsg.len400; - - if (defproxy.errmsg.msg403) - curproxy->errmsg.msg403 = strdup(defproxy.errmsg.msg403); - curproxy->errmsg.len403 = defproxy.errmsg.len403; - - if (defproxy.errmsg.msg408) - curproxy->errmsg.msg408 = strdup(defproxy.errmsg.msg408); - curproxy->errmsg.len408 = defproxy.errmsg.len408; - - if (defproxy.errmsg.msg500) - curproxy->errmsg.msg500 = strdup(defproxy.errmsg.msg500); - curproxy->errmsg.len500 = defproxy.errmsg.len500; - - if (defproxy.errmsg.msg502) - curproxy->errmsg.msg502 = strdup(defproxy.errmsg.msg502); - curproxy->errmsg.len502 = defproxy.errmsg.len502; - - if (defproxy.errmsg.msg503) - curproxy->errmsg.msg503 = strdup(defproxy.errmsg.msg503); - curproxy->errmsg.len503 = defproxy.errmsg.len503; - - if (defproxy.errmsg.msg504) - curproxy->errmsg.msg504 = strdup(defproxy.errmsg.msg504); - curproxy->errmsg.len504 = defproxy.errmsg.len504; - - curproxy->clitimeout = defproxy.clitimeout; - curproxy->contimeout = defproxy.contimeout; - curproxy->srvtimeout = defproxy.srvtimeout; - curproxy->mode = defproxy.mode; - curproxy->logfac1 = defproxy.logfac1; - curproxy->logsrv1 = defproxy.logsrv1; - curproxy->loglev1 = defproxy.loglev1; - curproxy->logfac2 = defproxy.logfac2; - curproxy->logsrv2 = defproxy.logsrv2; - curproxy->loglev2 = defproxy.loglev2; - curproxy->to_log = defproxy.to_log & ~LW_COOKIE & ~LW_REQHDR & ~ LW_RSPHDR; - curproxy->grace = defproxy.grace; - curproxy->uri_auth = defproxy.uri_auth; - curproxy->source_addr = defproxy.source_addr; - curproxy->mon_net = defproxy.mon_net; - curproxy->mon_mask = defproxy.mon_mask; - return 0; - } - else if (!strcmp(args[0], "defaults")) { /* use this one to assign default values */ - /* some variables may have already been initialized earlier */ - if (defproxy.check_req) free(defproxy.check_req); - if (defproxy.cookie_name) free(defproxy.cookie_name); - if (defproxy.capture_name) free(defproxy.capture_name); - if (defproxy.errmsg.msg400) free(defproxy.errmsg.msg400); - if (defproxy.errmsg.msg403) free(defproxy.errmsg.msg403); - if (defproxy.errmsg.msg408) free(defproxy.errmsg.msg408); - if (defproxy.errmsg.msg500) free(defproxy.errmsg.msg500); - if (defproxy.errmsg.msg502) free(defproxy.errmsg.msg502); - if (defproxy.errmsg.msg503) free(defproxy.errmsg.msg503); - if (defproxy.errmsg.msg504) free(defproxy.errmsg.msg504); - /* we cannot free uri_auth because it might already be used */ - init_default_instance(); - curproxy = &defproxy; - return 0; - } - else if (curproxy == NULL) { - Alert("parsing [%s:%d] : 'listen' or 'defaults' expected.\n", file, linenum); - return -1; - } - - if (!strcmp(args[0], "bind")) { /* new listen addresses */ - if (curproxy == &defproxy) { - Alert("parsing [%s:%d] : '%s' not allowed in 'defaults' section.\n", file, linenum, args[0]); - return -1; - } - - if (strchr(args[1], ':') == NULL) { - Alert("parsing [%s:%d] : '%s' expects [addr1]:port1[-end1]{,[addr]:port[-end]}... as arguments.\n", - file, linenum, args[0]); - return -1; - } - curproxy->listen = str2listener(args[1], curproxy->listen); - if (!curproxy->listen) - return -1; - global.maxsock++; - return 0; - } - else if (!strcmp(args[0], "monitor-net")) { /* set the range of IPs to ignore */ - if (!*args[1] || !str2net(args[1], &curproxy->mon_net, &curproxy->mon_mask)) { - Alert("parsing [%s:%d] : '%s' expects address[/mask].\n", - file, linenum, args[0]); - return -1; - } - /* flush useless bits */ - curproxy->mon_net.s_addr &= curproxy->mon_mask.s_addr; - return 0; - } - else if (!strcmp(args[0], "mode")) { /* sets the proxy mode */ - if (!strcmp(args[1], "http")) curproxy->mode = PR_MODE_HTTP; - else if (!strcmp(args[1], "tcp")) curproxy->mode = PR_MODE_TCP; - else if (!strcmp(args[1], "health")) curproxy->mode = PR_MODE_HEALTH; - else { - Alert("parsing [%s:%d] : unknown proxy mode '%s'.\n", file, linenum, args[1]); - return -1; - } - } - else if (!strcmp(args[0], "disabled")) { /* disables this proxy */ - curproxy->state = PR_STSTOPPED; - } - else if (!strcmp(args[0], "enabled")) { /* enables this proxy (used to revert a disabled default) */ - curproxy->state = PR_STNEW; - } - else if (!strcmp(args[0], "cookie")) { /* cookie name */ - int cur_arg; -// if (curproxy == &defproxy) { -// Alert("parsing [%s:%d] : '%s' not allowed in 'defaults' section.\n", file, linenum, args[0]); -// return -1; -// } - - if (curproxy->cookie_name != NULL) { -// Alert("parsing [%s:%d] : cookie name already specified. Continuing.\n", -// file, linenum); -// return 0; - free(curproxy->cookie_name); - } - - if (*(args[1]) == 0) { - Alert("parsing [%s:%d] : '%s' expects as argument.\n", - file, linenum, args[0]); - return -1; - } - curproxy->cookie_name = strdup(args[1]); - curproxy->cookie_len = strlen(curproxy->cookie_name); - - cur_arg = 2; - while (*(args[cur_arg])) { - if (!strcmp(args[cur_arg], "rewrite")) { - curproxy->options |= PR_O_COOK_RW; - } - else if (!strcmp(args[cur_arg], "indirect")) { - curproxy->options |= PR_O_COOK_IND; - } - else if (!strcmp(args[cur_arg], "insert")) { - curproxy->options |= PR_O_COOK_INS; - } - else if (!strcmp(args[cur_arg], "nocache")) { - curproxy->options |= PR_O_COOK_NOC; - } - else if (!strcmp(args[cur_arg], "postonly")) { - curproxy->options |= PR_O_COOK_POST; - } - else if (!strcmp(args[cur_arg], "prefix")) { - curproxy->options |= PR_O_COOK_PFX; - } - else { - Alert("parsing [%s:%d] : '%s' supports 'rewrite', 'insert', 'prefix', 'indirect', 'nocache' and 'postonly' options.\n", - file, linenum, args[0]); - return -1; - } - cur_arg++; - } - if (!POWEROF2(curproxy->options & (PR_O_COOK_RW|PR_O_COOK_IND))) { - Alert("parsing [%s:%d] : cookie 'rewrite' and 'indirect' modes are incompatible.\n", - file, linenum); - return -1; - } - - if (!POWEROF2(curproxy->options & (PR_O_COOK_RW|PR_O_COOK_INS|PR_O_COOK_PFX))) { - Alert("parsing [%s:%d] : cookie 'rewrite', 'insert' and 'prefix' modes are incompatible.\n", - file, linenum); - return -1; - } - }/* end else if (!strcmp(args[0], "cookie")) */ - else if (!strcmp(args[0], "appsession")) { /* cookie name */ -// if (curproxy == &defproxy) { -// Alert("parsing [%s:%d] : '%s' not allowed in 'defaults' section.\n", file, linenum, args[0]); -// return -1; -// } - - if (curproxy->appsession_name != NULL) { -// Alert("parsing [%s:%d] : cookie name already specified. Continuing.\n", -// file, linenum); -// return 0; - free(curproxy->appsession_name); - } - - if (*(args[5]) == 0) { - Alert("parsing [%s:%d] : '%s' expects 'appsession' 'len' 'timeout' .\n", - file, linenum, args[0]); - return -1; - } - have_appsession = 1; - curproxy->appsession_name = strdup(args[1]); - curproxy->appsession_name_len = strlen(curproxy->appsession_name); - curproxy->appsession_len = atoi(args[3]); - curproxy->appsession_timeout = atoi(args[5]); - rc = chtbl_init(&(curproxy->htbl_proxy), TBLSIZ, hashpjw, match_str, destroy); - if (rc) { - Alert("Error Init Appsession Hashtable.\n"); - return -1; - } - } /* Url App Session */ - else if (!strcmp(args[0], "capture")) { - if (!strcmp(args[1], "cookie")) { /* name of a cookie to capture */ - // if (curproxy == &defproxy) { - // Alert("parsing [%s:%d] : '%s' not allowed in 'defaults' section.\n", file, linenum, args[0]); - // return -1; - // } - - if (curproxy->capture_name != NULL) { - // Alert("parsing [%s:%d] : '%s' already specified. Continuing.\n", - // file, linenum, args[0]); - // return 0; - free(curproxy->capture_name); - } - - if (*(args[4]) == 0) { - Alert("parsing [%s:%d] : '%s' expects 'cookie' 'len' .\n", - file, linenum, args[0]); - return -1; - } - curproxy->capture_name = strdup(args[2]); - curproxy->capture_namelen = strlen(curproxy->capture_name); - curproxy->capture_len = atol(args[4]); - if (curproxy->capture_len >= CAPTURE_LEN) { - Warning("parsing [%s:%d] : truncating capture length to %d bytes.\n", - file, linenum, CAPTURE_LEN - 1); - curproxy->capture_len = CAPTURE_LEN - 1; - } - curproxy->to_log |= LW_COOKIE; - } - else if (!strcmp(args[1], "request") && !strcmp(args[2], "header")) { - struct cap_hdr *hdr; - - if (curproxy == &defproxy) { - Alert("parsing [%s:%d] : '%s %s' not allowed in 'defaults' section.\n", file, linenum, args[0], args[1]); - return -1; - } - - if (*(args[3]) == 0 || strcmp(args[4], "len") != 0 || *(args[5]) == 0) { - Alert("parsing [%s:%d] : '%s %s' expects 'header' 'len' .\n", - file, linenum, args[0], args[1]); - return -1; - } - - hdr = calloc(sizeof(struct cap_hdr), 1); - hdr->next = curproxy->req_cap; - hdr->name = strdup(args[3]); - hdr->namelen = strlen(args[3]); - hdr->len = atol(args[5]); - hdr->index = curproxy->nb_req_cap++; - curproxy->req_cap = hdr; - curproxy->to_log |= LW_REQHDR; - } - else if (!strcmp(args[1], "response") && !strcmp(args[2], "header")) { - struct cap_hdr *hdr; - - if (curproxy == &defproxy) { - Alert("parsing [%s:%d] : '%s %s' not allowed in 'defaults' section.\n", file, linenum, args[0], args[1]); - return -1; - } - - if (*(args[3]) == 0 || strcmp(args[4], "len") != 0 || *(args[5]) == 0) { - Alert("parsing [%s:%d] : '%s %s' expects 'header' 'len' .\n", - file, linenum, args[0], args[1]); - return -1; - } - hdr = calloc(sizeof(struct cap_hdr), 1); - hdr->next = curproxy->rsp_cap; - hdr->name = strdup(args[3]); - hdr->namelen = strlen(args[3]); - hdr->len = atol(args[5]); - hdr->index = curproxy->nb_rsp_cap++; - curproxy->rsp_cap = hdr; - curproxy->to_log |= LW_RSPHDR; - } - else { - Alert("parsing [%s:%d] : '%s' expects 'cookie' or 'request header' or 'response header'.\n", - file, linenum, args[0]); - return -1; - } - } - else if (!strcmp(args[0], "contimeout")) { /* connect timeout */ - if (curproxy->contimeout != defproxy.contimeout) { - Alert("parsing [%s:%d] : '%s' already specified. Continuing.\n", file, linenum, args[0]); - return 0; - } - if (*(args[1]) == 0) { - Alert("parsing [%s:%d] : '%s' expects an integer as argument.\n", - file, linenum, args[0]); - return -1; - } - curproxy->contimeout = atol(args[1]); - } - else if (!strcmp(args[0], "clitimeout")) { /* client timeout */ - if (curproxy->clitimeout != defproxy.clitimeout) { - Alert("parsing [%s:%d] : '%s' already specified. Continuing.\n", - file, linenum, args[0]); - return 0; - } - if (*(args[1]) == 0) { - Alert("parsing [%s:%d] : '%s' expects an integer as argument.\n", - file, linenum, args[0]); - return -1; - } - curproxy->clitimeout = atol(args[1]); - } - else if (!strcmp(args[0], "srvtimeout")) { /* server timeout */ - if (curproxy->srvtimeout != defproxy.srvtimeout) { - Alert("parsing [%s:%d] : '%s' already specified. Continuing.\n", file, linenum, args[0]); - return 0; - } - if (*(args[1]) == 0) { - Alert("parsing [%s:%d] : '%s' expects an integer as argument.\n", - file, linenum, args[0]); - return -1; - } - curproxy->srvtimeout = atol(args[1]); - } - else if (!strcmp(args[0], "retries")) { /* connection retries */ - if (*(args[1]) == 0) { - Alert("parsing [%s:%d] : '%s' expects an integer argument (dispatch counts for one).\n", - file, linenum, args[0]); - return -1; - } - curproxy->conn_retries = atol(args[1]); - } - else if (!strcmp(args[0], "stats")) { - if (curproxy != &defproxy && curproxy->uri_auth == defproxy.uri_auth) - curproxy->uri_auth = NULL; /* we must detach from the default config */ - - if (*(args[1]) == 0) { - Alert("parsing [%s:%d] : '%s' expects 'uri', 'realm', 'auth', 'scope' or 'enable'.\n", file, linenum, args[0]); - return -1; - } else if (!strcmp(args[1], "uri")) { - if (*(args[2]) == 0) { - Alert("parsing [%s:%d] : 'uri' needs an URI prefix.\n", file, linenum); - return -1; - } else if (!stats_set_uri(&curproxy->uri_auth, args[2])) { - Alert("parsing [%s:%d] : out of memory.\n", file, linenum); - return -1; - } - } else if (!strcmp(args[1], "realm")) { - if (*(args[2]) == 0) { - Alert("parsing [%s:%d] : 'realm' needs an realm name.\n", file, linenum); - return -1; - } else if (!stats_set_realm(&curproxy->uri_auth, args[2])) { - Alert("parsing [%s:%d] : out of memory.\n", file, linenum); - return -1; - } - } else if (!strcmp(args[1], "auth")) { - if (*(args[2]) == 0) { - Alert("parsing [%s:%d] : 'auth' needs a user:password account.\n", file, linenum); - return -1; - } else if (!stats_add_auth(&curproxy->uri_auth, args[2])) { - Alert("parsing [%s:%d] : out of memory.\n", file, linenum); - return -1; - } - } else if (!strcmp(args[1], "scope")) { - if (*(args[2]) == 0) { - Alert("parsing [%s:%d] : 'scope' needs a proxy name.\n", file, linenum); - return -1; - } else if (!stats_add_scope(&curproxy->uri_auth, args[2])) { - Alert("parsing [%s:%d] : out of memory.\n", file, linenum); - return -1; - } - } else if (!strcmp(args[1], "enable")) { - if (!stats_check_init_uri_auth(&curproxy->uri_auth)) { - Alert("parsing [%s:%d] : out of memory.\n", file, linenum); - return -1; - } - } else { - Alert("parsing [%s:%d] : unknown stats parameter '%s' (expects 'uri', 'realm', 'auth' or 'enable').\n", - file, linenum, args[0]); - return -1; - } - } - else if (!strcmp(args[0], "option")) { - if (*(args[1]) == 0) { - Alert("parsing [%s:%d] : '%s' expects an option name.\n", file, linenum, args[0]); - return -1; - } - if (!strcmp(args[1], "redispatch")) - /* enable reconnections to dispatch */ - curproxy->options |= PR_O_REDISP; -#ifdef TPROXY - else if (!strcmp(args[1], "transparent")) - /* enable transparent proxy connections */ - curproxy->options |= PR_O_TRANSP; -#endif - else if (!strcmp(args[1], "keepalive")) - /* enable keep-alive */ - curproxy->options |= PR_O_KEEPALIVE; - else if (!strcmp(args[1], "forwardfor")) - /* insert x-forwarded-for field */ - curproxy->options |= PR_O_FWDFOR; - else if (!strcmp(args[1], "logasap")) - /* log as soon as possible, without waiting for the session to complete */ - curproxy->options |= PR_O_LOGASAP; - else if (!strcmp(args[1], "abortonclose")) - /* abort connection if client closes during queue or connect() */ - curproxy->options |= PR_O_ABRT_CLOSE; - else if (!strcmp(args[1], "httpclose")) - /* force connection: close in both directions in HTTP mode */ - curproxy->options |= PR_O_HTTP_CLOSE; - else if (!strcmp(args[1], "forceclose")) - /* force connection: close in both directions in HTTP mode and enforce end of session */ - curproxy->options |= PR_O_FORCE_CLO | PR_O_HTTP_CLOSE; - else if (!strcmp(args[1], "checkcache")) - /* require examination of cacheability of the 'set-cookie' field */ - curproxy->options |= PR_O_CHK_CACHE; - else if (!strcmp(args[1], "httplog")) - /* generate a complete HTTP log */ - curproxy->to_log |= LW_DATE | LW_CLIP | LW_SVID | LW_REQ | LW_PXID | LW_RESP | LW_BYTES; - else if (!strcmp(args[1], "tcplog")) - /* generate a detailed TCP log */ - curproxy->to_log |= LW_DATE | LW_CLIP | LW_SVID | LW_PXID | LW_BYTES; - else if (!strcmp(args[1], "dontlognull")) { - /* don't log empty requests */ - curproxy->options |= PR_O_NULLNOLOG; - } - else if (!strcmp(args[1], "tcpka")) { - /* enable TCP keep-alives on client and server sessions */ - curproxy->options |= PR_O_TCP_CLI_KA | PR_O_TCP_SRV_KA; - } - else if (!strcmp(args[1], "clitcpka")) { - /* enable TCP keep-alives on client sessions */ - curproxy->options |= PR_O_TCP_CLI_KA; - } - else if (!strcmp(args[1], "srvtcpka")) { - /* enable TCP keep-alives on server sessions */ - curproxy->options |= PR_O_TCP_SRV_KA; - } - else if (!strcmp(args[1], "allbackups")) { - /* Use all backup servers simultaneously */ - curproxy->options |= PR_O_USE_ALL_BK; - } - else if (!strcmp(args[1], "httpchk")) { - /* use HTTP request to check servers' health */ - if (curproxy->check_req != NULL) { - free(curproxy->check_req); - } - curproxy->options |= PR_O_HTTP_CHK; - if (!*args[2]) { /* no argument */ - curproxy->check_req = strdup(DEF_CHECK_REQ); /* default request */ - curproxy->check_len = strlen(DEF_CHECK_REQ); - } else if (!*args[3]) { /* one argument : URI */ - int reqlen = strlen(args[2]) + strlen("OPTIONS / HTTP/1.0\r\n\r\n"); - curproxy->check_req = (char *)malloc(reqlen); - curproxy->check_len = snprintf(curproxy->check_req, reqlen, - "OPTIONS %s HTTP/1.0\r\n\r\n", args[2]); /* URI to use */ - } else { /* more arguments : METHOD URI [HTTP_VER] */ - int reqlen = strlen(args[2]) + strlen(args[3]) + 3 + strlen("\r\n\r\n"); - if (*args[4]) - reqlen += strlen(args[4]); - else - reqlen += strlen("HTTP/1.0"); - - curproxy->check_req = (char *)malloc(reqlen); - curproxy->check_len = snprintf(curproxy->check_req, reqlen, - "%s %s %s\r\n\r\n", args[2], args[3], *args[4]?args[4]:"HTTP/1.0"); - } - } - else if (!strcmp(args[1], "persist")) { - /* persist on using the server specified by the cookie, even when it's down */ - curproxy->options |= PR_O_PERSIST; - } - else { - Alert("parsing [%s:%d] : unknown option '%s'.\n", file, linenum, args[1]); - return -1; - } - return 0; - } - else if (!strcmp(args[0], "redispatch") || !strcmp(args[0], "redisp")) { - /* enable reconnections to dispatch */ - curproxy->options |= PR_O_REDISP; - } -#ifdef TPROXY - else if (!strcmp(args[0], "transparent")) { - /* enable transparent proxy connections */ - curproxy->options |= PR_O_TRANSP; - } -#endif - else if (!strcmp(args[0], "maxconn")) { /* maxconn */ - if (*(args[1]) == 0) { - Alert("parsing [%s:%d] : '%s' expects an integer argument.\n", file, linenum, args[0]); - return -1; - } - curproxy->maxconn = atol(args[1]); - } - else if (!strcmp(args[0], "grace")) { /* grace time (ms) */ - if (*(args[1]) == 0) { - Alert("parsing [%s:%d] : '%s' expects a time in milliseconds.\n", file, linenum, args[0]); - return -1; - } - curproxy->grace = atol(args[1]); - } - else if (!strcmp(args[0], "dispatch")) { /* dispatch address */ - if (curproxy == &defproxy) { - Alert("parsing [%s:%d] : '%s' not allowed in 'defaults' section.\n", file, linenum, args[0]); - return -1; - } - if (strchr(args[1], ':') == NULL) { - Alert("parsing [%s:%d] : '%s' expects as argument.\n", file, linenum, args[0]); - return -1; - } - curproxy->dispatch_addr = *str2sa(args[1]); - } - else if (!strcmp(args[0], "balance")) { /* set balancing with optional algorithm */ - if (*(args[1])) { - if (!strcmp(args[1], "roundrobin")) { - curproxy->options |= PR_O_BALANCE_RR; - } - else if (!strcmp(args[1], "source")) { - curproxy->options |= PR_O_BALANCE_SH; - } - else { - Alert("parsing [%s:%d] : '%s' only supports 'roundrobin' and 'source' options.\n", file, linenum, args[0]); - return -1; - } - } - else /* if no option is set, use round-robin by default */ - curproxy->options |= PR_O_BALANCE_RR; - } - else if (!strcmp(args[0], "server")) { /* server address */ - int cur_arg; - char *rport; - char *raddr; - short realport; - int do_check; - - if (curproxy == &defproxy) { - Alert("parsing [%s:%d] : '%s' not allowed in 'defaults' section.\n", file, linenum, args[0]); - return -1; - } - - if (!*args[2]) { - Alert("parsing [%s:%d] : '%s' expects and [:] as arguments.\n", - file, linenum, args[0]); - return -1; - } - if ((newsrv = (struct server *)calloc(1, sizeof(struct server))) == NULL) { - Alert("parsing [%s:%d] : out of memory.\n", file, linenum); - return -1; - } - - /* the servers are linked backwards first */ - newsrv->next = curproxy->srv; - curproxy->srv = newsrv; - newsrv->proxy = curproxy; - - LIST_INIT(&newsrv->pendconns); - do_check = 0; - newsrv->state = SRV_RUNNING; /* early server setup */ - newsrv->id = strdup(args[1]); - - /* several ways to check the port component : - * - IP => port=+0, relative - * - IP: => port=+0, relative - * - IP:N => port=N, absolute - * - IP:+N => port=+N, relative - * - IP:-N => port=-N, relative - */ - raddr = strdup(args[2]); - rport = strchr(raddr, ':'); - if (rport) { - *rport++ = 0; - realport = atol(rport); - if (!isdigit((int)*rport)) - newsrv->state |= SRV_MAPPORTS; - } else { - realport = 0; - newsrv->state |= SRV_MAPPORTS; - } - - newsrv->addr = *str2sa(raddr); - newsrv->addr.sin_port = htons(realport); - free(raddr); - - newsrv->curfd = -1; /* no health-check in progress */ - newsrv->inter = DEF_CHKINTR; - newsrv->rise = DEF_RISETIME; - newsrv->fall = DEF_FALLTIME; - newsrv->health = newsrv->rise; /* up, but will fall down at first failure */ - cur_arg = 3; - while (*args[cur_arg]) { - if (!strcmp(args[cur_arg], "cookie")) { - newsrv->cookie = strdup(args[cur_arg + 1]); - newsrv->cklen = strlen(args[cur_arg + 1]); - cur_arg += 2; - } - else if (!strcmp(args[cur_arg], "rise")) { - newsrv->rise = atol(args[cur_arg + 1]); - newsrv->health = newsrv->rise; - cur_arg += 2; - } - else if (!strcmp(args[cur_arg], "fall")) { - newsrv->fall = atol(args[cur_arg + 1]); - cur_arg += 2; - } - else if (!strcmp(args[cur_arg], "inter")) { - newsrv->inter = atol(args[cur_arg + 1]); - cur_arg += 2; - } - else if (!strcmp(args[cur_arg], "port")) { - newsrv->check_port = atol(args[cur_arg + 1]); - cur_arg += 2; - } - else if (!strcmp(args[cur_arg], "backup")) { - newsrv->state |= SRV_BACKUP; - cur_arg ++; - } - else if (!strcmp(args[cur_arg], "weight")) { - int w; - w = atol(args[cur_arg + 1]); - if (w < 1 || w > 256) { - Alert("parsing [%s:%d] : weight of server %s is not within 1 and 256 (%d).\n", - file, linenum, newsrv->id, w); - return -1; - } - newsrv->uweight = w - 1; - cur_arg += 2; - } - else if (!strcmp(args[cur_arg], "minconn")) { - newsrv->minconn = atol(args[cur_arg + 1]); - cur_arg += 2; - } - else if (!strcmp(args[cur_arg], "maxconn")) { - newsrv->maxconn = atol(args[cur_arg + 1]); - cur_arg += 2; - } - else if (!strcmp(args[cur_arg], "check")) { - global.maxsock++; - do_check = 1; - cur_arg += 1; - } - else if (!strcmp(args[cur_arg], "source")) { /* address to which we bind when connecting */ - if (!*args[cur_arg + 1]) { - Alert("parsing [%s:%d] : '%s' expects [:] as argument.\n", - file, linenum, "source"); - return -1; - } - newsrv->state |= SRV_BIND_SRC; - newsrv->source_addr = *str2sa(args[cur_arg + 1]); - cur_arg += 2; - } - else { - Alert("parsing [%s:%d] : server %s only supports options 'backup', 'cookie', 'check', 'inter', 'rise', 'fall', 'port', 'source', 'minconn', 'maxconn' and 'weight'.\n", - file, linenum, newsrv->id); - return -1; - } - } - - if (do_check) { - if (!newsrv->check_port && !(newsrv->state & SRV_MAPPORTS)) - newsrv->check_port = realport; /* by default */ - if (!newsrv->check_port) { - Alert("parsing [%s:%d] : server %s has neither service port nor check port. Check has been disabled.\n", - file, linenum, newsrv->id); - return -1; - } - newsrv->state |= SRV_CHECKED; - } - - if (newsrv->state & SRV_BACKUP) - curproxy->srv_bck++; - else - curproxy->srv_act++; - } - else if (!strcmp(args[0], "log")) { /* syslog server address */ - struct sockaddr_in *sa; - int facility; - - if (*(args[1]) && *(args[2]) == 0 && !strcmp(args[1], "global")) { - curproxy->logfac1 = global.logfac1; - curproxy->logsrv1 = global.logsrv1; - curproxy->loglev1 = global.loglev1; - curproxy->logfac2 = global.logfac2; - curproxy->logsrv2 = global.logsrv2; - curproxy->loglev2 = global.loglev2; - } - else if (*(args[1]) && *(args[2])) { - int level; - - for (facility = 0; facility < NB_LOG_FACILITIES; facility++) - if (!strcmp(log_facilities[facility], args[2])) - break; - - if (facility >= NB_LOG_FACILITIES) { - Alert("parsing [%s:%d] : unknown log facility '%s'\n", file, linenum, args[2]); - exit(1); - } - - level = 7; /* max syslog level = debug */ - if (*(args[3])) { - while (level >= 0 && strcmp(log_levels[level], args[3])) - level--; - if (level < 0) { - Alert("parsing [%s:%d] : unknown optional log level '%s'\n", file, linenum, args[3]); - exit(1); - } - } - - sa = str2sa(args[1]); - if (!sa->sin_port) - sa->sin_port = htons(SYSLOG_PORT); - - if (curproxy->logfac1 == -1) { - curproxy->logsrv1 = *sa; - curproxy->logfac1 = facility; - curproxy->loglev1 = level; - } - else if (curproxy->logfac2 == -1) { - curproxy->logsrv2 = *sa; - curproxy->logfac2 = facility; - curproxy->loglev2 = level; - } - else { - Alert("parsing [%s:%d] : too many syslog servers\n", file, linenum); - return -1; - } - } - else { - Alert("parsing [%s:%d] : 'log' expects either and or 'global' as arguments.\n", - file, linenum); - return -1; - } - } - else if (!strcmp(args[0], "source")) { /* address to which we bind when connecting */ - if (!*args[1]) { - Alert("parsing [%s:%d] : '%s' expects [:] as argument.\n", - file, linenum, "source"); - return -1; - } - - curproxy->source_addr = *str2sa(args[1]); - curproxy->options |= PR_O_BIND_SRC; - } - else if (!strcmp(args[0], "cliexp") || !strcmp(args[0], "reqrep")) { /* replace request header from a regex */ - regex_t *preg; - if (curproxy == &defproxy) { - Alert("parsing [%s:%d] : '%s' not allowed in 'defaults' section.\n", file, linenum, args[0]); - return -1; - } - - if (*(args[1]) == 0 || *(args[2]) == 0) { - Alert("parsing [%s:%d] : '%s' expects and as arguments.\n", - file, linenum, args[0]); - return -1; - } - - preg = calloc(1, sizeof(regex_t)); - if (regcomp(preg, args[1], REG_EXTENDED) != 0) { - Alert("parsing [%s:%d] : bad regular expression '%s'.\n", file, linenum, args[1]); - return -1; - } - - err = chain_regex(&curproxy->req_exp, preg, ACT_REPLACE, strdup(args[2])); - if (err) { - Alert("parsing [%s:%d] : invalid character or unterminated sequence in replacement string near '%c'.\n", - file, linenum, *err); - return -1; - } - } - else if (!strcmp(args[0], "reqdel")) { /* delete request header from a regex */ - regex_t *preg; - if (curproxy == &defproxy) { - Alert("parsing [%s:%d] : '%s' not allowed in 'defaults' section.\n", file, linenum, args[0]); - return -1; - } - - if (*(args[1]) == 0) { - Alert("parsing [%s:%d] : '%s' expects as an argument.\n", file, linenum, args[0]); - return -1; - } - - preg = calloc(1, sizeof(regex_t)); - if (regcomp(preg, args[1], REG_EXTENDED) != 0) { - Alert("parsing [%s:%d] : bad regular expression '%s'.\n", file, linenum, args[1]); - return -1; - } - - chain_regex(&curproxy->req_exp, preg, ACT_REMOVE, NULL); - } - else if (!strcmp(args[0], "reqdeny")) { /* deny a request if a header matches this regex */ - regex_t *preg; - if (curproxy == &defproxy) { - Alert("parsing [%s:%d] : '%s' not allowed in 'defaults' section.\n", file, linenum, args[0]); - return -1; - } - - if (*(args[1]) == 0) { - Alert("parsing [%s:%d] : '%s' expects as an argument.\n", file, linenum, args[0]); - return -1; - } - - preg = calloc(1, sizeof(regex_t)); - if (regcomp(preg, args[1], REG_EXTENDED) != 0) { - Alert("parsing [%s:%d] : bad regular expression '%s'.\n", file, linenum, args[1]); - return -1; - } - - chain_regex(&curproxy->req_exp, preg, ACT_DENY, NULL); - } - else if (!strcmp(args[0], "reqpass")) { /* pass this header without allowing or denying the request */ - regex_t *preg; - if (curproxy == &defproxy) { - Alert("parsing [%s:%d] : '%s' not allowed in 'defaults' section.\n", file, linenum, args[0]); - return -1; - } - - if (*(args[1]) == 0) { - Alert("parsing [%s:%d] : '%s' expects as an argument.\n", file, linenum, args[0]); - return -1; - } - - preg = calloc(1, sizeof(regex_t)); - if (regcomp(preg, args[1], REG_EXTENDED) != 0) { - Alert("parsing [%s:%d] : bad regular expression '%s'.\n", file, linenum, args[1]); - return -1; - } - - chain_regex(&curproxy->req_exp, preg, ACT_PASS, NULL); - } - else if (!strcmp(args[0], "reqallow")) { /* allow a request if a header matches this regex */ - regex_t *preg; - if (curproxy == &defproxy) { - Alert("parsing [%s:%d] : '%s' not allowed in 'defaults' section.\n", file, linenum, args[0]); - return -1; - } - - if (*(args[1]) == 0) { - Alert("parsing [%s:%d] : '%s' expects as an argument.\n", file, linenum, args[0]); - return -1; - } - - preg = calloc(1, sizeof(regex_t)); - if (regcomp(preg, args[1], REG_EXTENDED) != 0) { - Alert("parsing [%s:%d] : bad regular expression '%s'.\n", file, linenum, args[1]); - return -1; - } - - chain_regex(&curproxy->req_exp, preg, ACT_ALLOW, NULL); - } - else if (!strcmp(args[0], "reqirep")) { /* replace request header from a regex, ignoring case */ - regex_t *preg; - if (curproxy == &defproxy) { - Alert("parsing [%s:%d] : '%s' not allowed in 'defaults' section.\n", file, linenum, args[0]); - return -1; - } - - if (*(args[1]) == 0 || *(args[2]) == 0) { - Alert("parsing [%s:%d] : '%s' expects and as arguments.\n", - file, linenum, args[0]); - return -1; - } - - preg = calloc(1, sizeof(regex_t)); - if (regcomp(preg, args[1], REG_EXTENDED | REG_ICASE) != 0) { - Alert("parsing [%s:%d] : bad regular expression '%s'.\n", file, linenum, args[1]); - return -1; - } - - err = chain_regex(&curproxy->req_exp, preg, ACT_REPLACE, strdup(args[2])); - if (err) { - Alert("parsing [%s:%d] : invalid character or unterminated sequence in replacement string near '%c'.\n", - file, linenum, *err); - return -1; - } - } - else if (!strcmp(args[0], "reqidel")) { /* delete request header from a regex ignoring case */ - regex_t *preg; - if (curproxy == &defproxy) { - Alert("parsing [%s:%d] : '%s' not allowed in 'defaults' section.\n", file, linenum, args[0]); - return -1; - } - - if (*(args[1]) == 0) { - Alert("parsing [%s:%d] : '%s' expects as an argument.\n", file, linenum, args[0]); - return -1; - } - - preg = calloc(1, sizeof(regex_t)); - if (regcomp(preg, args[1], REG_EXTENDED | REG_ICASE) != 0) { - Alert("parsing [%s:%d] : bad regular expression '%s'.\n", file, linenum, args[1]); - return -1; - } - - chain_regex(&curproxy->req_exp, preg, ACT_REMOVE, NULL); - } - else if (!strcmp(args[0], "reqideny")) { /* deny a request if a header matches this regex ignoring case */ - regex_t *preg; - if (curproxy == &defproxy) { - Alert("parsing [%s:%d] : '%s' not allowed in 'defaults' section.\n", file, linenum, args[0]); - return -1; - } - - if (*(args[1]) == 0) { - Alert("parsing [%s:%d] : '%s' expects as an argument.\n", file, linenum, args[0]); - return -1; - } - - preg = calloc(1, sizeof(regex_t)); - if (regcomp(preg, args[1], REG_EXTENDED | REG_ICASE) != 0) { - Alert("parsing [%s:%d] : bad regular expression '%s'.\n", file, linenum, args[1]); - return -1; - } - - chain_regex(&curproxy->req_exp, preg, ACT_DENY, NULL); - } - else if (!strcmp(args[0], "reqipass")) { /* pass this header without allowing or denying the request */ - regex_t *preg; - if (curproxy == &defproxy) { - Alert("parsing [%s:%d] : '%s' not allowed in 'defaults' section.\n", file, linenum, args[0]); - return -1; - } - - if (*(args[1]) == 0) { - Alert("parsing [%s:%d] : '%s' expects as an argument.\n", file, linenum, args[0]); - return -1; - } - - preg = calloc(1, sizeof(regex_t)); - if (regcomp(preg, args[1], REG_EXTENDED | REG_ICASE) != 0) { - Alert("parsing [%s:%d] : bad regular expression '%s'.\n", file, linenum, args[1]); - return -1; - } - - chain_regex(&curproxy->req_exp, preg, ACT_PASS, NULL); - } - else if (!strcmp(args[0], "reqiallow")) { /* allow a request if a header matches this regex ignoring case */ - regex_t *preg; - if (curproxy == &defproxy) { - Alert("parsing [%s:%d] : '%s' not allowed in 'defaults' section.\n", file, linenum, args[0]); - return -1; - } - - if (*(args[1]) == 0) { - Alert("parsing [%s:%d] : '%s' expects as an argument.\n", file, linenum, args[0]); - return -1; - } - - preg = calloc(1, sizeof(regex_t)); - if (regcomp(preg, args[1], REG_EXTENDED | REG_ICASE) != 0) { - Alert("parsing [%s:%d] : bad regular expression '%s'.\n", file, linenum, args[1]); - return -1; - } - - chain_regex(&curproxy->req_exp, preg, ACT_ALLOW, NULL); - } - else if (!strcmp(args[0], "reqadd")) { /* add request header */ - if (curproxy == &defproxy) { - Alert("parsing [%s:%d] : '%s' not allowed in 'defaults' section.\n", file, linenum, args[0]); - return -1; - } - - if (curproxy->nb_reqadd >= MAX_NEWHDR) { - Alert("parsing [%s:%d] : too many '%s'. Continuing.\n", file, linenum, args[0]); - return 0; - } - - if (*(args[1]) == 0) { - Alert("parsing [%s:%d] : '%s' expects
as an argument.\n", file, linenum, args[0]); - return -1; - } - - curproxy->req_add[curproxy->nb_reqadd++] = strdup(args[1]); - } - else if (!strcmp(args[0], "srvexp") || !strcmp(args[0], "rsprep")) { /* replace response header from a regex */ - regex_t *preg; - - if (*(args[1]) == 0 || *(args[2]) == 0) { - Alert("parsing [%s:%d] : '%s' expects and as arguments.\n", - file, linenum, args[0]); - return -1; - } - - preg = calloc(1, sizeof(regex_t)); - if (regcomp(preg, args[1], REG_EXTENDED) != 0) { - Alert("parsing [%s:%d] : bad regular expression '%s'.\n", file, linenum, args[1]); - return -1; - } - - err = chain_regex(&curproxy->rsp_exp, preg, ACT_REPLACE, strdup(args[2])); - if (err) { - Alert("parsing [%s:%d] : invalid character or unterminated sequence in replacement string near '%c'.\n", - file, linenum, *err); - return -1; - } - } - else if (!strcmp(args[0], "rspdel")) { /* delete response header from a regex */ - regex_t *preg; - if (curproxy == &defproxy) { - Alert("parsing [%s:%d] : '%s' not allowed in 'defaults' section.\n", file, linenum, args[0]); - return -1; - } - - if (*(args[1]) == 0) { - Alert("parsing [%s:%d] : '%s' expects as an argument.\n", file, linenum, args[0]); - return -1; - } - - preg = calloc(1, sizeof(regex_t)); - if (regcomp(preg, args[1], REG_EXTENDED) != 0) { - Alert("parsing [%s:%d] : bad regular expression '%s'.\n", file, linenum, args[1]); - return -1; - } - - err = chain_regex(&curproxy->rsp_exp, preg, ACT_REMOVE, strdup(args[2])); - if (err) { - Alert("parsing [%s:%d] : invalid character or unterminated sequence in replacement string near '%c'.\n", - file, linenum, *err); - return -1; - } - } - else if (!strcmp(args[0], "rspdeny")) { /* block response header from a regex */ - regex_t *preg; - if (curproxy == &defproxy) { - Alert("parsing [%s:%d] : '%s' not allowed in 'defaults' section.\n", file, linenum, args[0]); - return -1; - } - - if (*(args[1]) == 0) { - Alert("parsing [%s:%d] : '%s' expects as an argument.\n", file, linenum, args[0]); - return -1; - } - - preg = calloc(1, sizeof(regex_t)); - if (regcomp(preg, args[1], REG_EXTENDED) != 0) { - Alert("parsing [%s:%d] : bad regular expression '%s'.\n", file, linenum, args[1]); - return -1; - } - - err = chain_regex(&curproxy->rsp_exp, preg, ACT_DENY, strdup(args[2])); - if (err) { - Alert("parsing [%s:%d] : invalid character or unterminated sequence in replacement string near '%c'.\n", - file, linenum, *err); - return -1; - } - } - else if (!strcmp(args[0], "rspirep")) { /* replace response header from a regex ignoring case */ - regex_t *preg; - if (curproxy == &defproxy) { - Alert("parsing [%s:%d] : '%s' not allowed in 'defaults' section.\n", file, linenum, args[0]); - return -1; - } - - if (*(args[1]) == 0 || *(args[2]) == 0) { - Alert("parsing [%s:%d] : '%s' expects and as arguments.\n", - file, linenum, args[0]); - return -1; - } - - preg = calloc(1, sizeof(regex_t)); - if (regcomp(preg, args[1], REG_EXTENDED | REG_ICASE) != 0) { - Alert("parsing [%s:%d] : bad regular expression '%s'.\n", file, linenum, args[1]); - return -1; - } - - err = chain_regex(&curproxy->rsp_exp, preg, ACT_REPLACE, strdup(args[2])); - if (err) { - Alert("parsing [%s:%d] : invalid character or unterminated sequence in replacement string near '%c'.\n", - file, linenum, *err); - return -1; - } - } - else if (!strcmp(args[0], "rspidel")) { /* delete response header from a regex ignoring case */ - regex_t *preg; - if (curproxy == &defproxy) { - Alert("parsing [%s:%d] : '%s' not allowed in 'defaults' section.\n", file, linenum, args[0]); - return -1; - } - - if (*(args[1]) == 0) { - Alert("parsing [%s:%d] : '%s' expects as an argument.\n", file, linenum, args[0]); - return -1; - } - - preg = calloc(1, sizeof(regex_t)); - if (regcomp(preg, args[1], REG_EXTENDED | REG_ICASE) != 0) { - Alert("parsing [%s:%d] : bad regular expression '%s'.\n", file, linenum, args[1]); - return -1; - } - - err = chain_regex(&curproxy->rsp_exp, preg, ACT_REMOVE, strdup(args[2])); - if (err) { - Alert("parsing [%s:%d] : invalid character or unterminated sequence in replacement string near '%c'.\n", - file, linenum, *err); - return -1; - } - } - else if (!strcmp(args[0], "rspideny")) { /* block response header from a regex ignoring case */ - regex_t *preg; - if (curproxy == &defproxy) { - Alert("parsing [%s:%d] : '%s' not allowed in 'defaults' section.\n", file, linenum, args[0]); - return -1; - } - - if (*(args[1]) == 0) { - Alert("parsing [%s:%d] : '%s' expects as an argument.\n", file, linenum, args[0]); - return -1; - } - - preg = calloc(1, sizeof(regex_t)); - if (regcomp(preg, args[1], REG_EXTENDED | REG_ICASE) != 0) { - Alert("parsing [%s:%d] : bad regular expression '%s'.\n", file, linenum, args[1]); - return -1; - } - - err = chain_regex(&curproxy->rsp_exp, preg, ACT_DENY, strdup(args[2])); - if (err) { - Alert("parsing [%s:%d] : invalid character or unterminated sequence in replacement string near '%c'.\n", - file, linenum, *err); - return -1; - } - } - else if (!strcmp(args[0], "rspadd")) { /* add response header */ - if (curproxy == &defproxy) { - Alert("parsing [%s:%d] : '%s' not allowed in 'defaults' section.\n", file, linenum, args[0]); - return -1; - } - - if (curproxy->nb_rspadd >= MAX_NEWHDR) { - Alert("parsing [%s:%d] : too many '%s'. Continuing.\n", file, linenum, args[0]); - return 0; - } - - if (*(args[1]) == 0) { - Alert("parsing [%s:%d] : '%s' expects
as an argument.\n", file, linenum, args[0]); - return -1; - } - - curproxy->rsp_add[curproxy->nb_rspadd++] = strdup(args[1]); - } - else if (!strcmp(args[0], "errorloc") || - !strcmp(args[0], "errorloc302") || - !strcmp(args[0], "errorloc303")) { /* error location */ - int errnum, errlen; - char *err; - - // if (curproxy == &defproxy) { - // Alert("parsing [%s:%d] : '%s' not allowed in 'defaults' section.\n", file, linenum, args[0]); - // return -1; - // } - - if (*(args[2]) == 0) { - Alert("parsing [%s:%d] : expects and as arguments.\n", file, linenum); - return -1; - } - - errnum = atol(args[1]); - if (!strcmp(args[0], "errorloc303")) { - err = malloc(strlen(HTTP_303) + strlen(args[2]) + 5); - errlen = sprintf(err, "%s%s\r\n\r\n", HTTP_303, args[2]); - } else { - err = malloc(strlen(HTTP_302) + strlen(args[2]) + 5); - errlen = sprintf(err, "%s%s\r\n\r\n", HTTP_302, args[2]); - } - - if (errnum == 400) { - if (curproxy->errmsg.msg400) { - //Warning("parsing [%s:%d] : error %d already defined.\n", file, linenum, errnum); - free(curproxy->errmsg.msg400); - } - curproxy->errmsg.msg400 = err; - curproxy->errmsg.len400 = errlen; - } - else if (errnum == 403) { - if (curproxy->errmsg.msg403) { - //Warning("parsing [%s:%d] : error %d already defined.\n", file, linenum, errnum); - free(curproxy->errmsg.msg403); - } - curproxy->errmsg.msg403 = err; - curproxy->errmsg.len403 = errlen; - } - else if (errnum == 408) { - if (curproxy->errmsg.msg408) { - //Warning("parsing [%s:%d] : error %d already defined.\n", file, linenum, errnum); - free(curproxy->errmsg.msg408); - } - curproxy->errmsg.msg408 = err; - curproxy->errmsg.len408 = errlen; - } - else if (errnum == 500) { - if (curproxy->errmsg.msg500) { - //Warning("parsing [%s:%d] : error %d already defined.\n", file, linenum, errnum); - free(curproxy->errmsg.msg500); - } - curproxy->errmsg.msg500 = err; - curproxy->errmsg.len500 = errlen; - } - else if (errnum == 502) { - if (curproxy->errmsg.msg502) { - //Warning("parsing [%s:%d] : error %d already defined.\n", file, linenum, errnum); - free(curproxy->errmsg.msg502); - } - curproxy->errmsg.msg502 = err; - curproxy->errmsg.len502 = errlen; - } - else if (errnum == 503) { - if (curproxy->errmsg.msg503) { - //Warning("parsing [%s:%d] : error %d already defined.\n", file, linenum, errnum); - free(curproxy->errmsg.msg503); - } - curproxy->errmsg.msg503 = err; - curproxy->errmsg.len503 = errlen; - } - else if (errnum == 504) { - if (curproxy->errmsg.msg504) { - //Warning("parsing [%s:%d] : error %d already defined.\n", file, linenum, errnum); - free(curproxy->errmsg.msg504); - } - curproxy->errmsg.msg504 = err; - curproxy->errmsg.len504 = errlen; - } - else { - Warning("parsing [%s:%d] : error %d relocation will be ignored.\n", file, linenum, errnum); - free(err); - } - } - else { - Alert("parsing [%s:%d] : unknown keyword '%s' in '%s' section\n", file, linenum, args[0], "listen"); - return -1; - } - return 0; -} - - -/* - * This function reads and parses the configuration file given in the argument. - * returns 0 if OK, -1 if error. - */ -int readcfgfile(char *file) { - char thisline[256]; - char *line; - FILE *f; - int linenum = 0; - char *end; - char *args[MAX_LINE_ARGS]; - int arg; - int cfgerr = 0; - int nbchk, mininter; - int confsect = CFG_NONE; - - struct proxy *curproxy = NULL; - struct server *newsrv = NULL; - - if ((f=fopen(file,"r")) == NULL) - return -1; - - init_default_instance(); - - while (fgets(line = thisline, sizeof(thisline), f) != NULL) { - linenum++; - - end = line + strlen(line); - - /* skip leading spaces */ - while (isspace((int)*line)) - line++; - - arg = 0; - args[arg] = line; - - while (*line && arg < MAX_LINE_ARGS) { - /* first, we'll replace \\, \, \#, \r, \n, \t, \xXX with their - * C equivalent value. Other combinations left unchanged (eg: \1). - */ - if (*line == '\\') { - int skip = 0; - if (line[1] == ' ' || line[1] == '\\' || line[1] == '#') { - *line = line[1]; - skip = 1; - } - else if (line[1] == 'r') { - *line = '\r'; - skip = 1; - } - else if (line[1] == 'n') { - *line = '\n'; - skip = 1; - } - else if (line[1] == 't') { - *line = '\t'; - skip = 1; - } - else if (line[1] == 'x') { - if ((line + 3 < end ) && ishex(line[2]) && ishex(line[3])) { - unsigned char hex1, hex2; - hex1 = toupper(line[2]) - '0'; - hex2 = toupper(line[3]) - '0'; - if (hex1 > 9) hex1 -= 'A' - '9' - 1; - if (hex2 > 9) hex2 -= 'A' - '9' - 1; - *line = (hex1<<4) + hex2; - skip = 3; - } - else { - Alert("parsing [%s:%d] : invalid or incomplete '\\x' sequence in '%s'.\n", file, linenum, args[0]); - return -1; - } - } - if (skip) { - memmove(line + 1, line + 1 + skip, end - (line + skip + 1)); - end -= skip; - } - line++; - } - else if (*line == '#' || *line == '\n' || *line == '\r') { - /* end of string, end of loop */ - *line = 0; - break; - } - else if (isspace((int)*line)) { - /* a non-escaped space is an argument separator */ - *line++ = 0; - while (isspace((int)*line)) - line++; - args[++arg] = line; - } - else { - line++; - } - } - - /* empty line */ - if (!**args) - continue; - - /* zero out remaining args */ - while (++arg < MAX_LINE_ARGS) { - args[arg] = line; - } - - if (!strcmp(args[0], "listen") || !strcmp(args[0], "defaults")) /* new proxy */ - confsect = CFG_LISTEN; - else if (!strcmp(args[0], "global")) /* global config */ - confsect = CFG_GLOBAL; - /* else it's a section keyword */ - - switch (confsect) { - case CFG_LISTEN: - if (cfg_parse_listen(file, linenum, args) < 0) - return -1; - break; - case CFG_GLOBAL: - if (cfg_parse_global(file, linenum, args) < 0) - return -1; - break; - default: - Alert("parsing [%s:%d] : unknown keyword '%s' out of section.\n", file, linenum, args[0]); - return -1; - } - - - } - fclose(f); - - /* - * Now, check for the integrity of all that we have collected. - */ - - /* will be needed further to delay some tasks */ - tv_now(&now); - - if ((curproxy = proxy) == NULL) { - Alert("parsing %s : no line. Nothing to do !\n", - file); - return -1; - } - - while (curproxy != NULL) { - if (curproxy->state == PR_STSTOPPED) { - curproxy = curproxy->next; - continue; - } - - if (curproxy->listen == NULL) { - Alert("parsing %s : listener %s has no listen address. Please either specify a valid address on the line, or use the keyword.\n", file, curproxy->id); - cfgerr++; - } - else if ((curproxy->mode != PR_MODE_HEALTH) && - !(curproxy->options & (PR_O_TRANSP | PR_O_BALANCE)) && - (*(int *)&curproxy->dispatch_addr.sin_addr == 0)) { - Alert("parsing %s : listener %s has no dispatch address and is not in transparent or balance mode.\n", - file, curproxy->id); - cfgerr++; - } - else if ((curproxy->mode != PR_MODE_HEALTH) && (curproxy->options & PR_O_BALANCE)) { - if (curproxy->options & PR_O_TRANSP) { - Alert("parsing %s : listener %s cannot use both transparent and balance mode.\n", - file, curproxy->id); - cfgerr++; - } -#ifdef WE_DONT_SUPPORT_SERVERLESS_LISTENERS - else if (curproxy->srv == NULL) { - Alert("parsing %s : listener %s needs at least 1 server in balance mode.\n", - file, curproxy->id); - cfgerr++; - } -#endif - else if (*(int *)&curproxy->dispatch_addr.sin_addr != 0) { - Warning("parsing %s : dispatch address of listener %s will be ignored in balance mode.\n", - file, curproxy->id); - } - } - else if (curproxy->mode == PR_MODE_TCP || curproxy->mode == PR_MODE_HEALTH) { /* TCP PROXY or HEALTH CHECK */ - if (curproxy->cookie_name != NULL) { - Warning("parsing %s : cookie will be ignored for listener %s.\n", - file, curproxy->id); - } - if ((newsrv = curproxy->srv) != NULL) { - Warning("parsing %s : servers will be ignored for listener %s.\n", - file, curproxy->id); - } - if (curproxy->rsp_exp != NULL) { - Warning("parsing %s : server regular expressions will be ignored for listener %s.\n", - file, curproxy->id); - } - if (curproxy->req_exp != NULL) { - Warning("parsing %s : client regular expressions will be ignored for listener %s.\n", - file, curproxy->id); - } - } - else if (curproxy->mode == PR_MODE_HTTP) { /* HTTP PROXY */ - if ((curproxy->cookie_name != NULL) && ((newsrv = curproxy->srv) == NULL)) { - Alert("parsing %s : HTTP proxy %s has a cookie but no server list !\n", - file, curproxy->id); - cfgerr++; - } - } - - /* first, we will invert the servers list order */ - newsrv = NULL; - while (curproxy->srv) { - struct server *next; - - next = curproxy->srv->next; - curproxy->srv->next = newsrv; - newsrv = curproxy->srv; - if (!next) - break; - curproxy->srv = next; - } - - /* now, newsrv == curproxy->srv */ - if (newsrv) { - struct server *srv; - int pgcd; - int act, bck; - - /* We will factor the weights to reduce the table, - * using Euclide's largest common divisor algorithm - */ - pgcd = newsrv->uweight + 1; - for (srv = newsrv->next; srv && pgcd > 1; srv = srv->next) { - int t, w; - - w = srv->uweight + 1; - while (w) { - t = pgcd % w; - pgcd = w; - w = t; - } - } - - act = bck = 0; - for (srv = newsrv; srv; srv = srv->next) { - srv->eweight = ((srv->uweight + 1) / pgcd) - 1; - if (srv->state & SRV_BACKUP) - bck += srv->eweight + 1; - else - act += srv->eweight + 1; - } - - /* this is the largest map we will ever need for this servers list */ - if (act < bck) - act = bck; - - curproxy->srv_map = (struct server **)calloc(act, sizeof(struct server *)); - /* recounts servers and their weights */ - recount_servers(curproxy); - recalc_server_map(curproxy); - } - - if (curproxy->options & PR_O_LOGASAP) - curproxy->to_log &= ~LW_BYTES; - - if (curproxy->errmsg.msg400 == NULL) { - curproxy->errmsg.msg400 = (char *)HTTP_400; - curproxy->errmsg.len400 = strlen(HTTP_400); - } - if (curproxy->errmsg.msg403 == NULL) { - curproxy->errmsg.msg403 = (char *)HTTP_403; - curproxy->errmsg.len403 = strlen(HTTP_403); - } - if (curproxy->errmsg.msg408 == NULL) { - curproxy->errmsg.msg408 = (char *)HTTP_408; - curproxy->errmsg.len408 = strlen(HTTP_408); - } - if (curproxy->errmsg.msg500 == NULL) { - curproxy->errmsg.msg500 = (char *)HTTP_500; - curproxy->errmsg.len500 = strlen(HTTP_500); - } - if (curproxy->errmsg.msg502 == NULL) { - curproxy->errmsg.msg502 = (char *)HTTP_502; - curproxy->errmsg.len502 = strlen(HTTP_502); - } - if (curproxy->errmsg.msg503 == NULL) { - curproxy->errmsg.msg503 = (char *)HTTP_503; - curproxy->errmsg.len503 = strlen(HTTP_503); - } - if (curproxy->errmsg.msg504 == NULL) { - curproxy->errmsg.msg504 = (char *)HTTP_504; - curproxy->errmsg.len504 = strlen(HTTP_504); - } - - /* - * If this server supports a maxconn parameter, it needs a dedicated - * tasks to fill the emptied slots when a connection leaves. - */ - newsrv = curproxy->srv; - while (newsrv != NULL) { - if (newsrv->minconn >= newsrv->maxconn) { - /* Only 'minconn' was specified, or it was higher than or equal - * to 'maxconn'. Let's turn this into maxconn and clean it, as - * this will avoid further useless expensive computations. - */ - newsrv->maxconn = newsrv->minconn; - newsrv->minconn = 0; - } - - if (newsrv->maxconn > 0) { - struct task *t; - - if ((t = pool_alloc(task)) == NULL) { - Alert("parsing [%s:%d] : out of memory.\n", file, linenum); - return -1; - } - - t->next = t->prev = t->rqnext = NULL; /* task not in run queue yet */ - t->wq = LIST_HEAD(wait_queue[1]); /* already assigned to the eternity queue */ - t->state = TASK_IDLE; - t->process = process_srv_queue; - t->context = newsrv; - newsrv->queue_mgt = t; - - /* never run it unless specifically woken up */ - tv_eternity(&t->expire); - task_queue(t); - } - newsrv = newsrv->next; - } - - /* now we'll start this proxy's health checks if any */ - /* 1- count the checkers to run simultaneously */ - nbchk = 0; - mininter = 0; - newsrv = curproxy->srv; - while (newsrv != NULL) { - if (newsrv->state & SRV_CHECKED) { - if (!mininter || mininter > newsrv->inter) - mininter = newsrv->inter; - nbchk++; - } - newsrv = newsrv->next; - } - - /* 2- start them as far as possible from each others while respecting - * their own intervals. For this, we will start them after their own - * interval added to the min interval divided by the number of servers, - * weighted by the server's position in the list. - */ - if (nbchk > 0) { - struct task *t; - int srvpos; - - newsrv = curproxy->srv; - srvpos = 0; - while (newsrv != NULL) { - /* should this server be checked ? */ - if (newsrv->state & SRV_CHECKED) { - if ((t = pool_alloc(task)) == NULL) { - Alert("parsing [%s:%d] : out of memory.\n", file, linenum); - return -1; - } - - t->next = t->prev = t->rqnext = NULL; /* task not in run queue yet */ - t->wq = LIST_HEAD(wait_queue[0]); /* but already has a wait queue assigned */ - t->state = TASK_IDLE; - t->process = process_chk; - t->context = newsrv; - - /* check this every ms */ - tv_delayfrom(&t->expire, &now, - newsrv->inter + mininter * srvpos / nbchk); - task_queue(t); - //task_wakeup(&rq, t); - srvpos++; - } - newsrv = newsrv->next; - } - } - - curproxy = curproxy->next; - } - if (cfgerr > 0) { - Alert("Errors found in configuration file, aborting.\n"); - return -1; - } - else - return 0; -} - - -/* - * This function initializes all the necessary variables. It only returns - * if everything is OK. If something fails, it exits. - */ -void init(int argc, char **argv) { - int i; - int arg_mode = 0; /* MODE_DEBUG, ... */ - char *old_argv = *argv; - char *tmp; - char *cfg_pidfile = NULL; - - if (1<= 127 ). - * URL encoding only requires '"', '#' to be encoded as well as non- - * printable characters above. - */ - memset(hdr_encode_map, 0, sizeof(hdr_encode_map)); - memset(url_encode_map, 0, sizeof(url_encode_map)); - for (i = 0; i < 32; i++) { - FD_SET(i, hdr_encode_map); - FD_SET(i, url_encode_map); - } - for (i = 127; i < 256; i++) { - FD_SET(i, hdr_encode_map); - FD_SET(i, url_encode_map); - } - - tmp = "\"#{|}"; - while (*tmp) { - FD_SET(*tmp, hdr_encode_map); - tmp++; - } - - tmp = "\"#"; - while (*tmp) { - FD_SET(*tmp, url_encode_map); - tmp++; - } - - cfg_polling_mechanism = POLL_USE_SELECT; /* select() is always available */ -#if defined(ENABLE_POLL) - cfg_polling_mechanism |= POLL_USE_POLL; -#endif -#if defined(ENABLE_EPOLL) - cfg_polling_mechanism |= POLL_USE_EPOLL; -#endif - - pid = getpid(); - progname = *argv; - while ((tmp = strchr(progname, '/')) != NULL) - progname = tmp + 1; - - argc--; argv++; - while (argc > 0) { - char *flag; - - if (**argv == '-') { - flag = *argv+1; - - /* 1 arg */ - if (*flag == 'v') { - display_version(); - exit(0); - } -#if defined(ENABLE_EPOLL) - else if (*flag == 'd' && flag[1] == 'e') - cfg_polling_mechanism &= ~POLL_USE_EPOLL; -#endif -#if defined(ENABLE_POLL) - else if (*flag == 'd' && flag[1] == 'p') - cfg_polling_mechanism &= ~POLL_USE_POLL; -#endif - else if (*flag == 'V') - arg_mode |= MODE_VERBOSE; - else if (*flag == 'd' && flag[1] == 'b') - arg_mode |= MODE_FOREGROUND; - else if (*flag == 'd') - arg_mode |= MODE_DEBUG; - else if (*flag == 'c') - arg_mode |= MODE_CHECK; - else if (*flag == 'D') - arg_mode |= MODE_DAEMON | MODE_QUIET; - else if (*flag == 'q') - arg_mode |= MODE_QUIET; - else if (*flag == 's' && (flag[1] == 'f' || flag[1] == 't')) { - /* list of pids to finish ('f') or terminate ('t') */ - - if (flag[1] == 'f') - oldpids_sig = SIGUSR1; /* finish then exit */ - else - oldpids_sig = SIGTERM; /* terminate immediately */ - argv++; argc--; - - if (argc > 0) { - oldpids = calloc(argc, sizeof(int)); - while (argc > 0) { - oldpids[nb_oldpids] = atol(*argv); - if (oldpids[nb_oldpids] <= 0) - usage(old_argv); - argc--; argv++; - nb_oldpids++; - } - } - } -#if STATTIME > 0 - else if (*flag == 's') - arg_mode |= MODE_STATS; - else if (*flag == 'l') - arg_mode |= MODE_LOG; -#endif - else { /* >=2 args */ - argv++; argc--; - if (argc == 0) - usage(old_argv); - - switch (*flag) { - case 'n' : cfg_maxconn = atol(*argv); break; - case 'm' : global.rlimit_memmax = atol(*argv); break; - case 'N' : cfg_maxpconn = atol(*argv); break; - case 'f' : cfg_cfgfile = *argv; break; - case 'p' : cfg_pidfile = *argv; break; - default: usage(old_argv); - } - } - } - else - usage(old_argv); - argv++; argc--; - } - - global.mode = MODE_STARTING | /* during startup, we want most of the alerts */ - (arg_mode & (MODE_DAEMON | MODE_FOREGROUND | MODE_VERBOSE - | MODE_QUIET | MODE_CHECK | MODE_DEBUG)); - - if (!cfg_cfgfile) - usage(old_argv); - - gethostname(hostname, MAX_HOSTNAME_LEN); - - have_appsession = 0; - global.maxsock = 10; /* reserve 10 fds ; will be incremented by socket eaters */ - if (readcfgfile(cfg_cfgfile) < 0) { - Alert("Error reading configuration file : %s\n", cfg_cfgfile); - exit(1); - } - if (have_appsession) - appsession_init(); - - if (global.mode & MODE_CHECK) { - qfprintf(stdout, "Configuration file is valid : %s\n", cfg_cfgfile); - exit(0); - } - - if (cfg_maxconn > 0) - global.maxconn = cfg_maxconn; - - if (cfg_pidfile) { - if (global.pidfile) - free(global.pidfile); - global.pidfile = strdup(cfg_pidfile); - } - - if (global.maxconn == 0) - global.maxconn = DEFAULT_MAXCONN; - - global.maxsock += global.maxconn * 2; /* each connection needs two sockets */ - - if (arg_mode & (MODE_DEBUG | MODE_FOREGROUND)) { - /* command line debug mode inhibits configuration mode */ - global.mode &= ~(MODE_DAEMON | MODE_QUIET); - } - global.mode |= (arg_mode & (MODE_DAEMON | MODE_FOREGROUND | MODE_QUIET | - MODE_VERBOSE | MODE_DEBUG | MODE_STATS | MODE_LOG)); - - if ((global.mode & MODE_DEBUG) && (global.mode & (MODE_DAEMON | MODE_QUIET))) { - Warning(" mode incompatible with and . Keeping only.\n"); - global.mode &= ~(MODE_DAEMON | MODE_QUIET); - } - - if ((global.nbproc > 1) && !(global.mode & MODE_DAEMON)) { - if (!(global.mode & (MODE_FOREGROUND | MODE_DEBUG))) - Warning(" is only meaningful in daemon mode. Setting limit to 1 process.\n"); - global.nbproc = 1; - } - - if (global.nbproc < 1) - global.nbproc = 1; - - StaticReadEvent = (fd_set *)calloc(1, - sizeof(fd_set) * - (global.maxsock + FD_SETSIZE - 1) / FD_SETSIZE); - StaticWriteEvent = (fd_set *)calloc(1, - sizeof(fd_set) * - (global.maxsock + FD_SETSIZE - 1) / FD_SETSIZE); - - fdtab = (struct fdtab *)calloc(1, - sizeof(struct fdtab) * (global.maxsock)); - for (i = 0; i < global.maxsock; i++) { - fdtab[i].state = FD_STCLOSE; - } -} - -/* - * this function starts all the proxies. Its return value is composed from - * ERR_NONE, ERR_RETRYABLE and ERR_FATAL. Retryable errors will only be printed - * if is not zero. - */ -int start_proxies(int verbose) { - struct proxy *curproxy; - struct listener *listener; - int err = ERR_NONE; - int fd, pxerr; - - for (curproxy = proxy; curproxy != NULL; curproxy = curproxy->next) { - if (curproxy->state != PR_STNEW) - continue; /* already initialized */ - - pxerr = 0; - for (listener = curproxy->listen; listener != NULL; listener = listener->next) { - if (listener->fd != -1) - continue; /* already initialized */ - - if ((fd = socket(listener->addr.ss_family, SOCK_STREAM, IPPROTO_TCP)) == -1) { - if (verbose) - Alert("cannot create listening socket for proxy %s. Aborting.\n", - curproxy->id); - err |= ERR_RETRYABLE; - pxerr |= 1; - continue; - } - - if (fd >= global.maxsock) { - Alert("socket(): not enough free sockets for proxy %s. Raise -n argument. Aborting.\n", - curproxy->id); - close(fd); - err |= ERR_FATAL; - pxerr |= 1; - break; - } - - if ((fcntl(fd, F_SETFL, O_NONBLOCK) == -1) || - (setsockopt(fd, IPPROTO_TCP, TCP_NODELAY, - (char *) &one, sizeof(one)) == -1)) { - Alert("cannot make socket non-blocking for proxy %s. Aborting.\n", - curproxy->id); - close(fd); - err |= ERR_FATAL; - pxerr |= 1; - break; - } - - if (setsockopt(fd, SOL_SOCKET, SO_REUSEADDR, (char *) &one, sizeof(one)) == -1) { - Alert("cannot do so_reuseaddr for proxy %s. Continuing.\n", - curproxy->id); - } - -#ifdef SO_REUSEPORT - /* OpenBSD supports this. As it's present in old libc versions of Linux, - * it might return an error that we will silently ignore. - */ - setsockopt(fd, SOL_SOCKET, SO_REUSEPORT, (char *) &one, sizeof(one)); -#endif - if (bind(fd, - (struct sockaddr *)&listener->addr, - listener->addr.ss_family == AF_INET6 ? - sizeof(struct sockaddr_in6) : - sizeof(struct sockaddr_in)) == -1) { - if (verbose) - Alert("cannot bind socket for proxy %s. Aborting.\n", - curproxy->id); - close(fd); - err |= ERR_RETRYABLE; - pxerr |= 1; - continue; - } - - if (listen(fd, curproxy->maxconn) == -1) { - if (verbose) - Alert("cannot listen to socket for proxy %s. Aborting.\n", - curproxy->id); - close(fd); - err |= ERR_RETRYABLE; - pxerr |= 1; - continue; - } - - /* the socket is ready */ - listener->fd = fd; - - /* the function for the accept() event */ - fdtab[fd].read = &event_accept; - fdtab[fd].write = NULL; /* never called */ - fdtab[fd].owner = (struct task *)curproxy; /* reference the proxy instead of a task */ - fdtab[fd].state = FD_STLISTEN; - FD_SET(fd, StaticReadEvent); - fd_insert(fd); - listeners++; - } - - if (!pxerr) { - curproxy->state = PR_STRUN; - send_log(curproxy, LOG_NOTICE, "Proxy %s started.\n", curproxy->id); - } - } - - return err; -} - -int match_str(const void *key1, const void *key2) { - - appsess *temp1,*temp2; - temp1 = (appsess *)key1; - temp2 = (appsess *)key2; - - //fprintf(stdout,">>>>>>>>>>>>>>temp1->sessid :%s:\n",temp1->sessid); - //fprintf(stdout,">>>>>>>>>>>>>>temp2->sessid :%s:\n",temp2->sessid); - - return (strcmp(temp1->sessid,temp2->sessid) == 0); -}/* end match_str */ - -void destroy(void *data) { - appsess *temp1; - - //printf("destroy called\n"); - temp1 = (appsess *)data; - - if (temp1->sessid) - pool_free_to(apools.sessid, temp1->sessid); - - if (temp1->serverid) - pool_free_to(apools.serverid, temp1->serverid); - - pool_free(appsess, temp1); -} /* end destroy */ - -void appsession_cleanup( void ) -{ - struct proxy *p = proxy; - - while(p) { - chtbl_destroy(&(p->htbl_proxy)); - p = p->next; - } -}/* end appsession_cleanup() */ - -void pool_destroy(void **pool) -{ - void *temp, *next; - next = pool; - while (next) { - temp = next; - next = *(void **)temp; - free(temp); - } -}/* end pool_destroy() */ - -void deinit(void) { - struct proxy *p = proxy; - struct cap_hdr *h,*h_next; - struct server *s,*s_next; - struct listener *l,*l_next; - - while (p) { - if (p->id) - free(p->id); - - if (p->check_req) - free(p->check_req); - - if (p->cookie_name) - free(p->cookie_name); - - if (p->capture_name) - free(p->capture_name); - - /* only strup if the user have set in config. - When should we free it?! - if (p->errmsg.msg400) free(p->errmsg.msg400); - if (p->errmsg.msg403) free(p->errmsg.msg403); - if (p->errmsg.msg408) free(p->errmsg.msg408); - if (p->errmsg.msg500) free(p->errmsg.msg500); - if (p->errmsg.msg502) free(p->errmsg.msg502); - if (p->errmsg.msg503) free(p->errmsg.msg503); - if (p->errmsg.msg504) free(p->errmsg.msg504); - */ - if (p->appsession_name) - free(p->appsession_name); - - h = p->req_cap; - while (h) { - h_next = h->next; - if (h->name) - free(h->name); - pool_destroy(h->pool); - free(h); - h = h_next; - }/* end while(h) */ - - h = p->rsp_cap; - while (h) { - h_next = h->next; - if (h->name) - free(h->name); - - pool_destroy(h->pool); - free(h); - h = h_next; - }/* end while(h) */ - - s = p->srv; - while (s) { - s_next = s->next; - if (s->id) - free(s->id); - - if (s->cookie) - free(s->cookie); - - free(s); - s = s_next; - }/* end while(s) */ - - l = p->listen; - while (l) { - l_next = l->next; - free(l); - l = l_next; - }/* end while(l) */ - - pool_destroy((void **) p->req_cap_pool); - pool_destroy((void **) p->rsp_cap_pool); - p = p->next; - }/* end while(p) */ - - if (global.chroot) free(global.chroot); - if (global.pidfile) free(global.pidfile); - - if (StaticReadEvent) free(StaticReadEvent); - if (StaticWriteEvent) free(StaticWriteEvent); - if (fdtab) free(fdtab); - - pool_destroy(pool_session); - pool_destroy(pool_buffer); - pool_destroy(pool_fdtab); - pool_destroy(pool_requri); - pool_destroy(pool_task); - pool_destroy(pool_capture); - pool_destroy(pool_appsess); - - if (have_appsession) { - pool_destroy(apools.serverid); - pool_destroy(apools.sessid); - } -} /* end deinit() */ - -/* sends the signal to all pids found in */ -static void tell_old_pids(int sig) { - int p; - for (p = 0; p < nb_oldpids; p++) - kill(oldpids[p], sig); -} - -int main(int argc, char **argv) { - int err, retry; - struct rlimit limit; - FILE *pidfile = NULL; - init(argc, argv); - - signal(SIGQUIT, dump); - signal(SIGUSR1, sig_soft_stop); - signal(SIGHUP, sig_dump_state); -#ifdef DEBUG_MEMORY - signal(SIGINT, sig_int); - signal(SIGTERM, sig_term); -#endif - - /* on very high loads, a sigpipe sometimes happen just between the - * getsockopt() which tells "it's OK to write", and the following write :-( - */ -#ifndef MSG_NOSIGNAL - signal(SIGPIPE, SIG_IGN); -#endif - - /* We will loop at most 100 times with 10 ms delay each time. - * That's at most 1 second. We only send a signal to old pids - * if we cannot grab at least one port. - */ - retry = MAX_START_RETRIES; - err = ERR_NONE; - while (retry >= 0) { - struct timeval w; - err = start_proxies(retry == 0 || nb_oldpids == 0); - if (err != ERR_RETRYABLE) - break; - if (nb_oldpids == 0) - break; - - /* FIXME-20060514: Solaris and OpenBSD do not support shutdown() on - * listening sockets. So on those platforms, it would be wiser to - * simply send SIGUSR1, which will not be undoable. - */ - tell_old_pids(SIGTTOU); - /* give some time to old processes to stop listening */ - w.tv_sec = 0; - w.tv_usec = 10*1000; - select(0, NULL, NULL, NULL, &w); - retry--; - } - - /* Note: start_proxies() sends an alert when it fails. */ - if (err != ERR_NONE) { - if (retry != MAX_START_RETRIES && nb_oldpids) - tell_old_pids(SIGTTIN); - exit(1); - } - - if (listeners == 0) { - Alert("[%s.main()] No enabled listener found (check the keywords) ! Exiting.\n", argv[0]); - /* Note: we don't have to send anything to the old pids because we - * never stopped them. */ - exit(1); - } - - /* prepare pause/play signals */ - signal(SIGTTOU, sig_pause); - signal(SIGTTIN, sig_listen); - - if (global.mode & MODE_DAEMON) { - global.mode &= ~MODE_VERBOSE; - global.mode |= MODE_QUIET; - } - - /* MODE_QUIET can inhibit alerts and warnings below this line */ - - global.mode &= ~MODE_STARTING; - if ((global.mode & MODE_QUIET) && !(global.mode & MODE_VERBOSE)) { - /* detach from the tty */ - fclose(stdin); fclose(stdout); fclose(stderr); - close(0); close(1); close(2); - } - - /* open log & pid files before the chroot */ - if (global.mode & MODE_DAEMON && global.pidfile != NULL) { - int pidfd; - unlink(global.pidfile); - pidfd = open(global.pidfile, O_CREAT | O_WRONLY | O_TRUNC, 0644); - if (pidfd < 0) { - Alert("[%s.main()] Cannot create pidfile %s\n", argv[0], global.pidfile); - if (nb_oldpids) - tell_old_pids(SIGTTIN); - exit(1); - } - pidfile = fdopen(pidfd, "w"); - } - - /* chroot if needed */ - if (global.chroot != NULL) { - if (chroot(global.chroot) == -1) { - Alert("[%s.main()] Cannot chroot(%s).\n", argv[0], global.chroot); - if (nb_oldpids) - tell_old_pids(SIGTTIN); - } - chdir("/"); - } - - /* ulimits */ - if (!global.rlimit_nofile) - global.rlimit_nofile = global.maxsock; - - if (global.rlimit_nofile) { - limit.rlim_cur = limit.rlim_max = global.rlimit_nofile; - if (setrlimit(RLIMIT_NOFILE, &limit) == -1) { - Warning("[%s.main()] Cannot raise FD limit to %d.\n", argv[0], global.rlimit_nofile); - } - } - - if (global.rlimit_memmax) { - limit.rlim_cur = limit.rlim_max = - global.rlimit_memmax * 1048576 / global.nbproc; -#ifdef RLIMIT_AS - if (setrlimit(RLIMIT_AS, &limit) == -1) { - Warning("[%s.main()] Cannot fix MEM limit to %d megs.\n", - argv[0], global.rlimit_memmax); - } -#else - if (setrlimit(RLIMIT_DATA, &limit) == -1) { - Warning("[%s.main()] Cannot fix MEM limit to %d megs.\n", - argv[0], global.rlimit_memmax); - } -#endif - } - - if (nb_oldpids) - tell_old_pids(oldpids_sig); - - /* Note that any error at this stage will be fatal because we will not - * be able to restart the old pids. - */ - - /* setgid / setuid */ - if (global.gid && setgid(global.gid) == -1) { - Alert("[%s.main()] Cannot set gid %d.\n", argv[0], global.gid); - exit(1); - } - - if (global.uid && setuid(global.uid) == -1) { - Alert("[%s.main()] Cannot set uid %d.\n", argv[0], global.uid); - exit(1); - } - - /* check ulimits */ - limit.rlim_cur = limit.rlim_max = 0; - getrlimit(RLIMIT_NOFILE, &limit); - if (limit.rlim_cur < global.maxsock) { - Warning("[%s.main()] FD limit (%d) too low for maxconn=%d/maxsock=%d. Please raise 'ulimit-n' to %d or more to avoid any trouble.\n", - argv[0], limit.rlim_cur, global.maxconn, global.maxsock, global.maxsock); - } - - if (global.mode & MODE_DAEMON) { - int ret = 0; - int proc; - - /* the father launches the required number of processes */ - for (proc = 0; proc < global.nbproc; proc++) { - ret = fork(); - if (ret < 0) { - Alert("[%s.main()] Cannot fork.\n", argv[0]); - if (nb_oldpids) - exit(1); /* there has been an error */ - } - else if (ret == 0) /* child breaks here */ - break; - if (pidfile != NULL) { - fprintf(pidfile, "%d\n", ret); - fflush(pidfile); - } - } - /* close the pidfile both in children and father */ - if (pidfile != NULL) - fclose(pidfile); - free(global.pidfile); - - if (proc == global.nbproc) - exit(0); /* parent must leave */ - - /* if we're NOT in QUIET mode, we should now close the 3 first FDs to ensure - * that we can detach from the TTY. We MUST NOT do it in other cases since - * it would have already be done, and 0-2 would have been affected to listening - * sockets - */ - if (!(global.mode & MODE_QUIET)) { - /* detach from the tty */ - fclose(stdin); fclose(stdout); fclose(stderr); - close(0); close(1); close(2); /* close all fd's */ - global.mode |= MODE_QUIET; /* ensure that we won't say anything from now */ - } - pid = getpid(); /* update child's pid */ - setsid(); - } - -#if defined(ENABLE_EPOLL) - if (cfg_polling_mechanism & POLL_USE_EPOLL) { - if (epoll_loop(POLL_LOOP_ACTION_INIT)) { - epoll_loop(POLL_LOOP_ACTION_RUN); - epoll_loop(POLL_LOOP_ACTION_CLEAN); - cfg_polling_mechanism &= POLL_USE_EPOLL; - } - else { - Warning("epoll() is not available. Using poll()/select() instead.\n"); - cfg_polling_mechanism &= ~POLL_USE_EPOLL; - } - } -#endif - -#if defined(ENABLE_POLL) - if (cfg_polling_mechanism & POLL_USE_POLL) { - if (poll_loop(POLL_LOOP_ACTION_INIT)) { - poll_loop(POLL_LOOP_ACTION_RUN); - poll_loop(POLL_LOOP_ACTION_CLEAN); - cfg_polling_mechanism &= POLL_USE_POLL; - } - else { - Warning("poll() is not available. Using select() instead.\n"); - cfg_polling_mechanism &= ~POLL_USE_POLL; - } - } -#endif - if (cfg_polling_mechanism & POLL_USE_SELECT) { - if (select_loop(POLL_LOOP_ACTION_INIT)) { - select_loop(POLL_LOOP_ACTION_RUN); - select_loop(POLL_LOOP_ACTION_CLEAN); - cfg_polling_mechanism &= POLL_USE_SELECT; - } - } - - - /* Free all Hash Keys and all Hash elements */ - appsession_cleanup(); - /* Do some cleanup */ - deinit(); - - exit(0); -} - -#if defined(DEBUG_HASH) -static void print_table(const CHTbl *htbl) { - - ListElmt *element; - int i; - appsess *asession; - - /***************************************************************************** - * * - * Display the chained hash table. * - * * - *****************************************************************************/ - - fprintf(stdout, "Table size is %d\n", chtbl_size(htbl)); - - for (i = 0; i < TBLSIZ; i++) { - fprintf(stdout, "Bucket[%03d]\n", i); - - for (element = list_head(&htbl->table[i]); element != NULL; element = list_next(element)) { - //fprintf(stdout, "%c", *(char *)list_data(element)); - asession = (appsess *)list_data(element); - fprintf(stdout, "ELEM :%s:", asession->sessid); - fprintf(stdout, " Server :%s: \n", asession->serverid); - //fprintf(stdout, " Server request_count :%li:\n",asession->request_count); - } - - fprintf(stdout, "\n"); - } - return; -} /* end print_table */ -#endif - -static int appsession_init(void) -{ - static int initialized = 0; - int idlen; - struct server *s; - struct proxy *p = proxy; - - if (!initialized) { - if (!appsession_task_init()) { - apools.sessid = NULL; - apools.serverid = NULL; - apools.ser_waste = 0; - apools.ser_use = 0; - apools.ser_msize = sizeof(void *); - apools.ses_waste = 0; - apools.ses_use = 0; - apools.ses_msize = sizeof(void *); - while (p) { - s = p->srv; - if (apools.ses_msize < p->appsession_len) - apools.ses_msize = p->appsession_len; - while (s) { - idlen = strlen(s->id); - if (apools.ser_msize < idlen) - apools.ser_msize = idlen; - s = s->next; - } - p = p->next; - } - apools.ser_msize ++; /* we use strings, so reserve space for '\0' */ - apools.ses_msize ++; - } - else { - fprintf(stderr, "appsession_task_init failed\n"); - return -1; - } - initialized ++; - } - return 0; -} - -static int appsession_task_init(void) -{ - static int initialized = 0; - struct task *t; - if (!initialized) { - if ((t = pool_alloc(task)) == NULL) - return -1; - t->next = t->prev = t->rqnext = NULL; - t->wq = LIST_HEAD(wait_queue[0]); - t->state = TASK_IDLE; - t->context = NULL; - tv_delayfrom(&t->expire, &now, TBLCHKINT); - task_queue(t); - t->process = appsession_refresh; - initialized ++; - } - return 0; -} - -static int appsession_refresh(struct task *t) { - struct proxy *p = proxy; - CHTbl *htbl; - ListElmt *element, *last; - int i; - appsess *asession; - void *data; - - while (p) { - if (p->appsession_name != NULL) { - htbl = &p->htbl_proxy; - /* if we ever give up the use of TBLSIZ, we need to change this */ - for (i = 0; i < TBLSIZ; i++) { - last = NULL; - for (element = list_head(&htbl->table[i]); element != NULL; element = list_next(element)) { - asession = (appsess *)list_data(element); - if (tv_cmp2_ms(&asession->expire, &now) <= 0) { - if ((global.mode & MODE_DEBUG) && (!(global.mode & MODE_QUIET) || (global.mode & MODE_VERBOSE))) { - int len; - /* - on Linux NULL pointers are catched by sprintf, on solaris -> segfault - */ - len = sprintf(trash, "appsession_refresh: cleaning up expired Session '%s' on Server %s\n", - asession->sessid, asession->serverid?asession->serverid:"(null)"); - write(1, trash, len); - } - /* delete the expired element from within the hash table */ - if ((list_rem_next(&htbl->table[i], last, (void **)&data) == 0) - && (htbl->table[i].destroy != NULL)) { - htbl->table[i].destroy(data); - } - if (last == NULL) {/* patient lost his head, get a new one */ - element = list_head(&htbl->table[i]); - if (element == NULL) break; /* no heads left, go to next patient */ - } - else - element = last; - }/* end if (tv_cmp2_ms(&asession->expire, &now) <= 0) */ - else - last = element; - }/* end for (element = list_head(&htbl->table[i]); element != NULL; element = list_next(element)) */ - } - } - p = p->next; - } - tv_delayfrom(&t->expire, &now, TBLCHKINT); /* check expiration every 5 seconds */ - return TBLCHKINT; -} /* end appsession_refresh */ - - -/* - * Local variables: - * c-indent-level: 4 - * c-basic-offset: 4 - * End: - */ diff --git a/include/appsession.h b/include/appsession.h deleted file mode 100644 index 8a3103459..000000000 --- a/include/appsession.h +++ /dev/null @@ -1,44 +0,0 @@ -#ifndef _APPSESS_H -#define _APPSESS_H - -#define TBLSIZ 10 -#define TBLCHKINT 5000 /* The time between two calls of appsession_refresh in ms */ - -/* - These Parts are copied from - - http://www.oreilly.com/catalog/masteralgoc/index.html - Mastering Algorithms with C - By Kyle Loudon - ISBN: 1-56592-453-3 - Publishd by O'Reilly - - We have added our own struct to these function. - */ - -#include -#include -#include -/* end of copied parts */ - -struct app_pool { - void **sessid; - void **serverid; - int ses_waste, ses_use, ses_msize; - int ser_waste, ser_use, ser_msize; -}; - -struct app_pool apools; -int have_appsession; - -/* Callback for hash_lookup */ -int match_str(const void *key1, const void *key2); - -/* Callback for destroy */ -void destroy(void *data); - -#if defined(DEBUG_HASH) -static void print_table(const CHTbl *htbl); -#endif - -#endif diff --git a/include/haproxy/appsession.h b/include/haproxy/appsession.h new file mode 100644 index 000000000..94a7e65cc --- /dev/null +++ b/include/haproxy/appsession.h @@ -0,0 +1,58 @@ +#ifndef _HAPROXY_APPSESS_H +#define _HAPROXY_APPSESS_H + +#define TBLSIZ 10 +#define TBLCHKINT 5000 /* The time between two calls of appsession_refresh in ms */ + +#include + +#include +#include +#include + +#include + +typedef struct appsessions { + char *sessid; + char *serverid; + struct timeval expire; /* next expiration time for this application session */ + unsigned long int request_count; +} appsess; + +#define sizeof_appsess sizeof(struct appsessions) +extern void **pool_appsess; + +struct app_pool { + void **sessid; + void **serverid; + int ses_waste, ses_use, ses_msize; + int ser_waste, ser_use, ser_msize; +}; + +extern struct app_pool apools; +extern int have_appsession; + + +/* Callback for hash_lookup */ +int match_str(const void *key1, const void *key2); + +/* Callback for destroy */ +void destroy(void *data); + +#if defined(DEBUG_HASH) +static void print_table(const CHTbl *htbl); +#endif + +int appsession_refresh(struct task *t); +int appsession_task_init(void); +int appsession_init(void); +void appsession_cleanup(void); + +#endif /* _HAPROXY_APPSESS_H */ + +/* + * Local variables: + * c-indent-level: 8 + * c-basic-offset: 8 + * End: + */ diff --git a/include/base64.h b/include/haproxy/base64.h similarity index 66% rename from include/base64.h rename to include/haproxy/base64.h index 6408acfd0..d22d903a4 100644 --- a/include/base64.h +++ b/include/haproxy/base64.h @@ -1,6 +1,8 @@ /* + * include/haproxy/base64.h * Ascii to Base64 conversion as described in RFC1421. - * Copyright 2006 Willy Tarreau + * + * Copyright 2006 Willy Tarreau * * This program is free software; you can redistribute it and/or * modify it under the terms of the GNU General Public License @@ -9,9 +11,10 @@ * */ -#ifndef BASE64_H -#define BASE64_H +#ifndef _HAPROXY_BASE64_H +#define _HAPROXY_BASE64_H int a2base64(char *in, int ilen, char *out, int olen); +extern const char base64tab[]; -#endif /* BASE64_H */ +#endif /* _HAPROXY_BASE64_H */ diff --git a/include/haproxy/cfgparse.h b/include/haproxy/cfgparse.h new file mode 100644 index 000000000..f945d9c20 --- /dev/null +++ b/include/haproxy/cfgparse.h @@ -0,0 +1,45 @@ +/* + include/haproxy/cfgparse.h + Configuration parsing functions. + + Copyright (C) 2000-2006 Willy Tarreau - w@1wt.eu + + This library is free software; you can redistribute it and/or + modify it under the terms of the GNU Lesser General Public + License as published by the Free Software Foundation, version 2.1 + exclusively. + + This library is distributed in the hope that it will be useful, + but WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this library; if not, write to the Free Software + Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA +*/ + +#ifndef _HAPROXY_CFGPARSE_H +#define _HAPROXY_CFGPARSE_H + +/* configuration sections */ +#define CFG_NONE 0 +#define CFG_GLOBAL 1 +#define CFG_LISTEN 2 + +extern int cfg_maxpconn; +extern int cfg_maxconn; + +int cfg_parse_global(char *file, int linenum, char **args); +int cfg_parse_listen(char *file, int linenum, char **args); +int readcfgfile(char *file); + + +#endif /* _HAPROXY_CFGPARSE_H */ + +/* + * Local variables: + * c-indent-level: 8 + * c-basic-offset: 8 + * End: + */ diff --git a/include/chtbl.h b/include/haproxy/chtbl.h similarity index 96% rename from include/chtbl.h rename to include/haproxy/chtbl.h index 87b777ac1..fe4de70e4 100644 --- a/include/chtbl.h +++ b/include/haproxy/chtbl.h @@ -15,8 +15,8 @@ * * *****************************************************************************/ -#ifndef CHTBL_H -#define CHTBL_H +#ifndef _HAPROXY_CHTBL_H +#define _HAPROXY_CHTBL_H #include @@ -59,4 +59,5 @@ int chtbl_lookup(const CHTbl *htbl, void **data); #define chtbl_size(htbl) ((htbl)->size) -#endif +#endif /* _HAPROXY_CHTBL_H */ + diff --git a/include/haproxy/compat.h b/include/haproxy/compat.h new file mode 100644 index 000000000..bf4c843c7 --- /dev/null +++ b/include/haproxy/compat.h @@ -0,0 +1,62 @@ +/* + include/haproxy/compat.h + Operating system compatibility interface. + + Copyright (C) 2000-2006 Willy Tarreau - w@1wt.eu + + This library is free software; you can redistribute it and/or + modify it under the terms of the GNU Lesser General Public + License as published by the Free Software Foundation, version 2.1 + exclusively. + + This library is distributed in the hope that it will be useful, + but WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this library; if not, write to the Free Software + Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA +*/ + +#ifndef _HAPROXY_COMPAT_H +#define _HAPROXY_COMPAT_H + +/* This is needed on Linux for Netfilter includes */ +#include + +/* INTBITS + * how many bits are needed to code the size of an int on the target platform. + * (eg: 32bits -> 5) + */ +#define INTBITS 5 + +/* this is for libc5 for example */ +#ifndef TCP_NODELAY +#define TCP_NODELAY 1 +#endif + +#ifndef SHUT_RD +#define SHUT_RD 0 +#endif + +#ifndef SHUT_WR +#define SHUT_WR 1 +#endif + +#if defined(TPROXY) && defined(NETFILTER) +#include +#endif + +#if defined(__dietlibc__) +#include +#endif + +#endif /* _HAPROXY_COMPAT_H */ + +/* + * Local variables: + * c-indent-level: 8 + * c-basic-offset: 8 + * End: + */ diff --git a/include/haproxy/config.h b/include/haproxy/config.h new file mode 100644 index 000000000..968e3c151 --- /dev/null +++ b/include/haproxy/config.h @@ -0,0 +1,34 @@ +/* + include/haproxy/config.h + This files contains most of the user-configurable settings. + + Copyright (C) 2000-2006 Willy Tarreau - w@1wt.eu + + This library is free software; you can redistribute it and/or + modify it under the terms of the GNU Lesser General Public + License as published by the Free Software Foundation, version 2.1 + exclusively. + + This library is distributed in the hope that it will be useful, + but WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this library; if not, write to the Free Software + Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA +*/ + +#ifndef _HAPROXY_CONFIG_H +#define _HAPROXY_CONFIG_H + +#include + +/* this reduces the number of calls to select() by choosing appropriate + * sheduler precision in milliseconds. It should be near the minimum + * time that is needed by select() to collect all events. All timeouts + * are rounded up by adding this value prior to pass it to select(). + */ +#define SCHEDULER_RESOLUTION 9 + +#endif /* _HAPROXY_CONFIG_H */ diff --git a/include/haproxy/defaults.h b/include/haproxy/defaults.h new file mode 100644 index 000000000..f01dc67f6 --- /dev/null +++ b/include/haproxy/defaults.h @@ -0,0 +1,94 @@ +/* + include/haproxy/defaults.h + Miscellaneous default values. + + Copyright (C) 2000-2006 Willy Tarreau - w@1wt.eu + + This library is free software; you can redistribute it and/or + modify it under the terms of the GNU Lesser General Public + License as published by the Free Software Foundation, version 2.1 + exclusively. + + This library is distributed in the hope that it will be useful, + but WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this library; if not, write to the Free Software + Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA +*/ + +#ifndef _HAPROXY_DEFAULTS_H +#define _HAPROXY_DEFAULTS_H + + +/* CONFIG_HAP_MEM_OPTIM + * This enables use of memory pools instead of malloc()/free(). There + * is no reason to disable it, except perhaps for rare debugging. + */ +#ifndef CONFIG_HAP_NO_MEM_OPTIM +# define CONFIG_HAP_MEM_OPTIM +#endif /* CONFIG_HAP_NO_MEM_OPTIM */ + +/* + * BUFSIZE defines the size of a read and write buffer. It is the maximum + * amount of bytes which can be stored by the proxy for each session. However, + * when reading HTTP headers, the proxy needs some spare space to add or rewrite + * headers if needed. The size of this spare is defined with MAXREWRITE. So it + * is not possible to process headers longer than BUFSIZE-MAXREWRITE bytes. By + * default, BUFSIZE=16384 bytes and MAXREWRITE=BUFSIZE/2, so the maximum length + * of headers accepted is 8192 bytes, which is in line with Apache's limits. + */ +#ifndef BUFSIZE +#define BUFSIZE 16384 +#endif + +// reserved buffer space for header rewriting +#ifndef MAXREWRITE +#define MAXREWRITE (BUFSIZE / 2) +#endif + +#define REQURI_LEN 1024 +#define CAPTURE_LEN 64 + +// max # args on a configuration line +#define MAX_LINE_ARGS 40 + +// max # of added headers per request +#define MAX_NEWHDR 10 + +// max # of matches per regexp +#define MAX_MATCH 10 + +// cookie delimitor in "prefix" mode. This character is inserted between the +// persistence cookie and the original value. The '~' is allowed by RFC2965, +// and should not be too common in server names. +#ifndef COOKIE_DELIM +#define COOKIE_DELIM '~' +#endif + +#define CONN_RETRIES 3 + +#define CHK_CONNTIME 2000 +#define DEF_CHKINTR 2000 +#define DEF_FALLTIME 3 +#define DEF_RISETIME 2 +#define DEF_CHECK_REQ "OPTIONS / HTTP/1.0\r\n\r\n" + +/* Default connections limit. + * + * A system limit can be enforced at build time in order to avoid using haproxy + * beyond reasonable system limits. For this, just define SYSTEM_MAXCONN to the + * absolute limit accepted by the system. If the configuration specifies a + * higher value, it will be capped to SYSTEM_MAXCONN and a warning will be + * emitted. The only way to override this limit will be to set it via the + * command-line '-n' argument. + */ +#ifndef SYSTEM_MAXCONN +#define DEFAULT_MAXCONN 2000 +#else +#define DEFAULT_MAXCONN SYSTEM_MAXCONN +#endif + +#endif /* _HAPROXY_DEFAULTS_H */ diff --git a/include/epoll.h b/include/haproxy/epoll.h similarity index 53% rename from include/epoll.h rename to include/haproxy/epoll.h index 189242e78..d1bd112f1 100644 --- a/include/epoll.h +++ b/include/haproxy/epoll.h @@ -1,3 +1,24 @@ +/* + include/haproxy/epoll.h + epoll definitions for older libc. + + Copyright (C) 2000-2006 Willy Tarreau - w@1wt.eu + + This library is free software; you can redistribute it and/or + modify it under the terms of the GNU Lesser General Public + License as published by the Free Software Foundation, version 2.1 + exclusively. + + This library is distributed in the hope that it will be useful, + but WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this library; if not, write to the Free Software + Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA +*/ + /* * Those constants were found both in glibc and in the Linux kernel. * They are provided here because the epoll() syscall is featured in @@ -5,6 +26,9 @@ * just a basic definition. */ +#ifndef _HAPROXY_EPOLL_H +#define _HAPROXY_EPOLL_H + #include #include @@ -27,13 +51,13 @@ #endif struct epoll_event { - uint32_t events; - union { - void *ptr; - int fd; - uint32_t u32; - uint64_t u64; - } data; + uint32_t events; + union { + void *ptr; + int fd; + uint32_t u32; + uint64_t u64; + } data; }; @@ -64,6 +88,16 @@ struct epoll_event { #define __NR_epoll_wait 256 #endif -_syscall1 (int, epoll_create, int, size); -_syscall4 (int, epoll_ctl, int, epfd, int, op, int, fd, struct epoll_event *, event); -_syscall4 (int, epoll_wait, int, epfd, struct epoll_event *, events, int, maxevents, int, timeout); +extern int epoll_create(int size); +extern int epoll_ctl(int epfd, int op, int fd, struct epoll_event * event); +extern int epoll_wait(int epfd, struct epoll_event * events, int maxevents, int timeout); + +#endif /* _HAPROXY_EPOLL_H */ + + +/* + * Local variables: + * c-indent-level: 8 + * c-basic-offset: 8 + * End: + */ diff --git a/include/hashpjw.h b/include/haproxy/hashpjw.h similarity index 83% rename from include/hashpjw.h rename to include/haproxy/hashpjw.h index a20b5b3b2..2788395db 100644 --- a/include/hashpjw.h +++ b/include/haproxy/hashpjw.h @@ -16,17 +16,8 @@ * * *****************************************************************************/ -#ifndef HASHPJW_H -#define HASHPJW_H - -#include - -typedef struct appsessions { - char *sessid; - char *serverid; - struct timeval expire; /* next expiration time for this application session */ - unsigned long int request_count; -} appsess; /* end struct appsessions */ +#ifndef _HAPROXY_HASHPJW_H +#define _HAPROXY_HASHPJW_H /***************************************************************************** * * @@ -44,4 +35,4 @@ typedef struct appsessions { int hashpjw(const void *key); -#endif +#endif /* _HAPROXY_HASHPJW_H */ diff --git a/include/list.h b/include/haproxy/list.h similarity index 85% rename from include/list.h rename to include/haproxy/list.h index ae7f0868e..16895734c 100644 --- a/include/list.h +++ b/include/haproxy/list.h @@ -15,8 +15,8 @@ * * *****************************************************************************/ -#ifndef LIST_H -#define LIST_H +#ifndef _HAPROXY_LIST_H +#define _HAPROXY_LIST_H #include @@ -27,9 +27,8 @@ *****************************************************************************/ typedef struct ListElmt_ { - - void *data; - struct ListElmt_ *next; + void *data; + struct ListElmt_ *next; } ListElmt; /***************************************************************************** @@ -39,12 +38,12 @@ typedef struct ListElmt_ { *****************************************************************************/ typedef struct List_ { - int size; - int (*match)(const void *key1, const void *key2); - void (*destroy)(void *data); + int size; + int (*match)(const void *key1, const void *key2); + void (*destroy)(void *data); - ListElmt *head; - ListElmt *tail; + ListElmt *head; + ListElmt *tail; } List; /***************************************************************************** @@ -75,4 +74,11 @@ int list_rem_next(List *list, ListElmt *element, void **data); #define list_next(element) ((element)->next) -#endif +#endif /* _HAPROXY_LIST_H */ + +/* + * Local variables: + * c-indent-level: 8 + * c-basic-offset: 8 + * End: + */ diff --git a/include/haproxy/memory.h b/include/haproxy/memory.h new file mode 100644 index 000000000..3f269d2c8 --- /dev/null +++ b/include/haproxy/memory.h @@ -0,0 +1,122 @@ +/* + include/haproxy/memory.h + Memory management definitions.. + + Copyright (C) 2000-2006 Willy Tarreau - w@1wt.eu + + This library is free software; you can redistribute it and/or + modify it under the terms of the GNU Lesser General Public + License as published by the Free Software Foundation, version 2.1 + exclusively. + + This library is distributed in the hope that it will be useful, + but WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this library; if not, write to the Free Software + Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA +*/ + +#ifndef _HAPROXY_MEMORY_H +#define _HAPROXY_MEMORY_H + +#include + +#include + +#define sizeof_requri REQURI_LEN +#define sizeof_capture CAPTURE_LEN +/* + * Returns a pointer to an area of <__len> bytes taken from the pool or + * dynamically allocated. In the first case, <__pool> is updated to point to + * the next element in the list. + */ +#define pool_alloc_from(__pool, __len) \ +({ \ + void *__p; \ + if ((__p = (__pool)) == NULL) \ + __p = malloc(((__len) >= sizeof (void *)) ? \ + (__len) : sizeof(void *)); \ + else { \ + __pool = *(void **)(__pool); \ + } \ + __p; \ +}) + +/* + * Puts a memory area back to the corresponding pool. + * Items are chained directly through a pointer that + * is written in the beginning of the memory area, so + * there's no need for any carrier cell. This implies + * that each memory area is at least as big as one + * pointer. + */ +#define pool_free_to(__pool, __ptr) \ +({ \ + *(void **)(__ptr) = (void *)(__pool); \ + __pool = (void *)(__ptr); \ +}) + + +#ifdef CONFIG_HAP_MEM_OPTIM +/* + * Returns a pointer to type taken from the + * pool or dynamically allocated. In the + * first case, is updated to point to the + * next element in the list. + */ +#define pool_alloc(type) \ +({ \ + void *__p; \ + if ((__p = pool_##type) == NULL) \ + __p = malloc(sizeof_##type); \ + else { \ + pool_##type = *(void **)pool_##type; \ + } \ + __p; \ +}) + +/* + * Puts a memory area back to the corresponding pool. + * Items are chained directly through a pointer that + * is written in the beginning of the memory area, so + * there's no need for any carrier cell. This implies + * that each memory area is at least as big as one + * pointer. + */ +#define pool_free(type, ptr) \ +({ \ + *(void **)ptr = (void *)pool_##type; \ + pool_##type = (void *)ptr; \ +}) + +#else +#define pool_alloc(type) (calloc(1,sizeof_##type)) +#define pool_free(type, ptr) (free(ptr)) +#endif /* CONFIG_HAP_MEM_OPTIM */ + +/* + * This function destroys a pull by freeing it completely. + * This should be called only under extreme circumstances. + */ +static inline void pool_destroy(void **pool) +{ + void *temp, *next; + next = pool; + while (next) { + temp = next; + next = *(void **)temp; + free(temp); + } +} + +#endif /* _HAPROXY_MEMORY_H */ + +/* + * Local variables: + * c-indent-level: 8 + * c-basic-offset: 8 + * End: + */ diff --git a/include/mini-clist.h b/include/haproxy/mini-clist.h similarity index 95% rename from include/mini-clist.h rename to include/haproxy/mini-clist.h index 899e20c17..bf9bbe93c 100644 --- a/include/mini-clist.h +++ b/include/haproxy/mini-clist.h @@ -1,11 +1,11 @@ /* * list.h : list manipulation macros and structures. - * (C) 2002-2006 - Willy Tarreau - willy@ant-computing.com + * Copyright 2002-2006 Willy Tarreau * */ -#ifndef __MINI_CLIST_H__ -#define __MINI_CLIST_H__ +#ifndef _HAPROXY_MINI_CLIST_H +#define _HAPROXY_MINI_CLIST_H /* these are circular or bidirectionnal lists only. Each list pointer points to * another list pointer in a structure, and not the structure itself. The @@ -17,6 +17,8 @@ struct list { struct list *p; /* prev */ }; +#define LIST_HEAD(a) ((void *)(&(a))) + #define LIST_INIT(l) ((l)->n = (l)->p = (l)) /* dual linked lists : @@ -89,4 +91,4 @@ struct list { for ( ; (iterator) != (end_item); (iterator) = (backup), \ backup = LIST_ELEM((iterator)->struct_member.n, struct_type, struct_member)) -#endif /* __MINI_CLIST_H__ */ +#endif /* _HAPROXY_MINI_CLIST_H */ diff --git a/include/haproxy/regex.h b/include/haproxy/regex.h new file mode 100644 index 000000000..03b4ca690 --- /dev/null +++ b/include/haproxy/regex.h @@ -0,0 +1,61 @@ +/* + include/haproxy/regex.h + This file defines everything related to regular expressions. + + Copyright (C) 2000-2006 Willy Tarreau - w@1wt.eu + + This library is free software; you can redistribute it and/or + modify it under the terms of the GNU Lesser General Public + License as published by the Free Software Foundation, version 2.1 + exclusively. + + This library is distributed in the hope that it will be useful, + but WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this library; if not, write to the Free Software + Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA +*/ + +#ifndef _HAPROXY_REGEX_H +#define _HAPROXY_REGEX_H + +#include + +#ifdef USE_PCRE +#include +#include +#else +#include +#endif + +/* what to do when a header matches a regex */ +#define ACT_ALLOW 0 /* allow the request */ +#define ACT_REPLACE 1 /* replace the matching header */ +#define ACT_REMOVE 2 /* remove the matching header */ +#define ACT_DENY 3 /* deny the request */ +#define ACT_PASS 4 /* pass this header without allowing or denying the request */ + +struct hdr_exp { + struct hdr_exp *next; + regex_t *preg; /* expression to look for */ + int action; /* ACT_ALLOW, ACT_REPLACE, ACT_REMOVE, ACT_DENY */ + char *replace; /* expression to set instead */ +}; + +extern regmatch_t pmatch[MAX_MATCH]; + +int exp_replace(char *dst, char *src, char *str, regmatch_t *matches); +char *check_replace_string(char *str); +char *chain_regex(struct hdr_exp **head, regex_t *preg, int action, char *replace); + +#endif /* _HAPROXY_REGEX_H */ + +/* + * Local variables: + * c-indent-level: 8 + * c-basic-offset: 8 + * End: + */ diff --git a/include/haproxy/standard.h b/include/haproxy/standard.h new file mode 100644 index 000000000..05a2b0dbb --- /dev/null +++ b/include/haproxy/standard.h @@ -0,0 +1,92 @@ +/* + include/haproxy/standard.h + This files contains some general purpose functions and macros. + + Copyright (C) 2000-2006 Willy Tarreau - w@1wt.eu + + This library is free software; you can redistribute it and/or + modify it under the terms of the GNU Lesser General Public + License as published by the Free Software Foundation, version 2.1 + exclusively. + + This library is distributed in the hope that it will be useful, + but WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this library; if not, write to the Free Software + Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA +*/ + +#ifndef _HAPROXY_STANDARD_H +#define _HAPROXY_STANDARD_H + +#include +#include +#include + + +/****** string-specific macros and functions ******/ +/* if a > max, then bound to . The macro returns the new */ +#define UBOUND(a, max) ({ typeof(a) b = (max); if ((a) > b) (a) = b; (a); }) + +/* if a < min, then bound to . The macro returns the new */ +#define LBOUND(a, min) ({ typeof(a) b = (min); if ((a) < b) (a) = b; (a); }) + +/* returns 1 only if only zero or one bit is set in X, which means that X is a + * power of 2, and 0 otherwise */ +#define POWEROF2(x) (((x) & ((x)-1)) == 0) + + +/* + * copies at most chars from to . Last char is always + * set to 0, unless is 0. The number of chars copied is returned + * (excluding the terminating zero). + * This code has been optimized for size and speed : on x86, it's 45 bytes + * long, uses only registers, and consumes only 4 cycles per char. + */ +extern int strlcpy2(char *dst, const char *src, int size); + +/* + * This function simply returns a statically allocated string containing + * the ascii representation for number 'n' in decimal. + */ +extern char *ultoa(unsigned long n); + +/* + * Returns non-zero if character is a hex digit (0-9, a-f, A-F), else zero. + */ +extern int ishex(char s); + +/* + * converts to a struct sockaddr_in* which is locally allocated. + * The format is "addr:port", where "addr" can be a dotted IPv4 address, + * a host name, or empty or "*" to indicate INADDR_ANY. + */ +struct sockaddr_in *str2sa(char *str); + +/* + * converts to a two struct in_addr* which are locally allocated. + * The format is "addr[/mask]", where "addr" cannot be empty, and mask + * is optionnal and either in the dotted or CIDR notation. + * Note: "addr" can also be a hostname. Returns 1 if OK, 0 if error. + */ +int str2net(char *str, struct in_addr *addr, struct in_addr *mask); + +/* will try to encode the string replacing all characters tagged in + * with the hexadecimal representation of their ASCII-code (2 digits) + * prefixed by , and will store the result between (included) + * and (excluded), and will always terminate the string with a '\0' + * before . The position of the '\0' is returned if the conversion + * completes. If bytes are missing between and , then the + * conversion will be incomplete and truncated. If <= , the '\0' + * cannot even be stored so we return without writing the 0. + * The input string must also be zero-terminated. + */ +extern const char hextab[]; +char *encode_string(char *start, char *stop, + const char escape, const fd_set *map, + const char *string); + +#endif /* _HAPROXY_STANDARD_H */ diff --git a/include/haproxy/template.h b/include/haproxy/template.h new file mode 100644 index 000000000..da2b9d5d1 --- /dev/null +++ b/include/haproxy/template.h @@ -0,0 +1,33 @@ +/* + include/haproxy/template.h + This file serves as a template for future include files. + + Copyright (C) 2000-2006 Willy Tarreau - w@1wt.eu + + This library is free software; you can redistribute it and/or + modify it under the terms of the GNU Lesser General Public + License as published by the Free Software Foundation, version 2.1 + exclusively. + + This library is distributed in the hope that it will be useful, + but WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this library; if not, write to the Free Software + Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA +*/ + +#ifndef _HAPROXY_TEMPLATE_H +#define _HAPROXY_TEMPLATE_H + + +#endif /* _HAPROXY_TEMPLATE_H */ + +/* + * Local variables: + * c-indent-level: 8 + * c-basic-offset: 8 + * End: + */ diff --git a/include/haproxy/time.h b/include/haproxy/time.h new file mode 100644 index 000000000..dd3e70155 --- /dev/null +++ b/include/haproxy/time.h @@ -0,0 +1,176 @@ +/* + include/haproxy/time.h + Time calculation functions and macros. + + Copyright (C) 2000-2006 Willy Tarreau - w@1wt.eu + + This library is free software; you can redistribute it and/or + modify it under the terms of the GNU Lesser General Public + License as published by the Free Software Foundation, version 2.1 + exclusively. + + This library is distributed in the hope that it will be useful, + but WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this library; if not, write to the Free Software + Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA +*/ + +#ifndef _HAPROXY_TIME_H +#define _HAPROXY_TIME_H + +#include +#include + +#define TIME_ETERNITY -1 + +/* returns the lowest delay amongst and , and respects TIME_ETERNITY */ +#define MINTIME(old, new) (((new)<0)?(old):(((old)<0||(new)<(old))?(new):(old))) +#define SETNOW(a) (*a=now) + +extern struct timeval now; /* the current date at any moment */ +extern struct timeval start_date; /* the process's start date */ + + +/* + * adds ms to , set the result to and returns a pointer + */ +struct timeval *tv_delayfrom(struct timeval *tv, struct timeval *from, int ms); + +/* + * compares and modulo 1ms: returns 0 if equal, -1 if tv1 < tv2, 1 if tv1 > tv2 + * Must not be used when either argument is eternity. Use tv_cmp2_ms() for that. + */ +int tv_cmp_ms(struct timeval *tv1, struct timeval *tv2); + +/* + * compares and : returns 0 if equal, -1 if tv1 < tv2, 1 if tv1 > tv2, + * considering that 0 is the eternity. + */ +int tv_cmp2(struct timeval *tv1, struct timeval *tv2); +/* + * compares and modulo 1 ms: returns 0 if equal, -1 if tv1 < tv2, 1 if tv1 > tv2, + * considering that 0 is the eternity. + */ +int tv_cmp2_ms(struct timeval *tv1, struct timeval *tv2); + +/* + * returns the remaining time between tv1=now and event=tv2 + * if tv2 is passed, 0 is returned. + * Returns TIME_ETERNITY if tv2 is eternity. + */ +unsigned long tv_remain2(struct timeval *tv1, struct timeval *tv2); + + +/* sets to the current time */ +static inline struct timeval *tv_now(struct timeval *tv) +{ + if (tv) + gettimeofday(tv, NULL); + return tv; +} + +/* + * compares and : returns 0 if equal, -1 if tv1 < tv2, 1 if tv1 > tv2 + * Must not be used when either argument is eternity. Use tv_cmp2() for that. + */ +static inline int tv_cmp(struct timeval *tv1, struct timeval *tv2) +{ + if (tv1->tv_sec < tv2->tv_sec) + return -1; + else if (tv1->tv_sec > tv2->tv_sec) + return 1; + else if (tv1->tv_usec < tv2->tv_usec) + return -1; + else if (tv1->tv_usec > tv2->tv_usec) + return 1; + else + return 0; +} + +/* + * returns the difference, in ms, between tv1 and tv2 + * Must not be used when either argument is eternity. + */ +static inline unsigned long tv_diff(struct timeval *tv1, struct timeval *tv2) +{ + unsigned long ret; + + ret = (tv2->tv_sec - tv1->tv_sec) * 1000; + if (tv2->tv_usec > tv1->tv_usec) + ret += (tv2->tv_usec - tv1->tv_usec) / 1000; + else + ret -= (tv1->tv_usec - tv2->tv_usec) / 1000; + return (unsigned long) ret; +} + +/* + * returns the remaining time between tv1=now and event=tv2 + * if tv2 is passed, 0 is returned. + * Must not be used when either argument is eternity. + */ +static inline unsigned long tv_remain(struct timeval *tv1, struct timeval *tv2) +{ + unsigned long ret; + + if (tv_cmp_ms(tv1, tv2) >= 0) + return 0; /* event elapsed */ + + ret = (tv2->tv_sec - tv1->tv_sec) * 1000; + if (tv2->tv_usec > tv1->tv_usec) + ret += (tv2->tv_usec - tv1->tv_usec) / 1000; + else + ret -= (tv1->tv_usec - tv2->tv_usec) / 1000; + return (unsigned long) ret; +} + + +/* + * zeroes a struct timeval + */ + +static inline struct timeval *tv_eternity(struct timeval *tv) +{ + tv->tv_sec = tv->tv_usec = 0; + return tv; +} + +/* + * returns 1 if tv is null, else 0 + */ +static inline int tv_iseternity(struct timeval *tv) +{ + if (tv->tv_sec == 0 && tv->tv_usec == 0) + return 1; + else + return 0; +} + +/* + * returns the first event between tv1 and tv2 into tvmin. + * a zero tv is ignored. tvmin is returned. + */ +static inline struct timeval *tv_min(struct timeval *tvmin, + struct timeval *tv1, struct timeval *tv2) +{ + + if (tv_cmp2(tv1, tv2) <= 0) + *tvmin = *tv1; + else + *tvmin = *tv2; + + return tvmin; +} + + +#endif /* _HAPROXY_TIME_H */ + +/* + * Local variables: + * c-indent-level: 8 + * c-basic-offset: 8 + * End: + */ diff --git a/include/uri_auth.h b/include/haproxy/uri_auth.h similarity index 94% rename from include/uri_auth.h rename to include/haproxy/uri_auth.h index 80149ca4c..9eed7303b 100644 --- a/include/uri_auth.h +++ b/include/haproxy/uri_auth.h @@ -1,7 +1,7 @@ /* * URI-based user authentication using the HTTP basic method. * - * Copyright 2006 Willy Tarreau + * Copyright 2006 Willy Tarreau * * This program is free software; you can redistribute it and/or * modify it under the terms of the GNU General Public License @@ -10,8 +10,8 @@ * */ -#ifndef URI_AUTH_H -#define URI_AUTH_H +#ifndef _HAPROXY_URI_AUTH_H +#define _HAPROXY_URI_AUTH_H /* here we find a very basic list of base64-encoded 'user:passwd' strings */ struct user_auth { struct user_auth *next; /* next entry, NULL if none */ @@ -65,4 +65,4 @@ struct uri_auth *stats_set_realm(struct uri_auth **root, char *realm); struct uri_auth *stats_add_auth(struct uri_auth **root, char *user); struct uri_auth *stats_add_scope(struct uri_auth **root, char *scope); -#endif /* URI_AUTH_H */ +#endif /* _HAPROXY_URI_AUTH_H */ diff --git a/include/haproxy/version.h b/include/haproxy/version.h new file mode 100644 index 000000000..16e0d54a8 --- /dev/null +++ b/include/haproxy/version.h @@ -0,0 +1,39 @@ +/* + include/haproxy/version.h + This file serves as a template for future include files. + + Copyright (C) 2000-2006 Willy Tarreau - w@1wt.eu + + This library is free software; you can redistribute it and/or + modify it under the terms of the GNU Lesser General Public + License as published by the Free Software Foundation, version 2.1 + exclusively. + + This library is distributed in the hope that it will be useful, + but WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this library; if not, write to the Free Software + Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA +*/ + +#ifndef _HAPROXY_VERSION_H +#define _HAPROXY_VERSION_H + +#ifdef CONFIG_PRODUCT_NAME +#define PRODUCT_NAME CONFIG_PRODUCT_NAME +#else +#define PRODUCT_NAME "HAProxy" +#endif + +#ifndef HAPROXY_VERSION +#define HAPROXY_VERSION "1.3.0" +#endif + +#ifndef HAPROXY_DATE +#define HAPROXY_DATE "2006/06/26" +#endif + +#endif /* _HAPROXY_VERSION_H */ diff --git a/include/proto/backend.h b/include/proto/backend.h new file mode 100644 index 000000000..5f24be6d8 --- /dev/null +++ b/include/proto/backend.h @@ -0,0 +1,125 @@ +/* + include/proto/backend.h + Functions prototypes for the backend. + + Copyright (C) 2000-2006 Willy Tarreau - w@1wt.eu + + This library is free software; you can redistribute it and/or + modify it under the terms of the GNU Lesser General Public + License as published by the Free Software Foundation, version 2.1 + exclusively. + + This library is distributed in the hope that it will be useful, + but WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this library; if not, write to the Free Software + Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA +*/ + +#ifndef _PROTO_BACKEND_H +#define _PROTO_BACKEND_H + + +#include +#include + +#include + +int assign_server(struct session *s); +int assign_server_address(struct session *s); +int assign_server_and_queue(struct session *s); +int connect_server(struct session *s); +int srv_count_retry_down(struct session *t, int conn_err); +int srv_retryable_connect(struct session *t); +int srv_redispatch_connect(struct session *t); + +void recount_servers(struct proxy *px); +void recalc_server_map(struct proxy *px); + + +/* + * This function tries to find a running server with free connection slots for + * the proxy following the round-robin method. + * If any server is found, it will be returned and px->srv_rr_idx will be updated + * to point to the next server. If no valid server is found, NULL is returned. + */ +static inline struct server *get_server_rr_with_conns(struct proxy *px) +{ + int newidx; + struct server *srv; + + if (px->srv_map_sz == 0) + return NULL; + + if (px->srv_rr_idx < 0 || px->srv_rr_idx >= px->srv_map_sz) + px->srv_rr_idx = 0; + newidx = px->srv_rr_idx; + + do { + srv = px->srv_map[newidx++]; + if (!srv->maxconn || srv->cur_sess < srv_dynamic_maxconn(srv)) { + px->srv_rr_idx = newidx; + return srv; + } + if (newidx == px->srv_map_sz) + newidx = 0; + } while (newidx != px->srv_rr_idx); + + return NULL; +} + + +/* + * This function tries to find a running server for the proxy following + * the round-robin method. + * If any server is found, it will be returned and px->srv_rr_idx will be updated + * to point to the next server. If no valid server is found, NULL is returned. + */ +static inline struct server *get_server_rr(struct proxy *px) +{ + if (px->srv_map_sz == 0) + return NULL; + + if (px->srv_rr_idx < 0 || px->srv_rr_idx >= px->srv_map_sz) + px->srv_rr_idx = 0; + return px->srv_map[px->srv_rr_idx++]; +} + + +/* + * This function tries to find a running server for the proxy following + * the source hash method. Depending on the number of active/backup servers, + * it will either look for active servers, or for backup servers. + * If any server is found, it will be returned. If no valid server is found, + * NULL is returned. + */ +static inline struct server *get_server_sh(struct proxy *px, char *addr, int len) +{ + unsigned int h, l; + + if (px->srv_map_sz == 0) + return NULL; + + l = h = 0; + if (px->srv_act > 1 || (px->srv_act == 0 && px->srv_bck > 1)) { + while ((l + sizeof (int)) <= len) { + h ^= ntohl(*(unsigned int *)(&addr[l])); + l += sizeof (int); + } + h %= px->srv_map_sz; + } + return px->srv_map[h]; +} + + +#endif /* _PROTO_BACKEND_H */ + +/* + * Local variables: + * c-indent-level: 8 + * c-basic-offset: 8 + * End: + */ diff --git a/include/proto/buffers.h b/include/proto/buffers.h new file mode 100644 index 000000000..85557511b --- /dev/null +++ b/include/proto/buffers.h @@ -0,0 +1,85 @@ +/* + include/proto/buffers.h + Buffer management definitions, macros and inline functions. + + Copyright (C) 2000-2006 Willy Tarreau - w@1wt.eu + + This library is free software; you can redistribute it and/or + modify it under the terms of the GNU Lesser General Public + License as published by the Free Software Foundation, version 2.1 + exclusively. + + This library is distributed in the hope that it will be useful, + but WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this library; if not, write to the Free Software + Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA +*/ + +#ifndef _PROTO_BUFFERS_H +#define _PROTO_BUFFERS_H + +#include +#include + +/* returns 1 if the buffer is empty, 0 otherwise */ +static inline int buffer_isempty(struct buffer *buf) +{ + return buf->l == 0; +} + +/* returns 1 if the buffer is full, 0 otherwise */ +static inline int buffer_isfull(struct buffer *buf) { + return buf->l == BUFSIZE; +} + +/* flushes any content from buffer */ +static inline void buffer_flush(struct buffer *buf) +{ + buf->r = buf->h = buf->lr = buf->w = buf->data; + buf->l = 0; +} + + +/* returns the maximum number of bytes writable at once in this buffer */ +static inline int buffer_max(struct buffer *buf) +{ + if (buf->l == BUFSIZE) + return 0; + else if (buf->r >= buf->w) + return buf->data + BUFSIZE - buf->r; + else + return buf->w - buf->r; +} + + +/* + * Tries to realign the given buffer, and returns how many bytes can be written + * there at once without overwriting anything. + */ +static inline int buffer_realign(struct buffer *buf) +{ + if (buf->l == 0) { + /* let's realign the buffer to optimize I/O */ + buf->r = buf->w = buf->h = buf->lr = buf->data; + } + return buffer_max(buf); +} + + +int buffer_write(struct buffer *buf, const char *msg, int len); +int buffer_replace(struct buffer *b, char *pos, char *end, char *str); +int buffer_replace2(struct buffer *b, char *pos, char *end, char *str, int len); + + +#endif /* _PROTO_BUFFERS_H */ + +/* + * Local variables: + * c-indent-level: 8 + * c-basic-offset: 8 + * End: + */ diff --git a/include/proto/checks.h b/include/proto/checks.h new file mode 100644 index 000000000..d16a288bd --- /dev/null +++ b/include/proto/checks.h @@ -0,0 +1,36 @@ +/* + include/proto/checks.h + Functions prototypes for the checks. + + Copyright (C) 2000-2006 Willy Tarreau - w@1wt.eu + + This library is free software; you can redistribute it and/or + modify it under the terms of the GNU Lesser General Public + License as published by the Free Software Foundation, version 2.1 + exclusively. + + This library is distributed in the hope that it will be useful, + but WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this library; if not, write to the Free Software + Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA +*/ + +#ifndef _PROTO_CHECKS_H +#define _PROTO_CHECKS_H + +#include + +int process_chk(struct task *t); + +#endif /* _PROTO_CHECKS_H */ + +/* + * Local variables: + * c-indent-level: 8 + * c-basic-offset: 8 + * End: + */ diff --git a/include/proto/client.h b/include/proto/client.h new file mode 100644 index 000000000..e119dca6b --- /dev/null +++ b/include/proto/client.h @@ -0,0 +1,38 @@ +/* + include/proto/client.h + This file contains client-side definitions. + + Copyright (C) 2000-2006 Willy Tarreau - w@1wt.eu + + This library is free software; you can redistribute it and/or + modify it under the terms of the GNU Lesser General Public + License as published by the Free Software Foundation, version 2.1 + exclusively. + + This library is distributed in the hope that it will be useful, + but WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this library; if not, write to the Free Software + Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA +*/ + +#ifndef _PROTO_CLIENT_H +#define _PROTO_CLIENT_H + +#include + + +int event_accept(int fd); + + +#endif /* _PROTO_CLIENT_H */ + +/* + * Local variables: + * c-indent-level: 8 + * c-basic-offset: 8 + * End: + */ diff --git a/include/proto/fd.h b/include/proto/fd.h new file mode 100644 index 000000000..699047bdb --- /dev/null +++ b/include/proto/fd.h @@ -0,0 +1,52 @@ +/* + include/proto/fd.h + File descriptors states. + + Copyright (C) 2000-2006 Willy Tarreau - w@1wt.eu + + This library is free software; you can redistribute it and/or + modify it under the terms of the GNU Lesser General Public + License as published by the Free Software Foundation, version 2.1 + exclusively. + + This library is distributed in the hope that it will be useful, + but WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this library; if not, write to the Free Software + Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA +*/ + +#ifndef _PROTO_FD_H +#define _PROTO_FD_H + +#include +#include +#include + +#include + +/* Deletes an FD from the fdsets, and recomputes the maxfd limit. + * The file descriptor is also closed. + */ +void fd_delete(int fd); + + +/* recomputes the maxfd limit from the fd */ +static inline void fd_insert(int fd) +{ + if (fd + 1 > maxfd) + maxfd = fd + 1; +} + + +#endif /* _PROTO_FD_H */ + +/* + * Local variables: + * c-indent-level: 8 + * c-basic-offset: 8 + * End: + */ diff --git a/include/proto/log.h b/include/proto/log.h new file mode 100644 index 000000000..5cc568a5f --- /dev/null +++ b/include/proto/log.h @@ -0,0 +1,84 @@ +/* + include/proto/log.h + This file contains definitions of log-related functions, structures, + and macros. + + Copyright (C) 2000-2006 Willy Tarreau - w@1wt.eu + + This library is free software; you can redistribute it and/or + modify it under the terms of the GNU Lesser General Public + License as published by the Free Software Foundation, version 2.1 + exclusively. + + This library is distributed in the hope that it will be useful, + but WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this library; if not, write to the Free Software + Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA +*/ + +#ifndef _PROTO_LOG_H +#define _PROTO_LOG_H + +#include +#include + +#include +#include +#include + +/* + * Displays the message on stderr with the date and pid. Overrides the quiet + * mode during startup. + */ +void Alert(char *fmt, ...); + +/* + * Displays the message on stderr with the date and pid. + */ +void Warning(char *fmt, ...); + +/* + * Displays the message on only if quiet mode is not set. + */ +void qfprintf(FILE *out, char *fmt, ...); + +/* + * This function sends a syslog message to both log servers of a proxy, + * or to global log servers if the proxy is NULL. + * It also tries not to waste too much time computing the message header. + * It doesn't care about errors nor does it report them. + */ +void send_log(struct proxy *p, int level, char *message, ...); + +/* + * send a log for the session when we have enough info about it + */ +void sess_log(struct session *s); + +/* + * returns log level for or -1 if not found. + */ +int get_log_level(const char *lev); + +/* + * returns log facility for or -1 if not found. + */ +int get_log_facility(const char *fac); + +/* + * Initializes some data needed later. + */ +void init_log(); + +#endif /* _PROTO_LOG_H */ + +/* + * Local variables: + * c-indent-level: 8 + * c-basic-offset: 8 + * End: + */ diff --git a/include/proto/polling.h b/include/proto/polling.h new file mode 100644 index 000000000..6b349c609 --- /dev/null +++ b/include/proto/polling.h @@ -0,0 +1,72 @@ +/* + include/proto/polling.h + Polling functions. + + Copyright (C) 2000-2006 Willy Tarreau - w@1wt.eu + + This library is free software; you can redistribute it and/or + modify it under the terms of the GNU Lesser General Public + License as published by the Free Software Foundation, version 2.1 + exclusively. + + This library is distributed in the hope that it will be useful, + but WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this library; if not, write to the Free Software + Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA +*/ + +#ifndef _PROTO_POLLING_H +#define _PROTO_POLLING_H + +#include + +/* + * Main select() loop. + * does 3 actions : + * 0 (POLL_LOOP_ACTION_INIT) : initializes necessary private structures + * 1 (POLL_LOOP_ACTION_RUN) : runs the loop + * 2 (POLL_LOOP_ACTION_CLEAN) : cleans up + * + * returns 0 if initialization failed, !0 otherwise. + */ +int select_loop(int action); + +#if defined(ENABLE_POLL) +/* + * Main poll() loop. + * does 3 actions : + * 0 (POLL_LOOP_ACTION_INIT) : initializes necessary private structures + * 1 (POLL_LOOP_ACTION_RUN) : runs the loop + * 2 (POLL_LOOP_ACTION_CLEAN) : cleans up + * + * returns 0 if initialization failed, !0 otherwise. + */ +int poll_loop(int action); +#endif + +#if defined(ENABLE_EPOLL) +/* + * Main epoll() loop. + * does 3 actions : + * 0 (POLL_LOOP_ACTION_INIT) : initializes necessary private structures + * 1 (POLL_LOOP_ACTION_RUN) : runs the loop + * 2 (POLL_LOOP_ACTION_CLEAN) : cleans up + * + * returns 0 if initialization failed, !0 otherwise. + */ +int epoll_loop(int action); +#endif + + +#endif /* _PROTO_POLLING_H */ + +/* + * Local variables: + * c-indent-level: 8 + * c-basic-offset: 8 + * End: + */ diff --git a/include/proto/proto_http.h b/include/proto/proto_http.h new file mode 100644 index 000000000..e9cd4f3ea --- /dev/null +++ b/include/proto/proto_http.h @@ -0,0 +1,49 @@ +/* + include/proto/proto_http.h + This file contains HTTP protocol definitions. + + Copyright (C) 2000-2006 Willy Tarreau - w@1wt.eu + + This library is free software; you can redistribute it and/or + modify it under the terms of the GNU Lesser General Public + License as published by the Free Software Foundation, version 2.1 + exclusively. + + This library is distributed in the hope that it will be useful, + but WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this library; if not, write to the Free Software + Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA +*/ + +#ifndef _PROTO_PROTO_HTTP_H +#define _PROTO_PROTO_HTTP_H + +#include +#include +#include + + +int event_accept(int fd); +int process_session(struct task *t); +int process_cli(struct session *t); +int process_srv(struct session *t); + +void client_retnclose(struct session *s, int len, const char *msg); +void client_return(struct session *s, int len, const char *msg); +void srv_close_with_err(struct session *t, int err, int finst, + int status, int msglen, char *msg); + +int produce_content(struct session *s); + +#endif /* _PROTO_PROTO_HTTP_H */ + +/* + * Local variables: + * c-indent-level: 8 + * c-basic-offset: 8 + * End: + */ diff --git a/include/proto/proxy.h b/include/proto/proxy.h new file mode 100644 index 000000000..4a3d67c7d --- /dev/null +++ b/include/proto/proxy.h @@ -0,0 +1,43 @@ +/* + include/proto/proxy.h + This file defines function prototypes for proxy management. + + Copyright (C) 2000-2006 Willy Tarreau - w@1wt.eu + + This library is free software; you can redistribute it and/or + modify it under the terms of the GNU Lesser General Public + License as published by the Free Software Foundation, version 2.1 + exclusively. + + This library is distributed in the hope that it will be useful, + but WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this library; if not, write to the Free Software + Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA +*/ + +#ifndef _PROTO_PROXY_H +#define _PROTO_PROXY_H + + +#include + +int start_proxies(int verbose); +int maintain_proxies(void); +void soft_stop(void); +void pause_proxy(struct proxy *p); +void pause_proxies(void); +void listen_proxies(void); + + +#endif /* _PROTO_PROXY_H */ + +/* + * Local variables: + * c-indent-level: 8 + * c-basic-offset: 8 + * End: + */ diff --git a/include/proto/queue.h b/include/proto/queue.h new file mode 100644 index 000000000..9f135905c --- /dev/null +++ b/include/proto/queue.h @@ -0,0 +1,78 @@ +/* + include/proto/queue.h + This file defines everything related to queues. + + Copyright (C) 2000-2006 Willy Tarreau - w@1wt.eu + + This library is free software; you can redistribute it and/or + modify it under the terms of the GNU Lesser General Public + License as published by the Free Software Foundation, version 2.1 + exclusively. + + This library is distributed in the hope that it will be useful, + but WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this library; if not, write to the Free Software + Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA +*/ + +#ifndef _PROTO_QUEUE_H +#define _PROTO_QUEUE_H + +#include +#include + +#include +#include +#include +#include +#include + +struct session *pendconn_get_next_sess(struct server *srv, struct proxy *px); +struct pendconn *pendconn_add(struct session *sess); +void pendconn_free(struct pendconn *p); +int process_srv_queue(struct task *t); +unsigned int srv_dynamic_maxconn(struct server *s); + + + +/* Returns the first pending connection for server , which may be NULL if + * nothing is pending. + */ +static inline struct pendconn *pendconn_from_srv(struct server *s) { + if (!s->nbpend) + return NULL; + + return LIST_ELEM(s->pendconns.n, struct pendconn *, list); +} + +/* Returns the first pending connection for proxy , which may be NULL if + * nothing is pending. + */ +static inline struct pendconn *pendconn_from_px(struct proxy *px) { + if (!px->nbpend) + return NULL; + + return LIST_ELEM(px->pendconns.n, struct pendconn *, list); +} + +/* returns 0 if nothing has to be done for server regarding queued connections, + * and non-zero otherwise. Suited for and if/else usage. + */ +static inline int may_dequeue_tasks(struct server *s, struct proxy *p) { + return (s && (s->nbpend || p->nbpend) && + (!s->maxconn || s->cur_sess < srv_dynamic_maxconn(s)) && + s->queue_mgt); +} + +#endif /* _PROTO_QUEUE_H */ + +/* + * Local variables: + * c-indent-level: 8 + * c-basic-offset: 8 + * End: + */ diff --git a/include/proto/server.h b/include/proto/server.h new file mode 100644 index 000000000..b79b9702b --- /dev/null +++ b/include/proto/server.h @@ -0,0 +1,42 @@ +/* + include/proto/server.h + This file defines everything related to servers. + + Copyright (C) 2000-2006 Willy Tarreau - w@1wt.eu + + This library is free software; you can redistribute it and/or + modify it under the terms of the GNU Lesser General Public + License as published by the Free Software Foundation, version 2.1 + exclusively. + + This library is distributed in the hope that it will be useful, + but WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this library; if not, write to the Free Software + Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA +*/ + +#ifndef _PROTO_SERVER_H +#define _PROTO_SERVER_H + +#include + +#include +#include +#include + +#include + + + +#endif /* _PROTO_SERVER_H */ + +/* + * Local variables: + * c-indent-level: 8 + * c-basic-offset: 8 + * End: + */ diff --git a/include/proto/session.h b/include/proto/session.h new file mode 100644 index 000000000..6c84f4c23 --- /dev/null +++ b/include/proto/session.h @@ -0,0 +1,38 @@ +/* + include/proto/session.h + This file defines everything related to sessions. + + Copyright (C) 2000-2006 Willy Tarreau - w@1wt.eu + + This library is free software; you can redistribute it and/or + modify it under the terms of the GNU Lesser General Public + License as published by the Free Software Foundation, version 2.1 + exclusively. + + This library is distributed in the hope that it will be useful, + but WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this library; if not, write to the Free Software + Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA +*/ + +#ifndef _PROTO_SESSION_H +#define _PROTO_SESSION_H + + +#include + +void session_free(struct session *s); + + +#endif /* _PROTO_SESSION_H */ + +/* + * Local variables: + * c-indent-level: 8 + * c-basic-offset: 8 + * End: + */ diff --git a/include/proto/stream_sock.h b/include/proto/stream_sock.h new file mode 100644 index 000000000..bab3c53fd --- /dev/null +++ b/include/proto/stream_sock.h @@ -0,0 +1,63 @@ +/* + include/proto/stream_sock.h + This file contains client-side definitions. + + Copyright (C) 2000-2006 Willy Tarreau - w@1wt.eu + + This library is free software; you can redistribute it and/or + modify it under the terms of the GNU Lesser General Public + License as published by the Free Software Foundation, version 2.1 + exclusively. + + This library is distributed in the hope that it will be useful, + but WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this library; if not, write to the Free Software + Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA +*/ + +#ifndef _PROTO_STREAM_SOCK_H +#define _PROTO_STREAM_SOCK_H + +#include +#include +#include + +#include +#include + + +/* FIXME: merge those ones together */ +int event_cli_read(int fd); +int event_cli_write(int fd); +int event_srv_read(int fd); +int event_srv_write(int fd); + + +/* This either returns the sockname or the original destination address. Code + * inspired from Patrick Schaaf's example of nf_getsockname() implementation. + */ +static inline int get_original_dst(int fd, struct sockaddr_in *sa, socklen_t *salen) { +#if defined(TPROXY) && defined(SO_ORIGINAL_DST) + return getsockopt(fd, SOL_IP, SO_ORIGINAL_DST, (void *)sa, salen); +#else +#if defined(TPROXY) && defined(USE_GETSOCKNAME) + return getsockname(fd, (struct sockaddr *)sa, salen); +#else + return -1; +#endif +#endif +} + + +#endif /* _PROTO_STREAM_SOCK_H */ + +/* + * Local variables: + * c-indent-level: 8 + * c-basic-offset: 8 + * End: + */ diff --git a/include/proto/task.h b/include/proto/task.h new file mode 100644 index 000000000..8aba7950a --- /dev/null +++ b/include/proto/task.h @@ -0,0 +1,101 @@ +/* + include/proto/task.h + Functions for task management. + + Copyright (C) 2000-2006 Willy Tarreau - w@1wt.eu + + This library is free software; you can redistribute it and/or + modify it under the terms of the GNU Lesser General Public + License as published by the Free Software Foundation, version 2.1 + exclusively. + + This library is distributed in the hope that it will be useful, + but WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this library; if not, write to the Free Software + Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA +*/ + +#ifndef _PROTO_TASK_H +#define _PROTO_TASK_H + + +#include +#include +#include + + +/* puts the task in run queue , and returns */ +static inline struct task *task_wakeup(struct task **q, struct task *t) +{ + if (t->state == TASK_RUNNING) + return t; + else { + t->rqnext = *q; + t->state = TASK_RUNNING; + return *q = t; + } +} + +/* removes the task from the queue + * MUST be 's first task. + * set the run queue to point to the next one, and return it + */ +static inline struct task *task_sleep(struct task **q, struct task *t) +{ + if (t->state == TASK_RUNNING) { + *q = t->rqnext; + t->state = TASK_IDLE; /* tell that s has left the run queue */ + } + return *q; /* return next running task */ +} + +/* + * removes the task from its wait queue. It must have already been removed + * from the run queue. A pointer to the task itself is returned. + */ +static inline struct task *task_delete(struct task *t) +{ + t->prev->next = t->next; + t->next->prev = t->prev; + return t; +} + +/* + * frees a task. Its context must have been freed since it will be lost. + */ +static inline void task_free(struct task *t) +{ + pool_free(task, t); +} + +/* inserts into its assigned wait queue, where it may already be. In this case, it + * may be only moved or left where it was, depending on its timing requirements. + * is returned. + */ +struct task *task_queue(struct task *task); + +/* + * This does 4 things : + * - wake up all expired tasks + * - call all runnable tasks + * - call maintain_proxies() to enable/disable the listeners + * - return the delay till next event in ms, -1 = wait indefinitely + * Note: this part should be rewritten with the O(ln(n)) scheduler. + * + */ + +int process_runnable_tasks(); + + +#endif /* _PROTO_TASK_H */ + +/* + * Local variables: + * c-indent-level: 8 + * c-basic-offset: 8 + * End: + */ diff --git a/include/proto/template.h b/include/proto/template.h new file mode 100644 index 000000000..868634f78 --- /dev/null +++ b/include/proto/template.h @@ -0,0 +1,36 @@ +/* + include/proto/template.h + This file serves as a template for future include files. + + Copyright (C) 2000-2006 Willy Tarreau - w@1wt.eu + + This library is free software; you can redistribute it and/or + modify it under the terms of the GNU Lesser General Public + License as published by the Free Software Foundation, version 2.1 + exclusively. + + This library is distributed in the hope that it will be useful, + but WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this library; if not, write to the Free Software + Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA +*/ + +#ifndef _PROTO_TEMPLATE_H +#define _PROTO_TEMPLATE_H + + +#include + + +#endif /* _PROTO_TEMPLATE_H */ + +/* + * Local variables: + * c-indent-level: 8 + * c-basic-offset: 8 + * End: + */ diff --git a/include/types/backend.h b/include/types/backend.h new file mode 100644 index 000000000..7a6a640ad --- /dev/null +++ b/include/types/backend.h @@ -0,0 +1,60 @@ +/* + include/types/backend.h + This file rassembles definitions for backends + + Copyright (C) 2000-2006 Willy Tarreau - w@1wt.eu + + This library is free software; you can redistribute it and/or + modify it under the terms of the GNU Lesser General Public + License as published by the Free Software Foundation, version 2.1 + exclusively. + + This library is distributed in the hope that it will be useful, + but WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this library; if not, write to the Free Software + Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA +*/ + +#ifndef _TYPES_BACKEND_H +#define _TYPES_BACKEND_H + +/* bits for proxy->options */ +#define PR_O_REDISP 0x00000001 /* allow reconnection to dispatch in case of errors */ +#define PR_O_TRANSP 0x00000002 /* transparent mode : use original DEST as dispatch */ +#define PR_O_COOK_RW 0x00000004 /* rewrite all direct cookies with the right serverid */ +#define PR_O_COOK_IND 0x00000008 /* keep only indirect cookies */ +#define PR_O_COOK_INS 0x00000010 /* insert cookies when not accessing a server directly */ +#define PR_O_COOK_PFX 0x00000020 /* rewrite all cookies by prefixing the right serverid */ +#define PR_O_COOK_ANY (PR_O_COOK_RW | PR_O_COOK_IND | PR_O_COOK_INS | PR_O_COOK_PFX) +#define PR_O_BALANCE_RR 0x00000040 /* balance in round-robin mode */ +#define PR_O_KEEPALIVE 0x00000080 /* follow keep-alive sessions */ +#define PR_O_FWDFOR 0x00000100 /* insert x-forwarded-for with client address */ +#define PR_O_BIND_SRC 0x00000200 /* bind to a specific source address when connect()ing */ +#define PR_O_NULLNOLOG 0x00000400 /* a connect without request will not be logged */ +#define PR_O_COOK_NOC 0x00000800 /* add a 'Cache-control' header with the cookie */ +#define PR_O_COOK_POST 0x00001000 /* don't insert cookies for requests other than a POST */ +#define PR_O_HTTP_CHK 0x00002000 /* use HTTP 'OPTIONS' method to check server health */ +#define PR_O_PERSIST 0x00004000 /* server persistence stays effective even when server is down */ +#define PR_O_LOGASAP 0x00008000 /* log as soon as possible, without waiting for the session to complete */ +#define PR_O_HTTP_CLOSE 0x00010000 /* force 'connection: close' in both directions */ +#define PR_O_CHK_CACHE 0x00020000 /* require examination of cacheability of the 'set-cookie' field */ +#define PR_O_TCP_CLI_KA 0x00040000 /* enable TCP keep-alive on client-side sessions */ +#define PR_O_TCP_SRV_KA 0x00080000 /* enable TCP keep-alive on server-side sessions */ +#define PR_O_USE_ALL_BK 0x00100000 /* load-balance between backup servers */ +#define PR_O_FORCE_CLO 0x00200000 /* enforce the connection close immediately after server response */ +#define PR_O_BALANCE_SH 0x00400000 /* balance on source IP hash */ +#define PR_O_BALANCE (PR_O_BALANCE_RR | PR_O_BALANCE_SH) +#define PR_O_ABRT_CLOSE 0x00800000 /* immediately abort request when client closes */ + +#endif /* _TYPES_BACKEND_H */ + +/* + * Local variables: + * c-indent-level: 8 + * c-basic-offset: 8 + * End: + */ diff --git a/include/types/buffers.h b/include/types/buffers.h new file mode 100644 index 000000000..2fcf59fa5 --- /dev/null +++ b/include/types/buffers.h @@ -0,0 +1,53 @@ +/* + include/types/buffers.h + Buffer management definitions, macros and inline functions. + + Copyright (C) 2000-2006 Willy Tarreau - w@1wt.eu + + This library is free software; you can redistribute it and/or + modify it under the terms of the GNU Lesser General Public + License as published by the Free Software Foundation, version 2.1 + exclusively. + + This library is distributed in the hope that it will be useful, + but WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this library; if not, write to the Free Software + Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA +*/ + +#ifndef _TYPES_BUFFERS_H +#define _TYPES_BUFFERS_H + +#include +#include + +/* describes a chunk of string */ +struct chunk { + char *str; /* beginning of the string itself. Might not be 0-terminated */ + int len; /* size of the string from first to last char. <0 = uninit. */ +}; + +struct buffer { + unsigned int l; /* data length */ + char *r, *w, *h, *lr; /* read ptr, write ptr, last header ptr, last read */ + char *rlim; /* read limit, used for header rewriting */ + unsigned long long total; /* total data read */ + char data[BUFSIZE]; +}; + +#define sizeof_buffer sizeof(struct buffer) +extern void **pool_buffer; + + +#endif /* _TYPES_BUFFERS_H */ + +/* + * Local variables: + * c-indent-level: 8 + * c-basic-offset: 8 + * End: + */ diff --git a/include/types/capture.h b/include/types/capture.h new file mode 100644 index 000000000..e531b546d --- /dev/null +++ b/include/types/capture.h @@ -0,0 +1,43 @@ +/* + include/types/capture.h + This file defines everything related to captures. + + Copyright (C) 2000-2006 Willy Tarreau - w@1wt.eu + + This library is free software; you can redistribute it and/or + modify it under the terms of the GNU Lesser General Public + License as published by the Free Software Foundation, version 2.1 + exclusively. + + This library is distributed in the hope that it will be useful, + but WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this library; if not, write to the Free Software + Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA +*/ + +#ifndef _TYPES_CAPTURE_H +#define _TYPES_CAPTURE_H + +struct cap_hdr { + struct cap_hdr *next; + char *name; /* header name, case insensitive */ + int namelen; /* length of the header name, to speed-up lookups */ + int len; /* capture length, not including terminal zero */ + int index; /* index in the output array */ + void *pool; /* pool of pre-allocated memory area of (len+1) bytes */ +}; + +extern void **pool_capture; + +#endif /* _TYPES_CAPTURE_H */ + +/* + * Local variables: + * c-indent-level: 8 + * c-basic-offset: 8 + * End: + */ diff --git a/include/types/client.h b/include/types/client.h new file mode 100644 index 000000000..d19e10065 --- /dev/null +++ b/include/types/client.h @@ -0,0 +1,45 @@ +/* + include/types/client.h + This file contains client-side definitions. + + Copyright (C) 2000-2006 Willy Tarreau - w@1wt.eu + + This library is free software; you can redistribute it and/or + modify it under the terms of the GNU Lesser General Public + License as published by the Free Software Foundation, version 2.1 + exclusively. + + This library is distributed in the hope that it will be useful, + but WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this library; if not, write to the Free Software + Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA +*/ + +#ifndef _TYPES_CLIENT_H +#define _TYPES_CLIENT_H + +/* + * FIXME: break this into HTTP state and TCP socket state. + * See server.h for the other end. + */ + +/* different possible states for the client side */ +#define CL_STHEADERS 0 +#define CL_STDATA 1 +#define CL_STSHUTR 2 +#define CL_STSHUTW 3 +#define CL_STCLOSE 4 + + +#endif /* _TYPES_CLIENT_H */ + +/* + * Local variables: + * c-indent-level: 8 + * c-basic-offset: 8 + * End: + */ diff --git a/include/types/fd.h b/include/types/fd.h new file mode 100644 index 000000000..6e350e56e --- /dev/null +++ b/include/types/fd.h @@ -0,0 +1,60 @@ +/* + include/fd.h + File descriptors states. + + Copyright (C) 2000-2006 Willy Tarreau - w@1wt.eu + + This library is free software; you can redistribute it and/or + modify it under the terms of the GNU Lesser General Public + License as published by the Free Software Foundation, version 2.1 + exclusively. + + This library is distributed in the hope that it will be useful, + but WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this library; if not, write to the Free Software + Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA +*/ + +#ifndef _TYPES_FD_H +#define _TYPES_FD_H + +#include +#include +#include + +#include +#include + +/* different possible states for the fd */ +#define FD_STCLOSE 0 +#define FD_STLISTEN 1 +#define FD_STCONN 2 +#define FD_STREADY 3 +#define FD_STERROR 4 + + +/* info about one given fd */ +struct fdtab { + int (*read)(int fd); /* read function */ + int (*write)(int fd); /* write function */ + struct task *owner; /* the session (or proxy) associated with this fd */ + int state; /* the state of this fd */ +}; + +extern struct fdtab *fdtab; /* array of all the file descriptors */ +extern int maxfd; /* # of the highest fd + 1 */ +extern int totalconn; /* total # of terminated sessions */ +extern int actconn; /* # of active sessions */ + +#endif /* _TYPES_FD_H */ + +/* + * Local variables: + * c-indent-level: 8 + * c-basic-offset: 8 + * End: + */ diff --git a/include/types/global.h b/include/types/global.h new file mode 100644 index 000000000..4a2e895e8 --- /dev/null +++ b/include/types/global.h @@ -0,0 +1,75 @@ +/* + include/types/global.h + Global variables. + + Copyright (C) 2000-2006 Willy Tarreau - w@1wt.eu + + This library is free software; you can redistribute it and/or + modify it under the terms of the GNU Lesser General Public + License as published by the Free Software Foundation, version 2.1 + exclusively. + + This library is distributed in the hope that it will be useful, + but WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this library; if not, write to the Free Software + Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA +*/ + +#ifndef _TYPES_GLOBAL_H +#define _TYPES_GLOBAL_H + +#include + +#include + +/* modes of operation (global.mode) */ +#define MODE_DEBUG 1 +#define MODE_STATS 2 +#define MODE_LOG 4 +#define MODE_DAEMON 8 +#define MODE_QUIET 16 +#define MODE_CHECK 32 +#define MODE_VERBOSE 64 +#define MODE_STARTING 128 +#define MODE_FOREGROUND 256 + + +/* FIXME : this will have to be redefined correctly */ +struct global { + int uid; + int gid; + int nbproc; + int maxconn; + int maxsock; /* max # of sockets */ + int rlimit_nofile; /* default ulimit-n value : 0=unset */ + int rlimit_memmax; /* default ulimit-d in megs value : 0=unset */ + int mode; + char *chroot; + char *pidfile; + int logfac1, logfac2; + int loglev1, loglev2; + struct sockaddr_in logsrv1, logsrv2; +}; + +extern struct global global; +extern char *progname; /* program name */ +extern int pid; /* current process id */ +extern int actconn; /* # of active sessions */ +extern int listeners; +extern char trash[BUFSIZE]; +extern const int zero; +extern const int one; +extern int stopping; /* non zero means stopping in progress */ + +#endif /* _TYPES_GLOBAL_H */ + +/* + * Local variables: + * c-indent-level: 8 + * c-basic-offset: 8 + * End: + */ diff --git a/include/types/httperr.h b/include/types/httperr.h new file mode 100644 index 000000000..3a40a239f --- /dev/null +++ b/include/types/httperr.h @@ -0,0 +1,42 @@ +/* + include/types/httperr.h + This file defines everything related to HTTP responses and errors. + + Copyright (C) 2000-2006 Willy Tarreau - w@1wt.eu + + This library is free software; you can redistribute it and/or + modify it under the terms of the GNU Lesser General Public + License as published by the Free Software Foundation, version 2.1 + exclusively. + + This library is distributed in the hope that it will be useful, + but WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this library; if not, write to the Free Software + Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA +*/ + +#ifndef _TYPES_HTTPERR_H +#define _TYPES_HTTPERR_H + +/* various data sources for the responses */ +#define DATA_SRC_NONE 0 +#define DATA_SRC_STATS 1 + +/* data transmission states for the responses */ +#define DATA_ST_INIT 0 +#define DATA_ST_DATA 1 + + + +#endif /* _TYPES_HTTPERR_H */ + +/* + * Local variables: + * c-indent-level: 8 + * c-basic-offset: 8 + * End: + */ diff --git a/include/types/log.h b/include/types/log.h new file mode 100644 index 000000000..9aeb11e7f --- /dev/null +++ b/include/types/log.h @@ -0,0 +1,56 @@ +/* + include/types/log.h + This file contains definitions of log-related structures and macros. + + Copyright (C) 2000-2006 Willy Tarreau - w@1wt.eu + + This library is free software; you can redistribute it and/or + modify it under the terms of the GNU Lesser General Public + License as published by the Free Software Foundation, version 2.1 + exclusively. + + This library is distributed in the hope that it will be useful, + but WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this library; if not, write to the Free Software + Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA +*/ + +#ifndef _TYPES_LOG_H +#define _TYPES_LOG_H + + +#define MAX_SYSLOG_LEN 1024 +#define NB_LOG_FACILITIES 24 +#define NB_LOG_LEVELS 8 +#define SYSLOG_PORT 514 + + +/* fields that need to be logged. They appear as flags in session->logs.logwait */ +#define LW_DATE 1 /* date */ +#define LW_CLIP 2 /* CLient IP */ +#define LW_SVIP 4 /* SerVer IP */ +#define LW_SVID 8 /* server ID */ +#define LW_REQ 16 /* http REQuest */ +#define LW_RESP 32 /* http RESPonse */ +#define LW_PXIP 64 /* proxy IP */ +#define LW_PXID 128 /* proxy ID */ +#define LW_BYTES 256 /* bytes read from server */ +#define LW_COOKIE 512 /* captured cookie */ +#define LW_REQHDR 1024 /* request header(s) */ +#define LW_RSPHDR 2048 /* response header(s) */ + +extern void **pool_requri; + + +#endif /* _TYPES_LOG_H */ + +/* + * Local variables: + * c-indent-level: 8 + * c-basic-offset: 8 + * End: + */ diff --git a/include/types/polling.h b/include/types/polling.h new file mode 100644 index 000000000..3c2a231a5 --- /dev/null +++ b/include/types/polling.h @@ -0,0 +1,74 @@ +/* + include/types/polling.h + File descriptors and polling definitions. + + Copyright (C) 2000-2006 Willy Tarreau - w@1wt.eu + + This library is free software; you can redistribute it and/or + modify it under the terms of the GNU Lesser General Public + License as published by the Free Software Foundation, version 2.1 + exclusively. + + This library is distributed in the hope that it will be useful, + but WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this library; if not, write to the Free Software + Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA +*/ + +#ifndef _TYPES_POLLING_H +#define _TYPES_POLLING_H + +/* for fd_set */ +#include +#include +#include + +#include + +/* for POLL_* */ +#if defined(ENABLE_POLL) +#include +#endif + +/* for EPOLL_* */ +#if defined(ENABLE_EPOLL) +#if !defined(USE_MY_EPOLL) +#include +#else +#include +#endif +#endif + +/* possible actions for the *poll() loops */ +#define POLL_LOOP_ACTION_INIT 0 +#define POLL_LOOP_ACTION_RUN 1 +#define POLL_LOOP_ACTION_CLEAN 2 + +/* poll mechanisms available */ +#define POLL_USE_SELECT (1<<0) +#define POLL_USE_POLL (1<<1) +#define POLL_USE_EPOLL (1<<2) + +/* result of an I/O event */ +#define RES_SILENT 0 /* didn't happen */ +#define RES_DATA 1 /* data were sent or received */ +#define RES_NULL 2 /* result is 0 (read == 0), or connect without need for writing */ +#define RES_ERROR 3 /* result -1 or error on the socket (eg: connect()) */ + +/* fd states */ +extern fd_set *StaticReadEvent, *StaticWriteEvent; +extern int cfg_polling_mechanism; /* POLL_USE_{SELECT|POLL|EPOLL} */ + + +#endif /* _TYPES_POLLING_H */ + +/* + * Local variables: + * c-indent-level: 8 + * c-basic-offset: 8 + * End: + */ diff --git a/include/types/proto_http.h b/include/types/proto_http.h new file mode 100644 index 000000000..2ccee0651 --- /dev/null +++ b/include/types/proto_http.h @@ -0,0 +1,60 @@ +/* + include/types/proto_http.h + This file contains HTTP protocol definitions. + + Copyright (C) 2000-2006 Willy Tarreau - w@1wt.eu + + This library is free software; you can redistribute it and/or + modify it under the terms of the GNU Lesser General Public + License as published by the Free Software Foundation, version 2.1 + exclusively. + + This library is distributed in the hope that it will be useful, + but WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this library; if not, write to the Free Software + Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA +*/ + +#ifndef _TYPES_PROTO_HTTP_H +#define _TYPES_PROTO_HTTP_H + + +/* + * FIXME: break this into HTTP state and TCP socket state. + * See server.h for the other end. + */ + +/* different possible states for the client side */ +#define CL_STHEADERS 0 +#define CL_STDATA 1 +#define CL_STSHUTR 2 +#define CL_STSHUTW 3 +#define CL_STCLOSE 4 + +/* + * FIXME: break this into HTTP state and TCP socket state. + * See client.h for the other end. + */ + +/* different possible states for the server side */ +#define SV_STIDLE 0 +#define SV_STCONN 1 +#define SV_STHEADERS 2 +#define SV_STDATA 3 +#define SV_STSHUTR 4 +#define SV_STSHUTW 5 +#define SV_STCLOSE 6 + + +#endif /* _TYPES_PROTO_HTTP_H */ + +/* + * Local variables: + * c-indent-level: 8 + * c-basic-offset: 8 + * End: + */ diff --git a/include/types/proxy.h b/include/types/proxy.h new file mode 100644 index 000000000..96858280b --- /dev/null +++ b/include/types/proxy.h @@ -0,0 +1,145 @@ +/* + include/types/proxy.h + This file defines everything related to proxies. + + Copyright (C) 2000-2006 Willy Tarreau - w@1wt.eu + + This library is free software; you can redistribute it and/or + modify it under the terms of the GNU Lesser General Public + License as published by the Free Software Foundation, version 2.1 + exclusively. + + This library is distributed in the hope that it will be useful, + but WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this library; if not, write to the Free Software + Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA +*/ + +#ifndef _TYPES_PROXY_H +#define _TYPES_PROXY_H + +#include +#include +#include + +#include +#include +#include +#include + +#include +#include +#include + +/* values for proxy->state */ +#define PR_STNEW 0 +#define PR_STIDLE 1 +#define PR_STRUN 2 +#define PR_STSTOPPED 3 +#define PR_STPAUSED 4 +#define PR_STERROR 5 + +/* values for proxy->mode */ +#define PR_MODE_TCP 0 +#define PR_MODE_HTTP 1 +#define PR_MODE_HEALTH 2 + +/* return codes for start_proxies */ +#define ERR_NONE 0 /* no error */ +#define ERR_RETRYABLE 1 /* retryable error, may be cumulated */ +#define ERR_FATAL 2 /* fatal error, may be cumulated */ + + +struct listener { + int fd; /* the listen socket */ + struct sockaddr_storage addr; /* the address we listen to */ + struct listener *next; /* next address or NULL */ +}; + +struct proxy { + struct listener *listen; /* the listen addresses and sockets */ + struct in_addr mon_net, mon_mask; /* don't forward connections from this net (network order) FIXME: should support IPv6 */ + int state; /* proxy state */ + struct sockaddr_in dispatch_addr; /* the default address to connect to */ + struct server *srv; /* known servers */ + int srv_act, srv_bck; /* # of running servers */ + int tot_wact, tot_wbck; /* total weights of active and backup servers */ + struct server **srv_map; /* the server map used to apply weights */ + int srv_map_sz; /* the size of the effective server map */ + int srv_rr_idx; /* next server to be elected in round robin mode */ + char *cookie_name; /* name of the cookie to look for */ + int cookie_len; /* strlen(cookie_name), computed only once */ + char *appsession_name; /* name of the cookie to look for */ + int appsession_name_len; /* strlen(appsession_name), computed only once */ + int appsession_len; /* length of the appsession cookie value to be used */ + int appsession_timeout; + CHTbl htbl_proxy; /* Per Proxy hashtable */ + char *capture_name; /* beginning of the name of the cookie to capture */ + int capture_namelen; /* length of the cookie name to match */ + int capture_len; /* length of the string to be captured */ + struct uri_auth *uri_auth; /* if non-NULL, the (list of) per-URI authentications */ + int clitimeout; /* client I/O timeout (in milliseconds) */ + int srvtimeout; /* server I/O timeout (in milliseconds) */ + int contimeout; /* connect timeout (in milliseconds) */ + char *id; /* proxy id */ + struct list pendconns; /* pending connections with no server assigned yet */ + int nbpend, nbpend_max; /* number of pending connections with no server assigned yet */ + int totpend; /* total number of pending connections on this instance (for stats) */ + unsigned int nbconn, nbconn_max; /* # of active sessions */ + unsigned int cum_conn; /* cumulated number of processed sessions */ + unsigned int maxconn; /* max # of active sessions */ + unsigned failed_conns, failed_resp; /* failed connect() and responses */ + unsigned failed_secu; /* blocked responses because of security concerns */ + int conn_retries; /* maximum number of connect retries */ + int options; /* PR_O_REDISP, PR_O_TRANSP, ... */ + int mode; /* mode = PR_MODE_TCP, PR_MODE_HTTP or PR_MODE_HEALTH */ + struct sockaddr_in source_addr; /* the address to which we want to bind for connect() */ + struct proxy *next; + struct sockaddr_in logsrv1, logsrv2; /* 2 syslog servers */ + signed char logfac1, logfac2; /* log facility for both servers. -1 = disabled */ + int loglev1, loglev2; /* log level for each server, 7 by default */ + int to_log; /* things to be logged (LW_*) */ + struct timeval stop_time; /* date to stop listening, when stopping != 0 */ + int nb_reqadd, nb_rspadd; + struct hdr_exp *req_exp; /* regular expressions for request headers */ + struct hdr_exp *rsp_exp; /* regular expressions for response headers */ + int nb_req_cap, nb_rsp_cap; /* # of headers to be captured */ + struct cap_hdr *req_cap; /* chained list of request headers to be captured */ + struct cap_hdr *rsp_cap; /* chained list of response headers to be captured */ + void *req_cap_pool, *rsp_cap_pool; /* pools of pre-allocated char ** used to build the sessions */ + char *req_add[MAX_NEWHDR], *rsp_add[MAX_NEWHDR]; /* headers to be added */ + int grace; /* grace time after stop request */ + char *check_req; /* HTTP request to use if PR_O_HTTP_CHK is set, else NULL */ + int check_len; /* Length of the HTTP request */ + struct { + char *msg400; /* message for error 400 */ + int len400; /* message length for error 400 */ + char *msg403; /* message for error 403 */ + int len403; /* message length for error 403 */ + char *msg408; /* message for error 408 */ + int len408; /* message length for error 408 */ + char *msg500; /* message for error 500 */ + int len500; /* message length for error 500 */ + char *msg502; /* message for error 502 */ + int len502; /* message length for error 502 */ + char *msg503; /* message for error 503 */ + int len503; /* message length for error 503 */ + char *msg504; /* message for error 504 */ + int len504; /* message length for error 504 */ + } errmsg; +}; + +extern struct proxy *proxy; + +#endif /* _TYPES_PROXY_H */ + +/* + * Local variables: + * c-indent-level: 8 + * c-basic-offset: 8 + * End: + */ diff --git a/include/types/queue.h b/include/types/queue.h new file mode 100644 index 000000000..d35fae9d4 --- /dev/null +++ b/include/types/queue.h @@ -0,0 +1,47 @@ +/* + include/types/queue.h + This file defines variables and structures needed for queues. + + Copyright (C) 2000-2006 Willy Tarreau - w@1wt.eu + + This library is free software; you can redistribute it and/or + modify it under the terms of the GNU Lesser General Public + License as published by the Free Software Foundation, version 2.1 + exclusively. + + This library is distributed in the hope that it will be useful, + but WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this library; if not, write to the Free Software + Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA +*/ + +#ifndef _TYPES_QUEUE_H +#define _TYPES_QUEUE_H + +#include + +#include +#include + +struct pendconn { + struct list list; /* chaining ... */ + struct session *sess; /* the session waiting for a connection */ + struct server *srv; /* the server we are waiting for */ +}; + +#define sizeof_pendconn sizeof(struct pendconn) +extern void **pool_pendconn; + + +#endif /* _TYPES_QUEUE_H */ + +/* + * Local variables: + * c-indent-level: 8 + * c-basic-offset: 8 + * End: + */ diff --git a/include/types/server.h b/include/types/server.h new file mode 100644 index 000000000..56a6b63f0 --- /dev/null +++ b/include/types/server.h @@ -0,0 +1,87 @@ +/* + include/types/server.h + This file defines everything related to servers. + + Copyright (C) 2000-2006 Willy Tarreau - w@1wt.eu + + This library is free software; you can redistribute it and/or + modify it under the terms of the GNU Lesser General Public + License as published by the Free Software Foundation, version 2.1 + exclusively. + + This library is distributed in the hope that it will be useful, + but WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this library; if not, write to the Free Software + Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA +*/ + +#ifndef _TYPES_SERVER_H +#define _TYPES_SERVER_H + +#include +#include + +#include + +#include +#include +#include +#include + + +/* server flags */ +#define SRV_RUNNING 1 /* the server is UP */ +#define SRV_BACKUP 2 /* this server is a backup server */ +#define SRV_MAPPORTS 4 /* this server uses mapped ports */ +#define SRV_BIND_SRC 8 /* this server uses a specific source address */ +#define SRV_CHECKED 16 /* this server needs to be checked */ + +/* function which act on servers need to return various errors */ +#define SRV_STATUS_OK 0 /* everything is OK. */ +#define SRV_STATUS_INTERNAL 1 /* other unrecoverable errors. */ +#define SRV_STATUS_NOSRV 2 /* no server is available */ +#define SRV_STATUS_FULL 3 /* the/all server(s) are saturated */ +#define SRV_STATUS_QUEUED 4 /* the/all server(s) are saturated but the connection was queued */ + + +struct server { + struct server *next; + int state; /* server state (SRV_*) */ + int cklen; /* the len of the cookie, to speed up checks */ + char *cookie; /* the id set in the cookie */ + char *id; /* just for identification */ + struct list pendconns; /* pending connections */ + int nbpend, nbpend_max; /* number of pending connections */ + struct task *queue_mgt; /* the task associated to the queue processing */ + struct sockaddr_in addr; /* the address to connect to */ + struct sockaddr_in source_addr; /* the address to which we want to bind for connect() */ + short check_port; /* the port to use for the health checks */ + int health; /* 0->rise-1 = bad; rise->rise+fall-1 = good */ + int rise, fall; /* time in iterations */ + int inter; /* time in milliseconds */ + int result; /* 0 = connect OK, -1 = connect KO */ + int curfd; /* file desc used for current test, or -1 if not in test */ + unsigned char uweight, eweight; /* user-specified weight-1, and effective weight-1 */ + unsigned int wscore; /* weight score, used during srv map computation */ + int cur_sess, cur_sess_max; /* number of currently active sessions (including syn_sent) */ + unsigned int cum_sess; /* cumulated number of sessions really sent to this server */ + unsigned int maxconn, minconn; /* max # of active sessions (0 = unlimited), min# for dynamic limit. */ + unsigned failed_checks, down_trans; /* failed checks and up-down transitions */ + unsigned failed_conns, failed_resp; /* failed connect() and responses */ + unsigned failed_secu; /* blocked responses because of security concerns */ + struct proxy *proxy; /* the proxy this server belongs to */ +}; + + +#endif /* _TYPES_SERVER_H */ + +/* + * Local variables: + * c-indent-level: 8 + * c-basic-offset: 8 + * End: + */ diff --git a/include/types/session.h b/include/types/session.h new file mode 100644 index 000000000..e2ae54d7d --- /dev/null +++ b/include/types/session.h @@ -0,0 +1,166 @@ +/* + include/types/session.h + This file defines everything related to sessions. + + Copyright (C) 2000-2006 Willy Tarreau - w@1wt.eu + + This library is free software; you can redistribute it and/or + modify it under the terms of the GNU Lesser General Public + License as published by the Free Software Foundation, version 2.1 + exclusively. + + This library is distributed in the hope that it will be useful, + but WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this library; if not, write to the Free Software + Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA +*/ + +#ifndef _TYPES_SESSION_H +#define _TYPES_SESSION_H + + +#include +#include +#include +#include + +#include + +#include +#include +#include +#include +#include + + +/* various session flags, bits values 0x01 to 0x20 (shift 0) */ +#define SN_DIRECT 0x00000001 /* connection made on the server matching the client cookie */ +#define SN_CLDENY 0x00000002 /* a client header matches a deny regex */ +#define SN_CLALLOW 0x00000004 /* a client header matches an allow regex */ +#define SN_SVDENY 0x00000008 /* a server header matches a deny regex */ +#define SN_SVALLOW 0x00000010 /* a server header matches an allow regex */ +#define SN_POST 0x00000020 /* the request was an HTTP POST */ + +/* session flags dedicated to cookies : bits values 0x40, 0x80 (0-3 shift 6) */ +#define SN_CK_NONE 0x00000000 /* this session had no cookie */ +#define SN_CK_INVALID 0x00000040 /* this session had a cookie which matches no server */ +#define SN_CK_DOWN 0x00000080 /* this session had cookie matching a down server */ +#define SN_CK_VALID 0x000000C0 /* this session had cookie matching a valid server */ +#define SN_CK_MASK 0x000000C0 /* mask to get this session's cookie flags */ +#define SN_CK_SHIFT 6 /* bit shift */ + +/* session termination conditions, bits values 0x100 to 0x700 (0-7 shift 8) */ +#define SN_ERR_NONE 0x00000000 +#define SN_ERR_CLITO 0x00000100 /* client time-out */ +#define SN_ERR_CLICL 0x00000200 /* client closed (read/write error) */ +#define SN_ERR_SRVTO 0x00000300 /* server time-out, connect time-out */ +#define SN_ERR_SRVCL 0x00000400 /* server closed (connect/read/write error) */ +#define SN_ERR_PRXCOND 0x00000500 /* the proxy decided to close (deny...) */ +#define SN_ERR_RESOURCE 0x00000600 /* the proxy encountered a lack of a local resources (fd, mem, ...) */ +#define SN_ERR_INTERNAL 0x00000700 /* the proxy encountered an internal error */ +#define SN_ERR_MASK 0x00000700 /* mask to get only session error flags */ +#define SN_ERR_SHIFT 8 /* bit shift */ + +/* session state at termination, bits values 0x1000 to 0x7000 (0-7 shift 12) */ +#define SN_FINST_R 0x00001000 /* session ended during client request */ +#define SN_FINST_C 0x00002000 /* session ended during server connect */ +#define SN_FINST_H 0x00003000 /* session ended during server headers */ +#define SN_FINST_D 0x00004000 /* session ended during data phase */ +#define SN_FINST_L 0x00005000 /* session ended while pushing last data to client */ +#define SN_FINST_Q 0x00006000 /* session ended while waiting in queue for a server slot */ +#define SN_FINST_MASK 0x00007000 /* mask to get only final session state flags */ +#define SN_FINST_SHIFT 12 /* bit shift */ + +/* cookie information, bits values 0x10000 to 0x80000 (0-8 shift 16) */ +#define SN_SCK_NONE 0x00000000 /* no set-cookie seen for the server cookie */ +#define SN_SCK_DELETED 0x00010000 /* existing set-cookie deleted or changed */ +#define SN_SCK_INSERTED 0x00020000 /* new set-cookie inserted or changed existing one */ +#define SN_SCK_SEEN 0x00040000 /* set-cookie seen for the server cookie */ +#define SN_SCK_MASK 0x00070000 /* mask to get the set-cookie field */ +#define SN_SCK_ANY 0x00080000 /* at least one set-cookie seen (not to be counted) */ +#define SN_SCK_SHIFT 16 /* bit shift */ + +/* cacheability management, bits values 0x100000 to 0x300000 (0-3 shift 20) */ +#define SN_CACHEABLE 0x00100000 /* at least part of the response is cacheable */ +#define SN_CACHE_COOK 0x00200000 /* a cookie in the response is cacheable */ +#define SN_CACHE_SHIFT 20 /* bit shift */ + +/* various other session flags, bits values 0x400000 and above */ +#define SN_MONITOR 0x00400000 /* this session comes from a monitoring system */ +#define SN_ASSIGNED 0x00800000 /* no need to assign a server to this session */ +#define SN_ADDR_SET 0x01000000 /* this session's server address has been set */ +#define SN_SELF_GEN 0x02000000 /* the proxy generates data for the client (eg: stats) */ + + +/* WARNING: if new fields are added, they must be initialized in event_accept() */ +struct session { + struct task *task; /* the task associated with this session */ + /* application specific below */ + struct timeval crexpire; /* expiration date for a client read */ + struct timeval cwexpire; /* expiration date for a client write */ + struct timeval srexpire; /* expiration date for a server read */ + struct timeval swexpire; /* expiration date for a server write */ + struct timeval cnexpire; /* expiration date for a connect */ + char res_cr, res_cw, res_sr, res_sw; /* results of some events */ + struct proxy *proxy; /* the proxy this socket belongs to */ + int cli_fd; /* the client side fd */ + int srv_fd; /* the server side fd */ + int cli_state; /* state of the client side */ + int srv_state; /* state of the server side */ + int conn_retries; /* number of connect retries left */ + int flags; /* some flags describing the session */ + struct buffer *req; /* request buffer */ + struct buffer *rep; /* response buffer */ + struct sockaddr_storage cli_addr; /* the client address */ + struct sockaddr_in srv_addr; /* the address to connect to */ + struct server *srv; /* the server being used */ + struct pendconn *pend_pos; /* if not NULL, points to the position in the pending queue */ + char **req_cap; /* array of captured request headers (may be NULL) */ + char **rsp_cap; /* array of captured response headers (may be NULL) */ + struct chunk req_line; /* points to first line */ + struct chunk auth_hdr; /* points to 'Authorization:' header */ + struct { + int logwait; /* log fields waiting to be collected : LW_* */ + struct timeval tv_accept; /* date of the accept() (beginning of the session) */ + long t_request; /* delay before the end of the request arrives, -1 if never occurs */ + long t_queue; /* delay before the session gets out of the connect queue, -1 if never occurs */ + long t_connect; /* delay before the connect() to the server succeeds, -1 if never occurs */ + long t_data; /* delay before the first data byte from the server ... */ + unsigned long t_close; /* total session duration */ + unsigned long srv_queue_size; /* number of sessions waiting for a connect slot on this server at accept() time (in direct assignment) */ + unsigned long prx_queue_size; /* overall number of sessions waiting for a connect slot on this instance at accept() time */ + char *uri; /* first line if log needed, NULL otherwise */ + char *cli_cookie; /* cookie presented by the client, in capture mode */ + char *srv_cookie; /* cookie presented by the server, in capture mode */ + int status; /* HTTP status from the server, negative if from proxy */ + long long bytes; /* number of bytes transferred from the server */ + } logs; + short int data_source; /* where to get the data we generate ourselves */ + short int data_state; /* where to get the data we generate ourselves */ + union { + struct { + struct proxy *px; + struct server *sv; + short px_st, sv_st; /* DATA_ST_INIT or DATA_ST_DATA */ + } stats; + } data_ctx; + unsigned int uniq_id; /* unique ID used for the traces */ +}; + + +#define sizeof_session sizeof(struct session) +extern void **pool_session; + + +#endif /* _TYPES_SESSION_H */ + +/* + * Local variables: + * c-indent-level: 8 + * c-basic-offset: 8 + * End: + */ diff --git a/include/types/task.h b/include/types/task.h new file mode 100644 index 000000000..560a2fc68 --- /dev/null +++ b/include/types/task.h @@ -0,0 +1,58 @@ +/* + include/types/task.h + Macros, variables and structures for task management. + + Copyright (C) 2000-2006 Willy Tarreau - w@1wt.eu + + This library is free software; you can redistribute it and/or + modify it under the terms of the GNU Lesser General Public + License as published by the Free Software Foundation, version 2.1 + exclusively. + + This library is distributed in the hope that it will be useful, + but WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this library; if not, write to the Free Software + Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA +*/ + +#ifndef _TYPES_TASK_H +#define _TYPES_TASK_H + + +#include + + +/* values for task->state */ +#define TASK_IDLE 0 +#define TASK_RUNNING 1 + +/* The base for all tasks */ +struct task { + struct task *next, *prev; /* chaining ... */ + struct task *rqnext; /* chaining in run queue ... */ + struct task *wq; /* the wait queue this task is in */ + int state; /* task state : IDLE or RUNNING */ + struct timeval expire; /* next expiration time for this task, use only for fast sorting */ + int (*process)(struct task *t); /* the function which processes the task */ + void *context; /* the task's context */ +}; + +#define sizeof_task sizeof(struct task) +extern void **pool_task; + +extern struct task wait_queue[2]; +extern struct task *rq; + + +#endif /* _TYPES_TASK_H */ + +/* + * Local variables: + * c-indent-level: 8 + * c-basic-offset: 8 + * End: + */ diff --git a/include/template.h b/include/types/template.h similarity index 80% rename from include/template.h rename to include/types/template.h index 9c8620234..8fa1ce52e 100644 --- a/include/template.h +++ b/include/types/template.h @@ -1,6 +1,7 @@ /* - include/template.h + include/types/template.h This file serves as a template for future include files. + Copyright (C) 2000-2006 Willy Tarreau - w@1wt.eu This library is free software; you can redistribute it and/or @@ -18,8 +19,15 @@ Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA */ -#ifndef _TEMPLATE_H -#define _TEMPLATE_H +#ifndef _TYPES_TEMPLATE_H +#define _TYPES_TEMPLATE_H -#endif +#endif /* _TYPES_TEMPLATE_H */ + +/* + * Local variables: + * c-indent-level: 8 + * c-basic-offset: 8 + * End: + */ diff --git a/src/appsession.c b/src/appsession.c new file mode 100644 index 000000000..da7315aa7 --- /dev/null +++ b/src/appsession.c @@ -0,0 +1,222 @@ +/* + * AppSession functions. + * + * Copyright 2004-2006 Alexander Lazic, Klaus Wagner + * + * This program is free software; you can redistribute it and/or + * modify it under the terms of the GNU General Public License + * as published by the Free Software Foundation; either version + * 2 of the License, or (at your option) any later version. + * + */ + +#include + +#include +#include +#include +#include + +#include +#include +#include +#include + +#include + + +void **pool_appsess = NULL; +struct app_pool apools; +int have_appsession; + +#if defined(DEBUG_HASH) +void print_table(const CHTbl *htbl) +{ + ListElmt *element; + int i; + appsess *asession; + + /********************************************************************* + * * + * Display the chained hash table. * + * * + *********************************************************************/ + + fprintf(stdout, "Table size is %d\n", chtbl_size(htbl)); + + for (i = 0; i < TBLSIZ; i++) { + fprintf(stdout, "Bucket[%03d]\n", i); + + for (element = list_head(&htbl->table[i]); + element != NULL; element = list_next(element)) { + //fprintf(stdout, "%c", *(char *)list_data(element)); + asession = (appsess *)list_data(element); + fprintf(stdout, "ELEM :%s:", asession->sessid); + fprintf(stdout, " Server :%s: \n", asession->serverid); + //fprintf(stdout, " Server request_count :%li:\n",asession->request_count); + } + + fprintf(stdout, "\n"); + } + return; +} /* end print_table */ +#endif + +int appsession_init(void) +{ + static int initialized = 0; + int idlen; + struct server *s; + struct proxy *p = proxy; + + if (!initialized) { + if (!appsession_task_init()) { + apools.sessid = NULL; + apools.serverid = NULL; + apools.ser_waste = 0; + apools.ser_use = 0; + apools.ser_msize = sizeof(void *); + apools.ses_waste = 0; + apools.ses_use = 0; + apools.ses_msize = sizeof(void *); + while (p) { + s = p->srv; + if (apools.ses_msize < p->appsession_len) + apools.ses_msize = p->appsession_len; + while (s) { + idlen = strlen(s->id); + if (apools.ser_msize < idlen) + apools.ser_msize = idlen; + s = s->next; + } + p = p->next; + } + /* we use strings, so reserve space for '\0' */ + apools.ser_msize ++; + apools.ses_msize ++; + } + else { + fprintf(stderr, "appsession_task_init failed\n"); + return -1; + } + initialized ++; + } + return 0; +} + +int appsession_task_init(void) +{ + static int initialized = 0; + struct task *t; + if (!initialized) { + if ((t = pool_alloc(task)) == NULL) + return -1; + t->next = t->prev = t->rqnext = NULL; + t->wq = LIST_HEAD(wait_queue[0]); + t->state = TASK_IDLE; + t->context = NULL; + tv_delayfrom(&t->expire, &now, TBLCHKINT); + task_queue(t); + t->process = appsession_refresh; + initialized ++; + } + return 0; +} + +int appsession_refresh(struct task *t) +{ + struct proxy *p = proxy; + CHTbl *htbl; + ListElmt *element, *last; + int i; + appsess *asession; + void *data; + + while (p) { + if (p->appsession_name != NULL) { + htbl = &p->htbl_proxy; + /* if we ever give up the use of TBLSIZ, we need to change this */ + for (i = 0; i < TBLSIZ; i++) { + last = NULL; + for (element = list_head(&htbl->table[i]); + element != NULL; element = list_next(element)) { + asession = (appsess *)list_data(element); + if (tv_cmp2_ms(&asession->expire, &now) <= 0) { + if ((global.mode & MODE_DEBUG) && + (!(global.mode & MODE_QUIET) || (global.mode & MODE_VERBOSE))) { + int len; + /* + on Linux NULL pointers are catched by sprintf, on solaris -> segfault + */ + len = sprintf(trash, "appsession_refresh: cleaning up expired Session '%s' on Server %s\n", + asession->sessid, asession->serverid?asession->serverid:"(null)"); + write(1, trash, len); + } + /* delete the expired element from within the hash table */ + if ((list_rem_next(&htbl->table[i], last, (void **)&data) == 0) + && (htbl->table[i].destroy != NULL)) { + htbl->table[i].destroy(data); + } + if (last == NULL) {/* patient lost his head, get a new one */ + element = list_head(&htbl->table[i]); + if (element == NULL) break; /* no heads left, go to next patient */ + } + else + element = last; + }/* end if (tv_cmp2_ms(&asession->expire, &now) <= 0) */ + else + last = element; + }/* end for (element = list_head(&htbl->table[i]); element != NULL; element = list_next(element)) */ + } + } + p = p->next; + } + tv_delayfrom(&t->expire, &now, TBLCHKINT); /* check expiration every 5 seconds */ + return TBLCHKINT; +} /* end appsession_refresh */ + +int match_str(const void *key1, const void *key2) +{ + appsess *temp1,*temp2; + temp1 = (appsess *)key1; + temp2 = (appsess *)key2; + + //fprintf(stdout,">>>>>>>>>>>>>>temp1->sessid :%s:\n",temp1->sessid); + //fprintf(stdout,">>>>>>>>>>>>>>temp2->sessid :%s:\n",temp2->sessid); + + return (strcmp(temp1->sessid,temp2->sessid) == 0); +}/* end match_str */ + +void destroy(void *data) { + appsess *temp1; + + //printf("destroy called\n"); + temp1 = (appsess *)data; + + if (temp1->sessid) + pool_free_to(apools.sessid, temp1->sessid); + + if (temp1->serverid) + pool_free_to(apools.serverid, temp1->serverid); + + pool_free(appsess, temp1); +} /* end destroy */ + +void appsession_cleanup( void ) +{ + struct proxy *p = proxy; + + while(p) { + chtbl_destroy(&(p->htbl_proxy)); + p = p->next; + } +}/* end appsession_cleanup() */ + + + +/* + * Local variables: + * c-indent-level: 8 + * c-basic-offset: 8 + * End: + */ diff --git a/src/backend.c b/src/backend.c new file mode 100644 index 000000000..ec997901f --- /dev/null +++ b/src/backend.c @@ -0,0 +1,618 @@ +/* + * Backend variables and functions. + * + * Copyright 2000-2006 Willy Tarreau + * + * This program is free software; you can redistribute it and/or + * modify it under the terms of the GNU General Public License + * as published by the Free Software Foundation; either version + * 2 of the License, or (at your option) any later version. + * + */ + +#include +#include +#include +#include +#include + +#include +#include + +#include +#include +#include +#include +#include +#include + +#include +#include +#include +#include +#include +#include +#include + + +/* + * This function recounts the number of usable active and backup servers for + * proxy

. These numbers are returned into the p->srv_act and p->srv_bck. + * This function also recomputes the total active and backup weights. + */ +void recount_servers(struct proxy *px) +{ + struct server *srv; + + px->srv_act = 0; px->srv_bck = px->tot_wact = px->tot_wbck = 0; + for (srv = px->srv; srv != NULL; srv = srv->next) { + if (srv->state & SRV_RUNNING) { + if (srv->state & SRV_BACKUP) { + px->srv_bck++; + px->tot_wbck += srv->eweight + 1; + } else { + px->srv_act++; + px->tot_wact += srv->eweight + 1; + } + } + } +} + +/* This function recomputes the server map for proxy px. It + * relies on px->tot_wact and px->tot_wbck, so it must be + * called after recount_servers(). It also expects px->srv_map + * to be initialized to the largest value needed. + */ +void recalc_server_map(struct proxy *px) +{ + int o, tot, flag; + struct server *cur, *best; + + if (px->srv_act) { + flag = SRV_RUNNING; + tot = px->tot_wact; + } else if (px->srv_bck) { + flag = SRV_RUNNING | SRV_BACKUP; + if (px->options & PR_O_USE_ALL_BK) + tot = px->tot_wbck; + else + tot = 1; /* the first server is enough */ + } else { + px->srv_map_sz = 0; + return; + } + + /* this algorithm gives priority to the first server, which means that + * it will respect the declaration order for equivalent weights, and + * that whatever the weights, the first server called will always be + * the first declard. This is an important asumption for the backup + * case, where we want the first server only. + */ + for (cur = px->srv; cur; cur = cur->next) + cur->wscore = 0; + + for (o = 0; o < tot; o++) { + int max = 0; + best = NULL; + for (cur = px->srv; cur; cur = cur->next) { + if ((cur->state & (SRV_RUNNING | SRV_BACKUP)) == flag) { + int v; + + /* If we are forced to return only one server, we don't want to + * go further, because we would return the wrong one due to + * divide overflow. + */ + if (tot == 1) { + best = cur; + break; + } + + cur->wscore += cur->eweight + 1; + v = (cur->wscore + tot) / tot; /* result between 0 and 3 */ + if (best == NULL || v > max) { + max = v; + best = cur; + } + } + } + px->srv_map[o] = best; + best->wscore -= tot; + } + px->srv_map_sz = tot; +} + + +/* + * This function marks the session as 'assigned' in direct or dispatch modes, + * or tries to assign one in balance mode, according to the algorithm. It does + * nothing if the session had already been assigned a server. + * + * It may return : + * SRV_STATUS_OK if everything is OK. s->srv will be valid. + * SRV_STATUS_NOSRV if no server is available. s->srv = NULL. + * SRV_STATUS_FULL if all servers are saturated. s->srv = NULL. + * SRV_STATUS_INTERNAL for other unrecoverable errors. + * + * Upon successful return, the session flag SN_ASSIGNED to indicate that it does + * not need to be called anymore. This usually means that s->srv can be trusted + * in balance and direct modes. This flag is not cleared, so it's to the caller + * to clear it if required (eg: redispatch). + * + */ + +int assign_server(struct session *s) +{ +#ifdef DEBUG_FULL + fprintf(stderr,"assign_server : s=%p\n",s); +#endif + + if (s->pend_pos) + return SRV_STATUS_INTERNAL; + + if (!(s->flags & SN_ASSIGNED)) { + if ((s->proxy->options & PR_O_BALANCE) && !(s->flags & SN_DIRECT)) { + if (!s->proxy->srv_act && !s->proxy->srv_bck) + return SRV_STATUS_NOSRV; + + if (s->proxy->options & PR_O_BALANCE_RR) { + s->srv = get_server_rr_with_conns(s->proxy); + if (!s->srv) + return SRV_STATUS_FULL; + } + else if (s->proxy->options & PR_O_BALANCE_SH) { + int len; + + if (s->cli_addr.ss_family == AF_INET) + len = 4; + else if (s->cli_addr.ss_family == AF_INET6) + len = 16; + else /* unknown IP family */ + return SRV_STATUS_INTERNAL; + + s->srv = get_server_sh(s->proxy, + (void *)&((struct sockaddr_in *)&s->cli_addr)->sin_addr, + len); + } + else /* unknown balancing algorithm */ + return SRV_STATUS_INTERNAL; + } + s->flags |= SN_ASSIGNED; + } + return SRV_STATUS_OK; +} + + +/* + * This function assigns a server address to a session, and sets SN_ADDR_SET. + * The address is taken from the currently assigned server, or from the + * dispatch or transparent address. + * + * It may return : + * SRV_STATUS_OK if everything is OK. + * SRV_STATUS_INTERNAL for other unrecoverable errors. + * + * Upon successful return, the session flag SN_ADDR_SET is set. This flag is + * not cleared, so it's to the caller to clear it if required. + * + */ +int assign_server_address(struct session *s) +{ +#ifdef DEBUG_FULL + fprintf(stderr,"assign_server_address : s=%p\n",s); +#endif + + if (s->flags & SN_DIRECT || s->proxy->options & PR_O_BALANCE) { + /* A server is necessarily known for this session */ + if (!(s->flags & SN_ASSIGNED)) + return SRV_STATUS_INTERNAL; + + s->srv_addr = s->srv->addr; + + /* if this server remaps proxied ports, we'll use + * the port the client connected to with an offset. */ + if (s->srv->state & SRV_MAPPORTS) { + struct sockaddr_in sockname; + socklen_t namelen = sizeof(sockname); + + if (!(s->proxy->options & PR_O_TRANSP) || + get_original_dst(s->cli_fd, (struct sockaddr_in *)&sockname, &namelen) == -1) + getsockname(s->cli_fd, (struct sockaddr *)&sockname, &namelen); + s->srv_addr.sin_port = htons(ntohs(s->srv_addr.sin_port) + ntohs(sockname.sin_port)); + } + } + else if (*(int *)&s->proxy->dispatch_addr.sin_addr) { + /* connect to the defined dispatch addr */ + s->srv_addr = s->proxy->dispatch_addr; + } + else if (s->proxy->options & PR_O_TRANSP) { + /* in transparent mode, use the original dest addr if no dispatch specified */ + socklen_t salen = sizeof(s->srv_addr); + + if (get_original_dst(s->cli_fd, &s->srv_addr, &salen) == -1) { + qfprintf(stderr, "Cannot get original server address.\n"); + return SRV_STATUS_INTERNAL; + } + } + + s->flags |= SN_ADDR_SET; + return SRV_STATUS_OK; +} + + +/* This function assigns a server to session if required, and can add the + * connection to either the assigned server's queue or to the proxy's queue. + * + * Returns : + * + * SRV_STATUS_OK if everything is OK. + * SRV_STATUS_NOSRV if no server is available. s->srv = NULL. + * SRV_STATUS_QUEUED if the connection has been queued. + * SRV_STATUS_FULL if the server(s) is/are saturated and the + * connection could not be queued. + * SRV_STATUS_INTERNAL for other unrecoverable errors. + * + */ +int assign_server_and_queue(struct session *s) +{ + struct pendconn *p; + int err; + + if (s->pend_pos) + return SRV_STATUS_INTERNAL; + + if (s->flags & SN_ASSIGNED) { + /* a server does not need to be assigned, perhaps because we're in + * direct mode, or in dispatch or transparent modes where the server + * is not needed. + */ + if (s->srv && + s->srv->maxconn && s->srv->cur_sess >= srv_dynamic_maxconn(s->srv)) { + p = pendconn_add(s); + if (p) + return SRV_STATUS_QUEUED; + else + return SRV_STATUS_FULL; + } + return SRV_STATUS_OK; + } + + /* a server needs to be assigned */ + err = assign_server(s); + switch (err) { + case SRV_STATUS_OK: + /* in balance mode, we might have servers with connection limits */ + if (s->srv && + s->srv->maxconn && s->srv->cur_sess >= srv_dynamic_maxconn(s->srv)) { + p = pendconn_add(s); + if (p) + return SRV_STATUS_QUEUED; + else + return SRV_STATUS_FULL; + } + return SRV_STATUS_OK; + + case SRV_STATUS_FULL: + /* queue this session into the proxy's queue */ + p = pendconn_add(s); + if (p) + return SRV_STATUS_QUEUED; + else + return SRV_STATUS_FULL; + + case SRV_STATUS_NOSRV: + case SRV_STATUS_INTERNAL: + return err; + default: + return SRV_STATUS_INTERNAL; + } +} + + +/* + * This function initiates a connection to the server assigned to this session + * (s->srv, s->srv_addr). It will assign a server if none is assigned yet. + * It can return one of : + * - SN_ERR_NONE if everything's OK + * - SN_ERR_SRVTO if there are no more servers + * - SN_ERR_SRVCL if the connection was refused by the server + * - SN_ERR_PRXCOND if the connection has been limited by the proxy (maxconn) + * - SN_ERR_RESOURCE if a system resource is lacking (eg: fd limits, ports, ...) + * - SN_ERR_INTERNAL for any other purely internal errors + * Additionnally, in the case of SN_ERR_RESOURCE, an emergency log will be emitted. + */ +int connect_server(struct session *s) +{ + int fd, err; + + if (!(s->flags & SN_ADDR_SET)) { + err = assign_server_address(s); + if (err != SRV_STATUS_OK) + return SN_ERR_INTERNAL; + } + + if ((fd = s->srv_fd = socket(AF_INET, SOCK_STREAM, IPPROTO_TCP)) == -1) { + qfprintf(stderr, "Cannot get a server socket.\n"); + + if (errno == ENFILE) + send_log(s->proxy, LOG_EMERG, + "Proxy %s reached system FD limit at %d. Please check system tunables.\n", + s->proxy->id, maxfd); + else if (errno == EMFILE) + send_log(s->proxy, LOG_EMERG, + "Proxy %s reached process FD limit at %d. Please check 'ulimit-n' and restart.\n", + s->proxy->id, maxfd); + else if (errno == ENOBUFS || errno == ENOMEM) + send_log(s->proxy, LOG_EMERG, + "Proxy %s reached system memory limit at %d sockets. Please check system tunables.\n", + s->proxy->id, maxfd); + /* this is a resource error */ + return SN_ERR_RESOURCE; + } + + if (fd >= global.maxsock) { + /* do not log anything there, it's a normal condition when this option + * is used to serialize connections to a server ! + */ + Alert("socket(): not enough free sockets. Raise -n argument. Giving up.\n"); + close(fd); + return SN_ERR_PRXCOND; /* it is a configuration limit */ + } + + if ((fcntl(fd, F_SETFL, O_NONBLOCK)==-1) || + (setsockopt(fd, IPPROTO_TCP, TCP_NODELAY, (char *) &one, sizeof(one)) == -1)) { + qfprintf(stderr,"Cannot set client socket to non blocking mode.\n"); + close(fd); + return SN_ERR_INTERNAL; + } + + if (s->proxy->options & PR_O_TCP_SRV_KA) + setsockopt(fd, SOL_SOCKET, SO_KEEPALIVE, (char *) &one, sizeof(one)); + + /* allow specific binding : + * - server-specific at first + * - proxy-specific next + */ + if (s->srv != NULL && s->srv->state & SRV_BIND_SRC) { + setsockopt(fd, SOL_SOCKET, SO_REUSEADDR, (char *) &one, sizeof(one)); + if (bind(fd, (struct sockaddr *)&s->srv->source_addr, sizeof(s->srv->source_addr)) == -1) { + Alert("Cannot bind to source address before connect() for server %s/%s. Aborting.\n", + s->proxy->id, s->srv->id); + close(fd); + send_log(s->proxy, LOG_EMERG, + "Cannot bind to source address before connect() for server %s/%s.\n", + s->proxy->id, s->srv->id); + return SN_ERR_RESOURCE; + } + } + else if (s->proxy->options & PR_O_BIND_SRC) { + setsockopt(fd, SOL_SOCKET, SO_REUSEADDR, (char *) &one, sizeof(one)); + if (bind(fd, (struct sockaddr *)&s->proxy->source_addr, sizeof(s->proxy->source_addr)) == -1) { + Alert("Cannot bind to source address before connect() for proxy %s. Aborting.\n", s->proxy->id); + close(fd); + send_log(s->proxy, LOG_EMERG, + "Cannot bind to source address before connect() for server %s/%s.\n", + s->proxy->id, s->srv->id); + return SN_ERR_RESOURCE; + } + } + + if ((connect(fd, (struct sockaddr *)&s->srv_addr, sizeof(s->srv_addr)) == -1) && + (errno != EINPROGRESS) && (errno != EALREADY) && (errno != EISCONN)) { + + if (errno == EAGAIN || errno == EADDRINUSE) { + char *msg; + if (errno == EAGAIN) /* no free ports left, try again later */ + msg = "no free ports"; + else + msg = "local address already in use"; + + qfprintf(stderr,"Cannot connect: %s.\n",msg); + close(fd); + send_log(s->proxy, LOG_EMERG, + "Connect() failed for server %s/%s: %s.\n", + s->proxy->id, s->srv->id, msg); + return SN_ERR_RESOURCE; + } else if (errno == ETIMEDOUT) { + //qfprintf(stderr,"Connect(): ETIMEDOUT"); + close(fd); + return SN_ERR_SRVTO; + } else { + // (errno == ECONNREFUSED || errno == ENETUNREACH || errno == EACCES || errno == EPERM) + //qfprintf(stderr,"Connect(): %d", errno); + close(fd); + return SN_ERR_SRVCL; + } + } + + fdtab[fd].owner = s->task; + fdtab[fd].read = &event_srv_read; + fdtab[fd].write = &event_srv_write; + fdtab[fd].state = FD_STCONN; /* connection in progress */ + + FD_SET(fd, StaticWriteEvent); /* for connect status */ +#if defined(DEBUG_FULL) && defined(ENABLE_EPOLL) + if (PrevReadEvent) { + assert(!(FD_ISSET(fd, PrevReadEvent))); + assert(!(FD_ISSET(fd, PrevWriteEvent))); + } +#endif + + fd_insert(fd); + if (s->srv) { + s->srv->cur_sess++; + if (s->srv->cur_sess > s->srv->cur_sess_max) + s->srv->cur_sess_max = s->srv->cur_sess; + } + + if (s->proxy->contimeout) + tv_delayfrom(&s->cnexpire, &now, s->proxy->contimeout); + else + tv_eternity(&s->cnexpire); + return SN_ERR_NONE; /* connection is OK */ +} + + +/* + * This function checks the retry count during the connect() job. + * It updates the session's srv_state and retries, so that the caller knows + * what it has to do. It uses the last connection error to set the log when + * it expires. It returns 1 when it has expired, and 0 otherwise. + */ +int srv_count_retry_down(struct session *t, int conn_err) +{ + /* we are in front of a retryable error */ + t->conn_retries--; + if (t->conn_retries < 0) { + /* if not retryable anymore, let's abort */ + tv_eternity(&t->cnexpire); + srv_close_with_err(t, conn_err, SN_FINST_C, + 503, t->proxy->errmsg.len503, t->proxy->errmsg.msg503); + if (t->srv) + t->srv->failed_conns++; + t->proxy->failed_conns++; + + /* We used to have a free connection slot. Since we'll never use it, + * we have to inform the server that it may be used by another session. + */ + if (may_dequeue_tasks(t->srv, t->proxy)) + task_wakeup(&rq, t->srv->queue_mgt); + return 1; + } + return 0; +} + + +/* + * This function performs the retryable part of the connect() job. + * It updates the session's srv_state and retries, so that the caller knows + * what it has to do. It returns 1 when it breaks out of the loop, or 0 if + * it needs to redispatch. + */ +int srv_retryable_connect(struct session *t) +{ + int conn_err; + + /* This loop ensures that we stop before the last retry in case of a + * redispatchable server. + */ + do { + /* initiate a connection to the server */ + conn_err = connect_server(t); + switch (conn_err) { + + case SN_ERR_NONE: + //fprintf(stderr,"0: c=%d, s=%d\n", c, s); + t->srv_state = SV_STCONN; + return 1; + + case SN_ERR_INTERNAL: + tv_eternity(&t->cnexpire); + srv_close_with_err(t, SN_ERR_INTERNAL, SN_FINST_C, + 500, t->proxy->errmsg.len500, t->proxy->errmsg.msg500); + if (t->srv) + t->srv->failed_conns++; + t->proxy->failed_conns++; + /* release other sessions waiting for this server */ + if (may_dequeue_tasks(t->srv, t->proxy)) + task_wakeup(&rq, t->srv->queue_mgt); + return 1; + } + /* ensure that we have enough retries left */ + if (srv_count_retry_down(t, conn_err)) { + /* let's try to offer this slot to anybody */ + if (may_dequeue_tasks(t->srv, t->proxy)) + task_wakeup(&rq, t->srv->queue_mgt); + return 1; + } + } while (t->srv == NULL || t->conn_retries > 0 || !(t->proxy->options & PR_O_REDISP)); + + /* We're on our last chance, and the REDISP option was specified. + * We will ignore cookie and force to balance or use the dispatcher. + */ + /* let's try to offer this slot to anybody */ + if (may_dequeue_tasks(t->srv, t->proxy)) + task_wakeup(&rq, t->srv->queue_mgt); + + if (t->srv) + t->srv->failed_conns++; + t->proxy->failed_conns++; + + t->flags &= ~(SN_DIRECT | SN_ASSIGNED | SN_ADDR_SET); + t->srv = NULL; /* it's left to the dispatcher to choose a server */ + if ((t->flags & SN_CK_MASK) == SN_CK_VALID) { + t->flags &= ~SN_CK_MASK; + t->flags |= SN_CK_DOWN; + } + return 0; +} + + +/* This function performs the "redispatch" part of a connection attempt. It + * will assign a server if required, queue the connection if required, and + * handle errors that might arise at this level. It can change the server + * state. It will return 1 if it encounters an error, switches the server + * state, or has to queue a connection. Otherwise, it will return 0 indicating + * that the connection is ready to use. + */ + +int srv_redispatch_connect(struct session *t) +{ + int conn_err; + + /* We know that we don't have any connection pending, so we will + * try to get a new one, and wait in this state if it's queued + */ + conn_err = assign_server_and_queue(t); + switch (conn_err) { + case SRV_STATUS_OK: + break; + + case SRV_STATUS_NOSRV: + /* note: it is guaranteed that t->srv == NULL here */ + tv_eternity(&t->cnexpire); + srv_close_with_err(t, SN_ERR_SRVTO, SN_FINST_C, + 503, t->proxy->errmsg.len503, t->proxy->errmsg.msg503); + if (t->srv) + t->srv->failed_conns++; + t->proxy->failed_conns++; + + return 1; + + case SRV_STATUS_QUEUED: + /* FIXME-20060503 : we should use the queue timeout instead */ + if (t->proxy->contimeout) + tv_delayfrom(&t->cnexpire, &now, t->proxy->contimeout); + else + tv_eternity(&t->cnexpire); + t->srv_state = SV_STIDLE; + /* do nothing else and do not wake any other session up */ + return 1; + + case SRV_STATUS_FULL: + case SRV_STATUS_INTERNAL: + default: + tv_eternity(&t->cnexpire); + srv_close_with_err(t, SN_ERR_INTERNAL, SN_FINST_C, + 500, t->proxy->errmsg.len500, t->proxy->errmsg.msg500); + if (t->srv) + t->srv->failed_conns++; + t->proxy->failed_conns++; + + /* release other sessions waiting for this server */ + if (may_dequeue_tasks(t->srv, t->proxy)) + task_wakeup(&rq, t->srv->queue_mgt); + return 1; + } + /* if we get here, it's because we got SRV_STATUS_OK, which also + * means that the connection has not been queued. + */ + return 0; +} + + +/* + * Local variables: + * c-indent-level: 8 + * c-basic-offset: 8 + * End: + */ diff --git a/src/base64.c b/src/base64.c index 79e86c200..a427d5d83 100644 --- a/src/base64.c +++ b/src/base64.c @@ -1,6 +1,7 @@ /* * Ascii to Base64 conversion as described in RFC1421. - * Copyright 2006 Willy Tarreau + * + * Copyright 2006 Willy Tarreau * * This program is free software; you can redistribute it and/or * modify it under the terms of the GNU General Public License @@ -9,8 +10,9 @@ * */ -#include +#include +const char base64tab[64]="ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/"; /* Encodes bytes from to for at most chars (including * the trailing zero). Returns the number of bytes written. No check is made @@ -19,7 +21,6 @@ */ int a2base64(char *in, int ilen, char *out, int olen) { - char base64[64]="ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/"; int convlen; convlen = ((ilen + 2) / 3) * 4; @@ -29,10 +30,10 @@ int a2base64(char *in, int ilen, char *out, int olen) /* we don't need to check olen anymore */ while (ilen >= 3) { - out[0] = base64[(((unsigned char)in[0]) >> 2)]; - out[1] = base64[(((unsigned char)in[0] & 0x03) << 4) | (((unsigned char)in[1]) >> 4)]; - out[2] = base64[(((unsigned char)in[1] & 0x0F) << 2) | (((unsigned char)in[2]) >> 6)]; - out[3] = base64[(((unsigned char)in[2] & 0x3F))]; + out[0] = base64tab[(((unsigned char)in[0]) >> 2)]; + out[1] = base64tab[(((unsigned char)in[0] & 0x03) << 4) | (((unsigned char)in[1]) >> 4)]; + out[2] = base64tab[(((unsigned char)in[1] & 0x0F) << 2) | (((unsigned char)in[2]) >> 6)]; + out[3] = base64tab[(((unsigned char)in[2] & 0x3F))]; out += 4; in += 3; ilen -= 3; } @@ -40,14 +41,14 @@ int a2base64(char *in, int ilen, char *out, int olen) if (!ilen) { out[0] = '\0'; } else { - out[0] = base64[((unsigned char)in[0]) >> 2]; + out[0] = base64tab[((unsigned char)in[0]) >> 2]; if (ilen == 1) { - out[1] = base64[((unsigned char)in[0] & 0x03) << 4]; + out[1] = base64tab[((unsigned char)in[0] & 0x03) << 4]; out[2] = '='; } else { - out[1] = base64[(((unsigned char)in[0] & 0x03) << 4) | + out[1] = base64tab[(((unsigned char)in[0] & 0x03) << 4) | (((unsigned char)in[1]) >> 4)]; - out[2] = base64[((unsigned char)in[1] & 0x0F) << 2]; + out[2] = base64tab[((unsigned char)in[1] & 0x0F) << 2]; } out[3] = '='; out[4] = '\0'; diff --git a/src/buffers.c b/src/buffers.c new file mode 100644 index 000000000..bbc1f2831 --- /dev/null +++ b/src/buffers.c @@ -0,0 +1,116 @@ +/* + * Buffer management functions. + * + * Copyright 2000-2006 Willy Tarreau + * + * This program is free software; you can redistribute it and/or + * modify it under the terms of the GNU General Public License + * as published by the Free Software Foundation; either version + * 2 of the License, or (at your option) any later version. + * + */ + +#include +#include + +void **pool_buffer = NULL; + +/* writes bytes from message to buffer . Returns 0 in case of + * success, or the number of bytes available otherwise. + * FIXME-20060521: handle unaligned data. + */ +int buffer_write(struct buffer *buf, const char *msg, int len) +{ + int max; + + max = buffer_realign(buf); + + if (len > max) + return max; + + memcpy(buf->r, msg, len); + buf->l += len; + buf->r += len; + if (buf->r == buf->data + BUFSIZE) + buf->r = buf->data; + return 0; +} + +/* + * this function writes the string at position which must be in buffer , + * and moves just after the end of . + * 's parameters (l, r, w, h, lr) are recomputed to be valid after the shift. + * the shift value (positive or negative) is returned. + * If there's no space left, the move is not done. + * + */ +int buffer_replace(struct buffer *b, char *pos, char *end, char *str) +{ + int delta; + int len; + + len = strlen(str); + delta = len - (end - pos); + + if (delta + b->r >= b->data + BUFSIZE) + return 0; /* no space left */ + + /* first, protect the end of the buffer */ + memmove(end + delta, end, b->data + b->l - end); + + /* now, copy str over pos */ + memcpy(pos, str,len); + + /* we only move data after the displaced zone */ + if (b->r > pos) b->r += delta; + if (b->w > pos) b->w += delta; + if (b->h > pos) b->h += delta; + if (b->lr > pos) b->lr += delta; + b->l += delta; + + return delta; +} + +/* + * same except that the string length is given, which allows str to be NULL if + * len is 0. + */ +int buffer_replace2(struct buffer *b, char *pos, char *end, char *str, int len) +{ + int delta; + + delta = len - (end - pos); + + if (delta + b->r >= b->data + BUFSIZE) + return 0; /* no space left */ + + if (b->data + b->l < end) { + /* The data has been stolen, we could have crashed. + * Maybe we should abort() ? */ + return 0; + } + + /* first, protect the end of the buffer */ + memmove(end + delta, end, b->data + b->l - end); + + /* now, copy str over pos */ + if (len) + memcpy(pos, str, len); + + /* we only move data after the displaced zone */ + if (b->r > pos) b->r += delta; + if (b->w > pos) b->w += delta; + if (b->h > pos) b->h += delta; + if (b->lr > pos) b->lr += delta; + b->l += delta; + + return delta; +} + + +/* + * Local variables: + * c-indent-level: 8 + * c-basic-offset: 8 + * End: + */ diff --git a/src/capture.c b/src/capture.c new file mode 100644 index 000000000..3a7c2c6b1 --- /dev/null +++ b/src/capture.c @@ -0,0 +1,24 @@ +/* + * Capture variables and functions. + * + * Copyright 2000-2006 Willy Tarreau + * + * This program is free software; you can redistribute it and/or + * modify it under the terms of the GNU General Public License + * as published by the Free Software Foundation; either version + * 2 of the License, or (at your option) any later version. + * + */ + +#include +#include + +void **pool_capture = NULL; + + +/* + * Local variables: + * c-indent-level: 8 + * c-basic-offset: 8 + * End: + */ diff --git a/src/cfgparse.c b/src/cfgparse.c new file mode 100644 index 000000000..52b6e0865 --- /dev/null +++ b/src/cfgparse.c @@ -0,0 +1,2058 @@ +/* + * Configuration parser + * + * Copyright 2000-2006 Willy Tarreau + * + * This program is free software; you can redistribute it and/or + * modify it under the terms of the GNU General Public License + * as published by the Free Software Foundation; either version + * 2 of the License, or (at your option) any later version. + * + */ + +#include +#include +#include +#include +#include + +#include +#include +#include +#include +#include +#include + +#include +#include +#include +#include +#include + +#include +#include +#include +#include +#include + + +const char *HTTP_302 = + "HTTP/1.0 302 Found\r\n" + "Cache-Control: no-cache\r\n" + "Connection: close\r\n" + "Location: "; /* not terminated since it will be concatenated with the URL */ + +/* same as 302 except that the browser MUST retry with the GET method */ +const char *HTTP_303 = + "HTTP/1.0 303 See Other\r\n" + "Cache-Control: no-cache\r\n" + "Connection: close\r\n" + "Location: "; /* not terminated since it will be concatenated with the URL */ + +const char *HTTP_400 = + "HTTP/1.0 400 Bad request\r\n" + "Cache-Control: no-cache\r\n" + "Connection: close\r\n" + "\r\n" + "

400 Bad request

\nYour browser sent an invalid request.\n\n"; + +const char *HTTP_403 = + "HTTP/1.0 403 Forbidden\r\n" + "Cache-Control: no-cache\r\n" + "Connection: close\r\n" + "\r\n" + "

403 Forbidden

\nRequest forbidden by administrative rules.\n\n"; + +const char *HTTP_408 = + "HTTP/1.0 408 Request Time-out\r\n" + "Cache-Control: no-cache\r\n" + "Connection: close\r\n" + "\r\n" + "

408 Request Time-out

\nYour browser didn't send a complete request in time.\n\n"; + +const char *HTTP_500 = + "HTTP/1.0 500 Server Error\r\n" + "Cache-Control: no-cache\r\n" + "Connection: close\r\n" + "\r\n" + "

500 Server Error

\nAn internal server error occured.\n\n"; + +const char *HTTP_502 = + "HTTP/1.0 502 Bad Gateway\r\n" + "Cache-Control: no-cache\r\n" + "Connection: close\r\n" + "\r\n" + "

502 Bad Gateway

\nThe server returned an invalid or incomplete response.\n\n"; + +const char *HTTP_503 = + "HTTP/1.0 503 Service Unavailable\r\n" + "Cache-Control: no-cache\r\n" + "Connection: close\r\n" + "\r\n" + "

503 Service Unavailable

\nNo server is available to handle this request.\n\n"; + +const char *HTTP_504 = + "HTTP/1.0 504 Gateway Time-out\r\n" + "Cache-Control: no-cache\r\n" + "Connection: close\r\n" + "\r\n" + "

504 Gateway Time-out

\nThe server didn't respond in time.\n\n"; + + +static struct proxy defproxy; /* fake proxy used to assign default values on all instances */ +int cfg_maxpconn = DEFAULT_MAXCONN; /* # of simultaneous connections per proxy (-N) */ +int cfg_maxconn = 0; /* # of simultaneous connections, (-n) */ + +/* + * converts to a list of listeners which are dynamically allocated. + * The format is "{addr|'*'}:port[-end][,{addr|'*'}:port[-end]]*", where : + * - can be empty or "*" to indicate INADDR_ANY ; + * - is a numerical port from 1 to 65535 ; + * - indicates to use the range from to instead (inclusive). + * This can be repeated as many times as necessary, separated by a coma. + * The argument is a pointer to a current list which should be appended + * to the tail of the new list. The pointer to the new list is returned. + */ +static struct listener *str2listener(char *str, struct listener *tail) +{ + struct listener *l; + char *c, *next, *range, *dupstr; + int port, end; + + next = dupstr = strdup(str); + + while (next && *next) { + struct sockaddr_storage ss; + + str = next; + /* 1) look for the end of the first address */ + if ((next = strrchr(str, ',')) != NULL) { + *next++ = 0; + } + + /* 2) look for the addr/port delimiter, it's the last colon. */ + if ((range = strrchr(str, ':')) == NULL) { + Alert("Missing port number: '%s'\n", str); + goto fail; + } + + *range++ = 0; + + if (strrchr(str, ':') != NULL) { + /* IPv6 address contains ':' */ + memset(&ss, 0, sizeof(ss)); + ss.ss_family = AF_INET6; + + if (!inet_pton(ss.ss_family, str, &((struct sockaddr_in6 *)&ss)->sin6_addr)) { + Alert("Invalid server address: '%s'\n", str); + goto fail; + } + } + else { + memset(&ss, 0, sizeof(ss)); + ss.ss_family = AF_INET; + + if (*str == '*' || *str == '\0') { /* INADDR_ANY */ + ((struct sockaddr_in *)&ss)->sin_addr.s_addr = INADDR_ANY; + } + else if (!inet_pton(ss.ss_family, str, &((struct sockaddr_in *)&ss)->sin_addr)) { + struct hostent *he; + + if ((he = gethostbyname(str)) == NULL) { + Alert("Invalid server name: '%s'\n", str); + goto fail; + } + else + ((struct sockaddr_in *)&ss)->sin_addr = + *(struct in_addr *) *(he->h_addr_list); + } + } + + /* 3) look for the port-end delimiter */ + if ((c = strchr(range, '-')) != NULL) { + *c++ = 0; + end = atol(c); + } + else { + end = atol(range); + } + + port = atol(range); + + if (port < 1 || port > 65535) { + Alert("Invalid port '%d' specified for address '%s'.\n", port, str); + goto fail; + } + + if (end < 1 || end > 65535) { + Alert("Invalid port '%d' specified for address '%s'.\n", end, str); + goto fail; + } + + for (; port <= end; port++) { + l = (struct listener *)calloc(1, sizeof(struct listener)); + l->next = tail; + tail = l; + + l->fd = -1; + l->addr = ss; + if (ss.ss_family == AF_INET6) + ((struct sockaddr_in6 *)(&l->addr))->sin6_port = htons(port); + else + ((struct sockaddr_in *)(&l->addr))->sin_port = htons(port); + + } /* end for(port) */ + } /* end while(next) */ + free(dupstr); + return tail; + fail: + free(dupstr); + return NULL; +} + + +/* + * parse a line in a section. Returns 0 if OK, -1 if error. + */ +int cfg_parse_global(char *file, int linenum, char **args) +{ + + if (!strcmp(args[0], "global")) { /* new section */ + /* no option, nothing special to do */ + return 0; + } + else if (!strcmp(args[0], "daemon")) { + global.mode |= MODE_DAEMON; + } + else if (!strcmp(args[0], "debug")) { + global.mode |= MODE_DEBUG; + } + else if (!strcmp(args[0], "noepoll")) { + cfg_polling_mechanism &= ~POLL_USE_EPOLL; + } + else if (!strcmp(args[0], "nopoll")) { + cfg_polling_mechanism &= ~POLL_USE_POLL; + } + else if (!strcmp(args[0], "quiet")) { + global.mode |= MODE_QUIET; + } + else if (!strcmp(args[0], "stats")) { + global.mode |= MODE_STATS; + } + else if (!strcmp(args[0], "uid")) { + if (global.uid != 0) { + Alert("parsing [%s:%d] : '%s' already specified. Continuing.\n", file, linenum, args[0]); + return 0; + } + if (*(args[1]) == 0) { + Alert("parsing [%s:%d] : '%s' expects an integer argument.\n", file, linenum, args[0]); + return -1; + } + global.uid = atol(args[1]); + } + else if (!strcmp(args[0], "gid")) { + if (global.gid != 0) { + Alert("parsing [%s:%d] : '%s' already specified. Continuing.\n", file, linenum, args[0]); + return 0; + } + if (*(args[1]) == 0) { + Alert("parsing [%s:%d] : '%s' expects an integer argument.\n", file, linenum, args[0]); + return -1; + } + global.gid = atol(args[1]); + } + else if (!strcmp(args[0], "nbproc")) { + if (global.nbproc != 0) { + Alert("parsing [%s:%d] : '%s' already specified. Continuing.\n", file, linenum, args[0]); + return 0; + } + if (*(args[1]) == 0) { + Alert("parsing [%s:%d] : '%s' expects an integer argument.\n", file, linenum, args[0]); + return -1; + } + global.nbproc = atol(args[1]); + } + else if (!strcmp(args[0], "maxconn")) { + if (global.maxconn != 0) { + Alert("parsing [%s:%d] : '%s' already specified. Continuing.\n", file, linenum, args[0]); + return 0; + } + if (*(args[1]) == 0) { + Alert("parsing [%s:%d] : '%s' expects an integer argument.\n", file, linenum, args[0]); + return -1; + } + global.maxconn = atol(args[1]); +#ifdef SYSTEM_MAXCONN + if (global.maxconn > DEFAULT_MAXCONN && cfg_maxconn <= DEFAULT_MAXCONN) { + Alert("parsing [%s:%d] : maxconn value %d too high for this system.\nLimiting to %d. Please use '-n' to force the value.\n", file, linenum, global.maxconn, DEFAULT_MAXCONN); + global.maxconn = DEFAULT_MAXCONN; + } +#endif /* SYSTEM_MAXCONN */ + } + else if (!strcmp(args[0], "ulimit-n")) { + if (global.rlimit_nofile != 0) { + Alert("parsing [%s:%d] : '%s' already specified. Continuing.\n", file, linenum, args[0]); + return 0; + } + if (*(args[1]) == 0) { + Alert("parsing [%s:%d] : '%s' expects an integer argument.\n", file, linenum, args[0]); + return -1; + } + global.rlimit_nofile = atol(args[1]); + } + else if (!strcmp(args[0], "chroot")) { + if (global.chroot != NULL) { + Alert("parsing [%s:%d] : '%s' already specified. Continuing.\n", file, linenum, args[0]); + return 0; + } + if (*(args[1]) == 0) { + Alert("parsing [%s:%d] : '%s' expects a directory as an argument.\n", file, linenum, args[0]); + return -1; + } + global.chroot = strdup(args[1]); + } + else if (!strcmp(args[0], "pidfile")) { + if (global.pidfile != NULL) { + Alert("parsing [%s:%d] : '%s' already specified. Continuing.\n", file, linenum, args[0]); + return 0; + } + if (*(args[1]) == 0) { + Alert("parsing [%s:%d] : '%s' expects a file name as an argument.\n", file, linenum, args[0]); + return -1; + } + global.pidfile = strdup(args[1]); + } + else if (!strcmp(args[0], "log")) { /* syslog server address */ + struct sockaddr_in *sa; + int facility, level; + + if (*(args[1]) == 0 || *(args[2]) == 0) { + Alert("parsing [%s:%d] : '%s' expects
and as arguments.\n", file, linenum, args[0]); + return -1; + } + + facility = get_log_facility(args[2]); + if (facility < 0) { + Alert("parsing [%s:%d] : unknown log facility '%s'\n", file, linenum, args[2]); + exit(1); + } + + level = 7; /* max syslog level = debug */ + if (*(args[3])) { + level = get_log_level(args[3]); + if (level < 0) { + Alert("parsing [%s:%d] : unknown optional log level '%s'\n", file, linenum, args[3]); + exit(1); + } + } + + sa = str2sa(args[1]); + if (!sa->sin_port) + sa->sin_port = htons(SYSLOG_PORT); + + if (global.logfac1 == -1) { + global.logsrv1 = *sa; + global.logfac1 = facility; + global.loglev1 = level; + } + else if (global.logfac2 == -1) { + global.logsrv2 = *sa; + global.logfac2 = facility; + global.loglev2 = level; + } + else { + Alert("parsing [%s:%d] : too many syslog servers\n", file, linenum); + return -1; + } + + } + else { + Alert("parsing [%s:%d] : unknown keyword '%s' in '%s' section\n", file, linenum, args[0], "global"); + return -1; + } + return 0; +} + + +static void init_default_instance() +{ + memset(&defproxy, 0, sizeof(defproxy)); + defproxy.mode = PR_MODE_TCP; + defproxy.state = PR_STNEW; + defproxy.maxconn = cfg_maxpconn; + defproxy.conn_retries = CONN_RETRIES; + defproxy.logfac1 = defproxy.logfac2 = -1; /* log disabled */ +} + +/* + * parse a line in a section. Returns 0 if OK, -1 if error. + */ +int cfg_parse_listen(char *file, int linenum, char **args) +{ + static struct proxy *curproxy = NULL; + struct server *newsrv = NULL; + char *err; + int rc; + + if (!strcmp(args[0], "listen")) { /* new proxy */ + if (!*args[1]) { + Alert("parsing [%s:%d] : '%s' expects an argument and\n" + " optionnally supports [addr1]:port1[-end1]{,[addr]:port[-end]}...\n", + file, linenum, args[0]); + return -1; + } + + if ((curproxy = (struct proxy *)calloc(1, sizeof(struct proxy))) == NULL) { + Alert("parsing [%s:%d] : out of memory.\n", file, linenum); + return -1; + } + + curproxy->next = proxy; + proxy = curproxy; + LIST_INIT(&curproxy->pendconns); + + curproxy->id = strdup(args[1]); + + /* parse the listener address if any */ + if (*args[2]) { + curproxy->listen = str2listener(args[2], curproxy->listen); + if (!curproxy->listen) + return -1; + global.maxsock++; + } + + /* set default values */ + curproxy->state = defproxy.state; + curproxy->maxconn = defproxy.maxconn; + curproxy->conn_retries = defproxy.conn_retries; + curproxy->options = defproxy.options; + + if (defproxy.check_req) + curproxy->check_req = strdup(defproxy.check_req); + curproxy->check_len = defproxy.check_len; + + if (defproxy.cookie_name) + curproxy->cookie_name = strdup(defproxy.cookie_name); + curproxy->cookie_len = defproxy.cookie_len; + + if (defproxy.capture_name) + curproxy->capture_name = strdup(defproxy.capture_name); + curproxy->capture_namelen = defproxy.capture_namelen; + curproxy->capture_len = defproxy.capture_len; + + if (defproxy.errmsg.msg400) + curproxy->errmsg.msg400 = strdup(defproxy.errmsg.msg400); + curproxy->errmsg.len400 = defproxy.errmsg.len400; + + if (defproxy.errmsg.msg403) + curproxy->errmsg.msg403 = strdup(defproxy.errmsg.msg403); + curproxy->errmsg.len403 = defproxy.errmsg.len403; + + if (defproxy.errmsg.msg408) + curproxy->errmsg.msg408 = strdup(defproxy.errmsg.msg408); + curproxy->errmsg.len408 = defproxy.errmsg.len408; + + if (defproxy.errmsg.msg500) + curproxy->errmsg.msg500 = strdup(defproxy.errmsg.msg500); + curproxy->errmsg.len500 = defproxy.errmsg.len500; + + if (defproxy.errmsg.msg502) + curproxy->errmsg.msg502 = strdup(defproxy.errmsg.msg502); + curproxy->errmsg.len502 = defproxy.errmsg.len502; + + if (defproxy.errmsg.msg503) + curproxy->errmsg.msg503 = strdup(defproxy.errmsg.msg503); + curproxy->errmsg.len503 = defproxy.errmsg.len503; + + if (defproxy.errmsg.msg504) + curproxy->errmsg.msg504 = strdup(defproxy.errmsg.msg504); + curproxy->errmsg.len504 = defproxy.errmsg.len504; + + curproxy->clitimeout = defproxy.clitimeout; + curproxy->contimeout = defproxy.contimeout; + curproxy->srvtimeout = defproxy.srvtimeout; + curproxy->mode = defproxy.mode; + curproxy->logfac1 = defproxy.logfac1; + curproxy->logsrv1 = defproxy.logsrv1; + curproxy->loglev1 = defproxy.loglev1; + curproxy->logfac2 = defproxy.logfac2; + curproxy->logsrv2 = defproxy.logsrv2; + curproxy->loglev2 = defproxy.loglev2; + curproxy->to_log = defproxy.to_log & ~LW_COOKIE & ~LW_REQHDR & ~ LW_RSPHDR; + curproxy->grace = defproxy.grace; + curproxy->uri_auth = defproxy.uri_auth; + curproxy->source_addr = defproxy.source_addr; + curproxy->mon_net = defproxy.mon_net; + curproxy->mon_mask = defproxy.mon_mask; + return 0; + } + else if (!strcmp(args[0], "defaults")) { /* use this one to assign default values */ + /* some variables may have already been initialized earlier */ + if (defproxy.check_req) free(defproxy.check_req); + if (defproxy.cookie_name) free(defproxy.cookie_name); + if (defproxy.capture_name) free(defproxy.capture_name); + if (defproxy.errmsg.msg400) free(defproxy.errmsg.msg400); + if (defproxy.errmsg.msg403) free(defproxy.errmsg.msg403); + if (defproxy.errmsg.msg408) free(defproxy.errmsg.msg408); + if (defproxy.errmsg.msg500) free(defproxy.errmsg.msg500); + if (defproxy.errmsg.msg502) free(defproxy.errmsg.msg502); + if (defproxy.errmsg.msg503) free(defproxy.errmsg.msg503); + if (defproxy.errmsg.msg504) free(defproxy.errmsg.msg504); + /* we cannot free uri_auth because it might already be used */ + init_default_instance(); + curproxy = &defproxy; + return 0; + } + else if (curproxy == NULL) { + Alert("parsing [%s:%d] : 'listen' or 'defaults' expected.\n", file, linenum); + return -1; + } + + if (!strcmp(args[0], "bind")) { /* new listen addresses */ + if (curproxy == &defproxy) { + Alert("parsing [%s:%d] : '%s' not allowed in 'defaults' section.\n", file, linenum, args[0]); + return -1; + } + + if (strchr(args[1], ':') == NULL) { + Alert("parsing [%s:%d] : '%s' expects [addr1]:port1[-end1]{,[addr]:port[-end]}... as arguments.\n", + file, linenum, args[0]); + return -1; + } + curproxy->listen = str2listener(args[1], curproxy->listen); + if (!curproxy->listen) + return -1; + global.maxsock++; + return 0; + } + else if (!strcmp(args[0], "monitor-net")) { /* set the range of IPs to ignore */ + if (!*args[1] || !str2net(args[1], &curproxy->mon_net, &curproxy->mon_mask)) { + Alert("parsing [%s:%d] : '%s' expects address[/mask].\n", + file, linenum, args[0]); + return -1; + } + /* flush useless bits */ + curproxy->mon_net.s_addr &= curproxy->mon_mask.s_addr; + return 0; + } + else if (!strcmp(args[0], "mode")) { /* sets the proxy mode */ + if (!strcmp(args[1], "http")) curproxy->mode = PR_MODE_HTTP; + else if (!strcmp(args[1], "tcp")) curproxy->mode = PR_MODE_TCP; + else if (!strcmp(args[1], "health")) curproxy->mode = PR_MODE_HEALTH; + else { + Alert("parsing [%s:%d] : unknown proxy mode '%s'.\n", file, linenum, args[1]); + return -1; + } + } + else if (!strcmp(args[0], "disabled")) { /* disables this proxy */ + curproxy->state = PR_STSTOPPED; + } + else if (!strcmp(args[0], "enabled")) { /* enables this proxy (used to revert a disabled default) */ + curproxy->state = PR_STNEW; + } + else if (!strcmp(args[0], "cookie")) { /* cookie name */ + int cur_arg; + // if (curproxy == &defproxy) { + // Alert("parsing [%s:%d] : '%s' not allowed in 'defaults' section.\n", file, linenum, args[0]); + // return -1; + // } + + if (curproxy->cookie_name != NULL) { + // Alert("parsing [%s:%d] : cookie name already specified. Continuing.\n", + // file, linenum); + // return 0; + free(curproxy->cookie_name); + } + + if (*(args[1]) == 0) { + Alert("parsing [%s:%d] : '%s' expects as argument.\n", + file, linenum, args[0]); + return -1; + } + curproxy->cookie_name = strdup(args[1]); + curproxy->cookie_len = strlen(curproxy->cookie_name); + + cur_arg = 2; + while (*(args[cur_arg])) { + if (!strcmp(args[cur_arg], "rewrite")) { + curproxy->options |= PR_O_COOK_RW; + } + else if (!strcmp(args[cur_arg], "indirect")) { + curproxy->options |= PR_O_COOK_IND; + } + else if (!strcmp(args[cur_arg], "insert")) { + curproxy->options |= PR_O_COOK_INS; + } + else if (!strcmp(args[cur_arg], "nocache")) { + curproxy->options |= PR_O_COOK_NOC; + } + else if (!strcmp(args[cur_arg], "postonly")) { + curproxy->options |= PR_O_COOK_POST; + } + else if (!strcmp(args[cur_arg], "prefix")) { + curproxy->options |= PR_O_COOK_PFX; + } + else { + Alert("parsing [%s:%d] : '%s' supports 'rewrite', 'insert', 'prefix', 'indirect', 'nocache' and 'postonly' options.\n", + file, linenum, args[0]); + return -1; + } + cur_arg++; + } + if (!POWEROF2(curproxy->options & (PR_O_COOK_RW|PR_O_COOK_IND))) { + Alert("parsing [%s:%d] : cookie 'rewrite' and 'indirect' modes are incompatible.\n", + file, linenum); + return -1; + } + + if (!POWEROF2(curproxy->options & (PR_O_COOK_RW|PR_O_COOK_INS|PR_O_COOK_PFX))) { + Alert("parsing [%s:%d] : cookie 'rewrite', 'insert' and 'prefix' modes are incompatible.\n", + file, linenum); + return -1; + } + }/* end else if (!strcmp(args[0], "cookie")) */ + else if (!strcmp(args[0], "appsession")) { /* cookie name */ + // if (curproxy == &defproxy) { + // Alert("parsing [%s:%d] : '%s' not allowed in 'defaults' section.\n", file, linenum, args[0]); + // return -1; + // } + + if (curproxy->appsession_name != NULL) { + // Alert("parsing [%s:%d] : cookie name already specified. Continuing.\n", + // file, linenum); + // return 0; + free(curproxy->appsession_name); + } + + if (*(args[5]) == 0) { + Alert("parsing [%s:%d] : '%s' expects 'appsession' 'len' 'timeout' .\n", + file, linenum, args[0]); + return -1; + } + have_appsession = 1; + curproxy->appsession_name = strdup(args[1]); + curproxy->appsession_name_len = strlen(curproxy->appsession_name); + curproxy->appsession_len = atoi(args[3]); + curproxy->appsession_timeout = atoi(args[5]); + rc = chtbl_init(&(curproxy->htbl_proxy), TBLSIZ, hashpjw, match_str, destroy); + if (rc) { + Alert("Error Init Appsession Hashtable.\n"); + return -1; + } + } /* Url App Session */ + else if (!strcmp(args[0], "capture")) { + if (!strcmp(args[1], "cookie")) { /* name of a cookie to capture */ + // if (curproxy == &defproxy) { + // Alert("parsing [%s:%d] : '%s' not allowed in 'defaults' section.\n", file, linenum, args[0]); + // return -1; + // } + + if (curproxy->capture_name != NULL) { + // Alert("parsing [%s:%d] : '%s' already specified. Continuing.\n", + // file, linenum, args[0]); + // return 0; + free(curproxy->capture_name); + } + + if (*(args[4]) == 0) { + Alert("parsing [%s:%d] : '%s' expects 'cookie' 'len' .\n", + file, linenum, args[0]); + return -1; + } + curproxy->capture_name = strdup(args[2]); + curproxy->capture_namelen = strlen(curproxy->capture_name); + curproxy->capture_len = atol(args[4]); + if (curproxy->capture_len >= CAPTURE_LEN) { + Warning("parsing [%s:%d] : truncating capture length to %d bytes.\n", + file, linenum, CAPTURE_LEN - 1); + curproxy->capture_len = CAPTURE_LEN - 1; + } + curproxy->to_log |= LW_COOKIE; + } + else if (!strcmp(args[1], "request") && !strcmp(args[2], "header")) { + struct cap_hdr *hdr; + + if (curproxy == &defproxy) { + Alert("parsing [%s:%d] : '%s %s' not allowed in 'defaults' section.\n", file, linenum, args[0], args[1]); + return -1; + } + + if (*(args[3]) == 0 || strcmp(args[4], "len") != 0 || *(args[5]) == 0) { + Alert("parsing [%s:%d] : '%s %s' expects 'header' 'len' .\n", + file, linenum, args[0], args[1]); + return -1; + } + + hdr = calloc(sizeof(struct cap_hdr), 1); + hdr->next = curproxy->req_cap; + hdr->name = strdup(args[3]); + hdr->namelen = strlen(args[3]); + hdr->len = atol(args[5]); + hdr->index = curproxy->nb_req_cap++; + curproxy->req_cap = hdr; + curproxy->to_log |= LW_REQHDR; + } + else if (!strcmp(args[1], "response") && !strcmp(args[2], "header")) { + struct cap_hdr *hdr; + + if (curproxy == &defproxy) { + Alert("parsing [%s:%d] : '%s %s' not allowed in 'defaults' section.\n", file, linenum, args[0], args[1]); + return -1; + } + + if (*(args[3]) == 0 || strcmp(args[4], "len") != 0 || *(args[5]) == 0) { + Alert("parsing [%s:%d] : '%s %s' expects 'header' 'len' .\n", + file, linenum, args[0], args[1]); + return -1; + } + hdr = calloc(sizeof(struct cap_hdr), 1); + hdr->next = curproxy->rsp_cap; + hdr->name = strdup(args[3]); + hdr->namelen = strlen(args[3]); + hdr->len = atol(args[5]); + hdr->index = curproxy->nb_rsp_cap++; + curproxy->rsp_cap = hdr; + curproxy->to_log |= LW_RSPHDR; + } + else { + Alert("parsing [%s:%d] : '%s' expects 'cookie' or 'request header' or 'response header'.\n", + file, linenum, args[0]); + return -1; + } + } + else if (!strcmp(args[0], "contimeout")) { /* connect timeout */ + if (curproxy->contimeout != defproxy.contimeout) { + Alert("parsing [%s:%d] : '%s' already specified. Continuing.\n", file, linenum, args[0]); + return 0; + } + if (*(args[1]) == 0) { + Alert("parsing [%s:%d] : '%s' expects an integer as argument.\n", + file, linenum, args[0]); + return -1; + } + curproxy->contimeout = atol(args[1]); + } + else if (!strcmp(args[0], "clitimeout")) { /* client timeout */ + if (curproxy->clitimeout != defproxy.clitimeout) { + Alert("parsing [%s:%d] : '%s' already specified. Continuing.\n", + file, linenum, args[0]); + return 0; + } + if (*(args[1]) == 0) { + Alert("parsing [%s:%d] : '%s' expects an integer as argument.\n", + file, linenum, args[0]); + return -1; + } + curproxy->clitimeout = atol(args[1]); + } + else if (!strcmp(args[0], "srvtimeout")) { /* server timeout */ + if (curproxy->srvtimeout != defproxy.srvtimeout) { + Alert("parsing [%s:%d] : '%s' already specified. Continuing.\n", file, linenum, args[0]); + return 0; + } + if (*(args[1]) == 0) { + Alert("parsing [%s:%d] : '%s' expects an integer as argument.\n", + file, linenum, args[0]); + return -1; + } + curproxy->srvtimeout = atol(args[1]); + } + else if (!strcmp(args[0], "retries")) { /* connection retries */ + if (*(args[1]) == 0) { + Alert("parsing [%s:%d] : '%s' expects an integer argument (dispatch counts for one).\n", + file, linenum, args[0]); + return -1; + } + curproxy->conn_retries = atol(args[1]); + } + else if (!strcmp(args[0], "stats")) { + if (curproxy != &defproxy && curproxy->uri_auth == defproxy.uri_auth) + curproxy->uri_auth = NULL; /* we must detach from the default config */ + + if (*(args[1]) == 0) { + Alert("parsing [%s:%d] : '%s' expects 'uri', 'realm', 'auth', 'scope' or 'enable'.\n", file, linenum, args[0]); + return -1; + } else if (!strcmp(args[1], "uri")) { + if (*(args[2]) == 0) { + Alert("parsing [%s:%d] : 'uri' needs an URI prefix.\n", file, linenum); + return -1; + } else if (!stats_set_uri(&curproxy->uri_auth, args[2])) { + Alert("parsing [%s:%d] : out of memory.\n", file, linenum); + return -1; + } + } else if (!strcmp(args[1], "realm")) { + if (*(args[2]) == 0) { + Alert("parsing [%s:%d] : 'realm' needs an realm name.\n", file, linenum); + return -1; + } else if (!stats_set_realm(&curproxy->uri_auth, args[2])) { + Alert("parsing [%s:%d] : out of memory.\n", file, linenum); + return -1; + } + } else if (!strcmp(args[1], "auth")) { + if (*(args[2]) == 0) { + Alert("parsing [%s:%d] : 'auth' needs a user:password account.\n", file, linenum); + return -1; + } else if (!stats_add_auth(&curproxy->uri_auth, args[2])) { + Alert("parsing [%s:%d] : out of memory.\n", file, linenum); + return -1; + } + } else if (!strcmp(args[1], "scope")) { + if (*(args[2]) == 0) { + Alert("parsing [%s:%d] : 'scope' needs a proxy name.\n", file, linenum); + return -1; + } else if (!stats_add_scope(&curproxy->uri_auth, args[2])) { + Alert("parsing [%s:%d] : out of memory.\n", file, linenum); + return -1; + } + } else if (!strcmp(args[1], "enable")) { + if (!stats_check_init_uri_auth(&curproxy->uri_auth)) { + Alert("parsing [%s:%d] : out of memory.\n", file, linenum); + return -1; + } + } else { + Alert("parsing [%s:%d] : unknown stats parameter '%s' (expects 'uri', 'realm', 'auth' or 'enable').\n", + file, linenum, args[0]); + return -1; + } + } + else if (!strcmp(args[0], "option")) { + if (*(args[1]) == 0) { + Alert("parsing [%s:%d] : '%s' expects an option name.\n", file, linenum, args[0]); + return -1; + } + if (!strcmp(args[1], "redispatch")) + /* enable reconnections to dispatch */ + curproxy->options |= PR_O_REDISP; +#ifdef TPROXY + else if (!strcmp(args[1], "transparent")) + /* enable transparent proxy connections */ + curproxy->options |= PR_O_TRANSP; +#endif + else if (!strcmp(args[1], "keepalive")) + /* enable keep-alive */ + curproxy->options |= PR_O_KEEPALIVE; + else if (!strcmp(args[1], "forwardfor")) + /* insert x-forwarded-for field */ + curproxy->options |= PR_O_FWDFOR; + else if (!strcmp(args[1], "logasap")) + /* log as soon as possible, without waiting for the session to complete */ + curproxy->options |= PR_O_LOGASAP; + else if (!strcmp(args[1], "abortonclose")) + /* abort connection if client closes during queue or connect() */ + curproxy->options |= PR_O_ABRT_CLOSE; + else if (!strcmp(args[1], "httpclose")) + /* force connection: close in both directions in HTTP mode */ + curproxy->options |= PR_O_HTTP_CLOSE; + else if (!strcmp(args[1], "forceclose")) + /* force connection: close in both directions in HTTP mode and enforce end of session */ + curproxy->options |= PR_O_FORCE_CLO | PR_O_HTTP_CLOSE; + else if (!strcmp(args[1], "checkcache")) + /* require examination of cacheability of the 'set-cookie' field */ + curproxy->options |= PR_O_CHK_CACHE; + else if (!strcmp(args[1], "httplog")) + /* generate a complete HTTP log */ + curproxy->to_log |= LW_DATE | LW_CLIP | LW_SVID | LW_REQ | LW_PXID | LW_RESP | LW_BYTES; + else if (!strcmp(args[1], "tcplog")) + /* generate a detailed TCP log */ + curproxy->to_log |= LW_DATE | LW_CLIP | LW_SVID | LW_PXID | LW_BYTES; + else if (!strcmp(args[1], "dontlognull")) { + /* don't log empty requests */ + curproxy->options |= PR_O_NULLNOLOG; + } + else if (!strcmp(args[1], "tcpka")) { + /* enable TCP keep-alives on client and server sessions */ + curproxy->options |= PR_O_TCP_CLI_KA | PR_O_TCP_SRV_KA; + } + else if (!strcmp(args[1], "clitcpka")) { + /* enable TCP keep-alives on client sessions */ + curproxy->options |= PR_O_TCP_CLI_KA; + } + else if (!strcmp(args[1], "srvtcpka")) { + /* enable TCP keep-alives on server sessions */ + curproxy->options |= PR_O_TCP_SRV_KA; + } + else if (!strcmp(args[1], "allbackups")) { + /* Use all backup servers simultaneously */ + curproxy->options |= PR_O_USE_ALL_BK; + } + else if (!strcmp(args[1], "httpchk")) { + /* use HTTP request to check servers' health */ + if (curproxy->check_req != NULL) { + free(curproxy->check_req); + } + curproxy->options |= PR_O_HTTP_CHK; + if (!*args[2]) { /* no argument */ + curproxy->check_req = strdup(DEF_CHECK_REQ); /* default request */ + curproxy->check_len = strlen(DEF_CHECK_REQ); + } else if (!*args[3]) { /* one argument : URI */ + int reqlen = strlen(args[2]) + strlen("OPTIONS / HTTP/1.0\r\n\r\n"); + curproxy->check_req = (char *)malloc(reqlen); + curproxy->check_len = snprintf(curproxy->check_req, reqlen, + "OPTIONS %s HTTP/1.0\r\n\r\n", args[2]); /* URI to use */ + } else { /* more arguments : METHOD URI [HTTP_VER] */ + int reqlen = strlen(args[2]) + strlen(args[3]) + 3 + strlen("\r\n\r\n"); + if (*args[4]) + reqlen += strlen(args[4]); + else + reqlen += strlen("HTTP/1.0"); + + curproxy->check_req = (char *)malloc(reqlen); + curproxy->check_len = snprintf(curproxy->check_req, reqlen, + "%s %s %s\r\n\r\n", args[2], args[3], *args[4]?args[4]:"HTTP/1.0"); + } + } + else if (!strcmp(args[1], "persist")) { + /* persist on using the server specified by the cookie, even when it's down */ + curproxy->options |= PR_O_PERSIST; + } + else { + Alert("parsing [%s:%d] : unknown option '%s'.\n", file, linenum, args[1]); + return -1; + } + return 0; + } + else if (!strcmp(args[0], "redispatch") || !strcmp(args[0], "redisp")) { + /* enable reconnections to dispatch */ + curproxy->options |= PR_O_REDISP; + } +#ifdef TPROXY + else if (!strcmp(args[0], "transparent")) { + /* enable transparent proxy connections */ + curproxy->options |= PR_O_TRANSP; + } +#endif + else if (!strcmp(args[0], "maxconn")) { /* maxconn */ + if (*(args[1]) == 0) { + Alert("parsing [%s:%d] : '%s' expects an integer argument.\n", file, linenum, args[0]); + return -1; + } + curproxy->maxconn = atol(args[1]); + } + else if (!strcmp(args[0], "grace")) { /* grace time (ms) */ + if (*(args[1]) == 0) { + Alert("parsing [%s:%d] : '%s' expects a time in milliseconds.\n", file, linenum, args[0]); + return -1; + } + curproxy->grace = atol(args[1]); + } + else if (!strcmp(args[0], "dispatch")) { /* dispatch address */ + if (curproxy == &defproxy) { + Alert("parsing [%s:%d] : '%s' not allowed in 'defaults' section.\n", file, linenum, args[0]); + return -1; + } + if (strchr(args[1], ':') == NULL) { + Alert("parsing [%s:%d] : '%s' expects as argument.\n", file, linenum, args[0]); + return -1; + } + curproxy->dispatch_addr = *str2sa(args[1]); + } + else if (!strcmp(args[0], "balance")) { /* set balancing with optional algorithm */ + if (*(args[1])) { + if (!strcmp(args[1], "roundrobin")) { + curproxy->options |= PR_O_BALANCE_RR; + } + else if (!strcmp(args[1], "source")) { + curproxy->options |= PR_O_BALANCE_SH; + } + else { + Alert("parsing [%s:%d] : '%s' only supports 'roundrobin' and 'source' options.\n", file, linenum, args[0]); + return -1; + } + } + else /* if no option is set, use round-robin by default */ + curproxy->options |= PR_O_BALANCE_RR; + } + else if (!strcmp(args[0], "server")) { /* server address */ + int cur_arg; + char *rport; + char *raddr; + short realport; + int do_check; + + if (curproxy == &defproxy) { + Alert("parsing [%s:%d] : '%s' not allowed in 'defaults' section.\n", file, linenum, args[0]); + return -1; + } + + if (!*args[2]) { + Alert("parsing [%s:%d] : '%s' expects and [:] as arguments.\n", + file, linenum, args[0]); + return -1; + } + if ((newsrv = (struct server *)calloc(1, sizeof(struct server))) == NULL) { + Alert("parsing [%s:%d] : out of memory.\n", file, linenum); + return -1; + } + + /* the servers are linked backwards first */ + newsrv->next = curproxy->srv; + curproxy->srv = newsrv; + newsrv->proxy = curproxy; + + LIST_INIT(&newsrv->pendconns); + do_check = 0; + newsrv->state = SRV_RUNNING; /* early server setup */ + newsrv->id = strdup(args[1]); + + /* several ways to check the port component : + * - IP => port=+0, relative + * - IP: => port=+0, relative + * - IP:N => port=N, absolute + * - IP:+N => port=+N, relative + * - IP:-N => port=-N, relative + */ + raddr = strdup(args[2]); + rport = strchr(raddr, ':'); + if (rport) { + *rport++ = 0; + realport = atol(rport); + if (!isdigit((int)*rport)) + newsrv->state |= SRV_MAPPORTS; + } else { + realport = 0; + newsrv->state |= SRV_MAPPORTS; + } + + newsrv->addr = *str2sa(raddr); + newsrv->addr.sin_port = htons(realport); + free(raddr); + + newsrv->curfd = -1; /* no health-check in progress */ + newsrv->inter = DEF_CHKINTR; + newsrv->rise = DEF_RISETIME; + newsrv->fall = DEF_FALLTIME; + newsrv->health = newsrv->rise; /* up, but will fall down at first failure */ + cur_arg = 3; + while (*args[cur_arg]) { + if (!strcmp(args[cur_arg], "cookie")) { + newsrv->cookie = strdup(args[cur_arg + 1]); + newsrv->cklen = strlen(args[cur_arg + 1]); + cur_arg += 2; + } + else if (!strcmp(args[cur_arg], "rise")) { + newsrv->rise = atol(args[cur_arg + 1]); + newsrv->health = newsrv->rise; + cur_arg += 2; + } + else if (!strcmp(args[cur_arg], "fall")) { + newsrv->fall = atol(args[cur_arg + 1]); + cur_arg += 2; + } + else if (!strcmp(args[cur_arg], "inter")) { + newsrv->inter = atol(args[cur_arg + 1]); + cur_arg += 2; + } + else if (!strcmp(args[cur_arg], "port")) { + newsrv->check_port = atol(args[cur_arg + 1]); + cur_arg += 2; + } + else if (!strcmp(args[cur_arg], "backup")) { + newsrv->state |= SRV_BACKUP; + cur_arg ++; + } + else if (!strcmp(args[cur_arg], "weight")) { + int w; + w = atol(args[cur_arg + 1]); + if (w < 1 || w > 256) { + Alert("parsing [%s:%d] : weight of server %s is not within 1 and 256 (%d).\n", + file, linenum, newsrv->id, w); + return -1; + } + newsrv->uweight = w - 1; + cur_arg += 2; + } + else if (!strcmp(args[cur_arg], "minconn")) { + newsrv->minconn = atol(args[cur_arg + 1]); + cur_arg += 2; + } + else if (!strcmp(args[cur_arg], "maxconn")) { + newsrv->maxconn = atol(args[cur_arg + 1]); + cur_arg += 2; + } + else if (!strcmp(args[cur_arg], "check")) { + global.maxsock++; + do_check = 1; + cur_arg += 1; + } + else if (!strcmp(args[cur_arg], "source")) { /* address to which we bind when connecting */ + if (!*args[cur_arg + 1]) { + Alert("parsing [%s:%d] : '%s' expects [:] as argument.\n", + file, linenum, "source"); + return -1; + } + newsrv->state |= SRV_BIND_SRC; + newsrv->source_addr = *str2sa(args[cur_arg + 1]); + cur_arg += 2; + } + else { + Alert("parsing [%s:%d] : server %s only supports options 'backup', 'cookie', 'check', 'inter', 'rise', 'fall', 'port', 'source', 'minconn', 'maxconn' and 'weight'.\n", + file, linenum, newsrv->id); + return -1; + } + } + + if (do_check) { + if (!newsrv->check_port && !(newsrv->state & SRV_MAPPORTS)) + newsrv->check_port = realport; /* by default */ + if (!newsrv->check_port) { + Alert("parsing [%s:%d] : server %s has neither service port nor check port. Check has been disabled.\n", + file, linenum, newsrv->id); + return -1; + } + newsrv->state |= SRV_CHECKED; + } + + if (newsrv->state & SRV_BACKUP) + curproxy->srv_bck++; + else + curproxy->srv_act++; + } + else if (!strcmp(args[0], "log")) { /* syslog server address */ + struct sockaddr_in *sa; + int facility; + + if (*(args[1]) && *(args[2]) == 0 && !strcmp(args[1], "global")) { + curproxy->logfac1 = global.logfac1; + curproxy->logsrv1 = global.logsrv1; + curproxy->loglev1 = global.loglev1; + curproxy->logfac2 = global.logfac2; + curproxy->logsrv2 = global.logsrv2; + curproxy->loglev2 = global.loglev2; + } + else if (*(args[1]) && *(args[2])) { + int level; + + facility = get_log_facility(args[2]); + if (facility < 0) { + Alert("parsing [%s:%d] : unknown log facility '%s'\n", file, linenum, args[2]); + exit(1); + } + + level = 7; /* max syslog level = debug */ + if (*(args[3])) { + level = get_log_level(args[3]); + if (level < 0) { + Alert("parsing [%s:%d] : unknown optional log level '%s'\n", file, linenum, args[3]); + exit(1); + } + } + + sa = str2sa(args[1]); + if (!sa->sin_port) + sa->sin_port = htons(SYSLOG_PORT); + + if (curproxy->logfac1 == -1) { + curproxy->logsrv1 = *sa; + curproxy->logfac1 = facility; + curproxy->loglev1 = level; + } + else if (curproxy->logfac2 == -1) { + curproxy->logsrv2 = *sa; + curproxy->logfac2 = facility; + curproxy->loglev2 = level; + } + else { + Alert("parsing [%s:%d] : too many syslog servers\n", file, linenum); + return -1; + } + } + else { + Alert("parsing [%s:%d] : 'log' expects either and or 'global' as arguments.\n", + file, linenum); + return -1; + } + } + else if (!strcmp(args[0], "source")) { /* address to which we bind when connecting */ + if (!*args[1]) { + Alert("parsing [%s:%d] : '%s' expects [:] as argument.\n", + file, linenum, "source"); + return -1; + } + + curproxy->source_addr = *str2sa(args[1]); + curproxy->options |= PR_O_BIND_SRC; + } + else if (!strcmp(args[0], "cliexp") || !strcmp(args[0], "reqrep")) { /* replace request header from a regex */ + regex_t *preg; + if (curproxy == &defproxy) { + Alert("parsing [%s:%d] : '%s' not allowed in 'defaults' section.\n", file, linenum, args[0]); + return -1; + } + + if (*(args[1]) == 0 || *(args[2]) == 0) { + Alert("parsing [%s:%d] : '%s' expects and as arguments.\n", + file, linenum, args[0]); + return -1; + } + + preg = calloc(1, sizeof(regex_t)); + if (regcomp(preg, args[1], REG_EXTENDED) != 0) { + Alert("parsing [%s:%d] : bad regular expression '%s'.\n", file, linenum, args[1]); + return -1; + } + + err = chain_regex(&curproxy->req_exp, preg, ACT_REPLACE, strdup(args[2])); + if (err) { + Alert("parsing [%s:%d] : invalid character or unterminated sequence in replacement string near '%c'.\n", + file, linenum, *err); + return -1; + } + } + else if (!strcmp(args[0], "reqdel")) { /* delete request header from a regex */ + regex_t *preg; + if (curproxy == &defproxy) { + Alert("parsing [%s:%d] : '%s' not allowed in 'defaults' section.\n", file, linenum, args[0]); + return -1; + } + + if (*(args[1]) == 0) { + Alert("parsing [%s:%d] : '%s' expects as an argument.\n", file, linenum, args[0]); + return -1; + } + + preg = calloc(1, sizeof(regex_t)); + if (regcomp(preg, args[1], REG_EXTENDED) != 0) { + Alert("parsing [%s:%d] : bad regular expression '%s'.\n", file, linenum, args[1]); + return -1; + } + + chain_regex(&curproxy->req_exp, preg, ACT_REMOVE, NULL); + } + else if (!strcmp(args[0], "reqdeny")) { /* deny a request if a header matches this regex */ + regex_t *preg; + if (curproxy == &defproxy) { + Alert("parsing [%s:%d] : '%s' not allowed in 'defaults' section.\n", file, linenum, args[0]); + return -1; + } + + if (*(args[1]) == 0) { + Alert("parsing [%s:%d] : '%s' expects as an argument.\n", file, linenum, args[0]); + return -1; + } + + preg = calloc(1, sizeof(regex_t)); + if (regcomp(preg, args[1], REG_EXTENDED) != 0) { + Alert("parsing [%s:%d] : bad regular expression '%s'.\n", file, linenum, args[1]); + return -1; + } + + chain_regex(&curproxy->req_exp, preg, ACT_DENY, NULL); + } + else if (!strcmp(args[0], "reqpass")) { /* pass this header without allowing or denying the request */ + regex_t *preg; + if (curproxy == &defproxy) { + Alert("parsing [%s:%d] : '%s' not allowed in 'defaults' section.\n", file, linenum, args[0]); + return -1; + } + + if (*(args[1]) == 0) { + Alert("parsing [%s:%d] : '%s' expects as an argument.\n", file, linenum, args[0]); + return -1; + } + + preg = calloc(1, sizeof(regex_t)); + if (regcomp(preg, args[1], REG_EXTENDED) != 0) { + Alert("parsing [%s:%d] : bad regular expression '%s'.\n", file, linenum, args[1]); + return -1; + } + + chain_regex(&curproxy->req_exp, preg, ACT_PASS, NULL); + } + else if (!strcmp(args[0], "reqallow")) { /* allow a request if a header matches this regex */ + regex_t *preg; + if (curproxy == &defproxy) { + Alert("parsing [%s:%d] : '%s' not allowed in 'defaults' section.\n", file, linenum, args[0]); + return -1; + } + + if (*(args[1]) == 0) { + Alert("parsing [%s:%d] : '%s' expects as an argument.\n", file, linenum, args[0]); + return -1; + } + + preg = calloc(1, sizeof(regex_t)); + if (regcomp(preg, args[1], REG_EXTENDED) != 0) { + Alert("parsing [%s:%d] : bad regular expression '%s'.\n", file, linenum, args[1]); + return -1; + } + + chain_regex(&curproxy->req_exp, preg, ACT_ALLOW, NULL); + } + else if (!strcmp(args[0], "reqirep")) { /* replace request header from a regex, ignoring case */ + regex_t *preg; + if (curproxy == &defproxy) { + Alert("parsing [%s:%d] : '%s' not allowed in 'defaults' section.\n", file, linenum, args[0]); + return -1; + } + + if (*(args[1]) == 0 || *(args[2]) == 0) { + Alert("parsing [%s:%d] : '%s' expects and as arguments.\n", + file, linenum, args[0]); + return -1; + } + + preg = calloc(1, sizeof(regex_t)); + if (regcomp(preg, args[1], REG_EXTENDED | REG_ICASE) != 0) { + Alert("parsing [%s:%d] : bad regular expression '%s'.\n", file, linenum, args[1]); + return -1; + } + + err = chain_regex(&curproxy->req_exp, preg, ACT_REPLACE, strdup(args[2])); + if (err) { + Alert("parsing [%s:%d] : invalid character or unterminated sequence in replacement string near '%c'.\n", + file, linenum, *err); + return -1; + } + } + else if (!strcmp(args[0], "reqidel")) { /* delete request header from a regex ignoring case */ + regex_t *preg; + if (curproxy == &defproxy) { + Alert("parsing [%s:%d] : '%s' not allowed in 'defaults' section.\n", file, linenum, args[0]); + return -1; + } + + if (*(args[1]) == 0) { + Alert("parsing [%s:%d] : '%s' expects as an argument.\n", file, linenum, args[0]); + return -1; + } + + preg = calloc(1, sizeof(regex_t)); + if (regcomp(preg, args[1], REG_EXTENDED | REG_ICASE) != 0) { + Alert("parsing [%s:%d] : bad regular expression '%s'.\n", file, linenum, args[1]); + return -1; + } + + chain_regex(&curproxy->req_exp, preg, ACT_REMOVE, NULL); + } + else if (!strcmp(args[0], "reqideny")) { /* deny a request if a header matches this regex ignoring case */ + regex_t *preg; + if (curproxy == &defproxy) { + Alert("parsing [%s:%d] : '%s' not allowed in 'defaults' section.\n", file, linenum, args[0]); + return -1; + } + + if (*(args[1]) == 0) { + Alert("parsing [%s:%d] : '%s' expects as an argument.\n", file, linenum, args[0]); + return -1; + } + + preg = calloc(1, sizeof(regex_t)); + if (regcomp(preg, args[1], REG_EXTENDED | REG_ICASE) != 0) { + Alert("parsing [%s:%d] : bad regular expression '%s'.\n", file, linenum, args[1]); + return -1; + } + + chain_regex(&curproxy->req_exp, preg, ACT_DENY, NULL); + } + else if (!strcmp(args[0], "reqipass")) { /* pass this header without allowing or denying the request */ + regex_t *preg; + if (curproxy == &defproxy) { + Alert("parsing [%s:%d] : '%s' not allowed in 'defaults' section.\n", file, linenum, args[0]); + return -1; + } + + if (*(args[1]) == 0) { + Alert("parsing [%s:%d] : '%s' expects as an argument.\n", file, linenum, args[0]); + return -1; + } + + preg = calloc(1, sizeof(regex_t)); + if (regcomp(preg, args[1], REG_EXTENDED | REG_ICASE) != 0) { + Alert("parsing [%s:%d] : bad regular expression '%s'.\n", file, linenum, args[1]); + return -1; + } + + chain_regex(&curproxy->req_exp, preg, ACT_PASS, NULL); + } + else if (!strcmp(args[0], "reqiallow")) { /* allow a request if a header matches this regex ignoring case */ + regex_t *preg; + if (curproxy == &defproxy) { + Alert("parsing [%s:%d] : '%s' not allowed in 'defaults' section.\n", file, linenum, args[0]); + return -1; + } + + if (*(args[1]) == 0) { + Alert("parsing [%s:%d] : '%s' expects as an argument.\n", file, linenum, args[0]); + return -1; + } + + preg = calloc(1, sizeof(regex_t)); + if (regcomp(preg, args[1], REG_EXTENDED | REG_ICASE) != 0) { + Alert("parsing [%s:%d] : bad regular expression '%s'.\n", file, linenum, args[1]); + return -1; + } + + chain_regex(&curproxy->req_exp, preg, ACT_ALLOW, NULL); + } + else if (!strcmp(args[0], "reqadd")) { /* add request header */ + if (curproxy == &defproxy) { + Alert("parsing [%s:%d] : '%s' not allowed in 'defaults' section.\n", file, linenum, args[0]); + return -1; + } + + if (curproxy->nb_reqadd >= MAX_NEWHDR) { + Alert("parsing [%s:%d] : too many '%s'. Continuing.\n", file, linenum, args[0]); + return 0; + } + + if (*(args[1]) == 0) { + Alert("parsing [%s:%d] : '%s' expects
as an argument.\n", file, linenum, args[0]); + return -1; + } + + curproxy->req_add[curproxy->nb_reqadd++] = strdup(args[1]); + } + else if (!strcmp(args[0], "srvexp") || !strcmp(args[0], "rsprep")) { /* replace response header from a regex */ + regex_t *preg; + + if (*(args[1]) == 0 || *(args[2]) == 0) { + Alert("parsing [%s:%d] : '%s' expects and as arguments.\n", + file, linenum, args[0]); + return -1; + } + + preg = calloc(1, sizeof(regex_t)); + if (regcomp(preg, args[1], REG_EXTENDED) != 0) { + Alert("parsing [%s:%d] : bad regular expression '%s'.\n", file, linenum, args[1]); + return -1; + } + + err = chain_regex(&curproxy->rsp_exp, preg, ACT_REPLACE, strdup(args[2])); + if (err) { + Alert("parsing [%s:%d] : invalid character or unterminated sequence in replacement string near '%c'.\n", + file, linenum, *err); + return -1; + } + } + else if (!strcmp(args[0], "rspdel")) { /* delete response header from a regex */ + regex_t *preg; + if (curproxy == &defproxy) { + Alert("parsing [%s:%d] : '%s' not allowed in 'defaults' section.\n", file, linenum, args[0]); + return -1; + } + + if (*(args[1]) == 0) { + Alert("parsing [%s:%d] : '%s' expects as an argument.\n", file, linenum, args[0]); + return -1; + } + + preg = calloc(1, sizeof(regex_t)); + if (regcomp(preg, args[1], REG_EXTENDED) != 0) { + Alert("parsing [%s:%d] : bad regular expression '%s'.\n", file, linenum, args[1]); + return -1; + } + + err = chain_regex(&curproxy->rsp_exp, preg, ACT_REMOVE, strdup(args[2])); + if (err) { + Alert("parsing [%s:%d] : invalid character or unterminated sequence in replacement string near '%c'.\n", + file, linenum, *err); + return -1; + } + } + else if (!strcmp(args[0], "rspdeny")) { /* block response header from a regex */ + regex_t *preg; + if (curproxy == &defproxy) { + Alert("parsing [%s:%d] : '%s' not allowed in 'defaults' section.\n", file, linenum, args[0]); + return -1; + } + + if (*(args[1]) == 0) { + Alert("parsing [%s:%d] : '%s' expects as an argument.\n", file, linenum, args[0]); + return -1; + } + + preg = calloc(1, sizeof(regex_t)); + if (regcomp(preg, args[1], REG_EXTENDED) != 0) { + Alert("parsing [%s:%d] : bad regular expression '%s'.\n", file, linenum, args[1]); + return -1; + } + + err = chain_regex(&curproxy->rsp_exp, preg, ACT_DENY, strdup(args[2])); + if (err) { + Alert("parsing [%s:%d] : invalid character or unterminated sequence in replacement string near '%c'.\n", + file, linenum, *err); + return -1; + } + } + else if (!strcmp(args[0], "rspirep")) { /* replace response header from a regex ignoring case */ + regex_t *preg; + if (curproxy == &defproxy) { + Alert("parsing [%s:%d] : '%s' not allowed in 'defaults' section.\n", file, linenum, args[0]); + return -1; + } + + if (*(args[1]) == 0 || *(args[2]) == 0) { + Alert("parsing [%s:%d] : '%s' expects and as arguments.\n", + file, linenum, args[0]); + return -1; + } + + preg = calloc(1, sizeof(regex_t)); + if (regcomp(preg, args[1], REG_EXTENDED | REG_ICASE) != 0) { + Alert("parsing [%s:%d] : bad regular expression '%s'.\n", file, linenum, args[1]); + return -1; + } + + err = chain_regex(&curproxy->rsp_exp, preg, ACT_REPLACE, strdup(args[2])); + if (err) { + Alert("parsing [%s:%d] : invalid character or unterminated sequence in replacement string near '%c'.\n", + file, linenum, *err); + return -1; + } + } + else if (!strcmp(args[0], "rspidel")) { /* delete response header from a regex ignoring case */ + regex_t *preg; + if (curproxy == &defproxy) { + Alert("parsing [%s:%d] : '%s' not allowed in 'defaults' section.\n", file, linenum, args[0]); + return -1; + } + + if (*(args[1]) == 0) { + Alert("parsing [%s:%d] : '%s' expects as an argument.\n", file, linenum, args[0]); + return -1; + } + + preg = calloc(1, sizeof(regex_t)); + if (regcomp(preg, args[1], REG_EXTENDED | REG_ICASE) != 0) { + Alert("parsing [%s:%d] : bad regular expression '%s'.\n", file, linenum, args[1]); + return -1; + } + + err = chain_regex(&curproxy->rsp_exp, preg, ACT_REMOVE, strdup(args[2])); + if (err) { + Alert("parsing [%s:%d] : invalid character or unterminated sequence in replacement string near '%c'.\n", + file, linenum, *err); + return -1; + } + } + else if (!strcmp(args[0], "rspideny")) { /* block response header from a regex ignoring case */ + regex_t *preg; + if (curproxy == &defproxy) { + Alert("parsing [%s:%d] : '%s' not allowed in 'defaults' section.\n", file, linenum, args[0]); + return -1; + } + + if (*(args[1]) == 0) { + Alert("parsing [%s:%d] : '%s' expects as an argument.\n", file, linenum, args[0]); + return -1; + } + + preg = calloc(1, sizeof(regex_t)); + if (regcomp(preg, args[1], REG_EXTENDED | REG_ICASE) != 0) { + Alert("parsing [%s:%d] : bad regular expression '%s'.\n", file, linenum, args[1]); + return -1; + } + + err = chain_regex(&curproxy->rsp_exp, preg, ACT_DENY, strdup(args[2])); + if (err) { + Alert("parsing [%s:%d] : invalid character or unterminated sequence in replacement string near '%c'.\n", + file, linenum, *err); + return -1; + } + } + else if (!strcmp(args[0], "rspadd")) { /* add response header */ + if (curproxy == &defproxy) { + Alert("parsing [%s:%d] : '%s' not allowed in 'defaults' section.\n", file, linenum, args[0]); + return -1; + } + + if (curproxy->nb_rspadd >= MAX_NEWHDR) { + Alert("parsing [%s:%d] : too many '%s'. Continuing.\n", file, linenum, args[0]); + return 0; + } + + if (*(args[1]) == 0) { + Alert("parsing [%s:%d] : '%s' expects
as an argument.\n", file, linenum, args[0]); + return -1; + } + + curproxy->rsp_add[curproxy->nb_rspadd++] = strdup(args[1]); + } + else if (!strcmp(args[0], "errorloc") || + !strcmp(args[0], "errorloc302") || + !strcmp(args[0], "errorloc303")) { /* error location */ + int errnum, errlen; + char *err; + + // if (curproxy == &defproxy) { + // Alert("parsing [%s:%d] : '%s' not allowed in 'defaults' section.\n", file, linenum, args[0]); + // return -1; + // } + + if (*(args[2]) == 0) { + Alert("parsing [%s:%d] : expects and as arguments.\n", file, linenum); + return -1; + } + + errnum = atol(args[1]); + if (!strcmp(args[0], "errorloc303")) { + err = malloc(strlen(HTTP_303) + strlen(args[2]) + 5); + errlen = sprintf(err, "%s%s\r\n\r\n", HTTP_303, args[2]); + } else { + err = malloc(strlen(HTTP_302) + strlen(args[2]) + 5); + errlen = sprintf(err, "%s%s\r\n\r\n", HTTP_302, args[2]); + } + + if (errnum == 400) { + if (curproxy->errmsg.msg400) { + //Warning("parsing [%s:%d] : error %d already defined.\n", file, linenum, errnum); + free(curproxy->errmsg.msg400); + } + curproxy->errmsg.msg400 = err; + curproxy->errmsg.len400 = errlen; + } + else if (errnum == 403) { + if (curproxy->errmsg.msg403) { + //Warning("parsing [%s:%d] : error %d already defined.\n", file, linenum, errnum); + free(curproxy->errmsg.msg403); + } + curproxy->errmsg.msg403 = err; + curproxy->errmsg.len403 = errlen; + } + else if (errnum == 408) { + if (curproxy->errmsg.msg408) { + //Warning("parsing [%s:%d] : error %d already defined.\n", file, linenum, errnum); + free(curproxy->errmsg.msg408); + } + curproxy->errmsg.msg408 = err; + curproxy->errmsg.len408 = errlen; + } + else if (errnum == 500) { + if (curproxy->errmsg.msg500) { + //Warning("parsing [%s:%d] : error %d already defined.\n", file, linenum, errnum); + free(curproxy->errmsg.msg500); + } + curproxy->errmsg.msg500 = err; + curproxy->errmsg.len500 = errlen; + } + else if (errnum == 502) { + if (curproxy->errmsg.msg502) { + //Warning("parsing [%s:%d] : error %d already defined.\n", file, linenum, errnum); + free(curproxy->errmsg.msg502); + } + curproxy->errmsg.msg502 = err; + curproxy->errmsg.len502 = errlen; + } + else if (errnum == 503) { + if (curproxy->errmsg.msg503) { + //Warning("parsing [%s:%d] : error %d already defined.\n", file, linenum, errnum); + free(curproxy->errmsg.msg503); + } + curproxy->errmsg.msg503 = err; + curproxy->errmsg.len503 = errlen; + } + else if (errnum == 504) { + if (curproxy->errmsg.msg504) { + //Warning("parsing [%s:%d] : error %d already defined.\n", file, linenum, errnum); + free(curproxy->errmsg.msg504); + } + curproxy->errmsg.msg504 = err; + curproxy->errmsg.len504 = errlen; + } + else { + Warning("parsing [%s:%d] : error %d relocation will be ignored.\n", file, linenum, errnum); + free(err); + } + } + else { + Alert("parsing [%s:%d] : unknown keyword '%s' in '%s' section\n", file, linenum, args[0], "listen"); + return -1; + } + return 0; +} + + +/* + * This function reads and parses the configuration file given in the argument. + * returns 0 if OK, -1 if error. + */ +int readcfgfile(char *file) +{ + char thisline[256]; + char *line; + FILE *f; + int linenum = 0; + char *end; + char *args[MAX_LINE_ARGS]; + int arg; + int cfgerr = 0; + int nbchk, mininter; + int confsect = CFG_NONE; + + struct proxy *curproxy = NULL; + struct server *newsrv = NULL; + + if ((f=fopen(file,"r")) == NULL) + return -1; + + init_default_instance(); + + while (fgets(line = thisline, sizeof(thisline), f) != NULL) { + linenum++; + + end = line + strlen(line); + + /* skip leading spaces */ + while (isspace((int)*line)) + line++; + + arg = 0; + args[arg] = line; + + while (*line && arg < MAX_LINE_ARGS) { + /* first, we'll replace \\, \, \#, \r, \n, \t, \xXX with their + * C equivalent value. Other combinations left unchanged (eg: \1). + */ + if (*line == '\\') { + int skip = 0; + if (line[1] == ' ' || line[1] == '\\' || line[1] == '#') { + *line = line[1]; + skip = 1; + } + else if (line[1] == 'r') { + *line = '\r'; + skip = 1; + } + else if (line[1] == 'n') { + *line = '\n'; + skip = 1; + } + else if (line[1] == 't') { + *line = '\t'; + skip = 1; + } + else if (line[1] == 'x') { + if ((line + 3 < end ) && ishex(line[2]) && ishex(line[3])) { + unsigned char hex1, hex2; + hex1 = toupper(line[2]) - '0'; + hex2 = toupper(line[3]) - '0'; + if (hex1 > 9) hex1 -= 'A' - '9' - 1; + if (hex2 > 9) hex2 -= 'A' - '9' - 1; + *line = (hex1<<4) + hex2; + skip = 3; + } + else { + Alert("parsing [%s:%d] : invalid or incomplete '\\x' sequence in '%s'.\n", file, linenum, args[0]); + return -1; + } + } + if (skip) { + memmove(line + 1, line + 1 + skip, end - (line + skip + 1)); + end -= skip; + } + line++; + } + else if (*line == '#' || *line == '\n' || *line == '\r') { + /* end of string, end of loop */ + *line = 0; + break; + } + else if (isspace((int)*line)) { + /* a non-escaped space is an argument separator */ + *line++ = 0; + while (isspace((int)*line)) + line++; + args[++arg] = line; + } + else { + line++; + } + } + + /* empty line */ + if (!**args) + continue; + + /* zero out remaining args */ + while (++arg < MAX_LINE_ARGS) { + args[arg] = line; + } + + if (!strcmp(args[0], "listen") || !strcmp(args[0], "defaults")) /* new proxy */ + confsect = CFG_LISTEN; + else if (!strcmp(args[0], "global")) /* global config */ + confsect = CFG_GLOBAL; + /* else it's a section keyword */ + + switch (confsect) { + case CFG_LISTEN: + if (cfg_parse_listen(file, linenum, args) < 0) + return -1; + break; + case CFG_GLOBAL: + if (cfg_parse_global(file, linenum, args) < 0) + return -1; + break; + default: + Alert("parsing [%s:%d] : unknown keyword '%s' out of section.\n", file, linenum, args[0]); + return -1; + } + + + } + fclose(f); + + /* + * Now, check for the integrity of all that we have collected. + */ + + /* will be needed further to delay some tasks */ + tv_now(&now); + + if ((curproxy = proxy) == NULL) { + Alert("parsing %s : no line. Nothing to do !\n", + file); + return -1; + } + + while (curproxy != NULL) { + if (curproxy->state == PR_STSTOPPED) { + curproxy = curproxy->next; + continue; + } + + if (curproxy->listen == NULL) { + Alert("parsing %s : listener %s has no listen address. Please either specify a valid address on the line, or use the keyword.\n", file, curproxy->id); + cfgerr++; + } + else if ((curproxy->mode != PR_MODE_HEALTH) && + !(curproxy->options & (PR_O_TRANSP | PR_O_BALANCE)) && + (*(int *)&curproxy->dispatch_addr.sin_addr == 0)) { + Alert("parsing %s : listener %s has no dispatch address and is not in transparent or balance mode.\n", + file, curproxy->id); + cfgerr++; + } + else if ((curproxy->mode != PR_MODE_HEALTH) && (curproxy->options & PR_O_BALANCE)) { + if (curproxy->options & PR_O_TRANSP) { + Alert("parsing %s : listener %s cannot use both transparent and balance mode.\n", + file, curproxy->id); + cfgerr++; + } +#ifdef WE_DONT_SUPPORT_SERVERLESS_LISTENERS + else if (curproxy->srv == NULL) { + Alert("parsing %s : listener %s needs at least 1 server in balance mode.\n", + file, curproxy->id); + cfgerr++; + } +#endif + else if (*(int *)&curproxy->dispatch_addr.sin_addr != 0) { + Warning("parsing %s : dispatch address of listener %s will be ignored in balance mode.\n", + file, curproxy->id); + } + } + else if (curproxy->mode == PR_MODE_TCP || curproxy->mode == PR_MODE_HEALTH) { /* TCP PROXY or HEALTH CHECK */ + if (curproxy->cookie_name != NULL) { + Warning("parsing %s : cookie will be ignored for listener %s.\n", + file, curproxy->id); + } + if ((newsrv = curproxy->srv) != NULL) { + Warning("parsing %s : servers will be ignored for listener %s.\n", + file, curproxy->id); + } + if (curproxy->rsp_exp != NULL) { + Warning("parsing %s : server regular expressions will be ignored for listener %s.\n", + file, curproxy->id); + } + if (curproxy->req_exp != NULL) { + Warning("parsing %s : client regular expressions will be ignored for listener %s.\n", + file, curproxy->id); + } + } + else if (curproxy->mode == PR_MODE_HTTP) { /* HTTP PROXY */ + if ((curproxy->cookie_name != NULL) && ((newsrv = curproxy->srv) == NULL)) { + Alert("parsing %s : HTTP proxy %s has a cookie but no server list !\n", + file, curproxy->id); + cfgerr++; + } + } + + /* first, we will invert the servers list order */ + newsrv = NULL; + while (curproxy->srv) { + struct server *next; + + next = curproxy->srv->next; + curproxy->srv->next = newsrv; + newsrv = curproxy->srv; + if (!next) + break; + curproxy->srv = next; + } + + /* now, newsrv == curproxy->srv */ + if (newsrv) { + struct server *srv; + int pgcd; + int act, bck; + + /* We will factor the weights to reduce the table, + * using Euclide's largest common divisor algorithm + */ + pgcd = newsrv->uweight + 1; + for (srv = newsrv->next; srv && pgcd > 1; srv = srv->next) { + int t, w; + + w = srv->uweight + 1; + while (w) { + t = pgcd % w; + pgcd = w; + w = t; + } + } + + act = bck = 0; + for (srv = newsrv; srv; srv = srv->next) { + srv->eweight = ((srv->uweight + 1) / pgcd) - 1; + if (srv->state & SRV_BACKUP) + bck += srv->eweight + 1; + else + act += srv->eweight + 1; + } + + /* this is the largest map we will ever need for this servers list */ + if (act < bck) + act = bck; + + curproxy->srv_map = (struct server **)calloc(act, sizeof(struct server *)); + /* recounts servers and their weights */ + recount_servers(curproxy); + recalc_server_map(curproxy); + } + + if (curproxy->options & PR_O_LOGASAP) + curproxy->to_log &= ~LW_BYTES; + + if (curproxy->errmsg.msg400 == NULL) { + curproxy->errmsg.msg400 = (char *)HTTP_400; + curproxy->errmsg.len400 = strlen(HTTP_400); + } + if (curproxy->errmsg.msg403 == NULL) { + curproxy->errmsg.msg403 = (char *)HTTP_403; + curproxy->errmsg.len403 = strlen(HTTP_403); + } + if (curproxy->errmsg.msg408 == NULL) { + curproxy->errmsg.msg408 = (char *)HTTP_408; + curproxy->errmsg.len408 = strlen(HTTP_408); + } + if (curproxy->errmsg.msg500 == NULL) { + curproxy->errmsg.msg500 = (char *)HTTP_500; + curproxy->errmsg.len500 = strlen(HTTP_500); + } + if (curproxy->errmsg.msg502 == NULL) { + curproxy->errmsg.msg502 = (char *)HTTP_502; + curproxy->errmsg.len502 = strlen(HTTP_502); + } + if (curproxy->errmsg.msg503 == NULL) { + curproxy->errmsg.msg503 = (char *)HTTP_503; + curproxy->errmsg.len503 = strlen(HTTP_503); + } + if (curproxy->errmsg.msg504 == NULL) { + curproxy->errmsg.msg504 = (char *)HTTP_504; + curproxy->errmsg.len504 = strlen(HTTP_504); + } + + /* + * If this server supports a maxconn parameter, it needs a dedicated + * tasks to fill the emptied slots when a connection leaves. + */ + newsrv = curproxy->srv; + while (newsrv != NULL) { + if (newsrv->minconn >= newsrv->maxconn) { + /* Only 'minconn' was specified, or it was higher than or equal + * to 'maxconn'. Let's turn this into maxconn and clean it, as + * this will avoid further useless expensive computations. + */ + newsrv->maxconn = newsrv->minconn; + newsrv->minconn = 0; + } + + if (newsrv->maxconn > 0) { + struct task *t; + + if ((t = pool_alloc(task)) == NULL) { + Alert("parsing [%s:%d] : out of memory.\n", file, linenum); + return -1; + } + + t->next = t->prev = t->rqnext = NULL; /* task not in run queue yet */ + t->wq = LIST_HEAD(wait_queue[1]); /* already assigned to the eternity queue */ + t->state = TASK_IDLE; + t->process = process_srv_queue; + t->context = newsrv; + newsrv->queue_mgt = t; + + /* never run it unless specifically woken up */ + tv_eternity(&t->expire); + task_queue(t); + } + newsrv = newsrv->next; + } + + /* now we'll start this proxy's health checks if any */ + /* 1- count the checkers to run simultaneously */ + nbchk = 0; + mininter = 0; + newsrv = curproxy->srv; + while (newsrv != NULL) { + if (newsrv->state & SRV_CHECKED) { + if (!mininter || mininter > newsrv->inter) + mininter = newsrv->inter; + nbchk++; + } + newsrv = newsrv->next; + } + + /* 2- start them as far as possible from each others while respecting + * their own intervals. For this, we will start them after their own + * interval added to the min interval divided by the number of servers, + * weighted by the server's position in the list. + */ + if (nbchk > 0) { + struct task *t; + int srvpos; + + newsrv = curproxy->srv; + srvpos = 0; + while (newsrv != NULL) { + /* should this server be checked ? */ + if (newsrv->state & SRV_CHECKED) { + if ((t = pool_alloc(task)) == NULL) { + Alert("parsing [%s:%d] : out of memory.\n", file, linenum); + return -1; + } + + t->next = t->prev = t->rqnext = NULL; /* task not in run queue yet */ + t->wq = LIST_HEAD(wait_queue[0]); /* but already has a wait queue assigned */ + t->state = TASK_IDLE; + t->process = process_chk; + t->context = newsrv; + + /* check this every ms */ + tv_delayfrom(&t->expire, &now, + newsrv->inter + mininter * srvpos / nbchk); + task_queue(t); + //task_wakeup(&rq, t); + srvpos++; + } + newsrv = newsrv->next; + } + } + + curproxy = curproxy->next; + } + if (cfgerr > 0) { + Alert("Errors found in configuration file, aborting.\n"); + return -1; + } + else + return 0; +} + + + +/* + * Local variables: + * c-indent-level: 8 + * c-basic-offset: 8 + * End: + */ diff --git a/src/checks.c b/src/checks.c new file mode 100644 index 000000000..8fd3e8e7c --- /dev/null +++ b/src/checks.c @@ -0,0 +1,393 @@ +/* + * Health-checks functions. + * + * Copyright 2000-2006 Willy Tarreau + * + * This program is free software; you can redistribute it and/or + * modify it under the terms of the GNU General Public License + * as published by the Free Software Foundation; either version + * 2 of the License, or (at your option) any later version. + * + */ + +#include +#include +#include +#include +#include +#include +#include + +#include +#include +#include +#include + +#include +#include +#include +#include + +#include +#include +#include +#include +#include +#include + + +/* Sets server down, notifies by all available means, recounts the + * remaining servers on the proxy and transfers queued sessions whenever + * possible to other servers. + */ +void set_server_down(struct server *s) +{ + struct pendconn *pc, *pc_bck, *pc_end; + struct session *sess; + int xferred; + + s->state &= ~SRV_RUNNING; + + if (s->health == s->rise) { + recount_servers(s->proxy); + recalc_server_map(s->proxy); + + /* we might have sessions queued on this server and waiting for + * a connection. Those which are redispatchable will be queued + * to another server or to the proxy itself. + */ + xferred = 0; + FOREACH_ITEM_SAFE(pc, pc_bck, &s->pendconns, pc_end, struct pendconn *, list) { + sess = pc->sess; + if ((sess->proxy->options & PR_O_REDISP)) { + /* The REDISP option was specified. We will ignore + * cookie and force to balance or use the dispatcher. + */ + sess->flags &= ~(SN_DIRECT | SN_ASSIGNED | SN_ADDR_SET); + sess->srv = NULL; /* it's left to the dispatcher to choose a server */ + if ((sess->flags & SN_CK_MASK) == SN_CK_VALID) { + sess->flags &= ~SN_CK_MASK; + sess->flags |= SN_CK_DOWN; + } + pendconn_free(pc); + task_wakeup(&rq, sess->task); + xferred++; + } + } + + sprintf(trash, "%sServer %s/%s is DOWN. %d active and %d backup servers left.%s" + " %d sessions active, %d requeued, %d remaining in queue.\n", + s->state & SRV_BACKUP ? "Backup " : "", + s->proxy->id, s->id, s->proxy->srv_act, s->proxy->srv_bck, + (s->proxy->srv_bck && !s->proxy->srv_act) ? " Running on backup." : "", + s->cur_sess, xferred, s->nbpend); + + Warning("%s", trash); + send_log(s->proxy, LOG_ALERT, "%s", trash); + + if (s->proxy->srv_bck == 0 && s->proxy->srv_act == 0) { + Alert("Proxy %s has no server available !\n", s->proxy->id); + send_log(s->proxy, LOG_EMERG, "Proxy %s has no server available !\n", s->proxy->id); + } + s->down_trans++; + } + s->health = 0; /* failure */ +} + + +/* + * This function is used only for server health-checks. It handles + * the connection acknowledgement. If the proxy requires HTTP health-checks, + * it sends the request. In other cases, it returns 1 if the socket is OK, + * or -1 if an error occured. + */ +int event_srv_chk_w(int fd) +{ + struct task *t = fdtab[fd].owner; + struct server *s = t->context; + int skerr; + socklen_t lskerr = sizeof(skerr); + + skerr = 1; + if ((getsockopt(fd, SOL_SOCKET, SO_ERROR, &skerr, &lskerr) == -1) + || (skerr != 0)) { + /* in case of TCP only, this tells us if the connection failed */ + s->result = -1; + fdtab[fd].state = FD_STERROR; + FD_CLR(fd, StaticWriteEvent); + } + else if (s->result != -1) { + /* we don't want to mark 'UP' a server on which we detected an error earlier */ + if (s->proxy->options & PR_O_HTTP_CHK) { + int ret; + /* we want to check if this host replies to "OPTIONS / HTTP/1.0" + * so we'll send the request, and won't wake the checker up now. + */ +#ifndef MSG_NOSIGNAL + ret = send(fd, s->proxy->check_req, s->proxy->check_len, MSG_DONTWAIT); +#else + ret = send(fd, s->proxy->check_req, s->proxy->check_len, MSG_DONTWAIT | MSG_NOSIGNAL); +#endif + if (ret == s->proxy->check_len) { + FD_SET(fd, StaticReadEvent); /* prepare for reading reply */ + FD_CLR(fd, StaticWriteEvent); /* nothing more to write */ + return 0; + } + else { + s->result = -1; + FD_CLR(fd, StaticWriteEvent); + } + } + else { + /* good TCP connection is enough */ + s->result = 1; + } + } + + task_wakeup(&rq, t); + return 0; +} + + +/* + * This function is used only for server health-checks. It handles + * the server's reply to an HTTP request. It returns 1 if the server replies + * 2xx or 3xx (valid responses), or -1 in other cases. + */ +int event_srv_chk_r(int fd) +{ + char reply[64]; + int len, result; + struct task *t = fdtab[fd].owner; + struct server *s = t->context; + int skerr; + socklen_t lskerr = sizeof(skerr); + + result = len = -1; + + getsockopt(fd, SOL_SOCKET, SO_ERROR, &skerr, &lskerr); + if (!skerr) { +#ifndef MSG_NOSIGNAL + len = recv(fd, reply, sizeof(reply), 0); +#else + /* Warning! Linux returns EAGAIN on SO_ERROR if data are still available + * but the connection was closed on the remote end. Fortunately, recv still + * works correctly and we don't need to do the getsockopt() on linux. + */ + len = recv(fd, reply, sizeof(reply), MSG_NOSIGNAL); +#endif + + if ((len >= sizeof("HTTP/1.0 000")) && + !memcmp(reply, "HTTP/1.", 7) && + (reply[9] == '2' || reply[9] == '3')) /* 2xx or 3xx */ + result = 1; + } + + if (result == -1) + fdtab[fd].state = FD_STERROR; + + if (s->result != -1) + s->result = result; + + FD_CLR(fd, StaticReadEvent); + task_wakeup(&rq, t); + return 0; +} + +/* + * manages a server health-check. Returns + * the time the task accepts to wait, or TIME_ETERNITY for infinity. + */ +int process_chk(struct task *t) +{ + struct server *s = t->context; + struct sockaddr_in sa; + int fd; + + //fprintf(stderr, "process_chk: task=%p\n", t); + + new_chk: + fd = s->curfd; + if (fd < 0) { /* no check currently running */ + //fprintf(stderr, "process_chk: 2\n"); + if (tv_cmp2_ms(&t->expire, &now) > 0) { /* not good time yet */ + task_queue(t); /* restore t to its place in the task list */ + return tv_remain2(&now, &t->expire); + } + + /* we don't send any health-checks when the proxy is stopped or when + * the server should not be checked. + */ + if (!(s->state & SRV_CHECKED) || s->proxy->state == PR_STSTOPPED) { + while (tv_cmp2_ms(&t->expire, &now) <= 0) + tv_delayfrom(&t->expire, &t->expire, s->inter); + task_queue(t); /* restore t to its place in the task list */ + return tv_remain2(&now, &t->expire); + } + + /* we'll initiate a new check */ + s->result = 0; /* no result yet */ + if ((fd = socket(AF_INET, SOCK_STREAM, IPPROTO_TCP)) != -1) { + if ((fd < global.maxsock) && + (fcntl(fd, F_SETFL, O_NONBLOCK) != -1) && + (setsockopt(fd, IPPROTO_TCP, TCP_NODELAY, (char *) &one, sizeof(one)) != -1)) { + //fprintf(stderr, "process_chk: 3\n"); + + /* we'll connect to the check port on the server */ + sa = s->addr; + sa.sin_port = htons(s->check_port); + + /* allow specific binding : + * - server-specific at first + * - proxy-specific next + */ + if (s->state & SRV_BIND_SRC) { + setsockopt(fd, SOL_SOCKET, SO_REUSEADDR, (char *) &one, sizeof(one)); + if (bind(fd, (struct sockaddr *)&s->source_addr, sizeof(s->source_addr)) == -1) { + Alert("Cannot bind to source address before connect() for server %s/%s. Aborting.\n", + s->proxy->id, s->id); + s->result = -1; + } + } + else if (s->proxy->options & PR_O_BIND_SRC) { + setsockopt(fd, SOL_SOCKET, SO_REUSEADDR, (char *) &one, sizeof(one)); + if (bind(fd, (struct sockaddr *)&s->proxy->source_addr, sizeof(s->proxy->source_addr)) == -1) { + Alert("Cannot bind to source address before connect() for proxy %s. Aborting.\n", + s->proxy->id); + s->result = -1; + } + } + + if (!s->result) { + if ((connect(fd, (struct sockaddr *)&sa, sizeof(sa)) != -1) || (errno == EINPROGRESS)) { + /* OK, connection in progress or established */ + + //fprintf(stderr, "process_chk: 4\n"); + + s->curfd = fd; /* that's how we know a test is in progress ;-) */ + fdtab[fd].owner = t; + fdtab[fd].read = &event_srv_chk_r; + fdtab[fd].write = &event_srv_chk_w; + fdtab[fd].state = FD_STCONN; /* connection in progress */ + FD_SET(fd, StaticWriteEvent); /* for connect status */ +#ifdef DEBUG_FULL + assert (!FD_ISSET(fd, StaticReadEvent)); +#endif + fd_insert(fd); + /* FIXME: we allow up to for a connection to establish, but we should use another parameter */ + tv_delayfrom(&t->expire, &now, s->inter); + task_queue(t); /* restore t to its place in the task list */ + return tv_remain(&now, &t->expire); + } + else if (errno != EALREADY && errno != EISCONN && errno != EAGAIN) { + s->result = -1; /* a real error */ + } + } + } + close(fd); /* socket creation error */ + } + + if (!s->result) { /* nothing done */ + //fprintf(stderr, "process_chk: 6\n"); + while (tv_cmp2_ms(&t->expire, &now) <= 0) + tv_delayfrom(&t->expire, &t->expire, s->inter); + goto new_chk; /* may be we should initialize a new check */ + } + + /* here, we have seen a failure */ + if (s->health > s->rise) { + s->health--; /* still good */ + s->failed_checks++; + } + else + set_server_down(s); + + //fprintf(stderr, "process_chk: 7\n"); + /* FIXME: we allow up to for a connection to establish, but we should use another parameter */ + while (tv_cmp2_ms(&t->expire, &now) <= 0) + tv_delayfrom(&t->expire, &t->expire, s->inter); + goto new_chk; + } + else { + //fprintf(stderr, "process_chk: 8\n"); + /* there was a test running */ + if (s->result > 0) { /* good server detected */ + //fprintf(stderr, "process_chk: 9\n"); + s->health++; /* was bad, stays for a while */ + if (s->health >= s->rise) { + s->state |= SRV_RUNNING; + + if (s->health == s->rise) { + int xferred; + + recount_servers(s->proxy); + recalc_server_map(s->proxy); + + /* check if we can handle some connections queued at the proxy. We + * will take as many as we can handle. + */ + for (xferred = 0; !s->maxconn || xferred < srv_dynamic_maxconn(s); xferred++) { + struct session *sess; + struct pendconn *p; + + p = pendconn_from_px(s->proxy); + if (!p) + break; + p->sess->srv = s; + sess = p->sess; + pendconn_free(p); + task_wakeup(&rq, sess->task); + } + + sprintf(trash, + "%sServer %s/%s is UP. %d active and %d backup servers online.%s" + " %d sessions requeued, %d total in queue.\n", + s->state & SRV_BACKUP ? "Backup " : "", + s->proxy->id, s->id, s->proxy->srv_act, s->proxy->srv_bck, + (s->proxy->srv_bck && !s->proxy->srv_act) ? " Running on backup." : "", + xferred, s->nbpend); + + Warning("%s", trash); + send_log(s->proxy, LOG_NOTICE, "%s", trash); + } + + s->health = s->rise + s->fall - 1; /* OK now */ + } + s->curfd = -1; /* no check running anymore */ + //FD_CLR(fd, StaticWriteEvent); + fd_delete(fd); + while (tv_cmp2_ms(&t->expire, &now) <= 0) + tv_delayfrom(&t->expire, &t->expire, s->inter); + goto new_chk; + } + else if (s->result < 0 || tv_cmp2_ms(&t->expire, &now) <= 0) { + //fprintf(stderr, "process_chk: 10\n"); + /* failure or timeout detected */ + if (s->health > s->rise) { + s->health--; /* still good */ + s->failed_checks++; + } + else + set_server_down(s); + s->curfd = -1; + //FD_CLR(fd, StaticWriteEvent); + fd_delete(fd); + while (tv_cmp2_ms(&t->expire, &now) <= 0) + tv_delayfrom(&t->expire, &t->expire, s->inter); + goto new_chk; + } + /* if result is 0 and there's no timeout, we have to wait again */ + } + //fprintf(stderr, "process_chk: 11\n"); + s->result = 0; + task_queue(t); /* restore t to its place in the task list */ + return tv_remain2(&now, &t->expire); +} + + +/* + * Local variables: + * c-indent-level: 8 + * c-basic-offset: 8 + * End: + */ diff --git a/src/chtbl.c b/src/chtbl.c index 481b3ac63..c8e794fd3 100644 --- a/src/chtbl.c +++ b/src/chtbl.c @@ -18,8 +18,8 @@ #include #include -#include -#include +#include +#include /***************************************************************************** * * @@ -30,47 +30,47 @@ int chtbl_init(CHTbl *htbl, int buckets, int (*h)(const void *key), int (*match)(const void *key1, const void *key2), void (*destroy)(void*data)) { - int i; + int i; - /***************************************************************************** - * * - * Allocate space for the hash table. * - * * - *****************************************************************************/ + /***************************************************************************** + * * + * Allocate space for the hash table. * + * * + *****************************************************************************/ - if ((htbl->table = (List *)malloc(buckets * sizeof(List))) == NULL) - return -1; + if ((htbl->table = (List *)malloc(buckets * sizeof(List))) == NULL) + return -1; - /***************************************************************************** - * * - * Initialize the buckets. * - * * - *****************************************************************************/ + /***************************************************************************** + * * + * Initialize the buckets. * + * * + *****************************************************************************/ - htbl->buckets = buckets; + htbl->buckets = buckets; - for (i = 0; i < htbl->buckets; i++) - list_init(&htbl->table[i], destroy); + for (i = 0; i < htbl->buckets; i++) + list_init(&htbl->table[i], destroy); - /***************************************************************************** - * * - * Encapsulate the functions. * - * * - *****************************************************************************/ + /***************************************************************************** + * * + * Encapsulate the functions. * + * * + *****************************************************************************/ - htbl->h = h; - htbl->match = match; - htbl->destroy = destroy; + htbl->h = h; + htbl->match = match; + htbl->destroy = destroy; - /***************************************************************************** - * * - * Initialize the number of elements in the table. * - * * - *****************************************************************************/ + /***************************************************************************** + * * + * Initialize the number of elements in the table. * + * * + *****************************************************************************/ - htbl->size = 0; + htbl->size = 0; - return 0; + return 0; } /* end chtbl_init () */ /***************************************************************************** @@ -81,35 +81,35 @@ int chtbl_init(CHTbl *htbl, int buckets, int (*h)(const void *key), int void chtbl_destroy(CHTbl *htbl) { - int i; + int i; - /***************************************************************************** - * * - * Destroy each bucket. * - * * - *****************************************************************************/ + /***************************************************************************** + * * + * Destroy each bucket. * + * * + *****************************************************************************/ - for (i = 0; i < htbl->buckets; i++) { - list_destroy(&htbl->table[i]); - } /* end for () */ + for (i = 0; i < htbl->buckets; i++) { + list_destroy(&htbl->table[i]); + } /* end for () */ - /***************************************************************************** - * * - * Free the storage allocated for the hash table. * - * * - *****************************************************************************/ + /***************************************************************************** + * * + * Free the storage allocated for the hash table. * + * * + *****************************************************************************/ - free(htbl->table); + free(htbl->table); - /***************************************************************************** - * * - * No operations are allowed now, but clear the structure as a precaution. * - * * - *****************************************************************************/ + /***************************************************************************** + * * + * No operations are allowed now, but clear the structure as a precaution. * + * * + *****************************************************************************/ - memset(htbl, 0, sizeof(CHTbl)); + memset(htbl, 0, sizeof(CHTbl)); - return; + return; } /* end chtbl_destroy() */ /***************************************************************************** @@ -120,38 +120,38 @@ void chtbl_destroy(CHTbl *htbl) { int chtbl_insert(CHTbl *htbl, const void *data) { - void *temp; - int bucket,retval; + void *temp; + int bucket,retval; - /***************************************************************************** - * * - * Do nothing if the data is already in the table. * - * * - *****************************************************************************/ + /***************************************************************************** + * * + * Do nothing if the data is already in the table. * + * * + *****************************************************************************/ - temp = (void *)data; + temp = (void *)data; - if (chtbl_lookup(htbl, &temp) == 0) - return 1; + if (chtbl_lookup(htbl, &temp) == 0) + return 1; - /***************************************************************************** - * * - * Hash the key. * - * * - *****************************************************************************/ + /***************************************************************************** + * * + * Hash the key. * + * * + *****************************************************************************/ - bucket = htbl->h(data) % htbl->buckets; + bucket = htbl->h(data) % htbl->buckets; - /***************************************************************************** - * * - * Insert the data into the bucket. * - * * - *****************************************************************************/ + /***************************************************************************** + * * + * Insert the data into the bucket. * + * * + *****************************************************************************/ - if ((retval = list_ins_next(&htbl->table[bucket], NULL, data)) == 0) - htbl->size++; + if ((retval = list_ins_next(&htbl->table[bucket], NULL, data)) == 0) + htbl->size++; - return retval; + return retval; } /* end chtbl_insert() */ /***************************************************************************** @@ -162,53 +162,54 @@ int chtbl_insert(CHTbl *htbl, const void *data) { int chtbl_remove(CHTbl *htbl, void **data) { - ListElmt *element, *prev; - int bucket; + ListElmt *element, *prev; + int bucket; - /***************************************************************************** - * * - * Hash the key. * - * * - *****************************************************************************/ + /********************************************************************* + * * + * Hash the key. * + * * + *********************************************************************/ - bucket = htbl->h(*data) % htbl->buckets; + bucket = htbl->h(*data) % htbl->buckets; - /***************************************************************************** - * * - * Search for the data in the bucket. * - * * - *****************************************************************************/ + /********************************************************************* + * * + * Search for the data in the bucket. * + * * + *********************************************************************/ - prev = NULL; + prev = NULL; - for (element = list_head(&htbl->table[bucket]); element != NULL; element = list_next(element)) { - if (htbl->match(*data, list_data(element))) { + for (element = list_head(&htbl->table[bucket]); + element != NULL; element = list_next(element)) { + if (htbl->match(*data, list_data(element))) { - /*********************************************************************** - * * - * Remove the data from the bucket. * - * * - ***********************************************************************/ + /***************************************************** + * * + * Remove the data from the bucket. * + * * + *****************************************************/ - if (list_rem_next(&htbl->table[bucket], prev, data) == 0) { - htbl->size--; - return 0; - } /* end if() */ - else { - return -1; - }/* end else */ - }/* end if (htbl->match(*data, list_data(element))) */ + if (list_rem_next(&htbl->table[bucket], prev, data) == 0) { + htbl->size--; + return 0; + } /* end if() */ + else { + return -1; + }/* end else */ + }/* end if (htbl->match(*data, list_data(element))) */ - prev = element; - }/* end for() */ + prev = element; + }/* end for() */ - /***************************************************************************** - * * - * Return that the data was not found. * - * * - *****************************************************************************/ + /********************************************************************* + * * + * Return that the data was not found. * + * * + *********************************************************************/ - return -1; + return -1; } /* end int chtbl_remove(CHTbl *htbl, void **data) */ /***************************************************************************** @@ -219,42 +220,50 @@ int chtbl_remove(CHTbl *htbl, void **data) { int chtbl_lookup(const CHTbl *htbl, void **data) { - ListElmt *element; - int bucket; + ListElmt *element; + int bucket; - /***************************************************************************** - * * - * Hash the key. * - * * - *****************************************************************************/ + /********************************************************************* + * * + * Hash the key. * + * * + *********************************************************************/ - bucket = htbl->h(*data) % htbl->buckets; + bucket = htbl->h(*data) % htbl->buckets; - /***************************************************************************** - * * - * Search for the data in the bucket. * - * * - *****************************************************************************/ + /********************************************************************* + * * + * Search for the data in the bucket. * + * * + *********************************************************************/ - for (element = list_head(&htbl->table[bucket]); element != NULL; element = list_next(element)) { - if (htbl->match(*data, list_data(element))) { + for (element = list_head(&htbl->table[bucket]); + element != NULL; element = list_next(element)) { + if (htbl->match(*data, list_data(element))) { - /*********************************************************************** - * * - * Pass back the data from the table. * - * * - ***********************************************************************/ + /***************************************************** + * * + * Pass back the data from the table. * + * * + *****************************************************/ - *data = list_data(element); - return 0; - }/* end if() */ - }/* end for() */ + *data = list_data(element); + return 0; + }/* end if() */ + }/* end for() */ - /***************************************************************************** - * * - * Return that the data was not found. * - * * - *****************************************************************************/ + /********************************************************************* + * * + * Return that the data was not found. * + * * + *********************************************************************/ - return -1; + return -1; } /* end chtbl_lookup() */ + +/* + * Local variables: + * c-indent-level: 8 + * c-basic-offset: 8 + * End: + */ diff --git a/src/client.c b/src/client.c new file mode 100644 index 000000000..d42e8aadd --- /dev/null +++ b/src/client.c @@ -0,0 +1,397 @@ +/* + * Client-side variables and functions. + * + * Copyright 2000-2006 Willy Tarreau + * + * This program is free software; you can redistribute it and/or + * modify it under the terms of the GNU General Public License + * as published by the Free Software Foundation; either version + * 2 of the License, or (at your option) any later version. + * + */ + +#include +#include +#include +#include + +#include +#include +#include + +#include +#include + +#include +#include +#include +#include +#include +#include +#include +#include + +#include +#include +#include +#include +#include +#include + + + +/* + * FIXME: This should move to the STREAM_SOCK code then split into TCP and HTTP. + */ + +/* + * this function is called on a read event from a listen socket, corresponding + * to an accept. It tries to accept as many connections as possible. + * It returns 0. + */ +int event_accept(int fd) { + struct proxy *p = (struct proxy *)fdtab[fd].owner; + struct session *s; + struct task *t; + int cfd; + int max_accept; + + if (global.nbproc > 1) + max_accept = 8; /* let other processes catch some connections too */ + else + max_accept = -1; + + while (p->nbconn < p->maxconn && max_accept--) { + struct sockaddr_storage addr; + socklen_t laddr = sizeof(addr); + + if ((cfd = accept(fd, (struct sockaddr *)&addr, &laddr)) == -1) { + switch (errno) { + case EAGAIN: + case EINTR: + case ECONNABORTED: + return 0; /* nothing more to accept */ + case ENFILE: + send_log(p, LOG_EMERG, + "Proxy %s reached system FD limit at %d. Please check system tunables.\n", + p->id, maxfd); + return 0; + case EMFILE: + send_log(p, LOG_EMERG, + "Proxy %s reached process FD limit at %d. Please check 'ulimit-n' and restart.\n", + p->id, maxfd); + return 0; + case ENOBUFS: + case ENOMEM: + send_log(p, LOG_EMERG, + "Proxy %s reached system memory limit at %d sockets. Please check system tunables.\n", + p->id, maxfd); + return 0; + default: + return 0; + } + } + + if ((s = pool_alloc(session)) == NULL) { /* disable this proxy for a while */ + Alert("out of memory in event_accept().\n"); + FD_CLR(fd, StaticReadEvent); + p->state = PR_STIDLE; + close(cfd); + return 0; + } + + /* if this session comes from a known monitoring system, we want to ignore + * it as soon as possible, which means closing it immediately for TCP. + */ + s->flags = 0; + if (addr.ss_family == AF_INET && + p->mon_mask.s_addr && + (((struct sockaddr_in *)&addr)->sin_addr.s_addr & p->mon_mask.s_addr) == p->mon_net.s_addr) { + if (p->mode == PR_MODE_TCP) { + close(cfd); + pool_free(session, s); + continue; + } + s->flags |= SN_MONITOR; + } + + if ((t = pool_alloc(task)) == NULL) { /* disable this proxy for a while */ + Alert("out of memory in event_accept().\n"); + FD_CLR(fd, StaticReadEvent); + p->state = PR_STIDLE; + close(cfd); + pool_free(session, s); + return 0; + } + + s->cli_addr = addr; + if (cfd >= global.maxsock) { + Alert("accept(): not enough free sockets. Raise -n argument. Giving up.\n"); + close(cfd); + pool_free(task, t); + pool_free(session, s); + return 0; + } + + if ((fcntl(cfd, F_SETFL, O_NONBLOCK) == -1) || + (setsockopt(cfd, IPPROTO_TCP, TCP_NODELAY, + (char *) &one, sizeof(one)) == -1)) { + Alert("accept(): cannot set the socket in non blocking mode. Giving up\n"); + close(cfd); + pool_free(task, t); + pool_free(session, s); + return 0; + } + + if (p->options & PR_O_TCP_CLI_KA) + setsockopt(cfd, SOL_SOCKET, SO_KEEPALIVE, (char *) &one, sizeof(one)); + + t->next = t->prev = t->rqnext = NULL; /* task not in run queue yet */ + t->wq = LIST_HEAD(wait_queue[0]); /* but already has a wait queue assigned */ + t->state = TASK_IDLE; + t->process = process_session; + t->context = s; + + s->task = t; + s->proxy = p; + s->cli_state = (p->mode == PR_MODE_HTTP) ? CL_STHEADERS : CL_STDATA; /* no HTTP headers for non-HTTP proxies */ + s->srv_state = SV_STIDLE; + s->req = s->rep = NULL; /* will be allocated later */ + + s->res_cr = s->res_cw = s->res_sr = s->res_sw = RES_SILENT; + s->cli_fd = cfd; + s->srv_fd = -1; + s->req_line.len = -1; + s->auth_hdr.len = -1; + s->srv = NULL; + s->pend_pos = NULL; + s->conn_retries = p->conn_retries; + + if (s->flags & SN_MONITOR) + s->logs.logwait = 0; + else + s->logs.logwait = p->to_log; + + s->logs.tv_accept = now; + s->logs.t_request = -1; + s->logs.t_queue = -1; + s->logs.t_connect = -1; + s->logs.t_data = -1; + s->logs.t_close = 0; + s->logs.uri = NULL; + s->logs.cli_cookie = NULL; + s->logs.srv_cookie = NULL; + s->logs.status = -1; + s->logs.bytes = 0; + s->logs.prx_queue_size = 0; /* we get the number of pending conns before us */ + s->logs.srv_queue_size = 0; /* we will get this number soon */ + + s->data_source = DATA_SRC_NONE; + + s->uniq_id = totalconn; + p->cum_conn++; + + if (p->nb_req_cap > 0) { + if ((s->req_cap = + pool_alloc_from(p->req_cap_pool, p->nb_req_cap*sizeof(char *))) + == NULL) { /* no memory */ + close(cfd); /* nothing can be done for this fd without memory */ + pool_free(task, t); + pool_free(session, s); + return 0; + } + memset(s->req_cap, 0, p->nb_req_cap*sizeof(char *)); + } + else + s->req_cap = NULL; + + if (p->nb_rsp_cap > 0) { + if ((s->rsp_cap = + pool_alloc_from(p->rsp_cap_pool, p->nb_rsp_cap*sizeof(char *))) + == NULL) { /* no memory */ + if (s->req_cap != NULL) + pool_free_to(p->req_cap_pool, s->req_cap); + close(cfd); /* nothing can be done for this fd without memory */ + pool_free(task, t); + pool_free(session, s); + return 0; + } + memset(s->rsp_cap, 0, p->nb_rsp_cap*sizeof(char *)); + } + else + s->rsp_cap = NULL; + + if ((p->mode == PR_MODE_TCP || p->mode == PR_MODE_HTTP) + && (p->logfac1 >= 0 || p->logfac2 >= 0)) { + struct sockaddr_storage sockname; + socklen_t namelen = sizeof(sockname); + + if (addr.ss_family != AF_INET || + !(s->proxy->options & PR_O_TRANSP) || + get_original_dst(cfd, (struct sockaddr_in *)&sockname, &namelen) == -1) + getsockname(cfd, (struct sockaddr *)&sockname, &namelen); + + if (p->to_log) { + /* we have the client ip */ + if (s->logs.logwait & LW_CLIP) + if (!(s->logs.logwait &= ~LW_CLIP)) + sess_log(s); + } + else if (s->cli_addr.ss_family == AF_INET) { + char pn[INET_ADDRSTRLEN], sn[INET_ADDRSTRLEN]; + if (inet_ntop(AF_INET, (const void *)&((struct sockaddr_in *)&sockname)->sin_addr, + sn, sizeof(sn)) && + inet_ntop(AF_INET, (const void *)&((struct sockaddr_in *)&s->cli_addr)->sin_addr, + pn, sizeof(pn))) { + send_log(p, LOG_INFO, "Connect from %s:%d to %s:%d (%s/%s)\n", + pn, ntohs(((struct sockaddr_in *)&s->cli_addr)->sin_port), + sn, ntohs(((struct sockaddr_in *)&sockname)->sin_port), + p->id, (p->mode == PR_MODE_HTTP) ? "HTTP" : "TCP"); + } + } + else { + char pn[INET6_ADDRSTRLEN], sn[INET6_ADDRSTRLEN]; + if (inet_ntop(AF_INET6, (const void *)&((struct sockaddr_in6 *)&sockname)->sin6_addr, + sn, sizeof(sn)) && + inet_ntop(AF_INET6, (const void *)&((struct sockaddr_in6 *)&s->cli_addr)->sin6_addr, + pn, sizeof(pn))) { + send_log(p, LOG_INFO, "Connect from %s:%d to %s:%d (%s/%s)\n", + pn, ntohs(((struct sockaddr_in6 *)&s->cli_addr)->sin6_port), + sn, ntohs(((struct sockaddr_in6 *)&sockname)->sin6_port), + p->id, (p->mode == PR_MODE_HTTP) ? "HTTP" : "TCP"); + } + } + } + + if ((global.mode & MODE_DEBUG) && (!(global.mode & MODE_QUIET) || (global.mode & MODE_VERBOSE))) { + struct sockaddr_in sockname; + socklen_t namelen = sizeof(sockname); + int len; + if (addr.ss_family != AF_INET || + !(s->proxy->options & PR_O_TRANSP) || + get_original_dst(cfd, (struct sockaddr_in *)&sockname, &namelen) == -1) + getsockname(cfd, (struct sockaddr *)&sockname, &namelen); + + if (s->cli_addr.ss_family == AF_INET) { + char pn[INET_ADDRSTRLEN]; + inet_ntop(AF_INET, + (const void *)&((struct sockaddr_in *)&s->cli_addr)->sin_addr, + pn, sizeof(pn)); + + len = sprintf(trash, "%08x:%s.accept(%04x)=%04x from [%s:%d]\n", + s->uniq_id, p->id, (unsigned short)fd, (unsigned short)cfd, + pn, ntohs(((struct sockaddr_in *)&s->cli_addr)->sin_port)); + } + else { + char pn[INET6_ADDRSTRLEN]; + inet_ntop(AF_INET6, + (const void *)&((struct sockaddr_in6 *)(&s->cli_addr))->sin6_addr, + pn, sizeof(pn)); + + len = sprintf(trash, "%08x:%s.accept(%04x)=%04x from [%s:%d]\n", + s->uniq_id, p->id, (unsigned short)fd, (unsigned short)cfd, + pn, ntohs(((struct sockaddr_in6 *)(&s->cli_addr))->sin6_port)); + } + + write(1, trash, len); + } + + if ((s->req = pool_alloc(buffer)) == NULL) { /* no memory */ + if (s->rsp_cap != NULL) + pool_free_to(p->rsp_cap_pool, s->rsp_cap); + if (s->req_cap != NULL) + pool_free_to(p->req_cap_pool, s->req_cap); + close(cfd); /* nothing can be done for this fd without memory */ + pool_free(task, t); + pool_free(session, s); + return 0; + } + + s->req->l = 0; + s->req->total = 0; + s->req->h = s->req->r = s->req->lr = s->req->w = s->req->data; /* r and w will be reset further */ + s->req->rlim = s->req->data + BUFSIZE; + if (s->cli_state == CL_STHEADERS) /* reserve some space for header rewriting */ + s->req->rlim -= MAXREWRITE; + + if ((s->rep = pool_alloc(buffer)) == NULL) { /* no memory */ + pool_free(buffer, s->req); + if (s->rsp_cap != NULL) + pool_free_to(p->rsp_cap_pool, s->rsp_cap); + if (s->req_cap != NULL) + pool_free_to(p->req_cap_pool, s->req_cap); + close(cfd); /* nothing can be done for this fd without memory */ + pool_free(task, t); + pool_free(session, s); + return 0; + } + s->rep->l = 0; + s->rep->total = 0; + s->rep->h = s->rep->r = s->rep->lr = s->rep->w = s->rep->rlim = s->rep->data; + + fdtab[cfd].read = &event_cli_read; + fdtab[cfd].write = &event_cli_write; + fdtab[cfd].owner = t; + fdtab[cfd].state = FD_STREADY; + + if ((p->mode == PR_MODE_HTTP && (s->flags & SN_MONITOR)) || + (p->mode == PR_MODE_HEALTH && (p->options & PR_O_HTTP_CHK))) + /* Either we got a request from a monitoring system on an HTTP instance, + * or we're in health check mode with the 'httpchk' option enabled. In + * both cases, we return a fake "HTTP/1.0 200 OK" response and we exit. + */ + client_retnclose(s, 19, "HTTP/1.0 200 OK\r\n\r\n"); /* forge a 200 response */ + else if (p->mode == PR_MODE_HEALTH) { /* health check mode, no client reading */ + client_retnclose(s, 3, "OK\n"); /* forge an "OK" response */ + } + else { + FD_SET(cfd, StaticReadEvent); + } + +#if defined(DEBUG_FULL) && defined(ENABLE_EPOLL) + if (PrevReadEvent) { + assert(!(FD_ISSET(cfd, PrevReadEvent))); + assert(!(FD_ISSET(cfd, PrevWriteEvent))); + } +#endif + fd_insert(cfd); + + tv_eternity(&s->cnexpire); + tv_eternity(&s->srexpire); + tv_eternity(&s->swexpire); + tv_eternity(&s->crexpire); + tv_eternity(&s->cwexpire); + + if (s->proxy->clitimeout) { + if (FD_ISSET(cfd, StaticReadEvent)) + tv_delayfrom(&s->crexpire, &now, s->proxy->clitimeout); + if (FD_ISSET(cfd, StaticWriteEvent)) + tv_delayfrom(&s->cwexpire, &now, s->proxy->clitimeout); + } + + tv_min(&t->expire, &s->crexpire, &s->cwexpire); + + task_queue(t); + + if (p->mode != PR_MODE_HEALTH) + task_wakeup(&rq, t); + + p->nbconn++; + if (p->nbconn > p->nbconn_max) + p->nbconn_max = p->nbconn; + actconn++; + totalconn++; + + // fprintf(stderr, "accepting from %p => %d conn, %d total, task=%p\n", p, actconn, totalconn, t); + } /* end of while (p->nbconn < p->maxconn) */ + return 0; +} + + + +/* + * Local variables: + * c-indent-level: 8 + * c-basic-offset: 8 + * End: + */ diff --git a/src/fd.c b/src/fd.c new file mode 100644 index 000000000..b7ff8add7 --- /dev/null +++ b/src/fd.c @@ -0,0 +1,503 @@ +/* + * File descriptors management functions. + * + * Copyright 2000-2006 Willy Tarreau + * + * This program is free software; you can redistribute it and/or + * modify it under the terms of the GNU General Public License + * as published by the Free Software Foundation; either version + * 2 of the License, or (at your option) any later version. + * + */ + +/* + * FIXME: + * - we still use 'listeners' to check whether we want to stop or not. + * - the various pollers should be moved to other external files, possibly + * dynamic libs. + * - merge event_cli_read() and event_srv_read(). The difference is res_*, + * buffer (at the beginning) and timeouts (at the end). + * => event_tcp_read(). It may be called from event_accept(). + * - extract the connect code from event_srv_write() + * => event_tcp_connect(). It must then call event_write(). + * - merge the remaining event_cli_write() and event_srv_write() + * => single event_tcp_write(). Check buffer, fd_state, res*, and timeouts. + * + */ + +#include +#include +#include + +#include +#include +#include + +#include +#include + +#include +#include + +struct fdtab *fdtab = NULL; /* array of all the file descriptors */ +int maxfd; /* # of the highest fd + 1 */ +int totalconn; /* total # of terminated sessions */ +int actconn; /* # of active sessions */ + +fd_set *StaticReadEvent, *StaticWriteEvent; +int cfg_polling_mechanism = 0; /* POLL_USE_{SELECT|POLL|EPOLL} */ + + +/****************************** + * pollers + ******************************/ + + +/* + * FIXME: this is dirty, but at the moment, there's no other solution to remove + * the old FDs from outside the loop. Perhaps we should export a global 'poll' + * structure with pointers to functions such as init_fd() and close_fd(), plus + * a private structure with several pointers to places such as below. + */ + +#if defined(ENABLE_EPOLL) +fd_set *PrevReadEvent = NULL, *PrevWriteEvent = NULL; + +#if defined(USE_MY_EPOLL) +_syscall1 (int, epoll_create, int, size); +_syscall4 (int, epoll_ctl, int, epfd, int, op, int, fd, struct epoll_event *, event); +_syscall4 (int, epoll_wait, int, epfd, struct epoll_event *, events, int, maxevents, int, timeout); +#endif + +/* + * Main epoll() loop. + * does 3 actions : + * 0 (POLL_LOOP_ACTION_INIT) : initializes necessary private structures + * 1 (POLL_LOOP_ACTION_RUN) : runs the loop + * 2 (POLL_LOOP_ACTION_CLEAN) : cleans up + * + * returns 0 if initialization failed, !0 otherwise. + */ + +int epoll_loop(int action) +{ + int next_time; + int status; + int fd; + + int fds, count; + int pr, pw, sr, sw; + unsigned rn, ro, wn, wo; /* read new, read old, write new, write old */ + struct epoll_event ev; + + /* private data */ + static struct epoll_event *epoll_events = NULL; + static int epoll_fd; + + if (action == POLL_LOOP_ACTION_INIT) { + epoll_fd = epoll_create(global.maxsock + 1); + if (epoll_fd < 0) + return 0; + else { + epoll_events = (struct epoll_event*) + calloc(1, sizeof(struct epoll_event) * global.maxsock); + PrevReadEvent = (fd_set *) + calloc(1, sizeof(fd_set) * (global.maxsock + FD_SETSIZE - 1) / FD_SETSIZE); + PrevWriteEvent = (fd_set *) + calloc(1, sizeof(fd_set) * (global.maxsock + FD_SETSIZE - 1) / FD_SETSIZE); + } + return 1; + } + else if (action == POLL_LOOP_ACTION_CLEAN) { + if (PrevWriteEvent) free(PrevWriteEvent); + if (PrevReadEvent) free(PrevReadEvent); + if (epoll_events) free(epoll_events); + close(epoll_fd); + epoll_fd = 0; + return 1; + } + + /* OK, it's POLL_LOOP_ACTION_RUN */ + + tv_now(&now); + + while (1) { + next_time = process_runnable_tasks(); + + /* stop when there's no connection left and we don't allow them anymore */ + if (!actconn && listeners == 0) + break; + + for (fds = 0; (fds << INTBITS) < maxfd; fds++) { + + rn = ((int*)StaticReadEvent)[fds]; ro = ((int*)PrevReadEvent)[fds]; + wn = ((int*)StaticWriteEvent)[fds]; wo = ((int*)PrevWriteEvent)[fds]; + + if ((ro^rn) | (wo^wn)) { + for (count = 0, fd = fds << INTBITS; count < (1<> count) & 1; + pw = (wo >> count) & 1; + sr = (rn >> count) & 1; + sw = (wn >> count) & 1; +#else + pr = FD_ISSET(fd&((1<> count) & 1; + sw = (wn >> count) & 1; +#else + sr = FD_ISSET(fd&((1< 0 && count < nbfd; count++) { + fd = poll_events[count].fd; + + if (!(poll_events[count].revents & ( POLLOUT | POLLIN | POLLERR | POLLHUP ))) + continue; + + /* ok, we found one active fd */ + status--; + + if (FD_ISSET(fd, StaticReadEvent)) { + if (fdtab[fd].state == FD_STCLOSE) + continue; + if (poll_events[count].revents & ( POLLIN | POLLERR | POLLHUP )) + fdtab[fd].read(fd); + } + + if (FD_ISSET(fd, StaticWriteEvent)) { + if (fdtab[fd].state == FD_STCLOSE) + continue; + if (poll_events[count].revents & ( POLLOUT | POLLERR | POLLHUP )) + fdtab[fd].write(fd); + } + } + } + return 1; +} +#endif + + + +/* + * Main select() loop. + * does 3 actions : + * 0 (POLL_LOOP_ACTION_INIT) : initializes necessary private structures + * 1 (POLL_LOOP_ACTION_RUN) : runs the loop + * 2 (POLL_LOOP_ACTION_CLEAN) : cleans up + * + * returns 0 if initialization failed, !0 otherwise. + */ + + +int select_loop(int action) +{ + int next_time; + int status; + int fd,i; + struct timeval delta; + int readnotnull, writenotnull; + static fd_set *ReadEvent = NULL, *WriteEvent = NULL; + + if (action == POLL_LOOP_ACTION_INIT) { + ReadEvent = (fd_set *) + calloc(1, sizeof(fd_set) * (global.maxsock + FD_SETSIZE - 1) / FD_SETSIZE); + WriteEvent = (fd_set *) + calloc(1, sizeof(fd_set) * (global.maxsock + FD_SETSIZE - 1) / FD_SETSIZE); + return 1; + } + else if (action == POLL_LOOP_ACTION_CLEAN) { + if (WriteEvent) free(WriteEvent); + if (ReadEvent) free(ReadEvent); + return 1; + } + + /* OK, it's POLL_LOOP_ACTION_RUN */ + + tv_now(&now); + + while (1) { + next_time = process_runnable_tasks(); + + /* stop when there's no connection left and we don't allow them anymore */ + if (!actconn && listeners == 0) + break; + + if (next_time > 0) { /* FIXME */ + /* Convert to timeval */ + /* to avoid eventual select loops due to timer precision */ + next_time += SCHEDULER_RESOLUTION; + delta.tv_sec = next_time / 1000; + delta.tv_usec = (next_time % 1000) * 1000; + } + else if (next_time == 0) { /* allow select to return immediately when needed */ + delta.tv_sec = delta.tv_usec = 0; + } + + + /* let's restore fdset state */ + + readnotnull = 0; writenotnull = 0; + for (i = 0; i < (maxfd + FD_SETSIZE - 1)/(8*sizeof(int)); i++) { + readnotnull |= (*(((int*)ReadEvent)+i) = *(((int*)StaticReadEvent)+i)) != 0; + writenotnull |= (*(((int*)WriteEvent)+i) = *(((int*)StaticWriteEvent)+i)) != 0; + } + + // /* just a verification code, needs to be removed for performance */ + // for (i=0; i= 0) ? &delta : NULL); + + /* this is an experiment on the separation of the select work */ + // status = (readnotnull ? select(maxfd, ReadEvent, NULL, NULL, (next_time >= 0) ? &delta : NULL) : 0); + // status |= (writenotnull ? select(maxfd, NULL, WriteEvent, NULL, (next_time >= 0) ? &delta : NULL) : 0); + + tv_now(&now); + + if (status > 0) { /* must proceed with events */ + + int fds; + char count; + + for (fds = 0; (fds << INTBITS) < maxfd; fds++) + if ((((int *)(ReadEvent))[fds] | ((int *)(WriteEvent))[fds]) != 0) + for (count = 1<= 0) && (fdtab[maxfd-1].state == FD_STCLOSE)) + maxfd--; +} + + +/* + * Local variables: + * c-indent-level: 8 + * c-basic-offset: 8 + * End: + */ diff --git a/src/haproxy.c b/src/haproxy.c new file mode 100644 index 000000000..e339a7b04 --- /dev/null +++ b/src/haproxy.c @@ -0,0 +1,869 @@ +/* + * HA-Proxy : High Availability-enabled HTTP/TCP proxy + * Copyright 2000-2006 Willy Tarreau . + * + * This program is free software; you can redistribute it and/or + * modify it under the terms of the GNU General Public License + * as published by the Free Software Foundation; either version + * 2 of the License, or (at your option) any later version. + * + * Please refer to RFC2068 or RFC2616 for informations about HTTP protocol, and + * RFC2965 for informations about cookies usage. More generally, the IETF HTTP + * Working Group's web site should be consulted for protocol related changes : + * + * http://ftp.ics.uci.edu/pub/ietf/http/ + * + * Pending bugs (may be not fixed because never reproduced) : + * - solaris only : sometimes, an HTTP proxy with only a dispatch address causes + * the proxy to terminate (no core) if the client breaks the connection during + * the response. Seen on 1.1.8pre4, but never reproduced. May not be related to + * the snprintf() bug since requests were simple (GET / HTTP/1.0), but may be + * related to missing setsid() (fixed in 1.1.15) + * - a proxy with an invalid config will prevent the startup even if disabled. + * + * ChangeLog has moved to the CHANGELOG file. + * + * TODO: + * - handle properly intermediate incomplete server headers. Done ? + * - handle hot-reconfiguration + * - fix client/server state transition when server is in connect or headers state + * and client suddenly disconnects. The server *should* switch to SHUT_WR, but + * still handle HTTP headers. + * - remove MAX_NEWHDR + * - cut this huge file into several ones + * + */ + +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include + +#ifdef DEBUG_FULL +#include +#endif + +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include + +#include +#include +#include +#include + +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include + +/*********************************************************************/ + +/*********************************************************************/ + +char *cfg_cfgfile = NULL; /* configuration file */ +char *progname = NULL; /* program name */ +int pid; /* current process id */ + +/* global options */ +struct global global = { + logfac1 : -1, + logfac2 : -1, + loglev1 : 7, /* max syslog level : debug */ + loglev2 : 7, + /* others NULL OK */ +}; + +/*********************************************************************/ + +int stopping; /* non zero means stopping in progress */ + +/* Here we store informations about the pids of the processes we may pause + * or kill. We will send them a signal every 10 ms until we can bind to all + * our ports. With 200 retries, that's about 2 seconds. + */ +#define MAX_START_RETRIES 200 +static int nb_oldpids = 0; +static int *oldpids = NULL; +static int oldpids_sig; /* use USR1 or TERM */ + +/* this is used to drain data, and as a temporary buffer for sprintf()... */ +char trash[BUFSIZE]; + +const int zero = 0; +const int one = 1; + +/* + * Syslog facilities and levels. Conforming to RFC3164. + */ + +#define MAX_HOSTNAME_LEN 32 +static char hostname[MAX_HOSTNAME_LEN] = ""; + + +/*********************************************************************/ +/* general purpose functions ***************************************/ +/*********************************************************************/ + +void display_version() +{ + printf("HA-Proxy version " HAPROXY_VERSION " " HAPROXY_DATE"\n"); + printf("Copyright 2000-2006 Willy Tarreau \n\n"); +} + +/* + * This function prints the command line usage and exits + */ +void usage(char *name) +{ + display_version(); + fprintf(stderr, + "Usage : %s -f [ -vdV" + "D ] [ -n ] [ -N ]\n" + " [ -p ] [ -m ]\n" + " -v displays version\n" + " -d enters debug mode ; -db only disables background mode.\n" + " -V enters verbose mode (disables quiet mode)\n" + " -D goes daemon ; implies -q\n" + " -q quiet mode : don't display messages\n" + " -c check mode : only check config file and exit\n" + " -n sets the maximum total # of connections (%d)\n" + " -m limits the usable amount of memory (in MB)\n" + " -N sets the default, per-proxy maximum # of connections (%d)\n" + " -p writes pids of all children to this file\n" +#if defined(ENABLE_EPOLL) + " -de disables epoll() usage even when available\n" +#endif +#if defined(ENABLE_POLL) + " -dp disables poll() usage even when available\n" +#endif + " -sf/-st [pid ]* finishes/terminates old pids. Must be last arguments.\n" + "\n", + name, DEFAULT_MAXCONN, cfg_maxpconn); + exit(1); +} + + + +/*********************************************************************/ +/* more specific functions ***************************************/ +/*********************************************************************/ + +/* + * upon SIGUSR1, let's have a soft stop. + */ +void sig_soft_stop(int sig) +{ + soft_stop(); + signal(sig, SIG_IGN); +} + +/* + * upon SIGTTOU, we pause everything + */ +void sig_pause(int sig) +{ + pause_proxies(); + signal(sig, sig_pause); +} + +/* + * upon SIGTTIN, let's have a soft stop. + */ +void sig_listen(int sig) +{ + listen_proxies(); + signal(sig, sig_listen); +} + +/* + * this function dumps every server's state when the process receives SIGHUP. + */ +void sig_dump_state(int sig) +{ + struct proxy *p = proxy; + + Warning("SIGHUP received, dumping servers states.\n"); + while (p) { + struct server *s = p->srv; + + send_log(p, LOG_NOTICE, "SIGHUP received, dumping servers states for proxy %s.\n", p->id); + while (s) { + snprintf(trash, sizeof(trash), + "SIGHUP: Server %s/%s is %s. Conn: %d act, %d pend, %d tot.", + p->id, s->id, + (s->state & SRV_RUNNING) ? "UP" : "DOWN", + s->cur_sess, s->nbpend, s->cum_sess); + Warning("%s\n", trash); + send_log(p, LOG_NOTICE, "%s\n", trash); + s = s->next; + } + + if (p->srv_act == 0) { + snprintf(trash, sizeof(trash), + "SIGHUP: Proxy %s %s ! Conn: %d act, %d pend (%d unass), %d tot.", + p->id, + (p->srv_bck) ? "is running on backup servers" : "has no server available", + p->nbconn, p->totpend, p->nbpend, p->cum_conn); + } else { + snprintf(trash, sizeof(trash), + "SIGHUP: Proxy %s has %d active servers and %d backup servers available." + " Conn: %d act, %d pend (%d unass), %d tot.", + p->id, p->srv_act, p->srv_bck, + p->nbconn, p->totpend, p->nbpend, p->cum_conn); + } + Warning("%s\n", trash); + send_log(p, LOG_NOTICE, "%s\n", trash); + + p = p->next; + } + signal(sig, sig_dump_state); +} + +void dump(int sig) +{ + struct task *t, *tnext; + struct session *s; + + tnext = ((struct task *)LIST_HEAD(wait_queue[0]))->next; + while ((t = tnext) != LIST_HEAD(wait_queue[0])) { /* we haven't looped ? */ + tnext = t->next; + s = t->context; + qfprintf(stderr,"[dump] wq: task %p, still %ld ms, " + "cli=%d, srv=%d, cr=%d, cw=%d, sr=%d, sw=%d, " + "req=%d, rep=%d, clifd=%d\n", + s, tv_remain(&now, &t->expire), + s->cli_state, + s->srv_state, + FD_ISSET(s->cli_fd, StaticReadEvent), + FD_ISSET(s->cli_fd, StaticWriteEvent), + FD_ISSET(s->srv_fd, StaticReadEvent), + FD_ISSET(s->srv_fd, StaticWriteEvent), + s->req->l, s->rep?s->rep->l:0, s->cli_fd + ); + } +} + +#ifdef DEBUG_MEMORY +static void fast_stop(void) +{ + struct proxy *p; + p = proxy; + while (p) { + p->grace = 0; + p = p->next; + } + soft_stop(); +} + +void sig_int(int sig) +{ + /* This would normally be a hard stop, + but we want to be sure about deallocation, + and so on, so we do a soft stop with + 0 GRACE time + */ + fast_stop(); + /* If we are killed twice, we decide to die*/ + signal(sig, SIG_DFL); +} + +void sig_term(int sig) +{ + /* This would normally be a hard stop, + but we want to be sure about deallocation, + and so on, so we do a soft stop with + 0 GRACE time + */ + fast_stop(); + /* If we are killed twice, we decide to die*/ + signal(sig, SIG_DFL); +} +#endif + + +/* + * This function initializes all the necessary variables. It only returns + * if everything is OK. If something fails, it exits. + */ +void init(int argc, char **argv) +{ + int i; + int arg_mode = 0; /* MODE_DEBUG, ... */ + char *old_argv = *argv; + char *tmp; + char *cfg_pidfile = NULL; + + if (1< 0) { + char *flag; + + if (**argv == '-') { + flag = *argv+1; + + /* 1 arg */ + if (*flag == 'v') { + display_version(); + exit(0); + } +#if defined(ENABLE_EPOLL) + else if (*flag == 'd' && flag[1] == 'e') + cfg_polling_mechanism &= ~POLL_USE_EPOLL; +#endif +#if defined(ENABLE_POLL) + else if (*flag == 'd' && flag[1] == 'p') + cfg_polling_mechanism &= ~POLL_USE_POLL; +#endif + else if (*flag == 'V') + arg_mode |= MODE_VERBOSE; + else if (*flag == 'd' && flag[1] == 'b') + arg_mode |= MODE_FOREGROUND; + else if (*flag == 'd') + arg_mode |= MODE_DEBUG; + else if (*flag == 'c') + arg_mode |= MODE_CHECK; + else if (*flag == 'D') + arg_mode |= MODE_DAEMON | MODE_QUIET; + else if (*flag == 'q') + arg_mode |= MODE_QUIET; + else if (*flag == 's' && (flag[1] == 'f' || flag[1] == 't')) { + /* list of pids to finish ('f') or terminate ('t') */ + + if (flag[1] == 'f') + oldpids_sig = SIGUSR1; /* finish then exit */ + else + oldpids_sig = SIGTERM; /* terminate immediately */ + argv++; argc--; + + if (argc > 0) { + oldpids = calloc(argc, sizeof(int)); + while (argc > 0) { + oldpids[nb_oldpids] = atol(*argv); + if (oldpids[nb_oldpids] <= 0) + usage(old_argv); + argc--; argv++; + nb_oldpids++; + } + } + } + else { /* >=2 args */ + argv++; argc--; + if (argc == 0) + usage(old_argv); + + switch (*flag) { + case 'n' : cfg_maxconn = atol(*argv); break; + case 'm' : global.rlimit_memmax = atol(*argv); break; + case 'N' : cfg_maxpconn = atol(*argv); break; + case 'f' : cfg_cfgfile = *argv; break; + case 'p' : cfg_pidfile = *argv; break; + default: usage(old_argv); + } + } + } + else + usage(old_argv); + argv++; argc--; + } + + global.mode = MODE_STARTING | /* during startup, we want most of the alerts */ + (arg_mode & (MODE_DAEMON | MODE_FOREGROUND | MODE_VERBOSE + | MODE_QUIET | MODE_CHECK | MODE_DEBUG)); + + if (!cfg_cfgfile) + usage(old_argv); + + gethostname(hostname, MAX_HOSTNAME_LEN); + + have_appsession = 0; + global.maxsock = 10; /* reserve 10 fds ; will be incremented by socket eaters */ + if (readcfgfile(cfg_cfgfile) < 0) { + Alert("Error reading configuration file : %s\n", cfg_cfgfile); + exit(1); + } + if (have_appsession) + appsession_init(); + + if (global.mode & MODE_CHECK) { + qfprintf(stdout, "Configuration file is valid : %s\n", cfg_cfgfile); + exit(0); + } + + if (cfg_maxconn > 0) + global.maxconn = cfg_maxconn; + + if (cfg_pidfile) { + if (global.pidfile) + free(global.pidfile); + global.pidfile = strdup(cfg_pidfile); + } + + if (global.maxconn == 0) + global.maxconn = DEFAULT_MAXCONN; + + global.maxsock += global.maxconn * 2; /* each connection needs two sockets */ + + if (arg_mode & (MODE_DEBUG | MODE_FOREGROUND)) { + /* command line debug mode inhibits configuration mode */ + global.mode &= ~(MODE_DAEMON | MODE_QUIET); + } + global.mode |= (arg_mode & (MODE_DAEMON | MODE_FOREGROUND | MODE_QUIET | + MODE_VERBOSE | MODE_DEBUG | MODE_STATS | MODE_LOG)); + + if ((global.mode & MODE_DEBUG) && (global.mode & (MODE_DAEMON | MODE_QUIET))) { + Warning(" mode incompatible with and . Keeping only.\n"); + global.mode &= ~(MODE_DAEMON | MODE_QUIET); + } + + if ((global.nbproc > 1) && !(global.mode & MODE_DAEMON)) { + if (!(global.mode & (MODE_FOREGROUND | MODE_DEBUG))) + Warning(" is only meaningful in daemon mode. Setting limit to 1 process.\n"); + global.nbproc = 1; + } + + if (global.nbproc < 1) + global.nbproc = 1; + + StaticReadEvent = (fd_set *)calloc(1, + sizeof(fd_set) * + (global.maxsock + FD_SETSIZE - 1) / FD_SETSIZE); + StaticWriteEvent = (fd_set *)calloc(1, + sizeof(fd_set) * + (global.maxsock + FD_SETSIZE - 1) / FD_SETSIZE); + + fdtab = (struct fdtab *)calloc(1, + sizeof(struct fdtab) * (global.maxsock)); + for (i = 0; i < global.maxsock; i++) { + fdtab[i].state = FD_STCLOSE; + } +} + +void deinit(void) +{ + struct proxy *p = proxy; + struct cap_hdr *h,*h_next; + struct server *s,*s_next; + struct listener *l,*l_next; + + while (p) { + if (p->id) + free(p->id); + + if (p->check_req) + free(p->check_req); + + if (p->cookie_name) + free(p->cookie_name); + + if (p->capture_name) + free(p->capture_name); + + /* only strup if the user have set in config. + When should we free it?! + if (p->errmsg.msg400) free(p->errmsg.msg400); + if (p->errmsg.msg403) free(p->errmsg.msg403); + if (p->errmsg.msg408) free(p->errmsg.msg408); + if (p->errmsg.msg500) free(p->errmsg.msg500); + if (p->errmsg.msg502) free(p->errmsg.msg502); + if (p->errmsg.msg503) free(p->errmsg.msg503); + if (p->errmsg.msg504) free(p->errmsg.msg504); + */ + if (p->appsession_name) + free(p->appsession_name); + + h = p->req_cap; + while (h) { + h_next = h->next; + if (h->name) + free(h->name); + pool_destroy(h->pool); + free(h); + h = h_next; + }/* end while(h) */ + + h = p->rsp_cap; + while (h) { + h_next = h->next; + if (h->name) + free(h->name); + + pool_destroy(h->pool); + free(h); + h = h_next; + }/* end while(h) */ + + s = p->srv; + while (s) { + s_next = s->next; + if (s->id) + free(s->id); + + if (s->cookie) + free(s->cookie); + + free(s); + s = s_next; + }/* end while(s) */ + + l = p->listen; + while (l) { + l_next = l->next; + free(l); + l = l_next; + }/* end while(l) */ + + pool_destroy((void **) p->req_cap_pool); + pool_destroy((void **) p->rsp_cap_pool); + p = p->next; + }/* end while(p) */ + + if (global.chroot) free(global.chroot); + if (global.pidfile) free(global.pidfile); + + if (StaticReadEvent) free(StaticReadEvent); + if (StaticWriteEvent) free(StaticWriteEvent); + if (fdtab) free(fdtab); + + pool_destroy(pool_session); + pool_destroy(pool_buffer); + pool_destroy(pool_requri); + pool_destroy(pool_task); + pool_destroy(pool_capture); + pool_destroy(pool_appsess); + + if (have_appsession) { + pool_destroy(apools.serverid); + pool_destroy(apools.sessid); + } +} /* end deinit() */ + +/* sends the signal to all pids found in */ +static void tell_old_pids(int sig) +{ + int p; + for (p = 0; p < nb_oldpids; p++) + kill(oldpids[p], sig); +} + +int main(int argc, char **argv) +{ + int err, retry; + struct rlimit limit; + FILE *pidfile = NULL; + init(argc, argv); + + signal(SIGQUIT, dump); + signal(SIGUSR1, sig_soft_stop); + signal(SIGHUP, sig_dump_state); +#ifdef DEBUG_MEMORY + signal(SIGINT, sig_int); + signal(SIGTERM, sig_term); +#endif + + /* on very high loads, a sigpipe sometimes happen just between the + * getsockopt() which tells "it's OK to write", and the following write :-( + */ +#ifndef MSG_NOSIGNAL + signal(SIGPIPE, SIG_IGN); +#endif + + /* We will loop at most 100 times with 10 ms delay each time. + * That's at most 1 second. We only send a signal to old pids + * if we cannot grab at least one port. + */ + retry = MAX_START_RETRIES; + err = ERR_NONE; + while (retry >= 0) { + struct timeval w; + err = start_proxies(retry == 0 || nb_oldpids == 0); + if (err != ERR_RETRYABLE) + break; + if (nb_oldpids == 0) + break; + + /* FIXME-20060514: Solaris and OpenBSD do not support shutdown() on + * listening sockets. So on those platforms, it would be wiser to + * simply send SIGUSR1, which will not be undoable. + */ + tell_old_pids(SIGTTOU); + /* give some time to old processes to stop listening */ + w.tv_sec = 0; + w.tv_usec = 10*1000; + select(0, NULL, NULL, NULL, &w); + retry--; + } + + /* Note: start_proxies() sends an alert when it fails. */ + if (err != ERR_NONE) { + if (retry != MAX_START_RETRIES && nb_oldpids) + tell_old_pids(SIGTTIN); + exit(1); + } + + if (listeners == 0) { + Alert("[%s.main()] No enabled listener found (check the keywords) ! Exiting.\n", argv[0]); + /* Note: we don't have to send anything to the old pids because we + * never stopped them. */ + exit(1); + } + + /* prepare pause/play signals */ + signal(SIGTTOU, sig_pause); + signal(SIGTTIN, sig_listen); + + if (global.mode & MODE_DAEMON) { + global.mode &= ~MODE_VERBOSE; + global.mode |= MODE_QUIET; + } + + /* MODE_QUIET can inhibit alerts and warnings below this line */ + + global.mode &= ~MODE_STARTING; + if ((global.mode & MODE_QUIET) && !(global.mode & MODE_VERBOSE)) { + /* detach from the tty */ + fclose(stdin); fclose(stdout); fclose(stderr); + close(0); close(1); close(2); + } + + /* open log & pid files before the chroot */ + if (global.mode & MODE_DAEMON && global.pidfile != NULL) { + int pidfd; + unlink(global.pidfile); + pidfd = open(global.pidfile, O_CREAT | O_WRONLY | O_TRUNC, 0644); + if (pidfd < 0) { + Alert("[%s.main()] Cannot create pidfile %s\n", argv[0], global.pidfile); + if (nb_oldpids) + tell_old_pids(SIGTTIN); + exit(1); + } + pidfile = fdopen(pidfd, "w"); + } + + /* chroot if needed */ + if (global.chroot != NULL) { + if (chroot(global.chroot) == -1) { + Alert("[%s.main()] Cannot chroot(%s).\n", argv[0], global.chroot); + if (nb_oldpids) + tell_old_pids(SIGTTIN); + } + chdir("/"); + } + + /* ulimits */ + if (!global.rlimit_nofile) + global.rlimit_nofile = global.maxsock; + + if (global.rlimit_nofile) { + limit.rlim_cur = limit.rlim_max = global.rlimit_nofile; + if (setrlimit(RLIMIT_NOFILE, &limit) == -1) { + Warning("[%s.main()] Cannot raise FD limit to %d.\n", argv[0], global.rlimit_nofile); + } + } + + if (global.rlimit_memmax) { + limit.rlim_cur = limit.rlim_max = + global.rlimit_memmax * 1048576 / global.nbproc; +#ifdef RLIMIT_AS + if (setrlimit(RLIMIT_AS, &limit) == -1) { + Warning("[%s.main()] Cannot fix MEM limit to %d megs.\n", + argv[0], global.rlimit_memmax); + } +#else + if (setrlimit(RLIMIT_DATA, &limit) == -1) { + Warning("[%s.main()] Cannot fix MEM limit to %d megs.\n", + argv[0], global.rlimit_memmax); + } +#endif + } + + if (nb_oldpids) + tell_old_pids(oldpids_sig); + + /* Note that any error at this stage will be fatal because we will not + * be able to restart the old pids. + */ + + /* setgid / setuid */ + if (global.gid && setgid(global.gid) == -1) { + Alert("[%s.main()] Cannot set gid %d.\n", argv[0], global.gid); + exit(1); + } + + if (global.uid && setuid(global.uid) == -1) { + Alert("[%s.main()] Cannot set uid %d.\n", argv[0], global.uid); + exit(1); + } + + /* check ulimits */ + limit.rlim_cur = limit.rlim_max = 0; + getrlimit(RLIMIT_NOFILE, &limit); + if (limit.rlim_cur < global.maxsock) { + Warning("[%s.main()] FD limit (%d) too low for maxconn=%d/maxsock=%d. Please raise 'ulimit-n' to %d or more to avoid any trouble.\n", + argv[0], limit.rlim_cur, global.maxconn, global.maxsock, global.maxsock); + } + + if (global.mode & MODE_DAEMON) { + int ret = 0; + int proc; + + /* the father launches the required number of processes */ + for (proc = 0; proc < global.nbproc; proc++) { + ret = fork(); + if (ret < 0) { + Alert("[%s.main()] Cannot fork.\n", argv[0]); + if (nb_oldpids) + exit(1); /* there has been an error */ + } + else if (ret == 0) /* child breaks here */ + break; + if (pidfile != NULL) { + fprintf(pidfile, "%d\n", ret); + fflush(pidfile); + } + } + /* close the pidfile both in children and father */ + if (pidfile != NULL) + fclose(pidfile); + free(global.pidfile); + + if (proc == global.nbproc) + exit(0); /* parent must leave */ + + /* if we're NOT in QUIET mode, we should now close the 3 first FDs to ensure + * that we can detach from the TTY. We MUST NOT do it in other cases since + * it would have already be done, and 0-2 would have been affected to listening + * sockets + */ + if (!(global.mode & MODE_QUIET)) { + /* detach from the tty */ + fclose(stdin); fclose(stdout); fclose(stderr); + close(0); close(1); close(2); /* close all fd's */ + global.mode |= MODE_QUIET; /* ensure that we won't say anything from now */ + } + pid = getpid(); /* update child's pid */ + setsid(); + } + +#if defined(ENABLE_EPOLL) + if (cfg_polling_mechanism & POLL_USE_EPOLL) { + if (epoll_loop(POLL_LOOP_ACTION_INIT)) { + epoll_loop(POLL_LOOP_ACTION_RUN); + epoll_loop(POLL_LOOP_ACTION_CLEAN); + cfg_polling_mechanism &= POLL_USE_EPOLL; + } + else { + Warning("epoll() is not available. Using poll()/select() instead.\n"); + cfg_polling_mechanism &= ~POLL_USE_EPOLL; + } + } +#endif + +#if defined(ENABLE_POLL) + if (cfg_polling_mechanism & POLL_USE_POLL) { + if (poll_loop(POLL_LOOP_ACTION_INIT)) { + poll_loop(POLL_LOOP_ACTION_RUN); + poll_loop(POLL_LOOP_ACTION_CLEAN); + cfg_polling_mechanism &= POLL_USE_POLL; + } + else { + Warning("poll() is not available. Using select() instead.\n"); + cfg_polling_mechanism &= ~POLL_USE_POLL; + } + } +#endif + if (cfg_polling_mechanism & POLL_USE_SELECT) { + if (select_loop(POLL_LOOP_ACTION_INIT)) { + select_loop(POLL_LOOP_ACTION_RUN); + select_loop(POLL_LOOP_ACTION_CLEAN); + cfg_polling_mechanism &= POLL_USE_SELECT; + } + } + + + /* Free all Hash Keys and all Hash elements */ + appsession_cleanup(); + /* Do some cleanup */ + deinit(); + + exit(0); +} + + +/* + * Local variables: + * c-indent-level: 8 + * c-basic-offset: 8 + * End: + */ diff --git a/src/hashpjw.c b/src/hashpjw.c index a207eb91d..78c0a5be7 100644 --- a/src/hashpjw.c +++ b/src/hashpjw.c @@ -16,7 +16,8 @@ * * *****************************************************************************/ -#include +#include +#include /***************************************************************************** * * @@ -26,37 +27,44 @@ int hashpjw(const void *key) { - const char *ptr; - unsigned int val; - appsess *appsession_temp; + const char *ptr; + unsigned int val; + appsess *appsession_temp; - /***************************************************************************** - * * - * Hash the key by performing a number of bit operations on it. * - * * - *****************************************************************************/ + /********************************************************************* + * * + * Hash the key by performing a number of bit operations on it. * + * * + *********************************************************************/ - val = 0; - appsession_temp = (appsess *)key; - ptr = appsession_temp->sessid; + val = 0; + appsession_temp = (appsess *)key; + ptr = appsession_temp->sessid; - while (*ptr != '\0') { + while (*ptr != '\0') { - int tmp; + int tmp; - val = (val << 4) + (*ptr); + val = (val << 4) + (*ptr); - if((tmp = (val & 0xf0000000))) { - val = val ^ (tmp >> 24); - val = val ^ tmp; - } - ptr++; - }/* end while */ + if((tmp = (val & 0xf0000000))) { + val = val ^ (tmp >> 24); + val = val ^ tmp; + } + ptr++; + }/* end while */ - /***************************************************************************** - * * - * In practice, replace PRIME_TBLSIZ with the actual table size. * - * * - *****************************************************************************/ - return val % PRIME_TBLSIZ; + /********************************************************************* + * * + * In practice, replace PRIME_TBLSIZ with the actual table size. * + * * + *********************************************************************/ + return val % PRIME_TBLSIZ; }/* end hashpjw */ + +/* + * Local variables: + * c-indent-level: 8 + * c-basic-offset: 8 + * End: + */ diff --git a/src/list.c b/src/list.c index 364ed141f..0eaf6ce32 100644 --- a/src/list.c +++ b/src/list.c @@ -18,7 +18,7 @@ #include #include -#include +#include /***************************************************************************** * * @@ -28,17 +28,17 @@ void list_init(List *list, void (*destroy)(void *data)) { - /***************************************************************************** - * * - * Initialize the list. * - * * - *****************************************************************************/ + /********************************************************************* + * * + * Initialize the list. * + * * + *********************************************************************/ - list->size = 0; - list->destroy = destroy; - list->head = NULL; - list->tail = NULL; - return; + list->size = 0; + list->destroy = destroy; + list->head = NULL; + list->tail = NULL; + return; } /* end list_init() */ /***************************************************************************** @@ -49,39 +49,39 @@ void list_init(List *list, void (*destroy)(void *data)) { void list_destroy(List *list) { - void *data; - int rc; + void *data; + int rc; - /***************************************************************************** - * * - * Remove each element. * - * * - *****************************************************************************/ + /********************************************************************* + * * + * Remove each element. * + * * + *********************************************************************/ - while (list_size(list) > 0) { + while (list_size(list) > 0) { - rc = list_rem_next(list, NULL, (void **)&data); + rc = list_rem_next(list, NULL, (void **)&data); - if (( rc == 0) && (list->destroy != NULL)) { + if (( rc == 0) && (list->destroy != NULL)) { - /*********************************************************************** - * * - * Call a user-defined function to free dynamically allocated data. * - * * - ***********************************************************************/ + /******************************************************************* + * * + * Call a user-defined function to free dynamically allocated data.* + * * + *******************************************************************/ - list->destroy(data); - }/* end if() */ - }/* end while() */ + list->destroy(data); + }/* end if() */ + }/* end while() */ - /***************************************************************************** - * * - * No operations are allowed now, but clear the structure as a precaution. * - * * - *****************************************************************************/ + /************************************************************************** + * * + * No operations are allowed now, but clear the structure as a precaution.* + * * + **************************************************************************/ - memset(list, 0, sizeof(List)); - return; + memset(list, 0, sizeof(List)); + return; } /* void list_destroy(List *list) */ /***************************************************************************** @@ -92,62 +92,62 @@ void list_destroy(List *list) { int list_ins_next(List *list, ListElmt *element, const void *data) { - ListElmt *new_element; + ListElmt *new_element; - /***************************************************************************** - * * - * Allocate storage for the element. * - * * - *****************************************************************************/ + /********************************************************************* + * * + * Allocate storage for the element. * + * * + *********************************************************************/ - if ((new_element = (ListElmt *)malloc(sizeof(ListElmt))) == NULL) - return -1; + if ((new_element = (ListElmt *)malloc(sizeof(ListElmt))) == NULL) + return -1; - /***************************************************************************** - * * - * Insert the element into the list. * - * * - *****************************************************************************/ + /********************************************************************* + * * + * Insert the element into the list. * + * * + *********************************************************************/ - new_element->data = (void *)data; + new_element->data = (void *)data; - if (element == NULL) { + if (element == NULL) { - /************************************************************************** - * * - * Handle insertion at the head of the list. * - * * - **************************************************************************/ + /************************************************************* + * * + * Handle insertion at the head of the list. * + * * + *************************************************************/ - if (list_size(list) == 0) - list->tail = new_element; + if (list_size(list) == 0) + list->tail = new_element; - new_element->next = list->head; - list->head = new_element; - }/* end if (element == NULL) */ - else { + new_element->next = list->head; + list->head = new_element; + }/* end if (element == NULL) */ + else { - /************************************************************************** - * * - * Handle insertion somewhere other than at the head. * - * * - **************************************************************************/ + /************************************************************* + * * + * Handle insertion somewhere other than at the head. * + * * + *************************************************************/ - if (element->next == NULL) - list->tail = new_element; + if (element->next == NULL) + list->tail = new_element; - new_element->next = element->next; - element->next = new_element; - }/* end else */ + new_element->next = element->next; + element->next = new_element; + }/* end else */ - /***************************************************************************** - * * - * Adjust the size of the list to account for the inserted element. * - * * - *****************************************************************************/ + /********************************************************************* + * * + * Adjust the size of the list to account for the inserted element. * + * * + *********************************************************************/ - list->size++; - return 0; + list->size++; + return 0; } /* end list_ins_next() */ /***************************************************************************** @@ -158,71 +158,78 @@ int list_ins_next(List *list, ListElmt *element, const void *data) { int list_rem_next(List *list, ListElmt *element, void **data) { - ListElmt *old_element; + ListElmt *old_element; - /***************************************************************************** - * * - * Do not allow removal from an empty list. * - * * - *****************************************************************************/ + /********************************************************************* + * * + * Do not allow removal from an empty list. * + * * + *********************************************************************/ - if (list_size(list) == 0) - return -1; + if (list_size(list) == 0) + return -1; - /***************************************************************************** - * * - * Remove the element from the list. * - * * - *****************************************************************************/ + /********************************************************************* + * * + * Remove the element from the list. * + * * + *********************************************************************/ - if (element == NULL) { + if (element == NULL) { - /************************************************************************** - * * - * Handle removal from the head of the list. * - * * - **************************************************************************/ + /************************************************************* + * * + * Handle removal from the head of the list. * + * * + *************************************************************/ - *data = list->head->data; - old_element = list->head; - list->head = list->head->next; + *data = list->head->data; + old_element = list->head; + list->head = list->head->next; - if (list_size(list) == 1) - list->tail = NULL; - }/* end if (element == NULL) */ - else { + if (list_size(list) == 1) + list->tail = NULL; + }/* end if (element == NULL) */ + else { - /************************************************************************** - * * - * Handle removal from somewhere other than the head. * - * * - **************************************************************************/ + /************************************************************* + * * + * Handle removal from somewhere other than the head. * + * * + *************************************************************/ - if (element->next == NULL) - return -1; + if (element->next == NULL) + return -1; - *data = element->next->data; - old_element = element->next; - element->next = element->next->next; + *data = element->next->data; + old_element = element->next; + element->next = element->next->next; - if (element->next == NULL) - list->tail = element; - }/* end else */ + if (element->next == NULL) + list->tail = element; + }/* end else */ - /***************************************************************************** - * * - * Free the storage allocated by the abstract data type. * - * * - *****************************************************************************/ + /********************************************************************* + * * + * Free the storage allocated by the abstract data type. * + * * + *********************************************************************/ - free(old_element); + free(old_element); - /***************************************************************************** - * * - * Adjust the size of the list to account for the removed element. * - * * - *****************************************************************************/ + /********************************************************************* + * * + * Adjust the size of the list to account for the removed element. * + * * + *********************************************************************/ - list->size--; - return 0; + list->size--; + return 0; } + +/* + * Local variables: + * c-indent-level: 8 + * c-basic-offset: 8 + * End: + */ diff --git a/src/log.c b/src/log.c new file mode 100644 index 000000000..d311ac888 --- /dev/null +++ b/src/log.c @@ -0,0 +1,459 @@ +/* + * General logging functions. + * + * Copyright 2000-2006 Willy Tarreau + * + * This program is free software; you can redistribute it and/or + * modify it under the terms of the GNU General Public License + * as published by the Free Software Foundation; either version + * 2 of the License, or (at your option) any later version. + * + */ + +#include +#include +#include +#include +#include +#include +#include + +#include + +#include + +#include +#include +#include +#include +#include +#include + + +const char *log_facilities[NB_LOG_FACILITIES] = { + "kern", "user", "mail", "daemon", + "auth", "syslog", "lpr", "news", + "uucp", "cron", "auth2", "ftp", + "ntp", "audit", "alert", "cron2", + "local0", "local1", "local2", "local3", + "local4", "local5", "local6", "local7" +}; + + +const char *log_levels[NB_LOG_LEVELS] = { + "emerg", "alert", "crit", "err", + "warning", "notice", "info", "debug" +}; + +const char *monthname[12] = { + "Jan", "Feb", "Mar", "Apr", "May", "Jun", + "Jul", "Aug", "Sep", "Oct", "Nov", "Dec" +}; + +const char sess_term_cond[8] = "-cCsSPRI"; /* normal, CliTo, CliErr, SrvTo, SrvErr, PxErr, Resource, Internal */ +const char sess_fin_state[8] = "-RCHDLQ7"; /* cliRequest, srvConnect, srvHeader, Data, Last, Queue, unknown */ +const char sess_cookie[4] = "NIDV"; /* No cookie, Invalid cookie, cookie for a Down server, Valid cookie */ +const char sess_set_cookie[8] = "N1I3PD5R"; /* No set-cookie, unknown, Set-Cookie Inserted, unknown, + Set-cookie seen and left unchanged (passive), Set-cookie Deleted, + unknown, Set-cookie Rewritten */ +void **pool_requri = NULL; + + +/* + * Displays the message on stderr with the date and pid. Overrides the quiet + * mode during startup. + */ +void Alert(char *fmt, ...) +{ + va_list argp; + struct timeval tv; + struct tm *tm; + + if (!(global.mode & MODE_QUIET) || (global.mode & (MODE_VERBOSE | MODE_STARTING))) { + va_start(argp, fmt); + + gettimeofday(&tv, NULL); + tm = localtime(&tv.tv_sec); + fprintf(stderr, "[ALERT] %03d/%02d%02d%02d (%d) : ", + tm->tm_yday, tm->tm_hour, tm->tm_min, tm->tm_sec, (int)getpid()); + vfprintf(stderr, fmt, argp); + fflush(stderr); + va_end(argp); + } +} + + +/* + * Displays the message on stderr with the date and pid. + */ +void Warning(char *fmt, ...) +{ + va_list argp; + struct timeval tv; + struct tm *tm; + + if (!(global.mode & MODE_QUIET) || (global.mode & MODE_VERBOSE)) { + va_start(argp, fmt); + + gettimeofday(&tv, NULL); + tm = localtime(&tv.tv_sec); + fprintf(stderr, "[WARNING] %03d/%02d%02d%02d (%d) : ", + tm->tm_yday, tm->tm_hour, tm->tm_min, tm->tm_sec, (int)getpid()); + vfprintf(stderr, fmt, argp); + fflush(stderr); + va_end(argp); + } +} + +/* + * Displays the message on only if quiet mode is not set. + */ +void qfprintf(FILE *out, char *fmt, ...) +{ + va_list argp; + + if (!(global.mode & MODE_QUIET) || (global.mode & MODE_VERBOSE)) { + va_start(argp, fmt); + vfprintf(out, fmt, argp); + fflush(out); + va_end(argp); + } +} + +/* + * returns log level for or -1 if not found. + */ +int get_log_level(const char *lev) +{ + int level; + + level = NB_LOG_LEVELS - 1; + while (level >= 0 && strcmp(log_levels[level], lev)) + level--; + + return level; +} + + +/* + * returns log facility for or -1 if not found. + */ +int get_log_facility(const char *fac) +{ + int facility; + + facility = NB_LOG_FACILITIES - 1; + while (facility >= 0 && strcmp(log_facilities[facility], fac)) + facility--; + + return facility; +} + + +#define FD_SETS_ARE_BITFIELDS +#ifdef FD_SETS_ARE_BITFIELDS +/* + * This map is used with all the FD_* macros to check whether a particular bit + * is set or not. Each bit represents an ACSII code. FD_SET() sets those bytes + * which should be encoded. When FD_ISSET() returns non-zero, it means that the + * byte should be encoded. Be careful to always pass bytes from 0 to 255 + * exclusively to the macros. + */ +fd_set hdr_encode_map[(sizeof(fd_set) > (256/8)) ? 1 : ((256/8) / sizeof(fd_set))]; +fd_set url_encode_map[(sizeof(fd_set) > (256/8)) ? 1 : ((256/8) / sizeof(fd_set))]; + +#else +#error "Check if your OS uses bitfields for fd_sets" +#endif + +/* + * This function sends a syslog message to both log servers of a proxy, + * or to global log servers if the proxy is NULL. + * It also tries not to waste too much time computing the message header. + * It doesn't care about errors nor does it report them. + */ +void send_log(struct proxy *p, int level, char *message, ...) +{ + static int logfd = -1; /* syslog UDP socket */ + static long tvsec = -1; /* to force the string to be initialized */ + struct timeval tv; + va_list argp; + static char logmsg[MAX_SYSLOG_LEN]; + static char *dataptr = NULL; + int fac_level; + int hdr_len, data_len; + struct sockaddr_in *sa[2]; + int facilities[2], loglevel[2]; + int nbloggers = 0; + char *log_ptr; + + if (logfd < 0) { + if ((logfd = socket(AF_INET, SOCK_DGRAM, IPPROTO_UDP)) < 0) + return; + } + + if (level < 0 || progname == NULL || message == NULL) + return; + + gettimeofday(&tv, NULL); + if (tv.tv_sec != tvsec || dataptr == NULL) { + /* this string is rebuild only once a second */ + struct tm *tm = localtime(&tv.tv_sec); + tvsec = tv.tv_sec; + + hdr_len = snprintf(logmsg, sizeof(logmsg), + "<<<<>%s %2d %02d:%02d:%02d %s[%d]: ", + monthname[tm->tm_mon], + tm->tm_mday, tm->tm_hour, tm->tm_min, tm->tm_sec, + progname, pid); + /* WARNING: depending upon implementations, snprintf may return + * either -1 or the number of bytes that would be needed to store + * the total message. In both cases, we must adjust it. + */ + if (hdr_len < 0 || hdr_len > sizeof(logmsg)) + hdr_len = sizeof(logmsg); + + dataptr = logmsg + hdr_len; + } + + va_start(argp, message); + data_len = vsnprintf(dataptr, logmsg + sizeof(logmsg) - dataptr, message, argp); + if (data_len < 0 || data_len > (logmsg + sizeof(logmsg) - dataptr)) + data_len = logmsg + sizeof(logmsg) - dataptr; + va_end(argp); + dataptr[data_len - 1] = '\n'; /* force a break on ultra-long lines */ + + if (p == NULL) { + if (global.logfac1 >= 0) { + sa[nbloggers] = &global.logsrv1; + facilities[nbloggers] = global.logfac1; + loglevel[nbloggers] = global.loglev1; + nbloggers++; + } + if (global.logfac2 >= 0) { + sa[nbloggers] = &global.logsrv2; + facilities[nbloggers] = global.logfac2; + loglevel[nbloggers] = global.loglev2; + nbloggers++; + } + } else { + if (p->logfac1 >= 0) { + sa[nbloggers] = &p->logsrv1; + facilities[nbloggers] = p->logfac1; + loglevel[nbloggers] = p->loglev1; + nbloggers++; + } + if (p->logfac2 >= 0) { + sa[nbloggers] = &p->logsrv2; + facilities[nbloggers] = p->logfac2; + loglevel[nbloggers] = p->loglev2; + nbloggers++; + } + } + + while (nbloggers-- > 0) { + /* we can filter the level of the messages that are sent to each logger */ + if (level > loglevel[nbloggers]) + continue; + + /* For each target, we may have a different facility. + * We can also have a different log level for each message. + * This induces variations in the message header length. + * Since we don't want to recompute it each time, nor copy it every + * time, we only change the facility in the pre-computed header, + * and we change the pointer to the header accordingly. + */ + fac_level = (facilities[nbloggers] << 3) + level; + log_ptr = logmsg + 3; /* last digit of the log level */ + do { + *log_ptr = '0' + fac_level % 10; + fac_level /= 10; + log_ptr--; + } while (fac_level && log_ptr > logmsg); + *log_ptr = '<'; + + /* the total syslog message now starts at logptr, for dataptr+data_len-logptr */ + +#ifndef MSG_NOSIGNAL + sendto(logfd, log_ptr, dataptr + data_len - log_ptr, MSG_DONTWAIT, + (struct sockaddr *)sa[nbloggers], sizeof(**sa)); +#else + sendto(logfd, log_ptr, dataptr + data_len - log_ptr, MSG_DONTWAIT | MSG_NOSIGNAL, + (struct sockaddr *)sa[nbloggers], sizeof(**sa)); +#endif + } +} + + +/* + * send a log for the session when we have enough info about it + */ +void sess_log(struct session *s) +{ + char pn[INET6_ADDRSTRLEN + strlen(":65535")]; + struct proxy *p = s->proxy; + int log; + char *uri; + char *pxid; + char *srv; + struct tm *tm; + + /* This is a first attempt at a better logging system. + * For now, we rely on send_log() to provide the date, although it obviously + * is the date of the log and not of the request, and most fields are not + * computed. + */ + + log = p->to_log & ~s->logs.logwait; + + if (s->cli_addr.ss_family == AF_INET) + inet_ntop(AF_INET, + (const void *)&((struct sockaddr_in *)&s->cli_addr)->sin_addr, + pn, sizeof(pn)); + else + inet_ntop(AF_INET6, + (const void *)&((struct sockaddr_in6 *)(&s->cli_addr))->sin6_addr, + pn, sizeof(pn)); + + uri = (log & LW_REQ) ? s->logs.uri ? s->logs.uri : "" : ""; + pxid = p->id; + srv = (p->to_log & LW_SVID) ? + (s->data_source != DATA_SRC_STATS) ? + (s->srv != NULL) ? s->srv->id : "" : "" : "-"; + + tm = localtime(&s->logs.tv_accept.tv_sec); + if (p->to_log & LW_REQ) { + char tmpline[MAX_SYSLOG_LEN], *h; + int hdr; + + h = tmpline; + if (p->to_log & LW_REQHDR && (h < tmpline + sizeof(tmpline) - 10)) { + *(h++) = ' '; + *(h++) = '{'; + for (hdr = 0; hdr < p->nb_req_cap; hdr++) { + if (hdr) + *(h++) = '|'; + if (s->req_cap[hdr] != NULL) + h = encode_string(h, tmpline + sizeof(tmpline) - 7, + '#', hdr_encode_map, s->req_cap[hdr]); + } + *(h++) = '}'; + } + + if (p->to_log & LW_RSPHDR && (h < tmpline + sizeof(tmpline) - 7)) { + *(h++) = ' '; + *(h++) = '{'; + for (hdr = 0; hdr < p->nb_rsp_cap; hdr++) { + if (hdr) + *(h++) = '|'; + if (s->rsp_cap[hdr] != NULL) + h = encode_string(h, tmpline + sizeof(tmpline) - 4, + '#', hdr_encode_map, s->rsp_cap[hdr]); + } + *(h++) = '}'; + } + + if (h < tmpline + sizeof(tmpline) - 4) { + *(h++) = ' '; + *(h++) = '"'; + h = encode_string(h, tmpline + sizeof(tmpline) - 1, + '#', url_encode_map, uri); + *(h++) = '"'; + } + *h = '\0'; + + send_log(p, LOG_INFO, + "%s:%d [%02d/%s/%04d:%02d:%02d:%02d]" + " %s %s %d/%d/%d/%d/%s%d %d %s%lld" + " %s %s %c%c%c%c %d/%d/%d %d/%d%s\n", + pn, + (s->cli_addr.ss_family == AF_INET) ? + ntohs(((struct sockaddr_in *)&s->cli_addr)->sin_port) : + ntohs(((struct sockaddr_in6 *)&s->cli_addr)->sin6_port), + tm->tm_mday, monthname[tm->tm_mon], tm->tm_year+1900, + tm->tm_hour, tm->tm_min, tm->tm_sec, + pxid, srv, + s->logs.t_request, + (s->logs.t_queue >= 0) ? s->logs.t_queue - s->logs.t_request : -1, + (s->logs.t_connect >= 0) ? s->logs.t_connect - s->logs.t_queue : -1, + (s->logs.t_data >= 0) ? s->logs.t_data - s->logs.t_connect : -1, + (p->to_log & LW_BYTES) ? "" : "+", s->logs.t_close, + s->logs.status, + (p->to_log & LW_BYTES) ? "" : "+", s->logs.bytes, + s->logs.cli_cookie ? s->logs.cli_cookie : "-", + s->logs.srv_cookie ? s->logs.srv_cookie : "-", + sess_term_cond[(s->flags & SN_ERR_MASK) >> SN_ERR_SHIFT], + sess_fin_state[(s->flags & SN_FINST_MASK) >> SN_FINST_SHIFT], + (p->options & PR_O_COOK_ANY) ? sess_cookie[(s->flags & SN_CK_MASK) >> SN_CK_SHIFT] : '-', + (p->options & PR_O_COOK_ANY) ? sess_set_cookie[(s->flags & SN_SCK_MASK) >> SN_SCK_SHIFT] : '-', + s->srv ? s->srv->cur_sess : 0, p->nbconn, actconn, + s->logs.srv_queue_size, s->logs.prx_queue_size, tmpline); + } + else { + send_log(p, LOG_INFO, "%s:%d [%02d/%s/%04d:%02d:%02d:%02d]" + " %s %s %d/%d/%s%d %s%lld" + " %c%c %d/%d/%d %d/%d\n", + pn, + (s->cli_addr.ss_family == AF_INET) ? + ntohs(((struct sockaddr_in *)&s->cli_addr)->sin_port) : + ntohs(((struct sockaddr_in6 *)&s->cli_addr)->sin6_port), + tm->tm_mday, monthname[tm->tm_mon], tm->tm_year+1900, + tm->tm_hour, tm->tm_min, tm->tm_sec, + pxid, srv, + (s->logs.t_queue >= 0) ? s->logs.t_queue : -1, + (s->logs.t_connect >= 0) ? s->logs.t_connect - s->logs.t_queue : -1, + (p->to_log & LW_BYTES) ? "" : "+", s->logs.t_close, + (p->to_log & LW_BYTES) ? "" : "+", s->logs.bytes, + sess_term_cond[(s->flags & SN_ERR_MASK) >> SN_ERR_SHIFT], + sess_fin_state[(s->flags & SN_FINST_MASK) >> SN_FINST_SHIFT], + s->srv ? s->srv->cur_sess : 0, p->nbconn, actconn, + s->logs.srv_queue_size, s->logs.prx_queue_size); + } + + s->logs.logwait = 0; +} + + +/* + * Initializes some data needed later. + */ +void init_log() +{ + int i; + char *tmp; + + /* initialize the log header encoding map : '{|}"#' should be encoded with + * '#' as prefix, as well as non-printable characters ( <32 or >= 127 ). + * URL encoding only requires '"', '#' to be encoded as well as non- + * printable characters above. + */ + memset(hdr_encode_map, 0, sizeof(hdr_encode_map)); + memset(url_encode_map, 0, sizeof(url_encode_map)); + for (i = 0; i < 32; i++) { + FD_SET(i, hdr_encode_map); + FD_SET(i, url_encode_map); + } + for (i = 127; i < 256; i++) { + FD_SET(i, hdr_encode_map); + FD_SET(i, url_encode_map); + } + + tmp = "\"#{|}"; + while (*tmp) { + FD_SET(*tmp, hdr_encode_map); + tmp++; + } + + tmp = "\"#"; + while (*tmp) { + FD_SET(*tmp, url_encode_map); + tmp++; + } +} + +/* + * Local variables: + * c-indent-level: 8 + * c-basic-offset: 8 + * End: + */ diff --git a/src/polling.c b/src/polling.c new file mode 100644 index 000000000..af0129050 --- /dev/null +++ b/src/polling.c @@ -0,0 +1,455 @@ +/* + * File descriptors management functions. + * + * Copyright 2000-2006 Willy Tarreau + * + * This program is free software; you can redistribute it and/or + * modify it under the terms of the GNU General Public License + * as published by the Free Software Foundation; either version + * 2 of the License, or (at your option) any later version. + * + */ + +#include +#include +#include + +#include +#include +#include + +#include +#include +#include + +#include + +fd_set *StaticReadEvent, *StaticWriteEvent; +int cfg_polling_mechanism = 0; /* POLL_USE_{SELECT|POLL|EPOLL} */ + +/* + * FIXME: this is dirty, but at the moment, there's no other solution to remove + * the old FDs from outside the loop. Perhaps we should export a global 'poll' + * structure with pointers to functions such as init_fd() and close_fd(), plus + * a private structure with several pointers to places such as below. + */ + +#if defined(ENABLE_EPOLL) +fd_set *PrevReadEvent = NULL, *PrevWriteEvent = NULL; + +#if defined(USE_MY_EPOLL) +_syscall1 (int, epoll_create, int, size); +_syscall4 (int, epoll_ctl, int, epfd, int, op, int, fd, struct epoll_event *, event); +_syscall4 (int, epoll_wait, int, epfd, struct epoll_event *, events, int, maxevents, int, timeout); +#endif + +#endif + + +#if defined(ENABLE_EPOLL) +/* + * Main epoll() loop. + * does 3 actions : + * 0 (POLL_LOOP_ACTION_INIT) : initializes necessary private structures + * 1 (POLL_LOOP_ACTION_RUN) : runs the loop + * 2 (POLL_LOOP_ACTION_CLEAN) : cleans up + * + * returns 0 if initialization failed, !0 otherwise. + */ + +int epoll_loop(int action) +{ + int next_time; + int status; + int fd; + + int fds, count; + int pr, pw, sr, sw; + unsigned rn, ro, wn, wo; /* read new, read old, write new, write old */ + struct epoll_event ev; + + /* private data */ + static struct epoll_event *epoll_events = NULL; + static int epoll_fd; + + if (action == POLL_LOOP_ACTION_INIT) { + epoll_fd = epoll_create(global.maxsock + 1); + if (epoll_fd < 0) + return 0; + else { + epoll_events = (struct epoll_event*) + calloc(1, sizeof(struct epoll_event) * global.maxsock); + PrevReadEvent = (fd_set *) + calloc(1, sizeof(fd_set) * (global.maxsock + FD_SETSIZE - 1) / FD_SETSIZE); + PrevWriteEvent = (fd_set *) + calloc(1, sizeof(fd_set) * (global.maxsock + FD_SETSIZE - 1) / FD_SETSIZE); + } + return 1; + } + else if (action == POLL_LOOP_ACTION_CLEAN) { + if (PrevWriteEvent) free(PrevWriteEvent); + if (PrevReadEvent) free(PrevReadEvent); + if (epoll_events) free(epoll_events); + close(epoll_fd); + epoll_fd = 0; + return 1; + } + + /* OK, it's POLL_LOOP_ACTION_RUN */ + + tv_now(&now); + + while (1) { + next_time = process_runnable_tasks(); + + /* stop when there's no connection left and we don't allow them anymore */ + if (!actconn && listeners == 0) + break; + + for (fds = 0; (fds << INTBITS) < maxfd; fds++) { + + rn = ((int*)StaticReadEvent)[fds]; ro = ((int*)PrevReadEvent)[fds]; + wn = ((int*)StaticWriteEvent)[fds]; wo = ((int*)PrevWriteEvent)[fds]; + + if ((ro^rn) | (wo^wn)) { + for (count = 0, fd = fds << INTBITS; count < (1<> count) & 1; + pw = (wo >> count) & 1; + sr = (rn >> count) & 1; + sw = (wn >> count) & 1; +#else + pr = FD_ISSET(fd&((1<> count) & 1; + sw = (wn >> count) & 1; +#else + sr = FD_ISSET(fd&((1< 0 && count < nbfd; count++) { + fd = poll_events[count].fd; + + if (!(poll_events[count].revents & ( POLLOUT | POLLIN | POLLERR | POLLHUP ))) + continue; + + /* ok, we found one active fd */ + status--; + + if (FD_ISSET(fd, StaticReadEvent)) { + if (fdtab[fd].state == FD_STCLOSE) + continue; + if (poll_events[count].revents & ( POLLIN | POLLERR | POLLHUP )) + fdtab[fd].read(fd); + } + + if (FD_ISSET(fd, StaticWriteEvent)) { + if (fdtab[fd].state == FD_STCLOSE) + continue; + if (poll_events[count].revents & ( POLLOUT | POLLERR | POLLHUP )) + fdtab[fd].write(fd); + } + } + } + return 1; +} +#endif + + + +/* + * Main select() loop. + * does 3 actions : + * 0 (POLL_LOOP_ACTION_INIT) : initializes necessary private structures + * 1 (POLL_LOOP_ACTION_RUN) : runs the loop + * 2 (POLL_LOOP_ACTION_CLEAN) : cleans up + * + * returns 0 if initialization failed, !0 otherwise. + */ + + +int select_loop(int action) +{ + int next_time; + int status; + int fd,i; + struct timeval delta; + int readnotnull, writenotnull; + static fd_set *ReadEvent = NULL, *WriteEvent = NULL; + + if (action == POLL_LOOP_ACTION_INIT) { + ReadEvent = (fd_set *) + calloc(1, sizeof(fd_set) * (global.maxsock + FD_SETSIZE - 1) / FD_SETSIZE); + WriteEvent = (fd_set *) + calloc(1, sizeof(fd_set) * (global.maxsock + FD_SETSIZE - 1) / FD_SETSIZE); + return 1; + } + else if (action == POLL_LOOP_ACTION_CLEAN) { + if (WriteEvent) free(WriteEvent); + if (ReadEvent) free(ReadEvent); + return 1; + } + + /* OK, it's POLL_LOOP_ACTION_RUN */ + + tv_now(&now); + + while (1) { + next_time = process_runnable_tasks(); + + /* stop when there's no connection left and we don't allow them anymore */ + if (!actconn && listeners == 0) + break; + + if (next_time > 0) { /* FIXME */ + /* Convert to timeval */ + /* to avoid eventual select loops due to timer precision */ + next_time += SCHEDULER_RESOLUTION; + delta.tv_sec = next_time / 1000; + delta.tv_usec = (next_time % 1000) * 1000; + } + else if (next_time == 0) { /* allow select to return immediately when needed */ + delta.tv_sec = delta.tv_usec = 0; + } + + + /* let's restore fdset state */ + + readnotnull = 0; writenotnull = 0; + for (i = 0; i < (maxfd + FD_SETSIZE - 1)/(8*sizeof(int)); i++) { + readnotnull |= (*(((int*)ReadEvent)+i) = *(((int*)StaticReadEvent)+i)) != 0; + writenotnull |= (*(((int*)WriteEvent)+i) = *(((int*)StaticWriteEvent)+i)) != 0; + } + + // /* just a verification code, needs to be removed for performance */ + // for (i=0; i= 0) ? &delta : NULL); + + /* this is an experiment on the separation of the select work */ + // status = (readnotnull ? select(maxfd, ReadEvent, NULL, NULL, (next_time >= 0) ? &delta : NULL) : 0); + // status |= (writenotnull ? select(maxfd, NULL, WriteEvent, NULL, (next_time >= 0) ? &delta : NULL) : 0); + + tv_now(&now); + + if (status > 0) { /* must proceed with events */ + + int fds; + char count; + + for (fds = 0; (fds << INTBITS) < maxfd; fds++) + if ((((int *)(ReadEvent))[fds] | ((int *)(WriteEvent))[fds]) != 0) + for (count = 1< + * + * This program is free software; you can redistribute it and/or + * modify it under the terms of the GNU General Public License + * as published by the Free Software Foundation; either version + * 2 of the License, or (at your option) any later version. + * + */ + +#include +#include +#include +#include +#include +#include +#include + +#include +#include +#include + +#include +#include +#include +#include +#include +#include +#include +#include +#include + +#include +#include +#include +#include +#include +#include +#include + +#include +#include +#include +#include +#include +#include +#include +#include + + +/* Warning: this one is an sprintf() fmt string, with as its only argument */ +const char *HTTP_401_fmt = + "HTTP/1.0 401 Unauthorized\r\n" + "Cache-Control: no-cache\r\n" + "Connection: close\r\n" + "WWW-Authenticate: Basic realm=\"%s\"\r\n" + "\r\n" + "

401 Unauthorized

\nYou need a valid user and password to access this content.\n\n"; + + +#ifdef DEBUG_FULL +static char *cli_stnames[5] = {"HDR", "DAT", "SHR", "SHW", "CLS" }; +static char *srv_stnames[7] = {"IDL", "CON", "HDR", "DAT", "SHR", "SHW", "CLS" }; +#endif + + +/* + * returns a message to the client ; the connection is shut down for read, + * and the request is cleared so that no server connection can be initiated. + * The client must be in a valid state for this (HEADER, DATA ...). + * Nothing is performed on the server side. + * The reply buffer doesn't need to be empty before this. + */ +void client_retnclose(struct session *s, int len, const char *msg) +{ + FD_CLR(s->cli_fd, StaticReadEvent); + FD_SET(s->cli_fd, StaticWriteEvent); + tv_eternity(&s->crexpire); + if (s->proxy->clitimeout) + tv_delayfrom(&s->cwexpire, &now, s->proxy->clitimeout); + else + tv_eternity(&s->cwexpire); + shutdown(s->cli_fd, SHUT_RD); + s->cli_state = CL_STSHUTR; + buffer_flush(s->rep); + buffer_write(s->rep, msg, len); + s->req->l = 0; +} + + +/* + * returns a message into the rep buffer, and flushes the req buffer. + * The reply buffer doesn't need to be empty before this. + */ +void client_return(struct session *s, int len, const char *msg) +{ + buffer_flush(s->rep); + buffer_write(s->rep, msg, len); + s->req->l = 0; +} + + +/* This function turns the server state into the SV_STCLOSE, and sets + * indicators accordingly. Note that if is 0, no message is + * returned. + */ +void srv_close_with_err(struct session *t, int err, int finst, + int status, int msglen, char *msg) +{ + t->srv_state = SV_STCLOSE; + if (status > 0) { + t->logs.status = status; + if (t->proxy->mode == PR_MODE_HTTP) + client_return(t, msglen, msg); + } + if (!(t->flags & SN_ERR_MASK)) + t->flags |= err; + if (!(t->flags & SN_FINST_MASK)) + t->flags |= finst; +} + + +/* Processes the client and server jobs of a session task, then + * puts it back to the wait queue in a clean state, or + * cleans up its resources if it must be deleted. Returns + * the time the task accepts to wait, or TIME_ETERNITY for + * infinity. + */ +int process_session(struct task *t) +{ + struct session *s = t->context; + int fsm_resync = 0; + + do { + fsm_resync = 0; + //fprintf(stderr,"before_cli:cli=%d, srv=%d\n", s->cli_state, s->srv_state); + fsm_resync |= process_cli(s); + //fprintf(stderr,"cli/srv:cli=%d, srv=%d\n", s->cli_state, s->srv_state); + fsm_resync |= process_srv(s); + //fprintf(stderr,"after_srv:cli=%d, srv=%d\n", s->cli_state, s->srv_state); + } while (fsm_resync); + + if (s->cli_state != CL_STCLOSE || s->srv_state != SV_STCLOSE) { + struct timeval min1, min2; + s->res_cw = s->res_cr = s->res_sw = s->res_sr = RES_SILENT; + + tv_min(&min1, &s->crexpire, &s->cwexpire); + tv_min(&min2, &s->srexpire, &s->swexpire); + tv_min(&min1, &min1, &s->cnexpire); + tv_min(&t->expire, &min1, &min2); + + /* restore t to its place in the task list */ + task_queue(t); + +#ifdef DEBUG_FULL + /* DEBUG code : this should never ever happen, otherwise it indicates + * that a task still has something to do and will provoke a quick loop. + */ + if (tv_remain2(&now, &t->expire) <= 0) + exit(100); +#endif + + return tv_remain2(&now, &t->expire); /* nothing more to do */ + } + + s->proxy->nbconn--; + actconn--; + + if ((global.mode & MODE_DEBUG) && (!(global.mode & MODE_QUIET) || (global.mode & MODE_VERBOSE))) { + int len; + len = sprintf(trash, "%08x:%s.closed[%04x:%04x]\n", s->uniq_id, s->proxy->id, (unsigned short)s->cli_fd, (unsigned short)s->srv_fd); + write(1, trash, len); + } + + s->logs.t_close = tv_diff(&s->logs.tv_accept, &now); + if (s->rep != NULL) + s->logs.bytes = s->rep->total; + + /* let's do a final log if we need it */ + if (s->logs.logwait && (!(s->proxy->options & PR_O_NULLNOLOG) || s->req->total)) + sess_log(s); + + /* the task MUST not be in the run queue anymore */ + task_delete(t); + session_free(s); + task_free(t); + return TIME_ETERNITY; /* rest in peace for eternity */ +} + + +/* + * FIXME: This should move to the HTTP_flow_analyzer code + */ + +/* + * manages the client FSM and its socket. BTW, it also tries to handle the + * cookie. It returns 1 if a state has changed (and a resync may be needed), + * 0 else. + */ +int process_cli(struct session *t) +{ + int s = t->srv_state; + int c = t->cli_state; + struct buffer *req = t->req; + struct buffer *rep = t->rep; + int method_checked = 0; + appsess *asession_temp = NULL; + appsess local_asession; + +#ifdef DEBUG_FULL + fprintf(stderr,"process_cli: c=%s s=%s set(r,w)=%d,%d exp(r,w)=%d.%d,%d.%d\n", + cli_stnames[c], srv_stnames[s], + FD_ISSET(t->cli_fd, StaticReadEvent), FD_ISSET(t->cli_fd, StaticWriteEvent), + t->crexpire.tv_sec, t->crexpire.tv_usec, + t->cwexpire.tv_sec, t->cwexpire.tv_usec); +#endif + //fprintf(stderr,"process_cli: c=%d, s=%d, cr=%d, cw=%d, sr=%d, sw=%d\n", c, s, + //FD_ISSET(t->cli_fd, StaticReadEvent), FD_ISSET(t->cli_fd, StaticWriteEvent), + //FD_ISSET(t->srv_fd, StaticReadEvent), FD_ISSET(t->srv_fd, StaticWriteEvent) + //); + if (c == CL_STHEADERS) { + /* now parse the partial (or complete) headers */ + while (req->lr < req->r) { /* this loop only sees one header at each iteration */ + char *ptr; + int delete_header; + char *request_line = NULL; + + ptr = req->lr; + + /* look for the end of the current header */ + while (ptr < req->r && *ptr != '\n' && *ptr != '\r') + ptr++; + + if (ptr == req->h) { /* empty line, end of headers */ + int line, len; + + /* + * first, let's check that it's not a leading empty line, in + * which case we'll ignore and remove it (according to RFC2616). + */ + if (req->h == req->data) { + /* to get a complete header line, we need the ending \r\n, \n\r, \r or \n too */ + if (ptr > req->r - 2) { + /* this is a partial header, let's wait for more to come */ + req->lr = ptr; + break; + } + + /* now we know that *ptr is either \r or \n, + * and that there are at least 1 char after it. + */ + if ((ptr[0] == ptr[1]) || (ptr[1] != '\r' && ptr[1] != '\n')) + req->lr = ptr + 1; /* \r\r, \n\n, \r[^\n], \n[^\r] */ + else + req->lr = ptr + 2; /* \r\n or \n\r */ + /* ignore empty leading lines */ + buffer_replace2(req, req->h, req->lr, NULL, 0); + req->h = req->lr; + continue; + } + + /* we can only get here after an end of headers */ + /* we'll have something else to do here : add new headers ... */ + + if (t->flags & SN_CLDENY) { + /* no need to go further */ + t->logs.status = 403; + t->logs.t_request = tv_diff(&t->logs.tv_accept, &now); /* let's log the request time */ + client_retnclose(t, t->proxy->errmsg.len403, t->proxy->errmsg.msg403); + if (!(t->flags & SN_ERR_MASK)) + t->flags |= SN_ERR_PRXCOND; + if (!(t->flags & SN_FINST_MASK)) + t->flags |= SN_FINST_R; + return 1; + } + + /* Right now, we know that we have processed the entire headers + * and that unwanted requests have been filtered out. We can do + * whatever we want. + */ + + if (t->proxy->uri_auth != NULL + && t->req_line.len >= t->proxy->uri_auth->uri_len + 4) { /* +4 for "GET /" */ + if (!memcmp(t->req_line.str + 4, + t->proxy->uri_auth->uri_prefix, t->proxy->uri_auth->uri_len) + && !memcmp(t->req_line.str, "GET ", 4)) { + struct user_auth *user; + int authenticated; + + /* we are in front of a interceptable URI. Let's check + * if there's an authentication and if it's valid. + */ + user = t->proxy->uri_auth->users; + if (!user) { + /* no user auth required, it's OK */ + authenticated = 1; + } else { + authenticated = 0; + + /* a user list is defined, we have to check. + * skip 21 chars for "Authorization: Basic ". + */ + if (t->auth_hdr.len < 21 || memcmp(t->auth_hdr.str + 14, " Basic ", 7)) + user = NULL; + + while (user) { + if ((t->auth_hdr.len == user->user_len + 21) + && !memcmp(t->auth_hdr.str+21, user->user_pwd, user->user_len)) { + authenticated = 1; + break; + } + user = user->next; + } + } + + if (!authenticated) { + int msglen; + + /* no need to go further */ + + msglen = sprintf(trash, HTTP_401_fmt, t->proxy->uri_auth->auth_realm); + t->logs.status = 401; + client_retnclose(t, msglen, trash); + if (!(t->flags & SN_ERR_MASK)) + t->flags |= SN_ERR_PRXCOND; + if (!(t->flags & SN_FINST_MASK)) + t->flags |= SN_FINST_R; + return 1; + } + + t->cli_state = CL_STSHUTR; + req->rlim = req->data + BUFSIZE; /* no more rewrite needed */ + t->logs.t_request = tv_diff(&t->logs.tv_accept, &now); + t->data_source = DATA_SRC_STATS; + t->data_state = DATA_ST_INIT; + produce_content(t); + return 1; + } + } + + + for (line = 0; line < t->proxy->nb_reqadd; line++) { + len = sprintf(trash, "%s\r\n", t->proxy->req_add[line]); + buffer_replace2(req, req->h, req->h, trash, len); + } + + if (t->proxy->options & PR_O_FWDFOR) { + if (t->cli_addr.ss_family == AF_INET) { + unsigned char *pn; + pn = (unsigned char *)&((struct sockaddr_in *)&t->cli_addr)->sin_addr; + len = sprintf(trash, "X-Forwarded-For: %d.%d.%d.%d\r\n", + pn[0], pn[1], pn[2], pn[3]); + buffer_replace2(req, req->h, req->h, trash, len); + } + else if (t->cli_addr.ss_family == AF_INET6) { + char pn[INET6_ADDRSTRLEN]; + inet_ntop(AF_INET6, + (const void *)&((struct sockaddr_in6 *)(&t->cli_addr))->sin6_addr, + pn, sizeof(pn)); + len = sprintf(trash, "X-Forwarded-For: %s\r\n", pn); + buffer_replace2(req, req->h, req->h, trash, len); + } + } + + /* add a "connection: close" line if needed */ + if (t->proxy->options & PR_O_HTTP_CLOSE) + buffer_replace2(req, req->h, req->h, "Connection: close\r\n", 19); + + if (!memcmp(req->data, "POST ", 5)) { + /* this is a POST request, which is not cacheable by default */ + t->flags |= SN_POST; + } + + t->cli_state = CL_STDATA; + req->rlim = req->data + BUFSIZE; /* no more rewrite needed */ + + t->logs.t_request = tv_diff(&t->logs.tv_accept, &now); + /* FIXME: we'll set the client in a wait state while we try to + * connect to the server. Is this really needed ? wouldn't it be + * better to release the maximum of system buffers instead ? + * The solution is to enable the FD but set its time-out to + * eternity as long as the server-side does not enable data xfer. + * CL_STDATA also has to take care of this, which is done below. + */ + //FD_CLR(t->cli_fd, StaticReadEvent); + //tv_eternity(&t->crexpire); + + /* FIXME: if we break here (as up to 1.1.23), having the client + * shutdown its connection can lead to an abort further. + * it's better to either return 1 or even jump directly to the + * data state which will save one schedule. + */ + //break; + + if (!t->proxy->clitimeout || + (t->srv_state < SV_STDATA && t->proxy->srvtimeout)) + /* If the client has no timeout, or if the server is not ready yet, + * and we know for sure that it can expire, then it's cleaner to + * disable the timeout on the client side so that too low values + * cannot make the sessions abort too early. + * + * FIXME-20050705: the server needs a way to re-enable this time-out + * when it switches its state, otherwise a client can stay connected + * indefinitely. This now seems to be OK. + */ + tv_eternity(&t->crexpire); + + goto process_data; + } + + /* to get a complete header line, we need the ending \r\n, \n\r, \r or \n too */ + if (ptr > req->r - 2) { + /* this is a partial header, let's wait for more to come */ + req->lr = ptr; + break; + } + + /* now we know that *ptr is either \r or \n, + * and that there are at least 1 char after it. + */ + if ((ptr[0] == ptr[1]) || (ptr[1] != '\r' && ptr[1] != '\n')) + req->lr = ptr + 1; /* \r\r, \n\n, \r[^\n], \n[^\r] */ + else + req->lr = ptr + 2; /* \r\n or \n\r */ + + /* + * now we know that we have a full header ; we can do whatever + * we want with these pointers : + * req->h = beginning of header + * ptr = end of header (first \r or \n) + * req->lr = beginning of next line (next rep->h) + * req->r = end of data (not used at this stage) + */ + + if (!method_checked && (t->proxy->appsession_name != NULL) && + ((memcmp(req->h, "GET ", 4) == 0) || (memcmp(req->h, "POST ", 4) == 0)) && + ((request_line = memchr(req->h, ';', req->lr - req->h)) != NULL)) { + + /* skip ; */ + request_line++; + + /* look if we have a jsessionid */ + + if (strncasecmp(request_line, t->proxy->appsession_name, t->proxy->appsession_name_len) == 0) { + + /* skip jsessionid= */ + request_line += t->proxy->appsession_name_len + 1; + + /* First try if we allready have an appsession */ + asession_temp = &local_asession; + + if ((asession_temp->sessid = pool_alloc_from(apools.sessid, apools.ses_msize)) == NULL) { + Alert("Not enough memory process_cli():asession_temp->sessid:calloc().\n"); + send_log(t->proxy, LOG_ALERT, "Not enough Memory process_cli():asession_temp->sessid:calloc().\n"); + return 0; + } + + /* Copy the sessionid */ + memcpy(asession_temp->sessid, request_line, t->proxy->appsession_len); + asession_temp->sessid[t->proxy->appsession_len] = 0; + asession_temp->serverid = NULL; + + /* only do insert, if lookup fails */ + if (chtbl_lookup(&(t->proxy->htbl_proxy), (void *)&asession_temp)) { + if ((asession_temp = pool_alloc(appsess)) == NULL) { + Alert("Not enough memory process_cli():asession:calloc().\n"); + send_log(t->proxy, LOG_ALERT, "Not enough memory process_cli():asession:calloc().\n"); + return 0; + } + asession_temp->sessid = local_asession.sessid; + asession_temp->serverid = local_asession.serverid; + chtbl_insert(&(t->proxy->htbl_proxy), (void *) asession_temp); + } /* end if (chtbl_lookup()) */ + else { + /*free wasted memory;*/ + pool_free_to(apools.sessid, local_asession.sessid); + } + + tv_delayfrom(&asession_temp->expire, &now, t->proxy->appsession_timeout); + asession_temp->request_count++; + +#if defined(DEBUG_HASH) + print_table(&(t->proxy->htbl_proxy)); +#endif + + if (asession_temp->serverid == NULL) { + Alert("Found Application Session without matching server.\n"); + } else { + struct server *srv = t->proxy->srv; + while (srv) { + if (strcmp(srv->id, asession_temp->serverid) == 0) { + if (srv->state & SRV_RUNNING || t->proxy->options & PR_O_PERSIST) { + /* we found the server and it's usable */ + t->flags &= ~SN_CK_MASK; + t->flags |= SN_CK_VALID | SN_DIRECT | SN_ASSIGNED; + t->srv = srv; + break; + } else { + t->flags &= ~SN_CK_MASK; + t->flags |= SN_CK_DOWN; + } + } /* end if (strcmp()) */ + srv = srv->next; + }/* end while(srv) */ + }/* end else of if (asession_temp->serverid == NULL) */ + }/* end if (strncasecmp(request_line,t->proxy->appsession_name,apssesion_name_len) == 0) */ + else { + //fprintf(stderr,">>>>>>>>>>>>>>>>>>>>>>NO SESSION\n"); + } + method_checked = 1; + } /* end if (!method_checked ...) */ + else{ + //printf("No Methode-Header with Session-String\n"); + } + + if (t->logs.logwait & LW_REQ) { + /* we have a complete HTTP request that we must log */ + int urilen; + + if ((t->logs.uri = pool_alloc(requri)) == NULL) { + Alert("HTTP logging : out of memory.\n"); + t->logs.status = 500; + client_retnclose(t, t->proxy->errmsg.len500, t->proxy->errmsg.msg500); + if (!(t->flags & SN_ERR_MASK)) + t->flags |= SN_ERR_PRXCOND; + if (!(t->flags & SN_FINST_MASK)) + t->flags |= SN_FINST_R; + return 1; + } + + urilen = ptr - req->h; + if (urilen >= REQURI_LEN) + urilen = REQURI_LEN - 1; + memcpy(t->logs.uri, req->h, urilen); + t->logs.uri[urilen] = 0; + + if (!(t->logs.logwait &= ~LW_REQ)) + sess_log(t); + } + else if (t->logs.logwait & LW_REQHDR) { + struct cap_hdr *h; + int len; + for (h = t->proxy->req_cap; h; h = h->next) { + if ((h->namelen + 2 <= ptr - req->h) && + (req->h[h->namelen] == ':') && + (strncasecmp(req->h, h->name, h->namelen) == 0)) { + + if (t->req_cap[h->index] == NULL) + t->req_cap[h->index] = pool_alloc_from(h->pool, h->len + 1); + + len = ptr - (req->h + h->namelen + 2); + if (len > h->len) + len = h->len; + + memcpy(t->req_cap[h->index], req->h + h->namelen + 2, len); + t->req_cap[h->index][len]=0; + } + } + + } + + delete_header = 0; + + if ((global.mode & MODE_DEBUG) && (!(global.mode & MODE_QUIET) || (global.mode & MODE_VERBOSE))) { + int len, max; + len = sprintf(trash, "%08x:%s.clihdr[%04x:%04x]: ", t->uniq_id, t->proxy->id, (unsigned short)t->cli_fd, (unsigned short)t->srv_fd); + max = ptr - req->h; + UBOUND(max, sizeof(trash) - len - 1); + len += strlcpy2(trash + len, req->h, max + 1); + trash[len++] = '\n'; + write(1, trash, len); + } + + + /* remove "connection: " if needed */ + if (!delete_header && (t->proxy->options & PR_O_HTTP_CLOSE) + && (strncasecmp(req->h, "Connection: ", 12) == 0)) { + delete_header = 1; + } + + /* try headers regexps */ + if (!delete_header && t->proxy->req_exp != NULL + && !(t->flags & SN_CLDENY)) { + struct hdr_exp *exp; + char term; + + term = *ptr; + *ptr = '\0'; + exp = t->proxy->req_exp; + do { + if (regexec(exp->preg, req->h, MAX_MATCH, pmatch, 0) == 0) { + switch (exp->action) { + case ACT_ALLOW: + if (!(t->flags & SN_CLDENY)) + t->flags |= SN_CLALLOW; + break; + case ACT_REPLACE: + if (!(t->flags & SN_CLDENY)) { + int len = exp_replace(trash, req->h, exp->replace, pmatch); + ptr += buffer_replace2(req, req->h, ptr, trash, len); + } + break; + case ACT_REMOVE: + if (!(t->flags & SN_CLDENY)) + delete_header = 1; + break; + case ACT_DENY: + if (!(t->flags & SN_CLALLOW)) + t->flags |= SN_CLDENY; + break; + case ACT_PASS: /* we simply don't deny this one */ + break; + } + break; + } + } while ((exp = exp->next) != NULL); + *ptr = term; /* restore the string terminator */ + } + + /* Now look for cookies. Conforming to RFC2109, we have to support + * attributes whose name begin with a '$', and associate them with + * the right cookie, if we want to delete this cookie. + * So there are 3 cases for each cookie read : + * 1) it's a special attribute, beginning with a '$' : ignore it. + * 2) it's a server id cookie that we *MAY* want to delete : save + * some pointers on it (last semi-colon, beginning of cookie...) + * 3) it's an application cookie : we *MAY* have to delete a previous + * "special" cookie. + * At the end of loop, if a "special" cookie remains, we may have to + * remove it. If no application cookie persists in the header, we + * *MUST* delete it + */ + if (!delete_header && + (t->proxy->cookie_name != NULL || t->proxy->capture_name != NULL || t->proxy->appsession_name !=NULL) + && !(t->flags & SN_CLDENY) && (ptr >= req->h + 8) + && (strncasecmp(req->h, "Cookie: ", 8) == 0)) { + char *p1, *p2, *p3, *p4; + char *del_colon, *del_cookie, *colon; + int app_cookies; + + p1 = req->h + 8; /* first char after 'Cookie: ' */ + colon = p1; + /* del_cookie == NULL => nothing to be deleted */ + del_colon = del_cookie = NULL; + app_cookies = 0; + + while (p1 < ptr) { + /* skip spaces and colons, but keep an eye on these ones */ + while (p1 < ptr) { + if (*p1 == ';' || *p1 == ',') + colon = p1; + else if (!isspace((int)*p1)) + break; + p1++; + } + + if (p1 == ptr) + break; + + /* p1 is at the beginning of the cookie name */ + p2 = p1; + while (p2 < ptr && *p2 != '=') + p2++; + + if (p2 == ptr) + break; + + p3 = p2 + 1; /* skips the '=' sign */ + if (p3 == ptr) + break; + + p4 = p3; + while (p4 < ptr && !isspace((int)*p4) && *p4 != ';' && *p4 != ',') + p4++; + + /* here, we have the cookie name between p1 and p2, + * and its value between p3 and p4. + * we can process it : + * + * Cookie: NAME=VALUE; + * | || || | + * | || || +--> p4 + * | || |+-------> p3 + * | || +--------> p2 + * | |+------------> p1 + * | +-------------> colon + * +--------------------> req->h + */ + + if (*p1 == '$') { + /* skip this one */ + } + else { + /* first, let's see if we want to capture it */ + if (t->proxy->capture_name != NULL && + t->logs.cli_cookie == NULL && + (p4 - p1 >= t->proxy->capture_namelen) && + memcmp(p1, t->proxy->capture_name, t->proxy->capture_namelen) == 0) { + int log_len = p4 - p1; + + if ((t->logs.cli_cookie = pool_alloc(capture)) == NULL) { + Alert("HTTP logging : out of memory.\n"); + } else { + if (log_len > t->proxy->capture_len) + log_len = t->proxy->capture_len; + memcpy(t->logs.cli_cookie, p1, log_len); + t->logs.cli_cookie[log_len] = 0; + } + } + + if ((p2 - p1 == t->proxy->cookie_len) && (t->proxy->cookie_name != NULL) && + (memcmp(p1, t->proxy->cookie_name, p2 - p1) == 0)) { + /* Cool... it's the right one */ + struct server *srv = t->proxy->srv; + char *delim; + + /* if we're in cookie prefix mode, we'll search the delimitor so that we + * have the server ID betweek p3 and delim, and the original cookie between + * delim+1 and p4. Otherwise, delim==p4 : + * + * Cookie: NAME=SRV~VALUE; + * | || || | | + * | || || | +--> p4 + * | || || +--------> delim + * | || |+-----------> p3 + * | || +------------> p2 + * | |+----------------> p1 + * | +-----------------> colon + * +------------------------> req->h + */ + + if (t->proxy->options & PR_O_COOK_PFX) { + for (delim = p3; delim < p4; delim++) + if (*delim == COOKIE_DELIM) + break; + } + else + delim = p4; + + + /* Here, we'll look for the first running server which supports the cookie. + * This allows to share a same cookie between several servers, for example + * to dedicate backup servers to specific servers only. + * However, to prevent clients from sticking to cookie-less backup server + * when they have incidentely learned an empty cookie, we simply ignore + * empty cookies and mark them as invalid. + */ + if (delim == p3) + srv = NULL; + + while (srv) { + if ((srv->cklen == delim - p3) && !memcmp(p3, srv->cookie, delim - p3)) { + if (srv->state & SRV_RUNNING || t->proxy->options & PR_O_PERSIST) { + /* we found the server and it's usable */ + t->flags &= ~SN_CK_MASK; + t->flags |= SN_CK_VALID | SN_DIRECT | SN_ASSIGNED; + t->srv = srv; + break; + } else { + /* we found a server, but it's down */ + t->flags &= ~SN_CK_MASK; + t->flags |= SN_CK_DOWN; + } + } + srv = srv->next; + } + + if (!srv && !(t->flags & SN_CK_DOWN)) { + /* no server matched this cookie */ + t->flags &= ~SN_CK_MASK; + t->flags |= SN_CK_INVALID; + } + + /* depending on the cookie mode, we may have to either : + * - delete the complete cookie if we're in insert+indirect mode, so that + * the server never sees it ; + * - remove the server id from the cookie value, and tag the cookie as an + * application cookie so that it does not get accidentely removed later, + * if we're in cookie prefix mode + */ + if ((t->proxy->options & PR_O_COOK_PFX) && (delim != p4)) { + buffer_replace2(req, p3, delim + 1, NULL, 0); + p4 -= (delim + 1 - p3); + ptr -= (delim + 1 - p3); + del_cookie = del_colon = NULL; + app_cookies++; /* protect the header from deletion */ + } + else if (del_cookie == NULL && + (t->proxy->options & (PR_O_COOK_INS | PR_O_COOK_IND)) == (PR_O_COOK_INS | PR_O_COOK_IND)) { + del_cookie = p1; + del_colon = colon; + } + } else { + /* now we know that we must keep this cookie since it's + * not ours. But if we wanted to delete our cookie + * earlier, we cannot remove the complete header, but we + * can remove the previous block itself. + */ + app_cookies++; + + if (del_cookie != NULL) { + buffer_replace2(req, del_cookie, p1, NULL, 0); + p4 -= (p1 - del_cookie); + ptr -= (p1 - del_cookie); + del_cookie = del_colon = NULL; + } + } + + if ((t->proxy->appsession_name != NULL) && + (memcmp(p1, t->proxy->appsession_name, p2 - p1) == 0)) { + /* first, let's see if the cookie is our appcookie*/ + + /* Cool... it's the right one */ + + asession_temp = &local_asession; + + if ((asession_temp->sessid = pool_alloc_from(apools.sessid, apools.ses_msize)) == NULL) { + Alert("Not enough memory process_cli():asession->sessid:malloc().\n"); + send_log(t->proxy, LOG_ALERT, "Not enough memory process_cli():asession->sessid:malloc().\n"); + return 0; + } + + memcpy(asession_temp->sessid, p3, t->proxy->appsession_len); + asession_temp->sessid[t->proxy->appsession_len] = 0; + asession_temp->serverid = NULL; + + /* only do insert, if lookup fails */ + if (chtbl_lookup(&(t->proxy->htbl_proxy), (void *) &asession_temp) != 0) { + if ((asession_temp = pool_alloc(appsess)) == NULL) { + Alert("Not enough memory process_cli():asession:calloc().\n"); + send_log(t->proxy, LOG_ALERT, "Not enough memory process_cli():asession:calloc().\n"); + return 0; + } + + asession_temp->sessid = local_asession.sessid; + asession_temp->serverid = local_asession.serverid; + chtbl_insert(&(t->proxy->htbl_proxy), (void *) asession_temp); + } else { + /* free wasted memory */ + pool_free_to(apools.sessid, local_asession.sessid); + } + + if (asession_temp->serverid == NULL) { + Alert("Found Application Session without matching server.\n"); + } else { + struct server *srv = t->proxy->srv; + while (srv) { + if (strcmp(srv->id, asession_temp->serverid) == 0) { + if (srv->state & SRV_RUNNING || t->proxy->options & PR_O_PERSIST) { + /* we found the server and it's usable */ + t->flags &= ~SN_CK_MASK; + t->flags |= SN_CK_VALID | SN_DIRECT | SN_ASSIGNED; + t->srv = srv; + break; + } else { + t->flags &= ~SN_CK_MASK; + t->flags |= SN_CK_DOWN; + } + } + srv = srv->next; + }/* end while(srv) */ + }/* end else if server == NULL */ + + tv_delayfrom(&asession_temp->expire, &now, t->proxy->appsession_timeout); + }/* end if ((t->proxy->appsession_name != NULL) ... */ + } + + /* we'll have to look for another cookie ... */ + p1 = p4; + } /* while (p1 < ptr) */ + + /* There's no more cookie on this line. + * We may have marked the last one(s) for deletion. + * We must do this now in two ways : + * - if there is no app cookie, we simply delete the header ; + * - if there are app cookies, we must delete the end of the + * string properly, including the colon/semi-colon before + * the cookie name. + */ + if (del_cookie != NULL) { + if (app_cookies) { + buffer_replace2(req, del_colon, ptr, NULL, 0); + /* WARNING! becomes invalid for now. If some code + * below needs to rely on it before the end of the global + * header loop, we need to correct it with this code : + */ + ptr = del_colon; + } + else + delete_header = 1; + } + } /* end of cookie processing on this header */ + + /* let's look if we have to delete this header */ + if (delete_header && !(t->flags & SN_CLDENY)) { + buffer_replace2(req, req->h, req->lr, NULL, 0); + /* WARNING: ptr is not valid anymore, since the header may have + * been deleted or truncated ! */ + } else { + /* try to catch the first line as the request */ + if (t->req_line.len < 0) { + t->req_line.str = req->h; + t->req_line.len = ptr - req->h; + } + + /* We might also need the 'Authorization: ' header */ + if (t->auth_hdr.len < 0 && + t->proxy->uri_auth != NULL && + ptr > req->h + 15 && + !strncasecmp("Authorization: ", req->h, 15)) { + t->auth_hdr.str = req->h; + t->auth_hdr.len = ptr - req->h; + } + } + + req->h = req->lr; + } /* while (req->lr < req->r) */ + + /* end of header processing (even if incomplete) */ + + if ((req->l < req->rlim - req->data) && ! FD_ISSET(t->cli_fd, StaticReadEvent)) { + /* fd in StaticReadEvent was disabled, perhaps because of a previous buffer + * full. We cannot loop here since event_cli_read will disable it only if + * req->l == rlim-data + */ + FD_SET(t->cli_fd, StaticReadEvent); + if (t->proxy->clitimeout) + tv_delayfrom(&t->crexpire, &now, t->proxy->clitimeout); + else + tv_eternity(&t->crexpire); + } + + /* Since we are in header mode, if there's no space left for headers, we + * won't be able to free more later, so the session will never terminate. + */ + if (req->l >= req->rlim - req->data) { + t->logs.status = 400; + client_retnclose(t, t->proxy->errmsg.len400, t->proxy->errmsg.msg400); + if (!(t->flags & SN_ERR_MASK)) + t->flags |= SN_ERR_PRXCOND; + if (!(t->flags & SN_FINST_MASK)) + t->flags |= SN_FINST_R; + return 1; + } + else if (t->res_cr == RES_ERROR || t->res_cr == RES_NULL) { + /* read error, or last read : give up. */ + tv_eternity(&t->crexpire); + fd_delete(t->cli_fd); + t->cli_state = CL_STCLOSE; + if (!(t->flags & SN_ERR_MASK)) + t->flags |= SN_ERR_CLICL; + if (!(t->flags & SN_FINST_MASK)) + t->flags |= SN_FINST_R; + return 1; + } + else if (tv_cmp2_ms(&t->crexpire, &now) <= 0) { + + /* read timeout : give up with an error message. + */ + t->logs.status = 408; + client_retnclose(t, t->proxy->errmsg.len408, t->proxy->errmsg.msg408); + if (!(t->flags & SN_ERR_MASK)) + t->flags |= SN_ERR_CLITO; + if (!(t->flags & SN_FINST_MASK)) + t->flags |= SN_FINST_R; + return 1; + } + + return t->cli_state != CL_STHEADERS; + } + else if (c == CL_STDATA) { + process_data: + /* FIXME: this error handling is partly buggy because we always report + * a 'DATA' phase while we don't know if the server was in IDLE, CONN + * or HEADER phase. BTW, it's not logical to expire the client while + * we're waiting for the server to connect. + */ + /* read or write error */ + if (t->res_cw == RES_ERROR || t->res_cr == RES_ERROR) { + tv_eternity(&t->crexpire); + tv_eternity(&t->cwexpire); + fd_delete(t->cli_fd); + t->cli_state = CL_STCLOSE; + if (!(t->flags & SN_ERR_MASK)) + t->flags |= SN_ERR_CLICL; + if (!(t->flags & SN_FINST_MASK)) { + if (t->pend_pos) + t->flags |= SN_FINST_Q; + else if (s == SV_STCONN) + t->flags |= SN_FINST_C; + else + t->flags |= SN_FINST_D; + } + return 1; + } + /* last read, or end of server write */ + else if (t->res_cr == RES_NULL || s == SV_STSHUTW || s == SV_STCLOSE) { + FD_CLR(t->cli_fd, StaticReadEvent); + tv_eternity(&t->crexpire); + shutdown(t->cli_fd, SHUT_RD); + t->cli_state = CL_STSHUTR; + return 1; + } + /* last server read and buffer empty */ + else if ((s == SV_STSHUTR || s == SV_STCLOSE) && (rep->l == 0)) { + FD_CLR(t->cli_fd, StaticWriteEvent); + tv_eternity(&t->cwexpire); + shutdown(t->cli_fd, SHUT_WR); + /* We must ensure that the read part is still alive when switching + * to shutw */ + FD_SET(t->cli_fd, StaticReadEvent); + if (t->proxy->clitimeout) + tv_delayfrom(&t->crexpire, &now, t->proxy->clitimeout); + t->cli_state = CL_STSHUTW; + //fprintf(stderr,"%p:%s(%d), c=%d, s=%d\n", t, __FUNCTION__, __LINE__, t->cli_state, t->cli_state); + return 1; + } + /* read timeout */ + else if (tv_cmp2_ms(&t->crexpire, &now) <= 0) { + FD_CLR(t->cli_fd, StaticReadEvent); + tv_eternity(&t->crexpire); + shutdown(t->cli_fd, SHUT_RD); + t->cli_state = CL_STSHUTR; + if (!(t->flags & SN_ERR_MASK)) + t->flags |= SN_ERR_CLITO; + if (!(t->flags & SN_FINST_MASK)) { + if (t->pend_pos) + t->flags |= SN_FINST_Q; + else if (s == SV_STCONN) + t->flags |= SN_FINST_C; + else + t->flags |= SN_FINST_D; + } + return 1; + } + /* write timeout */ + else if (tv_cmp2_ms(&t->cwexpire, &now) <= 0) { + FD_CLR(t->cli_fd, StaticWriteEvent); + tv_eternity(&t->cwexpire); + shutdown(t->cli_fd, SHUT_WR); + /* We must ensure that the read part is still alive when switching + * to shutw */ + FD_SET(t->cli_fd, StaticReadEvent); + if (t->proxy->clitimeout) + tv_delayfrom(&t->crexpire, &now, t->proxy->clitimeout); + + t->cli_state = CL_STSHUTW; + if (!(t->flags & SN_ERR_MASK)) + t->flags |= SN_ERR_CLITO; + if (!(t->flags & SN_FINST_MASK)) { + if (t->pend_pos) + t->flags |= SN_FINST_Q; + else if (s == SV_STCONN) + t->flags |= SN_FINST_C; + else + t->flags |= SN_FINST_D; + } + return 1; + } + + if (req->l >= req->rlim - req->data) { + /* no room to read more data */ + if (FD_ISSET(t->cli_fd, StaticReadEvent)) { + /* stop reading until we get some space */ + FD_CLR(t->cli_fd, StaticReadEvent); + tv_eternity(&t->crexpire); + } + } else { + /* there's still some space in the buffer */ + if (! FD_ISSET(t->cli_fd, StaticReadEvent)) { + FD_SET(t->cli_fd, StaticReadEvent); + if (!t->proxy->clitimeout || + (t->srv_state < SV_STDATA && t->proxy->srvtimeout)) + /* If the client has no timeout, or if the server not ready yet, and we + * know for sure that it can expire, then it's cleaner to disable the + * timeout on the client side so that too low values cannot make the + * sessions abort too early. + */ + tv_eternity(&t->crexpire); + else + tv_delayfrom(&t->crexpire, &now, t->proxy->clitimeout); + } + } + + if ((rep->l == 0) || + ((s < SV_STDATA) /* FIXME: this may be optimized && (rep->w == rep->h)*/)) { + if (FD_ISSET(t->cli_fd, StaticWriteEvent)) { + FD_CLR(t->cli_fd, StaticWriteEvent); /* stop writing */ + tv_eternity(&t->cwexpire); + } + } else { + /* buffer not empty */ + if (! FD_ISSET(t->cli_fd, StaticWriteEvent)) { + FD_SET(t->cli_fd, StaticWriteEvent); /* restart writing */ + if (t->proxy->clitimeout) { + tv_delayfrom(&t->cwexpire, &now, t->proxy->clitimeout); + /* FIXME: to prevent the client from expiring read timeouts during writes, + * we refresh it. */ + t->crexpire = t->cwexpire; + } + else + tv_eternity(&t->cwexpire); + } + } + return 0; /* other cases change nothing */ + } + else if (c == CL_STSHUTR) { + if (t->res_cw == RES_ERROR) { + tv_eternity(&t->cwexpire); + fd_delete(t->cli_fd); + t->cli_state = CL_STCLOSE; + if (!(t->flags & SN_ERR_MASK)) + t->flags |= SN_ERR_CLICL; + if (!(t->flags & SN_FINST_MASK)) { + if (t->pend_pos) + t->flags |= SN_FINST_Q; + else if (s == SV_STCONN) + t->flags |= SN_FINST_C; + else + t->flags |= SN_FINST_D; + } + return 1; + } + else if ((s == SV_STSHUTR || s == SV_STCLOSE) && (rep->l == 0) + && !(t->flags & SN_SELF_GEN)) { + tv_eternity(&t->cwexpire); + fd_delete(t->cli_fd); + t->cli_state = CL_STCLOSE; + return 1; + } + else if (tv_cmp2_ms(&t->cwexpire, &now) <= 0) { + tv_eternity(&t->cwexpire); + fd_delete(t->cli_fd); + t->cli_state = CL_STCLOSE; + if (!(t->flags & SN_ERR_MASK)) + t->flags |= SN_ERR_CLITO; + if (!(t->flags & SN_FINST_MASK)) { + if (t->pend_pos) + t->flags |= SN_FINST_Q; + else if (s == SV_STCONN) + t->flags |= SN_FINST_C; + else + t->flags |= SN_FINST_D; + } + return 1; + } + + if (t->flags & SN_SELF_GEN) { + produce_content(t); + if (rep->l == 0) { + tv_eternity(&t->cwexpire); + fd_delete(t->cli_fd); + t->cli_state = CL_STCLOSE; + return 1; + } + } + + if ((rep->l == 0) + || ((s == SV_STHEADERS) /* FIXME: this may be optimized && (rep->w == rep->h)*/)) { + if (FD_ISSET(t->cli_fd, StaticWriteEvent)) { + FD_CLR(t->cli_fd, StaticWriteEvent); /* stop writing */ + tv_eternity(&t->cwexpire); + } + } else { + /* buffer not empty */ + if (! FD_ISSET(t->cli_fd, StaticWriteEvent)) { + FD_SET(t->cli_fd, StaticWriteEvent); /* restart writing */ + if (t->proxy->clitimeout) { + tv_delayfrom(&t->cwexpire, &now, t->proxy->clitimeout); + /* FIXME: to prevent the client from expiring read timeouts during writes, + * we refresh it. */ + t->crexpire = t->cwexpire; + } + else + tv_eternity(&t->cwexpire); + } + } + return 0; + } + else if (c == CL_STSHUTW) { + if (t->res_cr == RES_ERROR) { + tv_eternity(&t->crexpire); + fd_delete(t->cli_fd); + t->cli_state = CL_STCLOSE; + if (!(t->flags & SN_ERR_MASK)) + t->flags |= SN_ERR_CLICL; + if (!(t->flags & SN_FINST_MASK)) { + if (t->pend_pos) + t->flags |= SN_FINST_Q; + else if (s == SV_STCONN) + t->flags |= SN_FINST_C; + else + t->flags |= SN_FINST_D; + } + return 1; + } + else if (t->res_cr == RES_NULL || s == SV_STSHUTW || s == SV_STCLOSE) { + tv_eternity(&t->crexpire); + fd_delete(t->cli_fd); + t->cli_state = CL_STCLOSE; + return 1; + } + else if (tv_cmp2_ms(&t->crexpire, &now) <= 0) { + tv_eternity(&t->crexpire); + fd_delete(t->cli_fd); + t->cli_state = CL_STCLOSE; + if (!(t->flags & SN_ERR_MASK)) + t->flags |= SN_ERR_CLITO; + if (!(t->flags & SN_FINST_MASK)) { + if (t->pend_pos) + t->flags |= SN_FINST_Q; + else if (s == SV_STCONN) + t->flags |= SN_FINST_C; + else + t->flags |= SN_FINST_D; + } + return 1; + } + else if (req->l >= req->rlim - req->data) { + /* no room to read more data */ + + /* FIXME-20050705: is it possible for a client to maintain a session + * after the timeout by sending more data after it receives a close ? + */ + + if (FD_ISSET(t->cli_fd, StaticReadEvent)) { + /* stop reading until we get some space */ + FD_CLR(t->cli_fd, StaticReadEvent); + tv_eternity(&t->crexpire); + //fprintf(stderr,"%p:%s(%d), c=%d, s=%d\n", t, __FUNCTION__, __LINE__, t->cli_state, t->cli_state); + } + } else { + /* there's still some space in the buffer */ + if (! FD_ISSET(t->cli_fd, StaticReadEvent)) { + FD_SET(t->cli_fd, StaticReadEvent); + if (t->proxy->clitimeout) + tv_delayfrom(&t->crexpire, &now, t->proxy->clitimeout); + else + tv_eternity(&t->crexpire); + //fprintf(stderr,"%p:%s(%d), c=%d, s=%d\n", t, __FUNCTION__, __LINE__, t->cli_state, t->cli_state); + } + } + return 0; + } + else { /* CL_STCLOSE: nothing to do */ + if ((global.mode & MODE_DEBUG) && (!(global.mode & MODE_QUIET) || (global.mode & MODE_VERBOSE))) { + int len; + len = sprintf(trash, "%08x:%s.clicls[%04x:%04x]\n", t->uniq_id, t->proxy->id, (unsigned short)t->cli_fd, (unsigned short)t->srv_fd); + write(1, trash, len); + } + return 0; + } + return 0; +} + + +/* + * manages the server FSM and its socket. It returns 1 if a state has changed + * (and a resync may be needed), 0 else. + */ +int process_srv(struct session *t) +{ + int s = t->srv_state; + int c = t->cli_state; + struct buffer *req = t->req; + struct buffer *rep = t->rep; + appsess *asession_temp = NULL; + appsess local_asession; + int conn_err; + +#ifdef DEBUG_FULL + fprintf(stderr,"process_srv: c=%s, s=%s\n", cli_stnames[c], srv_stnames[s]); +#endif + //fprintf(stderr,"process_srv: c=%d, s=%d, cr=%d, cw=%d, sr=%d, sw=%d\n", c, s, + //FD_ISSET(t->cli_fd, StaticReadEvent), FD_ISSET(t->cli_fd, StaticWriteEvent), + //FD_ISSET(t->srv_fd, StaticReadEvent), FD_ISSET(t->srv_fd, StaticWriteEvent) + //); + if (s == SV_STIDLE) { + if (c == CL_STHEADERS) + return 0; /* stay in idle, waiting for data to reach the client side */ + else if (c == CL_STCLOSE || c == CL_STSHUTW || + (c == CL_STSHUTR && + (t->req->l == 0 || t->proxy->options & PR_O_ABRT_CLOSE))) { /* give up */ + tv_eternity(&t->cnexpire); + if (t->pend_pos) + t->logs.t_queue = tv_diff(&t->logs.tv_accept, &now); + /* note that this must not return any error because it would be able to + * overwrite the client_retnclose() output. + */ + srv_close_with_err(t, SN_ERR_CLICL, t->pend_pos ? SN_FINST_Q : SN_FINST_C, 0, 0, NULL); + + return 1; + } + else { + /* Right now, we will need to create a connection to the server. + * We might already have tried, and got a connection pending, in + * which case we will not do anything till it's pending. It's up + * to any other session to release it and wake us up again. + */ + if (t->pend_pos) { + if (tv_cmp2_ms(&t->cnexpire, &now) > 0) + return 0; + else { + /* we've been waiting too long here */ + tv_eternity(&t->cnexpire); + t->logs.t_queue = tv_diff(&t->logs.tv_accept, &now); + srv_close_with_err(t, SN_ERR_SRVTO, SN_FINST_Q, + 503, t->proxy->errmsg.len503, t->proxy->errmsg.msg503); + if (t->srv) + t->srv->failed_conns++; + t->proxy->failed_conns++; + return 1; + } + } + + do { + /* first, get a connection */ + if (srv_redispatch_connect(t)) + return t->srv_state != SV_STIDLE; + + /* try to (re-)connect to the server, and fail if we expire the + * number of retries. + */ + if (srv_retryable_connect(t)) { + t->logs.t_queue = tv_diff(&t->logs.tv_accept, &now); + return t->srv_state != SV_STIDLE; + } + + } while (1); + } + } + else if (s == SV_STCONN) { /* connection in progress */ + if (c == CL_STCLOSE || c == CL_STSHUTW || + (c == CL_STSHUTR && + (t->req->l == 0 || t->proxy->options & PR_O_ABRT_CLOSE))) { /* give up */ + tv_eternity(&t->cnexpire); + fd_delete(t->srv_fd); + if (t->srv) + t->srv->cur_sess--; + + /* note that this must not return any error because it would be able to + * overwrite the client_retnclose() output. + */ + srv_close_with_err(t, SN_ERR_CLICL, SN_FINST_C, 0, 0, NULL); + return 1; + } + if (t->res_sw == RES_SILENT && tv_cmp2_ms(&t->cnexpire, &now) > 0) { + //fprintf(stderr,"1: c=%d, s=%d, now=%d.%06d, exp=%d.%06d\n", c, s, now.tv_sec, now.tv_usec, t->cnexpire.tv_sec, t->cnexpire.tv_usec); + return 0; /* nothing changed */ + } + else if (t->res_sw == RES_SILENT || t->res_sw == RES_ERROR) { + /* timeout, asynchronous connect error or first write error */ + //fprintf(stderr,"2: c=%d, s=%d\n", c, s); + + fd_delete(t->srv_fd); + if (t->srv) + t->srv->cur_sess--; + + if (t->res_sw == RES_SILENT) + conn_err = SN_ERR_SRVTO; // it was a connect timeout. + else + conn_err = SN_ERR_SRVCL; // it was an asynchronous connect error. + + /* ensure that we have enough retries left */ + if (srv_count_retry_down(t, conn_err)) + return 1; + + do { + /* Now we will try to either reconnect to the same server or + * connect to another server. If the connection gets queued + * because all servers are saturated, then we will go back to + * the SV_STIDLE state. + */ + if (srv_retryable_connect(t)) { + t->logs.t_queue = tv_diff(&t->logs.tv_accept, &now); + return t->srv_state != SV_STCONN; + } + + /* we need to redispatch the connection to another server */ + if (srv_redispatch_connect(t)) + return t->srv_state != SV_STCONN; + } while (1); + } + else { /* no error or write 0 */ + t->logs.t_connect = tv_diff(&t->logs.tv_accept, &now); + + //fprintf(stderr,"3: c=%d, s=%d\n", c, s); + if (req->l == 0) /* nothing to write */ { + FD_CLR(t->srv_fd, StaticWriteEvent); + tv_eternity(&t->swexpire); + } else /* need the right to write */ { + FD_SET(t->srv_fd, StaticWriteEvent); + if (t->proxy->srvtimeout) { + tv_delayfrom(&t->swexpire, &now, t->proxy->srvtimeout); + /* FIXME: to prevent the server from expiring read timeouts during writes, + * we refresh it. */ + t->srexpire = t->swexpire; + } + else + tv_eternity(&t->swexpire); + } + + if (t->proxy->mode == PR_MODE_TCP) { /* let's allow immediate data connection in this case */ + FD_SET(t->srv_fd, StaticReadEvent); + if (t->proxy->srvtimeout) + tv_delayfrom(&t->srexpire, &now, t->proxy->srvtimeout); + else + tv_eternity(&t->srexpire); + + t->srv_state = SV_STDATA; + if (t->srv) + t->srv->cum_sess++; + rep->rlim = rep->data + BUFSIZE; /* no rewrite needed */ + + /* if the user wants to log as soon as possible, without counting + bytes from the server, then this is the right moment. */ + if (t->proxy->to_log && !(t->logs.logwait & LW_BYTES)) { + t->logs.t_close = t->logs.t_connect; /* to get a valid end date */ + sess_log(t); + } + } + else { + t->srv_state = SV_STHEADERS; + if (t->srv) + t->srv->cum_sess++; + rep->rlim = rep->data + BUFSIZE - MAXREWRITE; /* rewrite needed */ + } + tv_eternity(&t->cnexpire); + return 1; + } + } + else if (s == SV_STHEADERS) { /* receiving server headers */ + /* now parse the partial (or complete) headers */ + while (rep->lr < rep->r) { /* this loop only sees one header at each iteration */ + char *ptr; + int delete_header; + + ptr = rep->lr; + + /* look for the end of the current header */ + while (ptr < rep->r && *ptr != '\n' && *ptr != '\r') + ptr++; + + if (ptr == rep->h) { + int line, len; + + /* we can only get here after an end of headers */ + + /* first, we'll block if security checks have caught nasty things */ + if (t->flags & SN_CACHEABLE) { + if ((t->flags & SN_CACHE_COOK) && + (t->flags & SN_SCK_ANY) && + (t->proxy->options & PR_O_CHK_CACHE)) { + + /* we're in presence of a cacheable response containing + * a set-cookie header. We'll block it as requested by + * the 'checkcache' option, and send an alert. + */ + tv_eternity(&t->srexpire); + tv_eternity(&t->swexpire); + fd_delete(t->srv_fd); + if (t->srv) { + t->srv->cur_sess--; + t->srv->failed_secu++; + } + t->proxy->failed_secu++; + t->srv_state = SV_STCLOSE; + t->logs.status = 502; + client_return(t, t->proxy->errmsg.len502, t->proxy->errmsg.msg502); + if (!(t->flags & SN_ERR_MASK)) + t->flags |= SN_ERR_PRXCOND; + if (!(t->flags & SN_FINST_MASK)) + t->flags |= SN_FINST_H; + + Alert("Blocking cacheable cookie in response from instance %s, server %s.\n", t->proxy->id, t->srv->id); + send_log(t->proxy, LOG_ALERT, "Blocking cacheable cookie in response from instance %s, server %s.\n", t->proxy->id, t->srv->id); + + /* We used to have a free connection slot. Since we'll never use it, + * we have to inform the server that it may be used by another session. + */ + if (may_dequeue_tasks(t->srv, t->proxy)) + task_wakeup(&rq, t->srv->queue_mgt); + + return 1; + } + } + + /* next, we'll block if an 'rspideny' or 'rspdeny' filter matched */ + if (t->flags & SN_SVDENY) { + tv_eternity(&t->srexpire); + tv_eternity(&t->swexpire); + fd_delete(t->srv_fd); + if (t->srv) { + t->srv->cur_sess--; + t->srv->failed_secu++; + } + t->proxy->failed_secu++; + t->srv_state = SV_STCLOSE; + t->logs.status = 502; + client_return(t, t->proxy->errmsg.len502, t->proxy->errmsg.msg502); + if (!(t->flags & SN_ERR_MASK)) + t->flags |= SN_ERR_PRXCOND; + if (!(t->flags & SN_FINST_MASK)) + t->flags |= SN_FINST_H; + /* We used to have a free connection slot. Since we'll never use it, + * we have to inform the server that it may be used by another session. + */ + if (may_dequeue_tasks(t->srv, t->proxy)) + task_wakeup(&rq, t->srv->queue_mgt); + + return 1; + } + + /* we'll have something else to do here : add new headers ... */ + + if ((t->srv) && !(t->flags & SN_DIRECT) && (t->proxy->options & PR_O_COOK_INS) && + (!(t->proxy->options & PR_O_COOK_POST) || (t->flags & SN_POST))) { + /* the server is known, it's not the one the client requested, we have to + * insert a set-cookie here, except if we want to insert only on POST + * requests and this one isn't. Note that servers which don't have cookies + * (eg: some backup servers) will return a full cookie removal request. + */ + len = sprintf(trash, "Set-Cookie: %s=%s; path=/\r\n", + t->proxy->cookie_name, + t->srv->cookie ? t->srv->cookie : "; Expires=Thu, 01-Jan-1970 00:00:01 GMT"); + + t->flags |= SN_SCK_INSERTED; + + /* Here, we will tell an eventual cache on the client side that we don't + * want it to cache this reply because HTTP/1.0 caches also cache cookies ! + * Some caches understand the correct form: 'no-cache="set-cookie"', but + * others don't (eg: apache <= 1.3.26). So we use 'private' instead. + */ + if (t->proxy->options & PR_O_COOK_NOC) + //len += sprintf(newhdr + len, "Cache-control: no-cache=\"set-cookie\"\r\n"); + len += sprintf(trash + len, "Cache-control: private\r\n"); + + if (rep->data + rep->l < rep->h) + /* The data has been stolen, we will crash cleanly instead of corrupting memory */ + *(int *)0 = 0; + buffer_replace2(rep, rep->h, rep->h, trash, len); + } + + /* headers to be added */ + for (line = 0; line < t->proxy->nb_rspadd; line++) { + len = sprintf(trash, "%s\r\n", t->proxy->rsp_add[line]); + buffer_replace2(rep, rep->h, rep->h, trash, len); + } + + /* add a "connection: close" line if needed */ + if (t->proxy->options & PR_O_HTTP_CLOSE) + buffer_replace2(rep, rep->h, rep->h, "Connection: close\r\n", 19); + + t->srv_state = SV_STDATA; + rep->rlim = rep->data + BUFSIZE; /* no more rewrite needed */ + t->logs.t_data = tv_diff(&t->logs.tv_accept, &now); + + /* client connection already closed or option 'httpclose' required : + * we close the server's outgoing connection right now. + */ + if ((req->l == 0) && + (c == CL_STSHUTR || c == CL_STCLOSE || t->proxy->options & PR_O_FORCE_CLO)) { + FD_CLR(t->srv_fd, StaticWriteEvent); + tv_eternity(&t->swexpire); + + /* We must ensure that the read part is still alive when switching + * to shutw */ + FD_SET(t->srv_fd, StaticReadEvent); + if (t->proxy->srvtimeout) + tv_delayfrom(&t->srexpire, &now, t->proxy->srvtimeout); + + shutdown(t->srv_fd, SHUT_WR); + t->srv_state = SV_STSHUTW; + } + + /* if the user wants to log as soon as possible, without counting + bytes from the server, then this is the right moment. */ + if (t->proxy->to_log && !(t->logs.logwait & LW_BYTES)) { + t->logs.t_close = t->logs.t_data; /* to get a valid end date */ + t->logs.bytes = rep->h - rep->data; + sess_log(t); + } + break; + } + + /* to get a complete header line, we need the ending \r\n, \n\r, \r or \n too */ + if (ptr > rep->r - 2) { + /* this is a partial header, let's wait for more to come */ + rep->lr = ptr; + break; + } + + // fprintf(stderr,"h=%p, ptr=%p, lr=%p, r=%p, *h=", rep->h, ptr, rep->lr, rep->r); + // write(2, rep->h, ptr - rep->h); fprintf(stderr,"\n"); + + /* now we know that *ptr is either \r or \n, + * and that there are at least 1 char after it. + */ + if ((ptr[0] == ptr[1]) || (ptr[1] != '\r' && ptr[1] != '\n')) + rep->lr = ptr + 1; /* \r\r, \n\n, \r[^\n], \n[^\r] */ + else + rep->lr = ptr + 2; /* \r\n or \n\r */ + + /* + * now we know that we have a full header ; we can do whatever + * we want with these pointers : + * rep->h = beginning of header + * ptr = end of header (first \r or \n) + * rep->lr = beginning of next line (next rep->h) + * rep->r = end of data (not used at this stage) + */ + + + if (t->logs.status == -1) { + t->logs.logwait &= ~LW_RESP; + t->logs.status = atoi(rep->h + 9); + switch (t->logs.status) { + case 200: + case 203: + case 206: + case 300: + case 301: + case 410: + /* RFC2616 @13.4: + * "A response received with a status code of + * 200, 203, 206, 300, 301 or 410 MAY be stored + * by a cache (...) unless a cache-control + * directive prohibits caching." + * + * RFC2616 @9.5: POST method : + * "Responses to this method are not cacheable, + * unless the response includes appropriate + * Cache-Control or Expires header fields." + */ + if (!(t->flags & SN_POST) && (t->proxy->options & PR_O_CHK_CACHE)) + t->flags |= SN_CACHEABLE | SN_CACHE_COOK; + break; + default: + break; + } + } + else if (t->logs.logwait & LW_RSPHDR) { + struct cap_hdr *h; + int len; + for (h = t->proxy->rsp_cap; h; h = h->next) { + if ((h->namelen + 2 <= ptr - rep->h) && + (rep->h[h->namelen] == ':') && + (strncasecmp(rep->h, h->name, h->namelen) == 0)) { + + if (t->rsp_cap[h->index] == NULL) + t->rsp_cap[h->index] = pool_alloc_from(h->pool, h->len + 1); + + len = ptr - (rep->h + h->namelen + 2); + if (len > h->len) + len = h->len; + + memcpy(t->rsp_cap[h->index], rep->h + h->namelen + 2, len); + t->rsp_cap[h->index][len]=0; + } + } + + } + + delete_header = 0; + + if ((global.mode & MODE_DEBUG) && (!(global.mode & MODE_QUIET) || (global.mode & MODE_VERBOSE))) { + int len, max; + len = sprintf(trash, "%08x:%s.srvhdr[%04x:%04x]: ", t->uniq_id, t->proxy->id, (unsigned short)t->cli_fd, (unsigned short)t->srv_fd); + max = ptr - rep->h; + UBOUND(max, sizeof(trash) - len - 1); + len += strlcpy2(trash + len, rep->h, max + 1); + trash[len++] = '\n'; + write(1, trash, len); + } + + /* remove "connection: " if needed */ + if (!delete_header && (t->proxy->options & PR_O_HTTP_CLOSE) + && (strncasecmp(rep->h, "Connection: ", 12) == 0)) { + delete_header = 1; + } + + /* try headers regexps */ + if (!delete_header && t->proxy->rsp_exp != NULL + && !(t->flags & SN_SVDENY)) { + struct hdr_exp *exp; + char term; + + term = *ptr; + *ptr = '\0'; + exp = t->proxy->rsp_exp; + do { + if (regexec(exp->preg, rep->h, MAX_MATCH, pmatch, 0) == 0) { + switch (exp->action) { + case ACT_ALLOW: + if (!(t->flags & SN_SVDENY)) + t->flags |= SN_SVALLOW; + break; + case ACT_REPLACE: + if (!(t->flags & SN_SVDENY)) { + int len = exp_replace(trash, rep->h, exp->replace, pmatch); + ptr += buffer_replace2(rep, rep->h, ptr, trash, len); + } + break; + case ACT_REMOVE: + if (!(t->flags & SN_SVDENY)) + delete_header = 1; + break; + case ACT_DENY: + if (!(t->flags & SN_SVALLOW)) + t->flags |= SN_SVDENY; + break; + case ACT_PASS: /* we simply don't deny this one */ + break; + } + break; + } + } while ((exp = exp->next) != NULL); + *ptr = term; /* restore the string terminator */ + } + + /* check for cache-control: or pragma: headers */ + if (!delete_header && (t->flags & SN_CACHEABLE)) { + if (strncasecmp(rep->h, "Pragma: no-cache", 16) == 0) + t->flags &= ~SN_CACHEABLE & ~SN_CACHE_COOK; + else if (strncasecmp(rep->h, "Cache-control: ", 15) == 0) { + if (strncasecmp(rep->h + 15, "no-cache", 8) == 0) { + if (rep->h + 23 == ptr || rep->h[23] == ',') + t->flags &= ~SN_CACHEABLE & ~SN_CACHE_COOK; + else { + if (strncasecmp(rep->h + 23, "=\"set-cookie", 12) == 0 + && (rep->h[35] == '"' || rep->h[35] == ',')) + t->flags &= ~SN_CACHE_COOK; + } + } else if ((strncasecmp(rep->h + 15, "private", 7) == 0 && + (rep->h + 22 == ptr || rep->h[22] == ',')) + || (strncasecmp(rep->h + 15, "no-store", 8) == 0 && + (rep->h + 23 == ptr || rep->h[23] == ','))) { + t->flags &= ~SN_CACHEABLE & ~SN_CACHE_COOK; + } else if (strncasecmp(rep->h + 15, "max-age=0", 9) == 0 && + (rep->h + 24 == ptr || rep->h[24] == ',')) { + t->flags &= ~SN_CACHEABLE & ~SN_CACHE_COOK; + } else if (strncasecmp(rep->h + 15, "s-maxage=0", 10) == 0 && + (rep->h + 25 == ptr || rep->h[25] == ',')) { + t->flags &= ~SN_CACHEABLE & ~SN_CACHE_COOK; + } else if (strncasecmp(rep->h + 15, "public", 6) == 0 && + (rep->h + 21 == ptr || rep->h[21] == ',')) { + t->flags |= SN_CACHEABLE | SN_CACHE_COOK; + } + } + } + + /* check for server cookies */ + if (!delete_header /*&& (t->proxy->options & PR_O_COOK_ANY)*/ + && (t->proxy->cookie_name != NULL || t->proxy->capture_name != NULL || t->proxy->appsession_name !=NULL) + && (strncasecmp(rep->h, "Set-Cookie: ", 12) == 0)) { + char *p1, *p2, *p3, *p4; + + t->flags |= SN_SCK_ANY; + + p1 = rep->h + 12; /* first char after 'Set-Cookie: ' */ + + while (p1 < ptr) { /* in fact, we'll break after the first cookie */ + while (p1 < ptr && (isspace((int)*p1))) + p1++; + + if (p1 == ptr || *p1 == ';') /* end of cookie */ + break; + + /* p1 is at the beginning of the cookie name */ + p2 = p1; + + while (p2 < ptr && *p2 != '=' && *p2 != ';') + p2++; + + if (p2 == ptr || *p2 == ';') /* next cookie */ + break; + + p3 = p2 + 1; /* skips the '=' sign */ + if (p3 == ptr) + break; + + p4 = p3; + while (p4 < ptr && !isspace((int)*p4) && *p4 != ';') + p4++; + + /* here, we have the cookie name between p1 and p2, + * and its value between p3 and p4. + * we can process it. + */ + + /* first, let's see if we want to capture it */ + if (t->proxy->capture_name != NULL && + t->logs.srv_cookie == NULL && + (p4 - p1 >= t->proxy->capture_namelen) && + memcmp(p1, t->proxy->capture_name, t->proxy->capture_namelen) == 0) { + int log_len = p4 - p1; + + if ((t->logs.srv_cookie = pool_alloc(capture)) == NULL) { + Alert("HTTP logging : out of memory.\n"); + } + + if (log_len > t->proxy->capture_len) + log_len = t->proxy->capture_len; + memcpy(t->logs.srv_cookie, p1, log_len); + t->logs.srv_cookie[log_len] = 0; + } + + if ((p2 - p1 == t->proxy->cookie_len) && (t->proxy->cookie_name != NULL) && + (memcmp(p1, t->proxy->cookie_name, p2 - p1) == 0)) { + /* Cool... it's the right one */ + t->flags |= SN_SCK_SEEN; + + /* If the cookie is in insert mode on a known server, we'll delete + * this occurrence because we'll insert another one later. + * We'll delete it too if the "indirect" option is set and we're in + * a direct access. */ + if (((t->srv) && (t->proxy->options & PR_O_COOK_INS)) || + ((t->flags & SN_DIRECT) && (t->proxy->options & PR_O_COOK_IND))) { + /* this header must be deleted */ + delete_header = 1; + t->flags |= SN_SCK_DELETED; + } + else if ((t->srv) && (t->proxy->options & PR_O_COOK_RW)) { + /* replace bytes p3->p4 with the cookie name associated + * with this server since we know it. + */ + buffer_replace2(rep, p3, p4, t->srv->cookie, t->srv->cklen); + t->flags |= SN_SCK_INSERTED | SN_SCK_DELETED; + } + else if ((t->srv) && (t->proxy->options & PR_O_COOK_PFX)) { + /* insert the cookie name associated with this server + * before existing cookie, and insert a delimitor between them.. + */ + buffer_replace2(rep, p3, p3, t->srv->cookie, t->srv->cklen + 1); + p3[t->srv->cklen] = COOKIE_DELIM; + t->flags |= SN_SCK_INSERTED | SN_SCK_DELETED; + } + break; + } + + /* first, let's see if the cookie is our appcookie*/ + if ((t->proxy->appsession_name != NULL) && + (memcmp(p1, t->proxy->appsession_name, p2 - p1) == 0)) { + + /* Cool... it's the right one */ + + size_t server_id_len = strlen(t->srv->id) + 1; + asession_temp = &local_asession; + + if ((asession_temp->sessid = pool_alloc_from(apools.sessid, apools.ses_msize)) == NULL) { + Alert("Not enought Memory process_srv():asession->sessid:malloc().\n"); + send_log(t->proxy, LOG_ALERT, "Not enought Memory process_srv():asession->sessid:malloc().\n"); + } + memcpy(asession_temp->sessid, p3, t->proxy->appsession_len); + asession_temp->sessid[t->proxy->appsession_len] = 0; + asession_temp->serverid = NULL; + + /* only do insert, if lookup fails */ + if (chtbl_lookup(&(t->proxy->htbl_proxy), (void *) &asession_temp) != 0) { + if ((asession_temp = pool_alloc(appsess)) == NULL) { + Alert("Not enought Memory process_srv():asession:calloc().\n"); + send_log(t->proxy, LOG_ALERT, "Not enought Memory process_srv():asession:calloc().\n"); + return 0; + } + asession_temp->sessid = local_asession.sessid; + asession_temp->serverid = local_asession.serverid; + chtbl_insert(&(t->proxy->htbl_proxy), (void *) asession_temp); + }/* end if (chtbl_lookup()) */ + else { + /* free wasted memory */ + pool_free_to(apools.sessid, local_asession.sessid); + } /* end else from if (chtbl_lookup()) */ + + if (asession_temp->serverid == NULL) { + if ((asession_temp->serverid = pool_alloc_from(apools.serverid, apools.ser_msize)) == NULL) { + Alert("Not enought Memory process_srv():asession->sessid:malloc().\n"); + send_log(t->proxy, LOG_ALERT, "Not enought Memory process_srv():asession->sessid:malloc().\n"); + } + asession_temp->serverid[0] = '\0'; + } + + if (asession_temp->serverid[0] == '\0') + memcpy(asession_temp->serverid,t->srv->id,server_id_len); + + tv_delayfrom(&asession_temp->expire, &now, t->proxy->appsession_timeout); + +#if defined(DEBUG_HASH) + print_table(&(t->proxy->htbl_proxy)); +#endif + break; + }/* end if ((t->proxy->appsession_name != NULL) ... */ + else { + // fprintf(stderr,"Ignoring unknown cookie : "); + // write(2, p1, p2-p1); + // fprintf(stderr," = "); + // write(2, p3, p4-p3); + // fprintf(stderr,"\n"); + } + break; /* we don't want to loop again since there cannot be another cookie on the same line */ + } /* we're now at the end of the cookie value */ + } /* end of cookie processing */ + + /* check for any set-cookie in case we check for cacheability */ + if (!delete_header && !(t->flags & SN_SCK_ANY) && + (t->proxy->options & PR_O_CHK_CACHE) && + (strncasecmp(rep->h, "Set-Cookie: ", 12) == 0)) { + t->flags |= SN_SCK_ANY; + } + + /* let's look if we have to delete this header */ + if (delete_header && !(t->flags & SN_SVDENY)) + buffer_replace2(rep, rep->h, rep->lr, "", 0); + + rep->h = rep->lr; + } /* while (rep->lr < rep->r) */ + + /* end of header processing (even if incomplete) */ + + if ((rep->l < rep->rlim - rep->data) && ! FD_ISSET(t->srv_fd, StaticReadEvent)) { + /* fd in StaticReadEvent was disabled, perhaps because of a previous buffer + * full. We cannot loop here since event_srv_read will disable it only if + * rep->l == rlim-data + */ + FD_SET(t->srv_fd, StaticReadEvent); + if (t->proxy->srvtimeout) + tv_delayfrom(&t->srexpire, &now, t->proxy->srvtimeout); + else + tv_eternity(&t->srexpire); + } + + /* read error, write error */ + if (t->res_sw == RES_ERROR || t->res_sr == RES_ERROR) { + tv_eternity(&t->srexpire); + tv_eternity(&t->swexpire); + fd_delete(t->srv_fd); + if (t->srv) { + t->srv->cur_sess--; + t->srv->failed_resp++; + } + t->proxy->failed_resp++; + + t->srv_state = SV_STCLOSE; + t->logs.status = 502; + client_return(t, t->proxy->errmsg.len502, t->proxy->errmsg.msg502); + if (!(t->flags & SN_ERR_MASK)) + t->flags |= SN_ERR_SRVCL; + if (!(t->flags & SN_FINST_MASK)) + t->flags |= SN_FINST_H; + /* We used to have a free connection slot. Since we'll never use it, + * we have to inform the server that it may be used by another session. + */ + if (may_dequeue_tasks(t->srv, t->proxy)) + task_wakeup(&rq, t->srv->queue_mgt); + + return 1; + } + /* end of client write or end of server read. + * since we are in header mode, if there's no space left for headers, we + * won't be able to free more later, so the session will never terminate. + */ + else if (t->res_sr == RES_NULL || c == CL_STSHUTW || c == CL_STCLOSE || rep->l >= rep->rlim - rep->data) { + FD_CLR(t->srv_fd, StaticReadEvent); + tv_eternity(&t->srexpire); + shutdown(t->srv_fd, SHUT_RD); + t->srv_state = SV_STSHUTR; + //fprintf(stderr,"%p:%s(%d), c=%d, s=%d\n", t, __FUNCTION__, __LINE__, t->cli_state, t->cli_state); + return 1; + } + /* read timeout : return a 504 to the client. + */ + else if (FD_ISSET(t->srv_fd, StaticReadEvent) && tv_cmp2_ms(&t->srexpire, &now) <= 0) { + tv_eternity(&t->srexpire); + tv_eternity(&t->swexpire); + fd_delete(t->srv_fd); + if (t->srv) { + t->srv->cur_sess--; + t->srv->failed_resp++; + } + t->proxy->failed_resp++; + t->srv_state = SV_STCLOSE; + t->logs.status = 504; + client_return(t, t->proxy->errmsg.len504, t->proxy->errmsg.msg504); + if (!(t->flags & SN_ERR_MASK)) + t->flags |= SN_ERR_SRVTO; + if (!(t->flags & SN_FINST_MASK)) + t->flags |= SN_FINST_H; + /* We used to have a free connection slot. Since we'll never use it, + * we have to inform the server that it may be used by another session. + */ + if (may_dequeue_tasks(t->srv, t->proxy)) + task_wakeup(&rq, t->srv->queue_mgt); + + return 1; + } + /* last client read and buffer empty */ + /* FIXME!!! here, we don't want to switch to SHUTW if the + * client shuts read too early, because we may still have + * some work to do on the headers. + * The side-effect is that if the client completely closes its + * connection during SV_STHEADER, the connection to the server + * is kept until a response comes back or the timeout is reached. + */ + else if ((/*c == CL_STSHUTR ||*/ c == CL_STCLOSE) && (req->l == 0)) { + FD_CLR(t->srv_fd, StaticWriteEvent); + tv_eternity(&t->swexpire); + + /* We must ensure that the read part is still alive when switching + * to shutw */ + FD_SET(t->srv_fd, StaticReadEvent); + if (t->proxy->srvtimeout) + tv_delayfrom(&t->srexpire, &now, t->proxy->srvtimeout); + + shutdown(t->srv_fd, SHUT_WR); + t->srv_state = SV_STSHUTW; + return 1; + } + /* write timeout */ + /* FIXME!!! here, we don't want to switch to SHUTW if the + * client shuts read too early, because we may still have + * some work to do on the headers. + */ + else if (FD_ISSET(t->srv_fd, StaticWriteEvent) && tv_cmp2_ms(&t->swexpire, &now) <= 0) { + FD_CLR(t->srv_fd, StaticWriteEvent); + tv_eternity(&t->swexpire); + shutdown(t->srv_fd, SHUT_WR); + /* We must ensure that the read part is still alive when switching + * to shutw */ + FD_SET(t->srv_fd, StaticReadEvent); + if (t->proxy->srvtimeout) + tv_delayfrom(&t->srexpire, &now, t->proxy->srvtimeout); + + /* We must ensure that the read part is still alive when switching + * to shutw */ + FD_SET(t->srv_fd, StaticReadEvent); + if (t->proxy->srvtimeout) + tv_delayfrom(&t->srexpire, &now, t->proxy->srvtimeout); + + t->srv_state = SV_STSHUTW; + if (!(t->flags & SN_ERR_MASK)) + t->flags |= SN_ERR_SRVTO; + if (!(t->flags & SN_FINST_MASK)) + t->flags |= SN_FINST_H; + return 1; + } + + if (req->l == 0) { + if (FD_ISSET(t->srv_fd, StaticWriteEvent)) { + FD_CLR(t->srv_fd, StaticWriteEvent); /* stop writing */ + tv_eternity(&t->swexpire); + } + } + else { /* client buffer not empty */ + if (! FD_ISSET(t->srv_fd, StaticWriteEvent)) { + FD_SET(t->srv_fd, StaticWriteEvent); /* restart writing */ + if (t->proxy->srvtimeout) { + tv_delayfrom(&t->swexpire, &now, t->proxy->srvtimeout); + /* FIXME: to prevent the server from expiring read timeouts during writes, + * we refresh it. */ + t->srexpire = t->swexpire; + } + else + tv_eternity(&t->swexpire); + } + } + + /* be nice with the client side which would like to send a complete header + * FIXME: COMPLETELY BUGGY !!! not all headers may be processed because the client + * would read all remaining data at once ! The client should not write past rep->lr + * when the server is in header state. + */ + //return header_processed; + return t->srv_state != SV_STHEADERS; + } + else if (s == SV_STDATA) { + /* read or write error */ + if (t->res_sw == RES_ERROR || t->res_sr == RES_ERROR) { + tv_eternity(&t->srexpire); + tv_eternity(&t->swexpire); + fd_delete(t->srv_fd); + if (t->srv) { + t->srv->cur_sess--; + t->srv->failed_resp++; + } + t->proxy->failed_resp++; + t->srv_state = SV_STCLOSE; + if (!(t->flags & SN_ERR_MASK)) + t->flags |= SN_ERR_SRVCL; + if (!(t->flags & SN_FINST_MASK)) + t->flags |= SN_FINST_D; + /* We used to have a free connection slot. Since we'll never use it, + * we have to inform the server that it may be used by another session. + */ + if (may_dequeue_tasks(t->srv, t->proxy)) + task_wakeup(&rq, t->srv->queue_mgt); + + return 1; + } + /* last read, or end of client write */ + else if (t->res_sr == RES_NULL || c == CL_STSHUTW || c == CL_STCLOSE) { + FD_CLR(t->srv_fd, StaticReadEvent); + tv_eternity(&t->srexpire); + shutdown(t->srv_fd, SHUT_RD); + t->srv_state = SV_STSHUTR; + //fprintf(stderr,"%p:%s(%d), c=%d, s=%d\n", t, __FUNCTION__, __LINE__, t->cli_state, t->cli_state); + return 1; + } + /* end of client read and no more data to send */ + else if ((c == CL_STSHUTR || c == CL_STCLOSE) && (req->l == 0)) { + FD_CLR(t->srv_fd, StaticWriteEvent); + tv_eternity(&t->swexpire); + shutdown(t->srv_fd, SHUT_WR); + /* We must ensure that the read part is still alive when switching + * to shutw */ + FD_SET(t->srv_fd, StaticReadEvent); + if (t->proxy->srvtimeout) + tv_delayfrom(&t->srexpire, &now, t->proxy->srvtimeout); + + t->srv_state = SV_STSHUTW; + return 1; + } + /* read timeout */ + else if (tv_cmp2_ms(&t->srexpire, &now) <= 0) { + FD_CLR(t->srv_fd, StaticReadEvent); + tv_eternity(&t->srexpire); + shutdown(t->srv_fd, SHUT_RD); + t->srv_state = SV_STSHUTR; + if (!(t->flags & SN_ERR_MASK)) + t->flags |= SN_ERR_SRVTO; + if (!(t->flags & SN_FINST_MASK)) + t->flags |= SN_FINST_D; + return 1; + } + /* write timeout */ + else if (tv_cmp2_ms(&t->swexpire, &now) <= 0) { + FD_CLR(t->srv_fd, StaticWriteEvent); + tv_eternity(&t->swexpire); + shutdown(t->srv_fd, SHUT_WR); + /* We must ensure that the read part is still alive when switching + * to shutw */ + FD_SET(t->srv_fd, StaticReadEvent); + if (t->proxy->srvtimeout) + tv_delayfrom(&t->srexpire, &now, t->proxy->srvtimeout); + t->srv_state = SV_STSHUTW; + if (!(t->flags & SN_ERR_MASK)) + t->flags |= SN_ERR_SRVTO; + if (!(t->flags & SN_FINST_MASK)) + t->flags |= SN_FINST_D; + return 1; + } + + /* recompute request time-outs */ + if (req->l == 0) { + if (FD_ISSET(t->srv_fd, StaticWriteEvent)) { + FD_CLR(t->srv_fd, StaticWriteEvent); /* stop writing */ + tv_eternity(&t->swexpire); + } + } + else { /* buffer not empty, there are still data to be transferred */ + if (! FD_ISSET(t->srv_fd, StaticWriteEvent)) { + FD_SET(t->srv_fd, StaticWriteEvent); /* restart writing */ + if (t->proxy->srvtimeout) { + tv_delayfrom(&t->swexpire, &now, t->proxy->srvtimeout); + /* FIXME: to prevent the server from expiring read timeouts during writes, + * we refresh it. */ + t->srexpire = t->swexpire; + } + else + tv_eternity(&t->swexpire); + } + } + + /* recompute response time-outs */ + if (rep->l == BUFSIZE) { /* no room to read more data */ + if (FD_ISSET(t->srv_fd, StaticReadEvent)) { + FD_CLR(t->srv_fd, StaticReadEvent); + tv_eternity(&t->srexpire); + } + } + else { + if (! FD_ISSET(t->srv_fd, StaticReadEvent)) { + FD_SET(t->srv_fd, StaticReadEvent); + if (t->proxy->srvtimeout) + tv_delayfrom(&t->srexpire, &now, t->proxy->srvtimeout); + else + tv_eternity(&t->srexpire); + } + } + + return 0; /* other cases change nothing */ + } + else if (s == SV_STSHUTR) { + if (t->res_sw == RES_ERROR) { + //FD_CLR(t->srv_fd, StaticWriteEvent); + tv_eternity(&t->swexpire); + fd_delete(t->srv_fd); + if (t->srv) { + t->srv->cur_sess--; + t->srv->failed_resp++; + } + t->proxy->failed_resp++; + //close(t->srv_fd); + t->srv_state = SV_STCLOSE; + if (!(t->flags & SN_ERR_MASK)) + t->flags |= SN_ERR_SRVCL; + if (!(t->flags & SN_FINST_MASK)) + t->flags |= SN_FINST_D; + /* We used to have a free connection slot. Since we'll never use it, + * we have to inform the server that it may be used by another session. + */ + if (may_dequeue_tasks(t->srv, t->proxy)) + task_wakeup(&rq, t->srv->queue_mgt); + + return 1; + } + else if ((c == CL_STSHUTR || c == CL_STCLOSE) && (req->l == 0)) { + //FD_CLR(t->srv_fd, StaticWriteEvent); + tv_eternity(&t->swexpire); + fd_delete(t->srv_fd); + if (t->srv) + t->srv->cur_sess--; + //close(t->srv_fd); + t->srv_state = SV_STCLOSE; + /* We used to have a free connection slot. Since we'll never use it, + * we have to inform the server that it may be used by another session. + */ + if (may_dequeue_tasks(t->srv, t->proxy)) + task_wakeup(&rq, t->srv->queue_mgt); + + return 1; + } + else if (tv_cmp2_ms(&t->swexpire, &now) <= 0) { + //FD_CLR(t->srv_fd, StaticWriteEvent); + tv_eternity(&t->swexpire); + fd_delete(t->srv_fd); + if (t->srv) + t->srv->cur_sess--; + //close(t->srv_fd); + t->srv_state = SV_STCLOSE; + if (!(t->flags & SN_ERR_MASK)) + t->flags |= SN_ERR_SRVTO; + if (!(t->flags & SN_FINST_MASK)) + t->flags |= SN_FINST_D; + /* We used to have a free connection slot. Since we'll never use it, + * we have to inform the server that it may be used by another session. + */ + if (may_dequeue_tasks(t->srv, t->proxy)) + task_wakeup(&rq, t->srv->queue_mgt); + + return 1; + } + else if (req->l == 0) { + if (FD_ISSET(t->srv_fd, StaticWriteEvent)) { + FD_CLR(t->srv_fd, StaticWriteEvent); /* stop writing */ + tv_eternity(&t->swexpire); + } + } + else { /* buffer not empty */ + if (! FD_ISSET(t->srv_fd, StaticWriteEvent)) { + FD_SET(t->srv_fd, StaticWriteEvent); /* restart writing */ + if (t->proxy->srvtimeout) { + tv_delayfrom(&t->swexpire, &now, t->proxy->srvtimeout); + /* FIXME: to prevent the server from expiring read timeouts during writes, + * we refresh it. */ + t->srexpire = t->swexpire; + } + else + tv_eternity(&t->swexpire); + } + } + return 0; + } + else if (s == SV_STSHUTW) { + if (t->res_sr == RES_ERROR) { + //FD_CLR(t->srv_fd, StaticReadEvent); + tv_eternity(&t->srexpire); + fd_delete(t->srv_fd); + if (t->srv) { + t->srv->cur_sess--; + t->srv->failed_resp++; + } + t->proxy->failed_resp++; + //close(t->srv_fd); + t->srv_state = SV_STCLOSE; + if (!(t->flags & SN_ERR_MASK)) + t->flags |= SN_ERR_SRVCL; + if (!(t->flags & SN_FINST_MASK)) + t->flags |= SN_FINST_D; + /* We used to have a free connection slot. Since we'll never use it, + * we have to inform the server that it may be used by another session. + */ + if (may_dequeue_tasks(t->srv, t->proxy)) + task_wakeup(&rq, t->srv->queue_mgt); + + return 1; + } + else if (t->res_sr == RES_NULL || c == CL_STSHUTW || c == CL_STCLOSE) { + //FD_CLR(t->srv_fd, StaticReadEvent); + tv_eternity(&t->srexpire); + fd_delete(t->srv_fd); + if (t->srv) + t->srv->cur_sess--; + //close(t->srv_fd); + t->srv_state = SV_STCLOSE; + /* We used to have a free connection slot. Since we'll never use it, + * we have to inform the server that it may be used by another session. + */ + if (may_dequeue_tasks(t->srv, t->proxy)) + task_wakeup(&rq, t->srv->queue_mgt); + + return 1; + } + else if (tv_cmp2_ms(&t->srexpire, &now) <= 0) { + //FD_CLR(t->srv_fd, StaticReadEvent); + tv_eternity(&t->srexpire); + fd_delete(t->srv_fd); + if (t->srv) + t->srv->cur_sess--; + //close(t->srv_fd); + t->srv_state = SV_STCLOSE; + if (!(t->flags & SN_ERR_MASK)) + t->flags |= SN_ERR_SRVTO; + if (!(t->flags & SN_FINST_MASK)) + t->flags |= SN_FINST_D; + /* We used to have a free connection slot. Since we'll never use it, + * we have to inform the server that it may be used by another session. + */ + if (may_dequeue_tasks(t->srv, t->proxy)) + task_wakeup(&rq, t->srv->queue_mgt); + + return 1; + } + else if (rep->l == BUFSIZE) { /* no room to read more data */ + if (FD_ISSET(t->srv_fd, StaticReadEvent)) { + FD_CLR(t->srv_fd, StaticReadEvent); + tv_eternity(&t->srexpire); + } + } + else { + if (! FD_ISSET(t->srv_fd, StaticReadEvent)) { + FD_SET(t->srv_fd, StaticReadEvent); + if (t->proxy->srvtimeout) + tv_delayfrom(&t->srexpire, &now, t->proxy->srvtimeout); + else + tv_eternity(&t->srexpire); + } + } + return 0; + } + else { /* SV_STCLOSE : nothing to do */ + if ((global.mode & MODE_DEBUG) && (!(global.mode & MODE_QUIET) || (global.mode & MODE_VERBOSE))) { + int len; + len = sprintf(trash, "%08x:%s.srvcls[%04x:%04x]\n", t->uniq_id, t->proxy->id, (unsigned short)t->cli_fd, (unsigned short)t->srv_fd); + write(1, trash, len); + } + return 0; + } + return 0; +} + + +/* + * Produces data for the session depending on its source. Expects to be + * called with s->cli_state == CL_STSHUTR. Right now, only statistics can be + * produced. It stops by itself by unsetting the SN_SELF_GEN flag from the + * session, which it uses to keep on being called when there is free space in + * the buffer, of simply by letting an empty buffer upon return. It returns 1 + * if it changes the session state from CL_STSHUTR, otherwise 0. + */ +int produce_content(struct session *s) +{ + struct buffer *rep = s->rep; + struct proxy *px; + struct server *sv; + int msglen; + + if (s->data_source == DATA_SRC_NONE) { + s->flags &= ~SN_SELF_GEN; + return 1; + } + else if (s->data_source == DATA_SRC_STATS) { + msglen = 0; + + if (s->data_state == DATA_ST_INIT) { /* the function had not been called yet */ + unsigned int up; + + s->flags |= SN_SELF_GEN; // more data will follow + + /* send the start of the HTTP response */ + msglen += snprintf(trash + msglen, sizeof(trash) - msglen, + "HTTP/1.0 200 OK\r\n" + "Cache-Control: no-cache\r\n" + "Connection: close\r\n" + "\r\n\r\n"); + + s->logs.status = 200; + client_retnclose(s, msglen, trash); // send the start of the response. + msglen = 0; + + if (!(s->flags & SN_ERR_MASK)) // this is not really an error but it is + s->flags |= SN_ERR_PRXCOND; // to mark that it comes from the proxy + if (!(s->flags & SN_FINST_MASK)) + s->flags |= SN_FINST_R; + + /* WARNING! This must fit in the first buffer !!! */ + msglen += snprintf(trash + msglen, sizeof(trash) - msglen, + "Statistics Report for " PRODUCT_NAME "\n" + "\n" + ""); + + if (buffer_write(rep, trash, msglen) != 0) + return 0; + msglen = 0; + + up = (now.tv_sec - start_date.tv_sec); + + /* WARNING! this has to fit the first packet too */ + msglen += snprintf(trash + msglen, sizeof(trash) - msglen, + "

" PRODUCT_NAME "

\n" + "

Statistics Report for pid %d

\n" + "
\n" + "

> General process information

\n" + "
\n" + "

pid = %d (nbproc = %d)
\n" + "uptime = %dd %dh%02dm%02ds
\n" + "system limits : memmax = %s%s ; ulimit-n = %d
\n" + "maxsock = %d
\n" + "maxconn = %d (current conns = %d)
\n" + "

\n" + "\n" + "" + "" + "" + "" + "" + "" + "" + "" + "" + "
 active UP  backup UP
active UP, going down backup UP, going down
active DOWN, going up backup DOWN, going up
active or backup DOWN  not checked
\n" + "
\n" + "", + pid, pid, global.nbproc, + up / 86400, (up % 86400) / 3600, + (up % 3600) / 60, (up % 60), + global.rlimit_memmax ? ultoa(global.rlimit_memmax) : "unlimited", + global.rlimit_memmax ? " MB" : "", + global.rlimit_nofile, + global.maxsock, + global.maxconn, + actconn + ); + + if (buffer_write(rep, trash, msglen) != 0) + return 0; + msglen = 0; + + s->data_state = DATA_ST_DATA; + memset(&s->data_ctx, 0, sizeof(s->data_ctx)); + + px = s->data_ctx.stats.px = proxy; + s->data_ctx.stats.px_st = DATA_ST_INIT; + } + + while (s->data_ctx.stats.px) { + int dispatch_sess, dispatch_cum; + int failed_checks, down_trans; + int failed_secu, failed_conns, failed_resp; + + if (s->data_ctx.stats.px_st == DATA_ST_INIT) { + /* we are on a new proxy */ + px = s->data_ctx.stats.px; + + /* skip the disabled proxies */ + if (px->state == PR_STSTOPPED) + goto next_proxy; + + if (s->proxy->uri_auth && s->proxy->uri_auth->scope) { + /* we have a limited scope, we have to check the proxy name */ + struct stat_scope *scope; + int len; + + len = strlen(px->id); + scope = s->proxy->uri_auth->scope; + + while (scope) { + /* match exact proxy name */ + if (scope->px_len == len && !memcmp(px->id, scope->px_id, len)) + break; + + /* match '.' which means 'self' proxy */ + if (!strcmp(scope->px_id, ".") && px == s->proxy) + break; + scope = scope->next; + } + + /* proxy name not found */ + if (scope == NULL) + goto next_proxy; + } + + msglen += snprintf(trash + msglen, sizeof(trash) - msglen, + "

> Proxy instance %s : " + "%d conns (maxconn=%d), %d queued (%d unassigned), %d total conns

\n" + "", + px->id, + px->nbconn, px->maxconn, px->totpend, px->nbpend, px->cum_conn); + + msglen += snprintf(trash + msglen, sizeof(trash) - msglen, + "\n" + "" + "" + "" + "" + "\n" + "" + "" + "" + "" + "\n"); + + if (buffer_write(rep, trash, msglen) != 0) + return 0; + msglen = 0; + + s->data_ctx.stats.sv = px->srv; + s->data_ctx.stats.px_st = DATA_ST_DATA; + } + + px = s->data_ctx.stats.px; + + /* stats.sv has been initialized above */ + while (s->data_ctx.stats.sv != NULL) { + static char *act_tab_bg[5] = { /*down*/"#FF9090", /*rising*/"#FFD020", /*failing*/"#FFFFA0", /*up*/"#C0FFC0", /*unchecked*/"#E0E0E0" }; + static char *bck_tab_bg[5] = { /*down*/"#FF9090", /*rising*/"#FF80ff", /*failing*/"#C060FF", /*up*/"#B0D0FF", /*unchecked*/"#E0E0E0" }; + static char *srv_hlt_st[5] = { "DOWN", "DN %d/%d ↑", "UP %d/%d ↓", "UP", "no check" }; + int sv_state; /* 0=DOWN, 1=going up, 2=going down, 3=UP */ + + sv = s->data_ctx.stats.sv; + + /* FIXME: produce some small strings for "UP/DOWN x/y &#xxxx;" */ + if (!(sv->state & SRV_CHECKED)) + sv_state = 4; + else if (sv->state & SRV_RUNNING) + if (sv->health == sv->rise + sv->fall - 1) + sv_state = 3; /* UP */ + else + sv_state = 2; /* going down */ + else + if (sv->health) + sv_state = 1; /* going up */ + else + sv_state = 0; /* DOWN */ + + /* name, weight */ + msglen += snprintf(trash, sizeof(trash), + "", + (sv->state & SRV_BACKUP) ? "-" : "Y", + (sv->state & SRV_BACKUP) ? "Y" : "-"); + + /* queue : current, max */ + msglen += snprintf(trash + msglen, sizeof(trash) - msglen, + "", + sv->nbpend, sv->nbpend_max); + + /* sessions : current, max, limit, cumul */ + msglen += snprintf(trash + msglen, sizeof(trash) - msglen, + "", + sv->cur_sess, sv->cur_sess_max, sv->maxconn ? ultoa(sv->maxconn) : "-", sv->cum_sess); + + /* errors : connect, response, security */ + msglen += snprintf(trash + msglen, sizeof(trash) - msglen, + "\n", + sv->failed_conns, sv->failed_resp, sv->failed_secu); + + /* check failures : unique, fatal */ + if (sv->state & SRV_CHECKED) + msglen += snprintf(trash + msglen, sizeof(trash) - msglen, + "\n", + sv->failed_checks, sv->down_trans); + else + msglen += snprintf(trash + msglen, sizeof(trash) - msglen, + "\n"); + + if (buffer_write(rep, trash, msglen) != 0) + return 0; + msglen = 0; + + s->data_ctx.stats.sv = sv->next; + } /* while sv */ + + /* now we are past the last server, we'll dump information about the dispatcher */ + + /* We have to count down from the proxy to the servers to tell how + * many sessions are on the dispatcher, and how many checks have + * failed. We cannot count this during the servers dump because it + * might be interrupted multiple times. + */ + dispatch_sess = px->nbconn; + dispatch_cum = px->cum_conn; + failed_secu = px->failed_secu; + failed_conns = px->failed_conns; + failed_resp = px->failed_resp; + failed_checks = down_trans = 0; + + sv = px->srv; + while (sv) { + dispatch_sess -= sv->cur_sess; + dispatch_cum -= sv->cum_sess; + failed_conns -= sv->failed_conns; + failed_resp -= sv->failed_resp; + failed_secu -= sv->failed_secu; + if (sv->state & SRV_CHECKED) { + failed_checks += sv->failed_checks; + down_trans += sv->down_trans; + } + sv = sv->next; + } + + /* name, weight, status, act, bck */ + msglen += snprintf(trash + msglen, sizeof(trash), + "" + "" + "", + px->state == PR_STRUN ? "UP" : "DOWN"); + + /* queue : current, max */ + msglen += snprintf(trash + msglen, sizeof(trash) - msglen, + "", + px->nbpend, px->nbpend_max); + + /* sessions : current, max, limit, cumul. */ + msglen += snprintf(trash + msglen, sizeof(trash) - msglen, + "", + dispatch_sess, px->nbconn_max, px->maxconn, dispatch_cum); + + /* errors : connect, response, security */ + msglen += snprintf(trash + msglen, sizeof(trash) - msglen, + "\n", + failed_conns, failed_resp, failed_secu); + + /* check failures : unique, fatal */ + msglen += snprintf(trash + msglen, sizeof(trash) - msglen, + "\n"); + + + /* now the summary for the whole proxy */ + /* name, weight, status, act, bck */ + msglen += snprintf(trash + msglen, sizeof(trash), + "" + "" + "", + (px->state == PR_STRUN && ((px->srv == NULL) || px->srv_act || px->srv_bck)) ? "UP" : "DOWN", + px->srv_act, px->srv_bck); + + /* queue : current, max */ + msglen += snprintf(trash + msglen, sizeof(trash) - msglen, + "", + px->totpend, px->nbpend_max); + + /* sessions : current, max, limit, cumul */ + msglen += snprintf(trash + msglen, sizeof(trash) - msglen, + "", + px->nbconn, px->nbconn_max, px->maxconn, px->cum_conn); + + /* errors : connect, response, security */ + msglen += snprintf(trash + msglen, sizeof(trash) - msglen, + "\n", + px->failed_conns, px->failed_resp, px->failed_secu); + + /* check failures : unique, fatal */ + msglen += snprintf(trash + msglen, sizeof(trash) - msglen, + "\n", + failed_checks, down_trans); + + msglen += snprintf(trash + msglen, sizeof(trash) - msglen, "
ServerQueueSessionsErrors
NameWeightStatusAct.Bck.Curr.Max.Curr.Max.LimitCumul.Conn.Resp.Sec.CheckDown
%s%d", + (sv->state & SRV_BACKUP) ? bck_tab_bg[sv_state] : act_tab_bg[sv_state], + sv->id, sv->uweight+1); + /* status */ + msglen += snprintf(trash + msglen, sizeof(trash) - msglen, srv_hlt_st[sv_state], + (sv->state & SRV_RUNNING) ? (sv->health - sv->rise + 1) : (sv->health), + (sv->state & SRV_RUNNING) ? (sv->fall) : (sv->rise)); + + /* act, bck */ + msglen += snprintf(trash + msglen, sizeof(trash) - msglen, + "%s%s%d%d%d%d%s%d%d%d%d%d%d
--
Dispatcher-%s--%d%d%d%d%d%d%d%d%d--
Total-%s%d%d%d%d%d%d%d%d%d%d%d%d%d

\n"); + + if (buffer_write(rep, trash, msglen) != 0) + return 0; + msglen = 0; + + s->data_ctx.stats.px_st = DATA_ST_INIT; + next_proxy: + s->data_ctx.stats.px = px->next; + } /* proxy loop */ + /* here, we just have reached the sv == NULL and px == NULL */ + s->flags &= ~SN_SELF_GEN; + return 1; + } + else { + /* unknown data source */ + s->logs.status = 500; + client_retnclose(s, s->proxy->errmsg.len500, s->proxy->errmsg.msg500); + if (!(s->flags & SN_ERR_MASK)) + s->flags |= SN_ERR_PRXCOND; + if (!(s->flags & SN_FINST_MASK)) + s->flags |= SN_FINST_R; + s->flags &= SN_SELF_GEN; + return 1; + } +} + + +/* + * Local variables: + * c-indent-level: 8 + * c-basic-offset: 8 + * End: + */ diff --git a/src/proxy.c b/src/proxy.c new file mode 100644 index 000000000..b1beb4b74 --- /dev/null +++ b/src/proxy.c @@ -0,0 +1,357 @@ +/* + * Proxy variables and functions. + * + * Copyright 2000-2006 Willy Tarreau + * + * This program is free software; you can redistribute it and/or + * modify it under the terms of the GNU General Public License + * as published by the Free Software Foundation; either version + * 2 of the License, or (at your option) any later version. + * + */ + +#include +#include +#include +#include +#include + +#include +#include +#include + +#include +#include + +#include +#include +#include +#include + + +int listeners; /* # of listeners */ +struct proxy *proxy = NULL; /* list of all existing proxies */ + + +/* + * this function starts all the proxies. Its return value is composed from + * ERR_NONE, ERR_RETRYABLE and ERR_FATAL. Retryable errors will only be printed + * if is not zero. + */ +int start_proxies(int verbose) +{ + struct proxy *curproxy; + struct listener *listener; + int err = ERR_NONE; + int fd, pxerr; + + for (curproxy = proxy; curproxy != NULL; curproxy = curproxy->next) { + if (curproxy->state != PR_STNEW) + continue; /* already initialized */ + + pxerr = 0; + for (listener = curproxy->listen; listener != NULL; listener = listener->next) { + if (listener->fd != -1) + continue; /* already initialized */ + + if ((fd = socket(listener->addr.ss_family, SOCK_STREAM, IPPROTO_TCP)) == -1) { + if (verbose) + Alert("cannot create listening socket for proxy %s. Aborting.\n", + curproxy->id); + err |= ERR_RETRYABLE; + pxerr |= 1; + continue; + } + + if (fd >= global.maxsock) { + Alert("socket(): not enough free sockets for proxy %s. Raise -n argument. Aborting.\n", + curproxy->id); + close(fd); + err |= ERR_FATAL; + pxerr |= 1; + break; + } + + if ((fcntl(fd, F_SETFL, O_NONBLOCK) == -1) || + (setsockopt(fd, IPPROTO_TCP, TCP_NODELAY, + (char *) &one, sizeof(one)) == -1)) { + Alert("cannot make socket non-blocking for proxy %s. Aborting.\n", + curproxy->id); + close(fd); + err |= ERR_FATAL; + pxerr |= 1; + break; + } + + if (setsockopt(fd, SOL_SOCKET, SO_REUSEADDR, (char *) &one, sizeof(one)) == -1) { + Alert("cannot do so_reuseaddr for proxy %s. Continuing.\n", + curproxy->id); + } + +#ifdef SO_REUSEPORT + /* OpenBSD supports this. As it's present in old libc versions of Linux, + * it might return an error that we will silently ignore. + */ + setsockopt(fd, SOL_SOCKET, SO_REUSEPORT, (char *) &one, sizeof(one)); +#endif + if (bind(fd, + (struct sockaddr *)&listener->addr, + listener->addr.ss_family == AF_INET6 ? + sizeof(struct sockaddr_in6) : + sizeof(struct sockaddr_in)) == -1) { + if (verbose) + Alert("cannot bind socket for proxy %s. Aborting.\n", + curproxy->id); + close(fd); + err |= ERR_RETRYABLE; + pxerr |= 1; + continue; + } + + if (listen(fd, curproxy->maxconn) == -1) { + if (verbose) + Alert("cannot listen to socket for proxy %s. Aborting.\n", + curproxy->id); + close(fd); + err |= ERR_RETRYABLE; + pxerr |= 1; + continue; + } + + /* the socket is ready */ + listener->fd = fd; + + /* the function for the accept() event */ + fdtab[fd].read = &event_accept; + fdtab[fd].write = NULL; /* never called */ + fdtab[fd].owner = (struct task *)curproxy; /* reference the proxy instead of a task */ + fdtab[fd].state = FD_STLISTEN; + FD_SET(fd, StaticReadEvent); + fd_insert(fd); + listeners++; + } + + if (!pxerr) { + curproxy->state = PR_STRUN; + send_log(curproxy, LOG_NOTICE, "Proxy %s started.\n", curproxy->id); + } + } + + return err; +} + + +/* + * this function enables proxies when there are enough free sessions, + * or stops them when the table is full. It is designed to be called from the + * select_loop(). It returns the time left before next expiration event + * during stop time, TIME_ETERNITY otherwise. + */ +int maintain_proxies(void) +{ + struct proxy *p; + struct listener *l; + int tleft; /* time left */ + + p = proxy; + tleft = TIME_ETERNITY; /* infinite time */ + + /* if there are enough free sessions, we'll activate proxies */ + if (actconn < global.maxconn) { + while (p) { + if (p->nbconn < p->maxconn) { + if (p->state == PR_STIDLE) { + for (l = p->listen; l != NULL; l = l->next) { + FD_SET(l->fd, StaticReadEvent); + } + p->state = PR_STRUN; + } + } + else { + if (p->state == PR_STRUN) { + for (l = p->listen; l != NULL; l = l->next) { + FD_CLR(l->fd, StaticReadEvent); + } + p->state = PR_STIDLE; + } + } + p = p->next; + } + } + else { /* block all proxies */ + while (p) { + if (p->state == PR_STRUN) { + for (l = p->listen; l != NULL; l = l->next) { + FD_CLR(l->fd, StaticReadEvent); + } + p->state = PR_STIDLE; + } + p = p->next; + } + } + + if (stopping) { + p = proxy; + while (p) { + if (p->state != PR_STSTOPPED) { + int t; + t = tv_remain2(&now, &p->stop_time); + if (t == 0) { + Warning("Proxy %s stopped.\n", p->id); + send_log(p, LOG_WARNING, "Proxy %s stopped.\n", p->id); + + for (l = p->listen; l != NULL; l = l->next) { + fd_delete(l->fd); + listeners--; + } + p->state = PR_STSTOPPED; + } + else { + tleft = MINTIME(t, tleft); + } + } + p = p->next; + } + } + return tleft; +} + + +/* + * this function disables health-check servers so that the process will quickly be ignored + * by load balancers. Note that if a proxy was already in the PAUSED state, then its grace + * time will not be used since it would already not listen anymore to the socket. + */ +void soft_stop(void) +{ + struct proxy *p; + + stopping = 1; + p = proxy; + tv_now(&now); /* else, the old time before select will be used */ + while (p) { + if (p->state != PR_STSTOPPED) { + Warning("Stopping proxy %s in %d ms.\n", p->id, p->grace); + send_log(p, LOG_WARNING, "Stopping proxy %s in %d ms.\n", p->id, p->grace); + tv_delayfrom(&p->stop_time, &now, p->grace); + } + p = p->next; + } +} + + +/* + * Linux unbinds the listen socket after a SHUT_RD, and ignores SHUT_WR. + * Solaris refuses either shutdown(). + * OpenBSD ignores SHUT_RD but closes upon SHUT_WR and refuses to rebind. + * So a common validation path involves SHUT_WR && listen && SHUT_RD. + * If disabling at least one listener returns an error, then the proxy + * state is set to PR_STERROR because we don't know how to resume from this. + */ +void pause_proxy(struct proxy *p) +{ + struct listener *l; + for (l = p->listen; l != NULL; l = l->next) { + if (shutdown(l->fd, SHUT_WR) == 0 && + listen(l->fd, p->maxconn) == 0 && + shutdown(l->fd, SHUT_RD) == 0) { + FD_CLR(l->fd, StaticReadEvent); + if (p->state != PR_STERROR) + p->state = PR_STPAUSED; + } + else + p->state = PR_STERROR; + } +} + +/* + * This function temporarily disables listening so that another new instance + * can start listening. It is designed to be called upon reception of a + * SIGTTOU, after which either a SIGUSR1 can be sent to completely stop + * the proxy, or a SIGTTIN can be sent to listen again. + */ +void pause_proxies(void) +{ + int err; + struct proxy *p; + + err = 0; + p = proxy; + tv_now(&now); /* else, the old time before select will be used */ + while (p) { + if (p->state != PR_STERROR && + p->state != PR_STSTOPPED && + p->state != PR_STPAUSED) { + Warning("Pausing proxy %s.\n", p->id); + send_log(p, LOG_WARNING, "Pausing proxy %s.\n", p->id); + pause_proxy(p); + if (p->state != PR_STPAUSED) { + err |= 1; + Warning("Proxy %s failed to enter pause mode.\n", p->id); + send_log(p, LOG_WARNING, "Proxy %s failed to enter pause mode.\n", p->id); + } + } + p = p->next; + } + if (err) { + Warning("Some proxies refused to pause, performing soft stop now.\n"); + send_log(p, LOG_WARNING, "Some proxies refused to pause, performing soft stop now.\n"); + soft_stop(); + } +} + + +/* + * This function reactivates listening. This can be used after a call to + * sig_pause(), for example when a new instance has failed starting up. + * It is designed to be called upon reception of a SIGTTIN. + */ +void listen_proxies(void) +{ + struct proxy *p; + struct listener *l; + + p = proxy; + tv_now(&now); /* else, the old time before select will be used */ + while (p) { + if (p->state == PR_STPAUSED) { + Warning("Enabling proxy %s.\n", p->id); + send_log(p, LOG_WARNING, "Enabling proxy %s.\n", p->id); + + for (l = p->listen; l != NULL; l = l->next) { + if (listen(l->fd, p->maxconn) == 0) { + if (actconn < global.maxconn && p->nbconn < p->maxconn) { + FD_SET(l->fd, StaticReadEvent); + p->state = PR_STRUN; + } + else + p->state = PR_STIDLE; + } else { + int port; + + if (l->addr.ss_family == AF_INET6) + port = ntohs(((struct sockaddr_in6 *)(&l->addr))->sin6_port); + else + port = ntohs(((struct sockaddr_in *)(&l->addr))->sin_port); + + Warning("Port %d busy while trying to enable proxy %s.\n", + port, p->id); + send_log(p, LOG_WARNING, "Port %d busy while trying to enable proxy %s.\n", + port, p->id); + /* Another port might have been enabled. Let's stop everything. */ + pause_proxy(p); + break; + } + } + } + p = p->next; + } +} + + +/* + * Local variables: + * c-indent-level: 8 + * c-basic-offset: 8 + * End: + */ diff --git a/src/queue.c b/src/queue.c new file mode 100644 index 000000000..67c0d7cc6 --- /dev/null +++ b/src/queue.c @@ -0,0 +1,139 @@ +/* + * Queue management functions. + * + * Copyright 2000-2006 Willy Tarreau + * + * This program is free software; you can redistribute it and/or + * modify it under the terms of the GNU General Public License + * as published by the Free Software Foundation; either version + * 2 of the License, or (at your option) any later version. + * + */ + +#include + +#include +#include + +#include +#include +#include + + +void **pool_pendconn = NULL; + +/* returns the effective dynamic maxconn for a server, considering the minconn + * and the proxy's usage relative to its saturation. + */ +unsigned int srv_dynamic_maxconn(struct server *s) +{ + return s->minconn ? + ((s->maxconn * s->proxy->nbconn / s->proxy->maxconn) < s->minconn) ? s->minconn : + (s->maxconn * s->proxy->nbconn / s->proxy->maxconn) : s->maxconn; +} + + +/* + * Manages a server's connection queue. If woken up, will try to dequeue as + * many pending sessions as possible, and wake them up. The task has nothing + * else to do, so it always returns TIME_ETERNITY. + */ +int process_srv_queue(struct task *t) +{ + struct server *s = (struct server*)t->context; + struct proxy *p = s->proxy; + int xferred; + + /* First, check if we can handle some connections queued at the proxy. We + * will take as many as we can handle. + */ + for (xferred = 0; s->cur_sess + xferred < srv_dynamic_maxconn(s); xferred++) { + struct session *sess; + + sess = pendconn_get_next_sess(s, p); + if (sess == NULL) + break; + task_wakeup(&rq, sess->task); + } + + return TIME_ETERNITY; +} + +/* Detaches the next pending connection from either a server or a proxy, and + * returns its associated session. If no pending connection is found, NULL is + * returned. Note that neither nor can be NULL. + */ +struct session *pendconn_get_next_sess(struct server *srv, struct proxy *px) +{ + struct pendconn *p; + struct session *sess; + + p = pendconn_from_srv(srv); + if (!p) { + p = pendconn_from_px(px); + if (!p) + return NULL; + p->sess->srv = srv; + } + sess = p->sess; + pendconn_free(p); + return sess; +} + +/* Adds the session to the pending connection list of server ->srv + * or to the one of ->proxy if srv is NULL. All counters and back pointers + * are updated accordingly. Returns NULL if no memory is available, otherwise the + * pendconn itself. + */ +struct pendconn *pendconn_add(struct session *sess) +{ + struct pendconn *p; + + p = pool_alloc(pendconn); + if (!p) + return NULL; + + sess->pend_pos = p; + p->sess = sess; + p->srv = sess->srv; + if (sess->srv) { + LIST_ADDQ(&sess->srv->pendconns, &p->list); + sess->logs.srv_queue_size += sess->srv->nbpend; + sess->srv->nbpend++; + if (sess->srv->nbpend > sess->srv->nbpend_max) + sess->srv->nbpend_max = sess->srv->nbpend; + } else { + LIST_ADDQ(&sess->proxy->pendconns, &p->list); + sess->logs.prx_queue_size += sess->proxy->nbpend; + sess->proxy->nbpend++; + if (sess->proxy->nbpend > sess->proxy->nbpend_max) + sess->proxy->nbpend_max = sess->proxy->nbpend; + } + sess->proxy->totpend++; + return p; +} + +/* + * Detaches pending connection

, decreases the pending count, and frees + * the pending connection. The connection might have been queued to a specific + * server as well as to the proxy. The session also gets marked unqueued. + */ +void pendconn_free(struct pendconn *p) +{ + LIST_DEL(&p->list); + p->sess->pend_pos = NULL; + if (p->srv) + p->srv->nbpend--; + else + p->sess->proxy->nbpend--; + p->sess->proxy->totpend--; + pool_free(pendconn, p); +} + + +/* + * Local variables: + * c-indent-level: 8 + * c-basic-offset: 8 + * End: + */ diff --git a/src/regex.c b/src/regex.c new file mode 100644 index 000000000..4c3776012 --- /dev/null +++ b/src/regex.c @@ -0,0 +1,130 @@ +/* + * Regex and string management functions. + * + * Copyright 2000-2006 Willy Tarreau + * + * This program is free software; you can redistribute it and/or + * modify it under the terms of the GNU General Public License + * as published by the Free Software Foundation; either version + * 2 of the License, or (at your option) any later version. + * + */ + +#include +#include +#include + +#include +#include +#include + +/* regex trash buffer used by various regex tests */ +regmatch_t pmatch[MAX_MATCH]; /* rm_so, rm_eo for regular expressions */ + + + +int exp_replace(char *dst, char *src, char *str, regmatch_t *matches) +{ + char *old_dst = dst; + + while (*str) { + if (*str == '\\') { + str++; + if (isdigit((int)*str)) { + int len, num; + + num = *str - '0'; + str++; + + if (matches[num].rm_eo > -1 && matches[num].rm_so > -1) { + len = matches[num].rm_eo - matches[num].rm_so; + memcpy(dst, src + matches[num].rm_so, len); + dst += len; + } + + } else if (*str == 'x') { + unsigned char hex1, hex2; + str++; + + hex1 = toupper(*str++) - '0'; + hex2 = toupper(*str++) - '0'; + + if (hex1 > 9) hex1 -= 'A' - '9' - 1; + if (hex2 > 9) hex2 -= 'A' - '9' - 1; + *dst++ = (hex1<<4) + hex2; + } else { + *dst++ = *str++; + } + } else { + *dst++ = *str++; + } + } + *dst = '\0'; + return dst - old_dst; +} + +/* returns NULL if the replacement string is valid, or the pointer to the first error */ +char *check_replace_string(char *str) +{ + char *err = NULL; + while (*str) { + if (*str == '\\') { + err = str; /* in case of a backslash, we return the pointer to it */ + str++; + if (!*str) + return err; + else if (isdigit((int)*str)) + err = NULL; + else if (*str == 'x') { + str++; + if (!ishex(*str)) + return err; + str++; + if (!ishex(*str)) + return err; + err = NULL; + } + else { + Warning("'\\%c' : deprecated use of a backslash before something not '\\','x' or a digit.\n", *str); + err = NULL; + } + } + str++; + } + return err; +} + + +/* returns the pointer to an error in the replacement string, or NULL if OK */ +char *chain_regex(struct hdr_exp **head, regex_t *preg, int action, char *replace) +{ + struct hdr_exp *exp; + + if (replace != NULL) { + char *err; + err = check_replace_string(replace); + if (err) + return err; + } + + while (*head != NULL) + head = &(*head)->next; + + exp = calloc(1, sizeof(struct hdr_exp)); + + exp->preg = preg; + exp->replace = replace; + exp->action = action; + *head = exp; + + return NULL; +} + + + +/* + * Local variables: + * c-indent-level: 8 + * c-basic-offset: 8 + * End: + */ diff --git a/src/server.c b/src/server.c new file mode 100644 index 000000000..50c025d3f --- /dev/null +++ b/src/server.c @@ -0,0 +1,23 @@ +/* + * Server management functions. + * + * Copyright 2000-2006 Willy Tarreau + * + * This program is free software; you can redistribute it and/or + * modify it under the terms of the GNU General Public License + * as published by the Free Software Foundation; either version + * 2 of the License, or (at your option) any later version. + * + */ + +#include +#include +#include + + +/* + * Local variables: + * c-indent-level: 8 + * c-basic-offset: 8 + * End: + */ diff --git a/src/session.c b/src/session.c new file mode 100644 index 000000000..0722d0f4c --- /dev/null +++ b/src/session.c @@ -0,0 +1,73 @@ +/* + * Server management functions. + * + * Copyright 2000-2006 Willy Tarreau + * + * This program is free software; you can redistribute it and/or + * modify it under the terms of the GNU General Public License + * as published by the Free Software Foundation; either version + * 2 of the License, or (at your option) any later version. + * + */ + +#include +#include + +#include +#include +#include +#include +#include + +#include +#include + + +void **pool_session = NULL; + +/* + * frees the context associated to a session. It must have been removed first. + */ +void session_free(struct session *s) +{ + if (s->pend_pos) + pendconn_free(s->pend_pos); + if (s->req) + pool_free(buffer, s->req); + if (s->rep) + pool_free(buffer, s->rep); + + if (s->rsp_cap != NULL) { + struct cap_hdr *h; + for (h = s->proxy->rsp_cap; h; h = h->next) { + if (s->rsp_cap[h->index] != NULL) + pool_free_to(h->pool, s->rsp_cap[h->index]); + } + pool_free_to(s->proxy->rsp_cap_pool, s->rsp_cap); + } + if (s->req_cap != NULL) { + struct cap_hdr *h; + for (h = s->proxy->req_cap; h; h = h->next) { + if (s->req_cap[h->index] != NULL) + pool_free_to(h->pool, s->req_cap[h->index]); + } + pool_free_to(s->proxy->req_cap_pool, s->req_cap); + } + + if (s->logs.uri) + pool_free(requri, s->logs.uri); + if (s->logs.cli_cookie) + pool_free(capture, s->logs.cli_cookie); + if (s->logs.srv_cookie) + pool_free(capture, s->logs.srv_cookie); + + pool_free(session, s); +} + + +/* + * Local variables: + * c-indent-level: 8 + * c-basic-offset: 8 + * End: + */ diff --git a/src/standard.c b/src/standard.c new file mode 100644 index 000000000..e218055fa --- /dev/null +++ b/src/standard.c @@ -0,0 +1,214 @@ +/* + * General purpose functions. + * + * Copyright 2000-2006 Willy Tarreau + * + * This program is free software; you can redistribute it and/or + * modify it under the terms of the GNU General Public License + * as published by the Free Software Foundation; either version + * 2 of the License, or (at your option) any later version. + * + */ + +#include +#include +#include +#include +#include + +#include +#include + +/* enough to store 2^63=18446744073709551615 */ +static char itoa_str[21]; + +/* + * copies at most chars from to . Last char is always + * set to 0, unless is 0. The number of chars copied is returned + * (excluding the terminating zero). + * This code has been optimized for size and speed : on x86, it's 45 bytes + * long, uses only registers, and consumes only 4 cycles per char. + */ +int strlcpy2(char *dst, const char *src, int size) +{ + char *orig = dst; + if (size) { + while (--size && (*dst = *src)) { + src++; dst++; + } + *dst = 0; + } + return dst - orig; +} + +/* + * This function simply returns a statically allocated string containing + * the ascii representation for number 'n' in decimal. + */ +char *ultoa(unsigned long n) +{ + char *pos; + + pos = itoa_str + sizeof(itoa_str) - 1; + *pos-- = '\0'; + + do { + *pos-- = '0' + n % 10; + n /= 10; + } while (n && pos >= itoa_str); + return pos + 1; +} + + +/* + * Returns non-zero if character is a hex digit (0-9, a-f, A-F), else zero. + * + * It looks like this one would be a good candidate for inlining, but this is + * not interesting because it around 35 bytes long and often called multiple + * times within the same function. + */ +int ishex(char s) +{ + s -= '0'; + if ((unsigned char)s <= 9) + return 1; + s -= 'A' - '0'; + if ((unsigned char)s <= 5) + return 1; + s -= 'a' - 'A'; + if ((unsigned char)s <= 5) + return 1; + return 0; +} + + +/* + * converts to a struct sockaddr_in* which is locally allocated. + * The format is "addr:port", where "addr" can be a dotted IPv4 address, + * a host name, or empty or "*" to indicate INADDR_ANY. + */ +struct sockaddr_in *str2sa(char *str) +{ + static struct sockaddr_in sa; + char *c; + int port; + + memset(&sa, 0, sizeof(sa)); + str = strdup(str); + + if ((c = strrchr(str,':')) != NULL) { + *c++ = '\0'; + port = atol(c); + } + else + port = 0; + + if (*str == '*' || *str == '\0') { /* INADDR_ANY */ + sa.sin_addr.s_addr = INADDR_ANY; + } + else if (!inet_pton(AF_INET, str, &sa.sin_addr)) { + struct hostent *he; + + if ((he = gethostbyname(str)) == NULL) { + Alert("Invalid server name: '%s'\n", str); + } + else + sa.sin_addr = *(struct in_addr *) *(he->h_addr_list); + } + sa.sin_port = htons(port); + sa.sin_family = AF_INET; + + free(str); + return &sa; +} + +/* + * converts to a two struct in_addr* which are locally allocated. + * The format is "addr[/mask]", where "addr" cannot be empty, and mask + * is optionnal and either in the dotted or CIDR notation. + * Note: "addr" can also be a hostname. Returns 1 if OK, 0 if error. + */ +int str2net(char *str, struct in_addr *addr, struct in_addr *mask) +{ + char *c; + unsigned long len; + + memset(mask, 0, sizeof(*mask)); + memset(addr, 0, sizeof(*addr)); + str = strdup(str); + + if ((c = strrchr(str, '/')) != NULL) { + *c++ = '\0'; + /* c points to the mask */ + if (strchr(c, '.') != NULL) { /* dotted notation */ + if (!inet_pton(AF_INET, c, mask)) + return 0; + } + else { /* mask length */ + char *err; + len = strtol(c, &err, 10); + if (!*c || (err && *err) || (unsigned)len > 32) + return 0; + if (len) + mask->s_addr = htonl(~0UL << (32 - len)); + else + mask->s_addr = 0; + } + } + else { + mask->s_addr = ~0UL; + } + if (!inet_pton(AF_INET, str, addr)) { + struct hostent *he; + + if ((he = gethostbyname(str)) == NULL) { + return 0; + } + else + *addr = *(struct in_addr *) *(he->h_addr_list); + } + free(str); + return 1; +} + +/* will try to encode the string replacing all characters tagged in + * with the hexadecimal representation of their ASCII-code (2 digits) + * prefixed by , and will store the result between (included) + * and (excluded), and will always terminate the string with a '\0' + * before . The position of the '\0' is returned if the conversion + * completes. If bytes are missing between and , then the + * conversion will be incomplete and truncated. If <= , the '\0' + * cannot even be stored so we return without writing the 0. + * The input string must also be zero-terminated. + */ +const char hextab[16] = "0123456789ABCDEF"; +char *encode_string(char *start, char *stop, + const char escape, const fd_set *map, + const char *string) +{ + if (start < stop) { + stop--; /* reserve one byte for the final '\0' */ + while (start < stop && *string != '\0') { + if (!FD_ISSET((unsigned char)(*string), map)) + *start++ = *string; + else { + if (start + 3 >= stop) + break; + *start++ = escape; + *start++ = hextab[(*string >> 4) & 15]; + *start++ = hextab[*string & 15]; + } + string++; + } + *start = '\0'; + } + return start; +} + + +/* + * Local variables: + * c-indent-level: 8 + * c-basic-offset: 8 + * End: + */ diff --git a/src/stream_sock.c b/src/stream_sock.c new file mode 100644 index 000000000..e30546117 --- /dev/null +++ b/src/stream_sock.c @@ -0,0 +1,462 @@ +/* + * Functions operating on SOCK_STREAM and buffers. + * + * Copyright 2000-2006 Willy Tarreau + * + * This program is free software; you can redistribute it and/or + * modify it under the terms of the GNU General Public License + * as published by the Free Software Foundation; either version + * 2 of the License, or (at your option) any later version. + * + */ + +#include +#include +#include +#include + +#include +#include +#include + +#include +#include + +#include +#include +#include +#include +#include +#include +#include +#include + +#include +#include +#include +#include +#include +#include + + +/* + * this function is called on a read event from a client socket. + * It returns 0. + */ +int event_cli_read(int fd) { + struct task *t = fdtab[fd].owner; + struct session *s = t->context; + struct buffer *b = s->req; + int ret, max; + +#ifdef DEBUG_FULL + fprintf(stderr,"event_cli_read : fd=%d, s=%p\n", fd, s); +#endif + + if (fdtab[fd].state != FD_STERROR) { +#ifdef FILL_BUFFERS + while (1) +#else + do +#endif + { + if (b->l == 0) { /* let's realign the buffer to optimize I/O */ + b->r = b->w = b->h = b->lr = b->data; + max = b->rlim - b->data; + } + else if (b->r > b->w) { + max = b->rlim - b->r; + } + else { + max = b->w - b->r; + /* FIXME: theorically, if w>0, we shouldn't have rlim < data+size anymore + * since it means that the rewrite protection has been removed. This + * implies that the if statement can be removed. + */ + if (max > b->rlim - b->data) + max = b->rlim - b->data; + } + + if (max == 0) { /* not anymore room to store data */ + FD_CLR(fd, StaticReadEvent); + break; + } + +#ifndef MSG_NOSIGNAL + { + int skerr; + socklen_t lskerr = sizeof(skerr); + + getsockopt(fd, SOL_SOCKET, SO_ERROR, &skerr, &lskerr); + if (skerr) + ret = -1; + else + ret = recv(fd, b->r, max, 0); + } +#else + ret = recv(fd, b->r, max, MSG_NOSIGNAL); +#endif + if (ret > 0) { + b->r += ret; + b->l += ret; + s->res_cr = RES_DATA; + + if (b->r == b->data + BUFSIZE) { + b->r = b->data; /* wrap around the buffer */ + } + + b->total += ret; + /* we hope to read more data or to get a close on next round */ + continue; + } + else if (ret == 0) { + s->res_cr = RES_NULL; + break; + } + else if (errno == EAGAIN) {/* ignore EAGAIN */ + break; + } + else { + s->res_cr = RES_ERROR; + fdtab[fd].state = FD_STERROR; + break; + } + } /* while(1) */ +#ifndef FILL_BUFFERS + while (0); +#endif + } + else { + s->res_cr = RES_ERROR; + fdtab[fd].state = FD_STERROR; + } + + if (s->res_cr != RES_SILENT) { + if (s->proxy->clitimeout && FD_ISSET(fd, StaticReadEvent)) + tv_delayfrom(&s->crexpire, &now, s->proxy->clitimeout); + else + tv_eternity(&s->crexpire); + + task_wakeup(&rq, t); + } + + return 0; +} + + +/* + * this function is called on a write event from a client socket. + * It returns 0. + */ +int event_cli_write(int fd) { + struct task *t = fdtab[fd].owner; + struct session *s = t->context; + struct buffer *b = s->rep; + int ret, max; + +#ifdef DEBUG_FULL + fprintf(stderr,"event_cli_write : fd=%d, s=%p\n", fd, s); +#endif + + if (b->l == 0) { /* let's realign the buffer to optimize I/O */ + b->r = b->w = b->h = b->lr = b->data; + // max = BUFSIZE; BUG !!!! + max = 0; + } + else if (b->r > b->w) { + max = b->r - b->w; + } + else + max = b->data + BUFSIZE - b->w; + + if (fdtab[fd].state != FD_STERROR) { + if (max == 0) { + s->res_cw = RES_NULL; + task_wakeup(&rq, t); + tv_eternity(&s->cwexpire); + FD_CLR(fd, StaticWriteEvent); + return 0; + } + +#ifndef MSG_NOSIGNAL + { + int skerr; + socklen_t lskerr = sizeof(skerr); + + getsockopt(fd, SOL_SOCKET, SO_ERROR, &skerr, &lskerr); + if (skerr) + ret = -1; + else + ret = send(fd, b->w, max, MSG_DONTWAIT); + } +#else + ret = send(fd, b->w, max, MSG_DONTWAIT | MSG_NOSIGNAL); +#endif + + if (ret > 0) { + b->l -= ret; + b->w += ret; + + s->res_cw = RES_DATA; + + if (b->w == b->data + BUFSIZE) { + b->w = b->data; /* wrap around the buffer */ + } + } + else if (ret == 0) { + /* nothing written, just make as if we were never called */ + // s->res_cw = RES_NULL; + return 0; + } + else if (errno == EAGAIN) /* ignore EAGAIN */ + return 0; + else { + s->res_cw = RES_ERROR; + fdtab[fd].state = FD_STERROR; + } + } + else { + s->res_cw = RES_ERROR; + fdtab[fd].state = FD_STERROR; + } + + if (s->proxy->clitimeout) { + tv_delayfrom(&s->cwexpire, &now, s->proxy->clitimeout); + /* FIXME: to prevent the client from expiring read timeouts during writes, + * we refresh it. A solution would be to merge read+write timeouts into a + * unique one, although that needs some study particularly on full-duplex + * TCP connections. */ + s->crexpire = s->cwexpire; + } + else + tv_eternity(&s->cwexpire); + + task_wakeup(&rq, t); + return 0; +} + + +/* + * this function is called on a read event from a server socket. + * It returns 0. + */ +int event_srv_read(int fd) { + struct task *t = fdtab[fd].owner; + struct session *s = t->context; + struct buffer *b = s->rep; + int ret, max; + +#ifdef DEBUG_FULL + fprintf(stderr,"event_srv_read : fd=%d, s=%p\n", fd, s); +#endif + + if (fdtab[fd].state != FD_STERROR) { +#ifdef FILL_BUFFERS + while (1) +#else + do +#endif + { + if (b->l == 0) { /* let's realign the buffer to optimize I/O */ + b->r = b->w = b->h = b->lr = b->data; + max = b->rlim - b->data; + } + else if (b->r > b->w) { + max = b->rlim - b->r; + } + else { + max = b->w - b->r; + /* FIXME: theorically, if w>0, we shouldn't have rlim < data+size anymore + * since it means that the rewrite protection has been removed. This + * implies that the if statement can be removed. + */ + if (max > b->rlim - b->data) + max = b->rlim - b->data; + } + + if (max == 0) { /* not anymore room to store data */ + FD_CLR(fd, StaticReadEvent); + break; + } + +#ifndef MSG_NOSIGNAL + { + int skerr; + socklen_t lskerr = sizeof(skerr); + + getsockopt(fd, SOL_SOCKET, SO_ERROR, &skerr, &lskerr); + if (skerr) + ret = -1; + else + ret = recv(fd, b->r, max, 0); + } +#else + ret = recv(fd, b->r, max, MSG_NOSIGNAL); +#endif + if (ret > 0) { + b->r += ret; + b->l += ret; + s->res_sr = RES_DATA; + + if (b->r == b->data + BUFSIZE) { + b->r = b->data; /* wrap around the buffer */ + } + + b->total += ret; + /* we hope to read more data or to get a close on next round */ + continue; + } + else if (ret == 0) { + s->res_sr = RES_NULL; + break; + } + else if (errno == EAGAIN) {/* ignore EAGAIN */ + break; + } + else { + s->res_sr = RES_ERROR; + fdtab[fd].state = FD_STERROR; + break; + } + } /* while(1) */ +#ifndef FILL_BUFFERS + while (0); +#endif + } + else { + s->res_sr = RES_ERROR; + fdtab[fd].state = FD_STERROR; + } + + if (s->res_sr != RES_SILENT) { + if (s->proxy->srvtimeout && FD_ISSET(fd, StaticReadEvent)) + tv_delayfrom(&s->srexpire, &now, s->proxy->srvtimeout); + else + tv_eternity(&s->srexpire); + + task_wakeup(&rq, t); + } + + return 0; +} + + +/* + * this function is called on a write event from a server socket. + * It returns 0. + */ +int event_srv_write(int fd) { + struct task *t = fdtab[fd].owner; + struct session *s = t->context; + struct buffer *b = s->req; + int ret, max; + +#ifdef DEBUG_FULL + fprintf(stderr,"event_srv_write : fd=%d, s=%p\n", fd, s); +#endif + + if (b->l == 0) { /* let's realign the buffer to optimize I/O */ + b->r = b->w = b->h = b->lr = b->data; + // max = BUFSIZE; BUG !!!! + max = 0; + } + else if (b->r > b->w) { + max = b->r - b->w; + } + else + max = b->data + BUFSIZE - b->w; + + if (fdtab[fd].state != FD_STERROR) { + if (max == 0) { + /* may be we have received a connection acknowledgement in TCP mode without data */ + if (s->srv_state == SV_STCONN) { + int skerr; + socklen_t lskerr = sizeof(skerr); + getsockopt(fd, SOL_SOCKET, SO_ERROR, &skerr, &lskerr); + if (skerr) { + s->res_sw = RES_ERROR; + fdtab[fd].state = FD_STERROR; + task_wakeup(&rq, t); + tv_eternity(&s->swexpire); + FD_CLR(fd, StaticWriteEvent); + return 0; + } + } + + s->res_sw = RES_NULL; + task_wakeup(&rq, t); + fdtab[fd].state = FD_STREADY; + tv_eternity(&s->swexpire); + FD_CLR(fd, StaticWriteEvent); + return 0; + } + +#ifndef MSG_NOSIGNAL + { + int skerr; + socklen_t lskerr = sizeof(skerr); + getsockopt(fd, SOL_SOCKET, SO_ERROR, &skerr, &lskerr); + if (skerr) + ret = -1; + else + ret = send(fd, b->w, max, MSG_DONTWAIT); + } +#else + ret = send(fd, b->w, max, MSG_DONTWAIT | MSG_NOSIGNAL); +#endif + fdtab[fd].state = FD_STREADY; + if (ret > 0) { + b->l -= ret; + b->w += ret; + + s->res_sw = RES_DATA; + + if (b->w == b->data + BUFSIZE) { + b->w = b->data; /* wrap around the buffer */ + } + } + else if (ret == 0) { + /* nothing written, just make as if we were never called */ + // s->res_sw = RES_NULL; + return 0; + } + else if (errno == EAGAIN) /* ignore EAGAIN */ + return 0; + else { + s->res_sw = RES_ERROR; + fdtab[fd].state = FD_STERROR; + } + } + else { + s->res_sw = RES_ERROR; + fdtab[fd].state = FD_STERROR; + } + + /* We don't want to re-arm read/write timeouts if we're trying to connect, + * otherwise it could loop indefinitely ! + */ + if (s->srv_state != SV_STCONN) { + if (s->proxy->srvtimeout) { + tv_delayfrom(&s->swexpire, &now, s->proxy->srvtimeout); + /* FIXME: to prevent the server from expiring read timeouts during writes, + * we refresh it. A solution would be to merge read+write+connect timeouts + * into a unique one since we don't mind expiring on read or write, and none + * of them is enabled while waiting for connect(), although that needs some + * study particularly on full-duplex TCP connections. */ + s->srexpire = s->swexpire; + } + else + tv_eternity(&s->swexpire); + } + + task_wakeup(&rq, t); + return 0; +} + + +/* + * Local variables: + * c-indent-level: 8 + * c-basic-offset: 8 + * End: + */ diff --git a/src/task.c b/src/task.c new file mode 100644 index 000000000..2c4adee3e --- /dev/null +++ b/src/task.c @@ -0,0 +1,201 @@ +/* + * Task management functions. + * + * Copyright 2000-2006 Willy Tarreau + * + * This program is free software; you can redistribute it and/or + * modify it under the terms of the GNU General Public License + * as published by the Free Software Foundation; either version + * 2 of the License, or (at your option) any later version. + * + */ + +#include +#include +#include + +#include + + +/* FIXME : this should be removed very quickly ! */ +extern int maintain_proxies(void); + +void **pool_task= NULL; +struct task *rq = NULL; /* global run queue */ +struct task wait_queue[2] = { /* global wait queue */ + { + prev:LIST_HEAD(wait_queue[0]), /* expirable tasks */ + next:LIST_HEAD(wait_queue[0]), + }, + { + prev:LIST_HEAD(wait_queue[1]), /* non-expirable tasks */ + next:LIST_HEAD(wait_queue[1]), + }, +}; + + +/* inserts into its assigned wait queue, where it may already be. In this case, it + * may be only moved or left where it was, depending on its timing requirements. + * is returned. + */ +struct task *task_queue(struct task *task) +{ + struct task *list = task->wq; + struct task *start_from; + + /* This is a very dirty hack to queue non-expirable tasks in another queue + * in order to avoid pulluting the tail of the standard queue. This will go + * away with the new O(log(n)) scheduler anyway. + */ + if (tv_iseternity(&task->expire)) { + /* if the task was queued in the standard wait queue, we must dequeue it */ + if (task->prev) { + if (task->wq == LIST_HEAD(wait_queue[1])) + return task; + else { + task_delete(task); + task->prev = NULL; + } + } + list = task->wq = LIST_HEAD(wait_queue[1]); + } else { + /* if the task was queued in the eternity queue, we must dequeue it */ + if (task->prev && (task->wq == LIST_HEAD(wait_queue[1]))) { + task_delete(task); + task->prev = NULL; + list = task->wq = LIST_HEAD(wait_queue[0]); + } + } + + /* next, test if the task was already in a list */ + if (task->prev == NULL) { + // start_from = list; + start_from = list->prev; + /* insert the unlinked into the list, searching back from the last entry */ + while (start_from != list && tv_cmp2(&task->expire, &start_from->expire) < 0) { + start_from = start_from->prev; + } + + // while (start_from->next != list && tv_cmp2(&task->expire, &start_from->next->expire) > 0) { + // start_from = start_from->next; + // stats_tsk_nsrch++; + // } + } + else if (task->prev == list || + tv_cmp2(&task->expire, &task->prev->expire) >= 0) { /* walk right */ + start_from = task->next; + if (start_from == list || tv_cmp2(&task->expire, &start_from->expire) <= 0) { + return task; /* it's already in the right place */ + } + + /* if the task is not at the right place, there's little chance that + * it has only shifted a bit, and it will nearly always be queued + * at the end of the list because of constant timeouts + * (observed in real case). + */ +#ifndef WE_REALLY_THINK_THAT_THIS_TASK_MAY_HAVE_SHIFTED + start_from = list->prev; /* assume we'll queue to the end of the list */ + while (start_from != list && tv_cmp2(&task->expire, &start_from->expire) < 0) { + start_from = start_from->prev; + } +#else /* WE_REALLY_... */ + /* insert the unlinked into the list, searching after position */ + while (start_from->next != list && tv_cmp2(&task->expire, &start_from->next->expire) > 0) { + start_from = start_from->next; + } +#endif /* WE_REALLY_... */ + + /* we need to unlink it now */ + task_delete(task); + } + else { /* walk left. */ +#ifdef LEFT_TO_TOP /* not very good */ + start_from = list; + while (start_from->next != list && tv_cmp2(&task->expire, &start_from->next->expire) > 0) { + start_from = start_from->next; + } +#else + start_from = task->prev->prev; /* valid because of the previous test above */ + while (start_from != list && tv_cmp2(&task->expire, &start_from->expire) < 0) { + start_from = start_from->prev; + } +#endif + /* we need to unlink it now */ + task_delete(task); + } + task->prev = start_from; + task->next = start_from->next; + task->next->prev = task; + start_from->next = task; + return task; +} + +/* + * This does 4 things : + * - wake up all expired tasks + * - call all runnable tasks + * - call maintain_proxies() to enable/disable the listeners + * - return the delay till next event in ms, -1 = wait indefinitely + * Note: this part should be rewritten with the O(ln(n)) scheduler. + * + */ + +int process_runnable_tasks() +{ + int next_time; + int time2; + struct task *t, *tnext; + + next_time = TIME_ETERNITY; /* set the timer to wait eternally first */ + + /* look for expired tasks and add them to the run queue. + */ + tnext = ((struct task *)LIST_HEAD(wait_queue[0]))->next; + while ((t = tnext) != LIST_HEAD(wait_queue[0])) { /* we haven't looped ? */ + tnext = t->next; + if (t->state & TASK_RUNNING) + continue; + + if (tv_iseternity(&t->expire)) + continue; + + /* wakeup expired entries. It doesn't matter if they are + * already running because of a previous event + */ + if (tv_cmp_ms(&t->expire, &now) <= 0) { + task_wakeup(&rq, t); + } + else { + /* first non-runnable task. Use its expiration date as an upper bound */ + int temp_time = tv_remain(&now, &t->expire); + if (temp_time) + next_time = temp_time; + break; + } + } + + /* process each task in the run queue now. Each task may be deleted + * since we only use the run queue's head. Note that any task can be + * woken up by any other task and it will be processed immediately + * after as it will be queued on the run queue's head. + */ + while ((t = rq) != NULL) { + int temp_time; + + task_sleep(&rq, t); + temp_time = t->process(t); + next_time = MINTIME(temp_time, next_time); + } + + /* maintain all proxies in a consistent state. This should quickly become a task */ + time2 = maintain_proxies(); + return MINTIME(time2, next_time); +} + + +/* + * Local variables: + * c-indent-level: 8 + * c-basic-offset: 8 + * End: + */ diff --git a/src/time.c b/src/time.c new file mode 100644 index 000000000..d495ed166 --- /dev/null +++ b/src/time.c @@ -0,0 +1,172 @@ +/* + * Time calculation functions. + * + * Copyright 2000-2006 Willy Tarreau + * + * This program is free software; you can redistribute it and/or + * modify it under the terms of the GNU General Public License + * as published by the Free Software Foundation; either version + * 2 of the License, or (at your option) any later version. + * + */ + +#include +#include + +struct timeval now; /* the current date at any moment */ +struct timeval start_date; /* the process's start date */ + +/* + * adds ms to , set the result to and returns a pointer + */ +struct timeval *tv_delayfrom(struct timeval *tv, struct timeval *from, int ms) +{ + if (!tv || !from) + return NULL; + tv->tv_usec = from->tv_usec + (ms%1000)*1000; + tv->tv_sec = from->tv_sec + (ms/1000); + while (tv->tv_usec >= 1000000) { + tv->tv_usec -= 1000000; + tv->tv_sec++; + } + return tv; +} + +/* + * compares and modulo 1ms: returns 0 if equal, -1 if tv1 < tv2, 1 if tv1 > tv2 + * Must not be used when either argument is eternity. Use tv_cmp2_ms() for that. + */ +int tv_cmp_ms(struct timeval *tv1, struct timeval *tv2) +{ + if (tv1->tv_sec == tv2->tv_sec) { + if (tv2->tv_usec >= tv1->tv_usec + 1000) + return -1; + else if (tv1->tv_usec >= tv2->tv_usec + 1000) + return 1; + else + return 0; + } + else if ((tv2->tv_sec > tv1->tv_sec + 1) || + ((tv2->tv_sec == tv1->tv_sec + 1) && (tv2->tv_usec + 1000000 >= tv1->tv_usec + 1000))) + return -1; + else if ((tv1->tv_sec > tv2->tv_sec + 1) || + ((tv1->tv_sec == tv2->tv_sec + 1) && (tv1->tv_usec + 1000000 >= tv2->tv_usec + 1000))) + return 1; + else + return 0; +} + +/* + * compares and : returns 0 if equal, -1 if tv1 < tv2, 1 if tv1 > tv2, + * considering that 0 is the eternity. + */ +int tv_cmp2(struct timeval *tv1, struct timeval *tv2) +{ + if (tv_iseternity(tv1)) + if (tv_iseternity(tv2)) + return 0; /* same */ + else + return 1; /* tv1 later than tv2 */ + else if (tv_iseternity(tv2)) + return -1; /* tv2 later than tv1 */ + + if (tv1->tv_sec > tv2->tv_sec) + return 1; + else if (tv1->tv_sec < tv2->tv_sec) + return -1; + else if (tv1->tv_usec > tv2->tv_usec) + return 1; + else if (tv1->tv_usec < tv2->tv_usec) + return -1; + else + return 0; +} + +/* + * compares and modulo 1 ms: returns 0 if equal, -1 if tv1 < tv2, 1 if tv1 > tv2, + * considering that 0 is the eternity. + */ +int tv_cmp2_ms(struct timeval *tv1, struct timeval *tv2) +{ + if (tv_iseternity(tv1)) + if (tv_iseternity(tv2)) + return 0; /* same */ + else + return 1; /* tv1 later than tv2 */ + else if (tv_iseternity(tv2)) + return -1; /* tv2 later than tv1 */ + + if (tv1->tv_sec == tv2->tv_sec) { + if (tv1->tv_usec >= tv2->tv_usec + 1000) + return 1; + else if (tv2->tv_usec >= tv1->tv_usec + 1000) + return -1; + else + return 0; + } + else if ((tv1->tv_sec > tv2->tv_sec + 1) || + ((tv1->tv_sec == tv2->tv_sec + 1) && (tv1->tv_usec + 1000000 >= tv2->tv_usec + 1000))) + return 1; + else if ((tv2->tv_sec > tv1->tv_sec + 1) || + ((tv2->tv_sec == tv1->tv_sec + 1) && (tv2->tv_usec + 1000000 >= tv1->tv_usec + 1000))) + return -1; + else + return 0; +} + +/* + * returns the remaining time between tv1=now and event=tv2 + * if tv2 is passed, 0 is returned. + * Returns TIME_ETERNITY if tv2 is eternity. + */ +unsigned long tv_remain2(struct timeval *tv1, struct timeval *tv2) +{ + unsigned long ret; + + if (tv_iseternity(tv2)) + return TIME_ETERNITY; + + if (tv_cmp_ms(tv1, tv2) >= 0) + return 0; /* event elapsed */ + + ret = (tv2->tv_sec - tv1->tv_sec) * 1000; + if (tv2->tv_usec > tv1->tv_usec) + ret += (tv2->tv_usec - tv1->tv_usec) / 1000; + else + ret -= (tv1->tv_usec - tv2->tv_usec) / 1000; + return (unsigned long) ret; +} + + +/* + * returns the absolute difference, in ms, between tv1 and tv2 + * Must not be used when either argument is eternity. + */ +unsigned long tv_delta(struct timeval *tv1, struct timeval *tv2) +{ + int cmp; + unsigned long ret; + + + cmp = tv_cmp(tv1, tv2); + if (!cmp) + return 0; /* same dates, null diff */ + else if (cmp < 0) { + struct timeval *tmp = tv1; + tv1 = tv2; + tv2 = tmp; + } + ret = (tv1->tv_sec - tv2->tv_sec) * 1000; + if (tv1->tv_usec > tv2->tv_usec) + ret += (tv1->tv_usec - tv2->tv_usec) / 1000; + else + ret -= (tv2->tv_usec - tv1->tv_usec) / 1000; + return (unsigned long) ret; +} + +/* + * Local variables: + * c-indent-level: 8 + * c-basic-offset: 8 + * End: + */ diff --git a/src/uri_auth.c b/src/uri_auth.c index 84570efd2..498d73512 100644 --- a/src/uri_auth.c +++ b/src/uri_auth.c @@ -1,7 +1,7 @@ /* * URI-based user authentication using the HTTP basic method. * - * Copyright 2006 Willy Tarreau + * Copyright 2006 Willy Tarreau * * This program is free software; you can redistribute it and/or * modify it under the terms of the GNU General Public License @@ -12,8 +12,9 @@ #include #include -#include -#include + +#include +#include /*