mirror of
https://github.com/haproxy/haproxy.git
synced 2026-04-22 14:49:45 -04:00
* released 1.2.4
* merged Alexander Lazic's and Klaus Wagner's work on application cookie-based persistence. Since this is the first merge, this version is not intended for general use and reports are more than welcome. Some documentation is really needed though.
This commit is contained in:
parent
0174f319a2
commit
12350155a4
10 changed files with 1395 additions and 24 deletions
|
|
@ -1,6 +1,12 @@
|
|||
ChangeLog :
|
||||
===========
|
||||
|
||||
2005/01/22 : 1.2.4
|
||||
- merged Alexander Lazic's and Klaus Wagner's work on application
|
||||
cookie-based persistence. Since this is the first merge, this version is
|
||||
not intended for general use and reports are more than welcome. Some
|
||||
documentation is really needed though.
|
||||
|
||||
2005/01/22 : 1.2.3 (1.1.30)
|
||||
- add an architecture guide to the documentation
|
||||
- released without any changes
|
||||
|
|
|
|||
6
Makefile
6
Makefile
|
|
@ -73,7 +73,7 @@ TARGET_OPTS=$(COPTS.$(TARGET))
|
|||
REGEX_OPTS=$(COPTS.$(REGEX))
|
||||
CPU_OPTS=$(COPTS.$(CPU))
|
||||
|
||||
COPTS=$(CPU_OPTS) $(TARGET_OPTS) $(REGEX_OPTS) $(SMALL_OPTS)
|
||||
COPTS=-I. $(CPU_OPTS) $(TARGET_OPTS) $(REGEX_OPTS) $(SMALL_OPTS)
|
||||
LIBS=$(LIBS.$(TARGET)) $(LIBS.$(REGEX))
|
||||
|
||||
# - use -DSTATTIME=0 to disable statistics, else specify an interval in
|
||||
|
|
@ -84,12 +84,12 @@ LDFLAGS = -g
|
|||
|
||||
all: haproxy
|
||||
|
||||
haproxy: haproxy.o
|
||||
haproxy: src/list.o src/chtbl.o src/hashpjw.o haproxy.o
|
||||
$(LD) $(LDFLAGS) -o $@ $^ $(LIBS)
|
||||
|
||||
%.o: %.c
|
||||
$(CC) $(CFLAGS) -c -o $@ $<
|
||||
|
||||
clean:
|
||||
rm -f *.[oas] *~ *.rej core haproxy test nohup.out gmon.out
|
||||
rm -f *.[oas] *~ *.rej core haproxy test nohup.out gmon.out src/*.[oas]
|
||||
|
||||
|
|
|
|||
2
TODO
2
TODO
|
|
@ -136,7 +136,7 @@ Todo for 1.2
|
|||
* listen [ip4.ip4.ip4.ip4]:port[-port]
|
||||
* listen [ip6::...ip6]/port[-port]
|
||||
- server xxx ipv4 | ipv4: | ipv4:port[-port] | ipv6/ | ipv6/port[-port]
|
||||
- appcookie
|
||||
* appcookie
|
||||
- weighted round robin
|
||||
- option to shutdown(listen_sock) when max connections reached
|
||||
|
||||
|
|
|
|||
668
haproxy.c
668
haproxy.c
|
|
@ -57,7 +57,51 @@
|
|||
#include <linux/netfilter_ipv4.h>
|
||||
#endif
|
||||
|
||||
#define HAPROXY_VERSION "1.2.3"
|
||||
#if defined(__dietlibc__)
|
||||
#include <strings.h>
|
||||
#endif
|
||||
|
||||
#define TBLSIZ 10
|
||||
#define TBLCHKINT 5000 /* The time between two calls of appsession_refresh in ms */
|
||||
|
||||
/*
|
||||
These Parts are copied from
|
||||
|
||||
http://www.oreilly.com/catalog/masteralgoc/index.html
|
||||
Mastering Algorithms with C
|
||||
By Kyle Loudon
|
||||
ISBN: 1-56592-453-3
|
||||
Publishd by O'Reilly
|
||||
|
||||
We have added our own struct to these function.
|
||||
*/
|
||||
|
||||
#include <include/list.h>
|
||||
#include <include/chtbl.h>
|
||||
#include <include/hashpjw.h>
|
||||
/* end of copied parts */
|
||||
|
||||
struct app_pool {
|
||||
void **sessid;
|
||||
void **serverid;
|
||||
int ses_waste, ses_use, ses_msize;
|
||||
int ser_waste, ser_use, ser_msize;
|
||||
};
|
||||
|
||||
struct app_pool apools;
|
||||
int have_appsession;
|
||||
|
||||
/* Callback for hash_lookup */
|
||||
int match_str(const void *key1, const void *key2);
|
||||
|
||||
/* Callback for destroy */
|
||||
void destroy(void *data);
|
||||
|
||||
#if defined(DEBUG_HASH)
|
||||
static void print_table(const CHTbl *htbl);
|
||||
#endif
|
||||
|
||||
#define HAPROXY_VERSION "1.2.4"
|
||||
#define HAPROXY_DATE "2005/01/22"
|
||||
|
||||
/* this is for libc5 for example */
|
||||
|
|
@ -236,8 +280,10 @@ int strlcpy2(char *dst, const char *src, int size) {
|
|||
#define sizeof_session sizeof(struct session)
|
||||
#define sizeof_buffer sizeof(struct buffer)
|
||||
#define sizeof_fdtab sizeof(struct fdtab)
|
||||
#define sizeof_curappsession CAPTURE_LEN /* current_session pool */
|
||||
#define sizeof_requri REQURI_LEN
|
||||
#define sizeof_capture CAPTURE_LEN
|
||||
#define sizeof_appsess sizeof(struct appsessions)
|
||||
|
||||
/* different possible states for the sockets */
|
||||
#define FD_STCLOSE 0
|
||||
|
|
@ -501,7 +547,12 @@ struct proxy {
|
|||
struct server *srv, *cursrv; /* known servers, current server */
|
||||
int nbservers; /* # of servers */
|
||||
char *cookie_name; /* name of the cookie to look for */
|
||||
int cookie_len; /* strlen(cookie_len), computed only once */
|
||||
int cookie_len; /* strlen(cookie_name), computed only once */
|
||||
char *appsession_name; /* name of the cookie to look for */
|
||||
int appsession_name_len; /* strlen(appsession_name), computed only once */
|
||||
int appsession_len; /* length of the appsession cookie value to be used */
|
||||
int appsession_timeout;
|
||||
CHTbl htbl_proxy; /* Per Proxy hashtable */
|
||||
char *capture_name; /* beginning of the name of the cookie to capture */
|
||||
int capture_namelen; /* length of the cookie name to match */
|
||||
int capture_len; /* length of the string to be captured */
|
||||
|
|
@ -598,7 +649,8 @@ void **pool_session = NULL,
|
|||
**pool_fdtab = NULL,
|
||||
**pool_requri = NULL,
|
||||
**pool_task = NULL,
|
||||
**pool_capture = NULL;
|
||||
**pool_capture = NULL,
|
||||
**pool_appsess = NULL;
|
||||
|
||||
struct proxy *proxy = NULL; /* list of all existing proxies */
|
||||
struct fdtab *fdtab = NULL; /* array of all the file descriptors */
|
||||
|
|
@ -745,6 +797,10 @@ int event_srv_read(int fd);
|
|||
int event_srv_write(int fd);
|
||||
int process_session(struct task *t);
|
||||
|
||||
static int appsession_task_init(void);
|
||||
static int appsession_init(void);
|
||||
static int appsession_refresh(struct task *t);
|
||||
|
||||
/*********************************************************************/
|
||||
/* general purpose functions ***************************************/
|
||||
/*********************************************************************/
|
||||
|
|
@ -1605,7 +1661,9 @@ static inline struct server *find_server(struct proxy *px) {
|
|||
int connect_server(struct session *s) {
|
||||
int fd;
|
||||
|
||||
// fprintf(stderr,"connect_server : s=%p\n",s);
|
||||
#ifdef DEBUG_FULL
|
||||
fprintf(stderr,"connect_server : s=%p\n",s);
|
||||
#endif
|
||||
|
||||
if (s->flags & SN_DIRECT) { /* srv cannot be null */
|
||||
s->srv_addr = s->srv->addr;
|
||||
|
|
@ -1729,7 +1787,9 @@ int event_cli_read(int fd) {
|
|||
struct buffer *b = s->req;
|
||||
int ret, max;
|
||||
|
||||
// fprintf(stderr,"event_cli_read : fd=%d, s=%p\n", fd, s);
|
||||
#ifdef DEBUG_FULL
|
||||
fprintf(stderr,"event_cli_read : fd=%d, s=%p\n", fd, s);
|
||||
#endif
|
||||
|
||||
if (fdtab[fd].state != FD_STERROR) {
|
||||
while (1) {
|
||||
|
|
@ -1824,7 +1884,9 @@ int event_srv_read(int fd) {
|
|||
struct buffer *b = s->rep;
|
||||
int ret, max;
|
||||
|
||||
// fprintf(stderr,"event_srv_read : fd=%d, s=%p\n", fd, s);
|
||||
#ifdef DEBUG_FULL
|
||||
fprintf(stderr,"event_srv_read : fd=%d, s=%p\n", fd, s);
|
||||
#endif
|
||||
|
||||
if (fdtab[fd].state != FD_STERROR) {
|
||||
while (1) {
|
||||
|
|
@ -1918,7 +1980,9 @@ int event_cli_write(int fd) {
|
|||
struct buffer *b = s->rep;
|
||||
int ret, max;
|
||||
|
||||
// fprintf(stderr,"event_cli_write : fd=%d, s=%p\n", fd, s);
|
||||
#ifdef DEBUG_FULL
|
||||
fprintf(stderr,"event_cli_write : fd=%d, s=%p\n", fd, s);
|
||||
#endif
|
||||
|
||||
if (b->l == 0) { /* let's realign the buffer to optimize I/O */
|
||||
b->r = b->w = b->h = b->lr = b->data;
|
||||
|
|
@ -2005,7 +2069,9 @@ int event_srv_write(int fd) {
|
|||
struct buffer *b = s->req;
|
||||
int ret, max;
|
||||
|
||||
//fprintf(stderr,"event_srv_write : fd=%d, s=%p\n", fd, s);
|
||||
#ifdef DEBUG_FULL
|
||||
fprintf(stderr,"event_srv_write : fd=%d, s=%p\n", fd, s);
|
||||
#endif
|
||||
|
||||
if (b->l == 0) { /* let's realign the buffer to optimize I/O */
|
||||
b->r = b->w = b->h = b->lr = b->data;
|
||||
|
|
@ -2694,6 +2760,9 @@ int process_cli(struct session *t) {
|
|||
int c = t->cli_state;
|
||||
struct buffer *req = t->req;
|
||||
struct buffer *rep = t->rep;
|
||||
int method_checked = 0;
|
||||
appsess *asession_temp = NULL;
|
||||
appsess local_asession;
|
||||
|
||||
#ifdef DEBUG_FULL
|
||||
fprintf(stderr,"process_cli: c=%s, s=%s\n", cli_stnames[c], srv_stnames[s]);
|
||||
|
|
@ -2707,6 +2776,7 @@ int process_cli(struct session *t) {
|
|||
while (req->lr < req->r) { /* this loop only sees one header at each iteration */
|
||||
char *ptr;
|
||||
int delete_header;
|
||||
char *request_line = NULL;
|
||||
|
||||
ptr = req->lr;
|
||||
|
||||
|
|
@ -2815,6 +2885,88 @@ int process_cli(struct session *t) {
|
|||
* req->r = end of data (not used at this stage)
|
||||
*/
|
||||
|
||||
if (!method_checked && (t->proxy->appsession_name != NULL) &&
|
||||
((memcmp(req->h, "GET ", 4) == 0) || (memcmp(req->h, "POST ", 4) == 0)) &&
|
||||
((request_line = memchr(req->h, ';', req->lr - req->h)) != NULL)) {
|
||||
|
||||
/* skip ; */
|
||||
request_line++;
|
||||
|
||||
/* look if we have a jsessionid */
|
||||
|
||||
if (strncasecmp(request_line, t->proxy->appsession_name, t->proxy->appsession_name_len) == 0) {
|
||||
|
||||
/* skip jsessionid= */
|
||||
request_line += t->proxy->appsession_name_len + 1;
|
||||
|
||||
/* First try if we allready have an appsession */
|
||||
asession_temp = &local_asession;
|
||||
|
||||
if ((asession_temp->sessid = pool_alloc_from(apools.sessid, apools.ses_msize)) == NULL) {
|
||||
Alert("Not enough memory process_cli():asession_temp->sessid:calloc().\n");
|
||||
send_log(t->proxy, LOG_ALERT, "Not enough Memory process_cli():asession_temp->sessid:calloc().\n");
|
||||
return 0;
|
||||
}
|
||||
|
||||
/* Copy the sessionid */
|
||||
memcpy(asession_temp->sessid, request_line, t->proxy->appsession_len);
|
||||
asession_temp->sessid[t->proxy->appsession_len] = 0;
|
||||
asession_temp->serverid = NULL;
|
||||
|
||||
/* only do insert, if lookup fails */
|
||||
if (chtbl_lookup(&(t->proxy->htbl_proxy), (void *)&asession_temp)) {
|
||||
if ((asession_temp = pool_alloc(appsess)) == NULL) {
|
||||
Alert("Not enough memory process_cli():asession:calloc().\n");
|
||||
send_log(t->proxy, LOG_ALERT, "Not enough memory process_cli():asession:calloc().\n");
|
||||
return 0;
|
||||
}
|
||||
asession_temp->sessid = local_asession.sessid;
|
||||
asession_temp->serverid = local_asession.serverid;
|
||||
chtbl_insert(&(t->proxy->htbl_proxy), (void *) asession_temp);
|
||||
} /* end if(chtbl_lookup()) */
|
||||
else{
|
||||
/*free wasted memory;*/
|
||||
pool_free_to(apools.sessid, local_asession.sessid);
|
||||
}
|
||||
|
||||
tv_delayfrom(&asession_temp->expire, &now, t->proxy->appsession_timeout);
|
||||
asession_temp->request_count++;
|
||||
|
||||
#if defined(DEBUG_HASH)
|
||||
print_table(&(t->proxy->htbl_proxy));
|
||||
#endif
|
||||
|
||||
if (asession_temp->serverid == NULL) {
|
||||
Alert("Found Application Session without matching server.\n");
|
||||
} else {
|
||||
struct server *srv = t->proxy->srv;
|
||||
while (srv) {
|
||||
if (strcmp(srv->id, asession_temp->serverid) == 0) {
|
||||
if (srv->state & SRV_RUNNING || t->proxy->options & PR_O_PERSIST) {
|
||||
/* we found the server and it's usable */
|
||||
t->flags &= ~SN_CK_MASK;
|
||||
t->flags |= SN_CK_VALID | SN_DIRECT;
|
||||
t->srv = srv;
|
||||
break;
|
||||
}else {
|
||||
t->flags &= ~SN_CK_MASK;
|
||||
t->flags |= SN_CK_DOWN;
|
||||
}
|
||||
}/* end if(strcmp()) */
|
||||
srv = srv->next;
|
||||
}/* end while(srv) */
|
||||
}/* end else of if (asession_temp->serverid == NULL) */
|
||||
|
||||
method_checked = 1;
|
||||
}/* end if(strncasecmp(request_line,t->proxy->appsession_name,apssesion_name_len) == 0) */
|
||||
else {
|
||||
//fprintf(stderr,">>>>>>>>>>>>>>>>>>>>>>NO SESSION\n");
|
||||
}
|
||||
}/* end if(!method_checked ...) */
|
||||
else{
|
||||
//printf("No Methode-Header with Session-String\n");
|
||||
}
|
||||
|
||||
if (t->logs.logwait & LW_REQ) {
|
||||
/* we have a complete HTTP request that we must log */
|
||||
int urilen;
|
||||
|
|
@ -2932,7 +3084,8 @@ int process_cli(struct session *t) {
|
|||
* remove it. If no application cookie persists in the header, we
|
||||
* *MUST* delete it
|
||||
*/
|
||||
if (!delete_header && (t->proxy->cookie_name != NULL || t->proxy->capture_name != NULL)
|
||||
if (!delete_header &&
|
||||
(t->proxy->cookie_name != NULL || t->proxy->capture_name != NULL || t->proxy->appsession_name !=NULL)
|
||||
&& !(t->flags & SN_CLDENY) && (ptr >= req->h + 8)
|
||||
&& (strncasecmp(req->h, "Cookie: ", 8) == 0)) {
|
||||
char *p1, *p2, *p3, *p4;
|
||||
|
|
@ -3001,12 +3154,12 @@ int process_cli(struct session *t) {
|
|||
|
||||
if ((t->logs.cli_cookie = pool_alloc(capture)) == NULL) {
|
||||
Alert("HTTP logging : out of memory.\n");
|
||||
} else {
|
||||
if (log_len > t->proxy->capture_len)
|
||||
log_len = t->proxy->capture_len;
|
||||
memcpy(t->logs.cli_cookie, p1, log_len);
|
||||
t->logs.cli_cookie[log_len] = 0;
|
||||
}
|
||||
|
||||
if (log_len > t->proxy->capture_len)
|
||||
log_len = t->proxy->capture_len;
|
||||
memcpy(t->logs.cli_cookie, p1, log_len);
|
||||
t->logs.cli_cookie[log_len] = 0;
|
||||
}
|
||||
|
||||
if ((p2 - p1 == t->proxy->cookie_len) && (t->proxy->cookie_name != NULL) &&
|
||||
|
|
@ -3051,8 +3204,7 @@ int process_cli(struct session *t) {
|
|||
t->flags |= SN_CK_VALID | SN_DIRECT;
|
||||
t->srv = srv;
|
||||
break;
|
||||
}
|
||||
else {
|
||||
} else {
|
||||
/* we found a server, but it's down */
|
||||
t->flags &= ~SN_CK_MASK;
|
||||
t->flags |= SN_CK_DOWN;
|
||||
|
|
@ -3086,8 +3238,7 @@ int process_cli(struct session *t) {
|
|||
del_cookie = p1;
|
||||
del_colon = colon;
|
||||
}
|
||||
}
|
||||
else {
|
||||
} else {
|
||||
/* now we know that we must keep this cookie since it's
|
||||
* not ours. But if we wanted to delete our cookie
|
||||
* earlier, we cannot remove the complete header, but we
|
||||
|
|
@ -3102,6 +3253,66 @@ int process_cli(struct session *t) {
|
|||
del_cookie = del_colon = NULL;
|
||||
}
|
||||
}
|
||||
|
||||
if ((t->proxy->appsession_name != NULL) &&
|
||||
(memcmp(p1, t->proxy->appsession_name, p2 - p1) == 0)) {
|
||||
/* first, let's see if the cookie is our appcookie*/
|
||||
|
||||
/* Cool... it's the right one */
|
||||
|
||||
asession_temp = &local_asession;
|
||||
|
||||
if ((asession_temp->sessid = pool_alloc_from(apools.sessid, apools.ses_msize)) == NULL) {
|
||||
Alert("Not enough memory process_cli():asession->sessid:malloc().\n");
|
||||
send_log(t->proxy, LOG_ALERT, "Not enough memory process_cli():asession->sessid:malloc().\n");
|
||||
return 0;
|
||||
}
|
||||
|
||||
memcpy(asession_temp->sessid, p3, t->proxy->appsession_len);
|
||||
asession_temp->sessid[t->proxy->appsession_len] = 0;
|
||||
asession_temp->serverid = NULL;
|
||||
|
||||
/* only do insert, if lookup fails */
|
||||
if (chtbl_lookup(&(t->proxy->htbl_proxy), (void *) &asession_temp) != 0) {
|
||||
if ((asession_temp = pool_alloc(appsess)) == NULL) {
|
||||
Alert("Not enough memory process_cli():asession:calloc().\n");
|
||||
send_log(t->proxy, LOG_ALERT, "Not enough memory process_cli():asession:calloc().\n");
|
||||
return 0;
|
||||
}
|
||||
|
||||
asession_temp->sessid = local_asession.sessid;
|
||||
asession_temp->serverid = local_asession.serverid;
|
||||
chtbl_insert(&(t->proxy->htbl_proxy), (void *) asession_temp);
|
||||
}
|
||||
else{
|
||||
/* free wasted memory */
|
||||
pool_free_to(apools.sessid, local_asession.sessid);
|
||||
}
|
||||
|
||||
if (asession_temp->serverid == NULL) {
|
||||
Alert("Found Application Session without matching server.\n");
|
||||
} else {
|
||||
struct server *srv = t->proxy->srv;
|
||||
while (srv) {
|
||||
if(strcmp(srv->id, asession_temp->serverid) == 0) {
|
||||
if (srv->state & SRV_RUNNING || t->proxy->options & PR_O_PERSIST) {
|
||||
/* we found the server and it's usable */
|
||||
t->flags &= ~SN_CK_MASK;
|
||||
t->flags |= SN_CK_VALID | SN_DIRECT;
|
||||
t->srv = srv;
|
||||
break;
|
||||
} else {
|
||||
t->flags &= ~SN_CK_MASK;
|
||||
t->flags |= SN_CK_DOWN;
|
||||
}
|
||||
}
|
||||
srv = srv->next;
|
||||
}/* end while(srv) */
|
||||
}/* end else if server == NULL */
|
||||
|
||||
tv_delayfrom(&asession_temp->expire, &now, t->proxy->appsession_timeout);
|
||||
break;
|
||||
}/* end if ((t->proxy->appsession_name != NULL) ... */
|
||||
}
|
||||
|
||||
/* we'll have to look for another cookie ... */
|
||||
|
|
@ -3413,6 +3624,8 @@ int process_srv(struct session *t) {
|
|||
int c = t->cli_state;
|
||||
struct buffer *req = t->req;
|
||||
struct buffer *rep = t->rep;
|
||||
appsess *asession_temp = NULL;
|
||||
appsess local_asession;
|
||||
|
||||
#ifdef DEBUG_FULL
|
||||
fprintf(stderr,"process_srv: c=%s, s=%s\n", cli_stnames[c], srv_stnames[s]);
|
||||
|
|
@ -3829,7 +4042,7 @@ int process_srv(struct session *t) {
|
|||
|
||||
/* check for server cookies */
|
||||
if (!delete_header /*&& (t->proxy->options & PR_O_COOK_ANY)*/
|
||||
&& (t->proxy->cookie_name != NULL || t->proxy->capture_name != NULL)
|
||||
&& (t->proxy->cookie_name != NULL || t->proxy->capture_name != NULL || t->proxy->appsession_name !=NULL)
|
||||
&& (strncasecmp(rep->h, "Set-Cookie: ", 12) == 0)) {
|
||||
char *p1, *p2, *p3, *p4;
|
||||
|
||||
|
|
@ -3915,6 +4128,58 @@ int process_srv(struct session *t) {
|
|||
}
|
||||
break;
|
||||
}
|
||||
|
||||
/* first, let's see if the cookie is our appcookie*/
|
||||
if ((t->proxy->appsession_name != NULL) &&
|
||||
(memcmp(p1, t->proxy->appsession_name, p2 - p1) == 0)) {
|
||||
|
||||
/* Cool... it's the right one */
|
||||
|
||||
size_t server_id_len = strlen(t->srv->id)+1;
|
||||
asession_temp = &local_asession;
|
||||
|
||||
if((asession_temp->sessid = pool_alloc_from(apools.sessid, apools.ses_msize)) == NULL){
|
||||
Alert("Not enought Memory process_srv():asession->sessid:malloc().\n");
|
||||
send_log(t->proxy, LOG_ALERT, "Not enought Memory process_srv():asession->sessid:malloc().\n");
|
||||
}
|
||||
memcpy(asession_temp->sessid, p3, t->proxy->appsession_len);
|
||||
asession_temp->sessid[t->proxy->appsession_len] = 0;
|
||||
asession_temp->serverid = NULL;
|
||||
|
||||
/* only do insert, if lookup fails */
|
||||
if (chtbl_lookup(&(t->proxy->htbl_proxy), (void *) &asession_temp) != 0) {
|
||||
if ((asession_temp = pool_alloc(appsess)) == NULL) {
|
||||
Alert("Not enought Memory process_srv():asession:calloc().\n");
|
||||
send_log(t->proxy, LOG_ALERT, "Not enought Memory process_srv():asession:calloc().\n");
|
||||
return 0;
|
||||
}
|
||||
asession_temp->sessid = local_asession.sessid;
|
||||
asession_temp->serverid = local_asession.serverid;
|
||||
chtbl_insert(&(t->proxy->htbl_proxy), (void *) asession_temp);
|
||||
}/* end if(chtbl_lookup()) */
|
||||
else
|
||||
{
|
||||
/* free wasted memory */
|
||||
pool_free_to(apools.sessid, local_asession.sessid);
|
||||
} /* end else from if(chtbl_lookup()) */
|
||||
|
||||
if(asession_temp->serverid == NULL){
|
||||
if((asession_temp->serverid = pool_alloc_from(apools.serverid, apools.ser_msize)) == NULL){
|
||||
Alert("Not enought Memory process_srv():asession->sessid:malloc().\n");
|
||||
send_log(t->proxy, LOG_ALERT, "Not enought Memory process_srv():asession->sessid:malloc().\n");
|
||||
}
|
||||
asession_temp->serverid[0] = '\0';
|
||||
}
|
||||
|
||||
if(asession_temp->serverid[0] == '\0') memcpy(asession_temp->serverid,t->srv->id,server_id_len);
|
||||
|
||||
tv_delayfrom(&asession_temp->expire, &now, t->proxy->appsession_timeout);
|
||||
|
||||
#if defined(DEBUG_HASH)
|
||||
print_table(&(t->proxy->htbl_proxy));
|
||||
#endif
|
||||
break;
|
||||
}/* end if ((t->proxy->appsession_name != NULL) ... */
|
||||
else {
|
||||
// fprintf(stderr,"Ignoring unknown cookie : ");
|
||||
// write(2, p1, p2-p1);
|
||||
|
|
@ -4830,6 +5095,39 @@ void dump(int sig) {
|
|||
}
|
||||
}
|
||||
|
||||
static void fast_stop(void)
|
||||
{
|
||||
struct proxy *p;
|
||||
p = proxy;
|
||||
while (p) {
|
||||
p->grace = 0;
|
||||
p = p->next;
|
||||
}
|
||||
soft_stop();
|
||||
}
|
||||
|
||||
void sig_int(int sig) {
|
||||
/* This would normally be a hard stop,
|
||||
but we want to be sure about deallocation,
|
||||
and so on, so we do a soft stop with
|
||||
0 GRACE time
|
||||
*/
|
||||
fast_stop();
|
||||
/* If we are killed twice, we decide to die*/
|
||||
signal(sig, SIG_DFL);
|
||||
}
|
||||
|
||||
void sig_term(int sig) {
|
||||
/* This would normally be a hard stop,
|
||||
but we want to be sure about deallocation,
|
||||
and so on, so we do a soft stop with
|
||||
0 GRACE time
|
||||
*/
|
||||
fast_stop();
|
||||
/* If we are killed twice, we decide to die*/
|
||||
signal(sig, SIG_DFL);
|
||||
}
|
||||
|
||||
void chain_regex(struct hdr_exp **head, regex_t *preg, int action, char *replace) {
|
||||
struct hdr_exp *exp;
|
||||
|
||||
|
|
@ -5003,6 +5301,7 @@ void init_default_instance() {
|
|||
int cfg_parse_listen(char *file, int linenum, char **args) {
|
||||
static struct proxy *curproxy = NULL;
|
||||
struct server *newsrv = NULL;
|
||||
int rc;
|
||||
|
||||
if (!strcmp(args[0], "listen")) { /* new proxy */
|
||||
if (!*args[1]) {
|
||||
|
|
@ -5195,7 +5494,36 @@ int cfg_parse_listen(char *file, int linenum, char **args) {
|
|||
file, linenum);
|
||||
return -1;
|
||||
}
|
||||
}
|
||||
}/* end else if (!strcmp(args[0], "cookie")) */
|
||||
else if (!strcmp(args[0], "appsession")) { /* cookie name */
|
||||
// if (curproxy == &defproxy) {
|
||||
// Alert("parsing [%s:%d] : '%s' not allowed in 'defaults' section.\n", file, linenum, args[0]);
|
||||
// return -1;
|
||||
// }
|
||||
|
||||
if (curproxy->appsession_name != NULL) {
|
||||
// Alert("parsing [%s:%d] : cookie name already specified. Continuing.\n",
|
||||
// file, linenum);
|
||||
// return 0;
|
||||
free(curproxy->appsession_name);
|
||||
}
|
||||
|
||||
if (*(args[5]) == 0) {
|
||||
Alert("parsing [%s:%d] : '%s' expects 'appsession' <cookie_name> 'len' <len> 'timeout' <timeout>.\n",
|
||||
file, linenum, args[0]);
|
||||
return -1;
|
||||
}
|
||||
have_appsession = 1;
|
||||
curproxy->appsession_name = strdup(args[1]);
|
||||
curproxy->appsession_name_len = strlen(curproxy->appsession_name);
|
||||
curproxy->appsession_len = atoi(args[3]);
|
||||
curproxy->appsession_timeout = atoi(args[5]);
|
||||
rc = chtbl_init(&(curproxy->htbl_proxy), TBLSIZ, hashpjw, match_str, destroy);
|
||||
if (rc) {
|
||||
Alert("Error Init Appsession Hashtable.\n");
|
||||
return -1;
|
||||
}
|
||||
} /* Url App Session */
|
||||
else if (!strcmp(args[0], "capture")) {
|
||||
if (!strcmp(args[1], "cookie")) { /* name of a cookie to capture */
|
||||
// if (curproxy == &defproxy) {
|
||||
|
|
@ -6438,10 +6766,13 @@ void init(int argc, char **argv) {
|
|||
|
||||
gethostname(hostname, MAX_HOSTNAME_LEN);
|
||||
|
||||
have_appsession = 0;
|
||||
if (readcfgfile(cfg_cfgfile) < 0) {
|
||||
Alert("Error reading configuration file : %s\n", cfg_cfgfile);
|
||||
exit(1);
|
||||
}
|
||||
if (have_appsession)
|
||||
appsession_init();
|
||||
|
||||
if (global.mode & MODE_CHECK) {
|
||||
qfprintf(stdout, "Configuration file is valid : %s\n", cfg_cfgfile);
|
||||
|
|
@ -6576,6 +6907,154 @@ int start_proxies() {
|
|||
return 0;
|
||||
}
|
||||
|
||||
int match_str(const void *key1, const void *key2){
|
||||
|
||||
appsess *temp1,*temp2;
|
||||
temp1 = (appsess *)key1;
|
||||
temp2 = (appsess *)key2;
|
||||
|
||||
//fprintf(stdout,">>>>>>>>>>>>>>temp1->sessid :%s:\n",temp1->sessid);
|
||||
//fprintf(stdout,">>>>>>>>>>>>>>temp2->sessid :%s:\n",temp2->sessid);
|
||||
|
||||
return (strcmp(temp1->sessid,temp2->sessid) == 0);
|
||||
}/* end match_str */
|
||||
|
||||
void destroy(void *data){
|
||||
appsess *temp1;
|
||||
|
||||
//printf("destroy called\n");
|
||||
temp1 = (appsess *)data;
|
||||
|
||||
if (temp1->sessid)
|
||||
pool_free_to(apools.sessid, temp1->sessid);
|
||||
|
||||
if (temp1->serverid)
|
||||
pool_free_to(apools.serverid, temp1->serverid);
|
||||
|
||||
pool_free(appsess, temp1);
|
||||
} /* end destroy */
|
||||
|
||||
void appsession_cleanup( void )
|
||||
{
|
||||
struct proxy *p = proxy;
|
||||
|
||||
while(p) {
|
||||
chtbl_destroy(&(p->htbl_proxy));
|
||||
p = p->next;
|
||||
}
|
||||
}/* end appsession_cleanup() */
|
||||
|
||||
void pool_destroy(void **pool)
|
||||
{
|
||||
void *temp, *next;
|
||||
next = pool;
|
||||
while (next) {
|
||||
temp = next;
|
||||
next = *(void **)temp;
|
||||
free(temp);
|
||||
}
|
||||
}/* end pool_destroy() */
|
||||
|
||||
void deinit(void){
|
||||
struct proxy *p = proxy;
|
||||
struct cap_hdr *h,*h_next;
|
||||
struct server *s,*s_next;
|
||||
struct listener *l,*l_next;
|
||||
|
||||
while (p) {
|
||||
if (p->id)
|
||||
free(p->id);
|
||||
|
||||
if (p->check_req)
|
||||
free(p->check_req);
|
||||
|
||||
if (p->cookie_name)
|
||||
free(p->cookie_name);
|
||||
|
||||
if (p->capture_name)
|
||||
free(p->capture_name);
|
||||
|
||||
/* only strup if the user have set in config.
|
||||
When should we free it?!
|
||||
if(p->errmsg.msg400) free(p->errmsg.msg400);
|
||||
if(p->errmsg.msg403) free(p->errmsg.msg403);
|
||||
if(p->errmsg.msg408) free(p->errmsg.msg408);
|
||||
if(p->errmsg.msg500) free(p->errmsg.msg500);
|
||||
if(p->errmsg.msg502) free(p->errmsg.msg502);
|
||||
if(p->errmsg.msg503) free(p->errmsg.msg503);
|
||||
if(p->errmsg.msg504) free(p->errmsg.msg504);
|
||||
*/
|
||||
if (p->appsession_name)
|
||||
free(p->appsession_name);
|
||||
|
||||
h = p->req_cap;
|
||||
while (h) {
|
||||
h_next = h->next;
|
||||
if (h->name)
|
||||
free(h->name);
|
||||
pool_destroy(h->pool);
|
||||
free(h);
|
||||
h = h_next;
|
||||
}/* end while(h) */
|
||||
|
||||
h = p->rsp_cap;
|
||||
while (h) {
|
||||
h_next = h->next;
|
||||
if (h->name)
|
||||
free(h->name);
|
||||
|
||||
pool_destroy(h->pool);
|
||||
free(h);
|
||||
h = h_next;
|
||||
}/* end while(h) */
|
||||
|
||||
s = p->srv;
|
||||
while (s) {
|
||||
s_next = s->next;
|
||||
if(s->id)
|
||||
free(s->id);
|
||||
|
||||
if(s->cookie)
|
||||
free(s->cookie);
|
||||
|
||||
free(s);
|
||||
s = s_next;
|
||||
}/* end while(s) */
|
||||
|
||||
l = p->listen;
|
||||
while (l) {
|
||||
l_next = l->next;
|
||||
free(l);
|
||||
l = l_next;
|
||||
}/* end while(l) */
|
||||
|
||||
pool_destroy((void **) p->req_cap_pool);
|
||||
pool_destroy((void **) p->rsp_cap_pool);
|
||||
p = p->next;
|
||||
}/* end while(p) */
|
||||
|
||||
if (global.chroot) free(global.chroot);
|
||||
if (global.pidfile) free(global.pidfile);
|
||||
|
||||
if (ReadEvent) free(ReadEvent);
|
||||
if (WriteEvent) free(WriteEvent);
|
||||
if (StaticReadEvent) free(StaticReadEvent);
|
||||
if (StaticWriteEvent) free(StaticWriteEvent);
|
||||
if (fdtab) free(fdtab);
|
||||
|
||||
pool_destroy(pool_session);
|
||||
pool_destroy(pool_buffer);
|
||||
pool_destroy(pool_fdtab);
|
||||
pool_destroy(pool_requri);
|
||||
pool_destroy(pool_task);
|
||||
pool_destroy(pool_capture);
|
||||
pool_destroy(pool_appsess);
|
||||
|
||||
if (have_appsession) {
|
||||
pool_destroy(apools.serverid);
|
||||
pool_destroy(apools.sessid);
|
||||
}
|
||||
} /* end deinit() */
|
||||
|
||||
int main(int argc, char **argv) {
|
||||
FILE *pidfile = NULL;
|
||||
|
|
@ -6590,6 +7069,8 @@ int main(int argc, char **argv) {
|
|||
signal(SIGQUIT, dump);
|
||||
signal(SIGUSR1, sig_soft_stop);
|
||||
signal(SIGHUP, sig_dump_state);
|
||||
signal(SIGINT, sig_int);
|
||||
signal(SIGTERM, sig_term);
|
||||
|
||||
/* on very high loads, a sigpipe sometimes happen just between the
|
||||
* getsockopt() which tells "it's OK to write", and the following write :-(
|
||||
|
|
@ -6676,5 +7157,152 @@ int main(int argc, char **argv) {
|
|||
|
||||
select_loop();
|
||||
|
||||
/* Free all Hash Keys and all Hash elements */
|
||||
appsession_cleanup();
|
||||
/* Do some cleanup */
|
||||
deinit();
|
||||
|
||||
exit(0);
|
||||
}
|
||||
|
||||
#if defined(DEBUG_HASH)
|
||||
static void print_table(const CHTbl *htbl) {
|
||||
|
||||
ListElmt *element;
|
||||
int i;
|
||||
appsess *asession;
|
||||
|
||||
/*****************************************************************************
|
||||
* *
|
||||
* Display the chained hash table. *
|
||||
* *
|
||||
*****************************************************************************/
|
||||
|
||||
fprintf(stdout, "Table size is %d\n", chtbl_size(htbl));
|
||||
|
||||
for (i = 0; i < TBLSIZ; i++) {
|
||||
fprintf(stdout, "Bucket[%03d]\n", i);
|
||||
|
||||
for (element = list_head(&htbl->table[i]); element != NULL; element = list_next(element)) {
|
||||
//fprintf(stdout, "%c", *(char *)list_data(element));
|
||||
asession = (appsess *)list_data(element);
|
||||
fprintf(stdout, "ELEM :%s:", asession->sessid);
|
||||
fprintf(stdout, " Server :%s: \n", asession->serverid);
|
||||
//fprintf(stdout, " Server request_count :%li:\n",asession->request_count);
|
||||
}
|
||||
|
||||
fprintf(stdout, "\n");
|
||||
}
|
||||
return;
|
||||
} /* end print_table */
|
||||
#endif
|
||||
|
||||
static int appsession_init(void)
|
||||
{
|
||||
static int initialized = 0;
|
||||
int idlen;
|
||||
struct server *s;
|
||||
struct proxy *p = proxy;
|
||||
|
||||
if (!initialized) {
|
||||
if (!appsession_task_init()) {
|
||||
apools.sessid = NULL;
|
||||
apools.serverid = NULL;
|
||||
apools.ser_waste = 0;
|
||||
apools.ser_use = 0;
|
||||
apools.ser_msize = sizeof(void *);
|
||||
apools.ses_waste = 0;
|
||||
apools.ses_use = 0;
|
||||
apools.ses_msize = sizeof(void *);
|
||||
while (p) {
|
||||
s = p->srv;
|
||||
if (apools.ses_msize < p->appsession_len)
|
||||
apools.ses_msize = p->appsession_len;
|
||||
while (s) {
|
||||
idlen = strlen(s->id);
|
||||
if (apools.ser_msize < idlen)
|
||||
apools.ser_msize = idlen;
|
||||
s = s->next;
|
||||
}
|
||||
p = p->next;
|
||||
}
|
||||
apools.ser_msize ++; /* we use strings, so reserve space for '\0' */
|
||||
apools.ses_msize ++;
|
||||
}
|
||||
else {
|
||||
fprintf(stderr, "appsession_task_init failed\n");
|
||||
return -1;
|
||||
}
|
||||
initialized ++;
|
||||
}
|
||||
return 0;
|
||||
}
|
||||
|
||||
static int appsession_task_init(void)
|
||||
{
|
||||
static int initialized = 0;
|
||||
struct task *t;
|
||||
if (!initialized) {
|
||||
if ((t = pool_alloc(task)) == NULL)
|
||||
return -1;
|
||||
t->next = t->prev = t->rqnext = NULL;
|
||||
t->wq = LIST_HEAD(wait_queue);
|
||||
t->state = TASK_IDLE;
|
||||
t->context = NULL;
|
||||
tv_delayfrom(&t->expire, &now, TBLCHKINT);
|
||||
task_queue(t);
|
||||
t->process = appsession_refresh;
|
||||
initialized ++;
|
||||
}
|
||||
return 0;
|
||||
}
|
||||
|
||||
static int appsession_refresh(struct task *t) {
|
||||
struct proxy *p = proxy;
|
||||
CHTbl *htbl;
|
||||
ListElmt *element, *last;
|
||||
int i;
|
||||
appsess *asession;
|
||||
void *data;
|
||||
|
||||
while (p) {
|
||||
if (p->appsession_name != NULL) {
|
||||
htbl = &p->htbl_proxy;
|
||||
/* if we ever give up the use of TBLSIZ, we need to change this */
|
||||
for (i = 0; i < TBLSIZ; i++) {
|
||||
last = NULL;
|
||||
for (element = list_head(&htbl->table[i]); element != NULL; element = list_next(element)) {
|
||||
asession = (appsess *)list_data(element);
|
||||
if (tv_cmp2_ms(&asession->expire, &now) <= 0) {
|
||||
if ((global.mode & MODE_DEBUG) && (!(global.mode & MODE_QUIET) || (global.mode & MODE_VERBOSE))) {
|
||||
int len;
|
||||
/*
|
||||
on Linux NULL pointers are catched by sprintf, on solaris -> segfault
|
||||
*/
|
||||
len = sprintf(trash, "appsession_refresh: cleaning up expired Session '%s' on Server %s\n",
|
||||
asession->sessid, asession->serverid?asession->serverid:"(null)");
|
||||
write(1, trash, len);
|
||||
}
|
||||
/* delete the expired element from within the hash table */
|
||||
if ((list_rem_next(&htbl->table[i], last, (void **)&data) == 0)
|
||||
&& (htbl->table[i].destroy != NULL)) {
|
||||
htbl->table[i].destroy(data);
|
||||
}
|
||||
if (last == NULL) {/* patient lost his head, get a new one */
|
||||
element = list_head(&htbl->table[i]);
|
||||
if (element == NULL) break; /* no heads left, go to next patient */
|
||||
}
|
||||
else
|
||||
element = last;
|
||||
}/* end if (tv_cmp2_ms(&asession->expire, &now) <= 0) */
|
||||
else
|
||||
last = element;
|
||||
}/* end for (element = list_head(&htbl->table[i]); element != NULL; element = list_next(element)) */
|
||||
}
|
||||
}
|
||||
p = p->next;
|
||||
}
|
||||
tv_delayfrom(&t->expire, &now, TBLCHKINT); /* check expiration every 5 seconds */
|
||||
return TBLCHKINT;
|
||||
} /* end appsession_refresh */
|
||||
|
||||
|
|
|
|||
62
include/chtbl.h
Normal file
62
include/chtbl.h
Normal file
|
|
@ -0,0 +1,62 @@
|
|||
/*
|
||||
This File is copied from
|
||||
|
||||
http://www.oreilly.com/catalog/masteralgoc/index.html
|
||||
Mastering Algorithms with C
|
||||
By Kyle Loudon
|
||||
ISBN: 1-56592-453-3
|
||||
Publishd by O'Reilly
|
||||
|
||||
*/
|
||||
|
||||
/*****************************************************************************
|
||||
* *
|
||||
* ------------------------------- chtbl.h -------------------------------- *
|
||||
* *
|
||||
*****************************************************************************/
|
||||
|
||||
#ifndef CHTBL_H
|
||||
#define CHTBL_H
|
||||
|
||||
#include <stdlib.h>
|
||||
|
||||
#include "list.h"
|
||||
|
||||
/*****************************************************************************
|
||||
* *
|
||||
* Define a structure for chained hash tables. *
|
||||
* *
|
||||
*****************************************************************************/
|
||||
|
||||
typedef struct CHTbl_ {
|
||||
|
||||
int buckets;
|
||||
|
||||
int (*h)(const void *key);
|
||||
int (*match)(const void *key1, const void *key2);
|
||||
void (*destroy)(void *data);
|
||||
|
||||
int size;
|
||||
List *table;
|
||||
} CHTbl;
|
||||
|
||||
/*****************************************************************************
|
||||
* *
|
||||
* --------------------------- Public Interface --------------------------- *
|
||||
* *
|
||||
*****************************************************************************/
|
||||
|
||||
int chtbl_init(CHTbl *htbl, int buckets, int (*h)(const void *key), int
|
||||
(*match)(const void *key1, const void *key2), void (*destroy)(void *data));
|
||||
|
||||
void chtbl_destroy(CHTbl *htbl);
|
||||
|
||||
int chtbl_insert(CHTbl *htbl, const void *data);
|
||||
|
||||
int chtbl_remove(CHTbl *htbl, void **data);
|
||||
|
||||
int chtbl_lookup(const CHTbl *htbl, void **data);
|
||||
|
||||
#define chtbl_size(htbl) ((htbl)->size)
|
||||
|
||||
#endif
|
||||
47
include/hashpjw.h
Normal file
47
include/hashpjw.h
Normal file
|
|
@ -0,0 +1,47 @@
|
|||
/*
|
||||
This File is copied from
|
||||
|
||||
http://www.oreilly.com/catalog/masteralgoc/index.html
|
||||
Mastering Algorithms with C
|
||||
By Kyle Loudon
|
||||
ISBN: 1-56592-453-3
|
||||
Publishd by O'Reilly
|
||||
|
||||
We have added our own struct to these function.
|
||||
*/
|
||||
|
||||
/*****************************************************************************
|
||||
* *
|
||||
* ------------------------------- hashpjw.h ------------------------------ *
|
||||
* *
|
||||
*****************************************************************************/
|
||||
|
||||
#ifndef HASHPJW_H
|
||||
#define HASHPJW_H
|
||||
|
||||
#include <sys/time.h>
|
||||
|
||||
typedef struct appsessions {
|
||||
char *sessid;
|
||||
char *serverid;
|
||||
struct timeval expire; /* next expiration time for this application session */
|
||||
unsigned long int request_count;
|
||||
} appsess; /* end struct appsessions */
|
||||
|
||||
/*****************************************************************************
|
||||
* *
|
||||
* Define a table size for demonstration purposes only. *
|
||||
* *
|
||||
*****************************************************************************/
|
||||
|
||||
#define PRIME_TBLSIZ 1699
|
||||
|
||||
/*****************************************************************************
|
||||
* *
|
||||
* --------------------------- Public Interface --------------------------- *
|
||||
* *
|
||||
*****************************************************************************/
|
||||
|
||||
int hashpjw(const void *key);
|
||||
|
||||
#endif
|
||||
78
include/list.h
Normal file
78
include/list.h
Normal file
|
|
@ -0,0 +1,78 @@
|
|||
/*
|
||||
This File is copied from
|
||||
|
||||
http://www.oreilly.com/catalog/masteralgoc/index.html
|
||||
Mastering Algorithms with C
|
||||
By Kyle Loudon
|
||||
ISBN: 1-56592-453-3
|
||||
Publishd by O'Reilly
|
||||
|
||||
*/
|
||||
|
||||
/*****************************************************************************
|
||||
* *
|
||||
* -------------------------------- list.h -------------------------------- *
|
||||
* *
|
||||
*****************************************************************************/
|
||||
|
||||
#ifndef LIST_H
|
||||
#define LIST_H
|
||||
|
||||
#include <stdlib.h>
|
||||
|
||||
/*****************************************************************************
|
||||
* *
|
||||
* Define a structure for linked list elements. *
|
||||
* *
|
||||
*****************************************************************************/
|
||||
|
||||
typedef struct ListElmt_ {
|
||||
|
||||
void *data;
|
||||
struct ListElmt_ *next;
|
||||
} ListElmt;
|
||||
|
||||
/*****************************************************************************
|
||||
* *
|
||||
* Define a structure for linked lists. *
|
||||
* *
|
||||
*****************************************************************************/
|
||||
|
||||
typedef struct List_ {
|
||||
int size;
|
||||
int (*match)(const void *key1, const void *key2);
|
||||
void (*destroy)(void *data);
|
||||
|
||||
ListElmt *head;
|
||||
ListElmt *tail;
|
||||
} List;
|
||||
|
||||
/*****************************************************************************
|
||||
* *
|
||||
* --------------------------- Public Interface --------------------------- *
|
||||
* *
|
||||
*****************************************************************************/
|
||||
|
||||
void list_init(List *list, void (*destroy)(void *data));
|
||||
|
||||
void list_destroy(List *list);
|
||||
|
||||
int list_ins_next(List *list, ListElmt *element, const void *data);
|
||||
|
||||
int list_rem_next(List *list, ListElmt *element, void **data);
|
||||
|
||||
#define list_size(list) ((list)->size)
|
||||
|
||||
#define list_head(list) ((list)->head)
|
||||
|
||||
#define list_tail(list) ((list)->tail)
|
||||
|
||||
#define list_is_head(list, element) ((element) == (list)->head ? 1 : 0)
|
||||
|
||||
#define list_is_tail(element) ((element)->next == NULL ? 1 : 0)
|
||||
|
||||
#define list_data(element) ((element)->data)
|
||||
|
||||
#define list_next(element) ((element)->next)
|
||||
|
||||
#endif
|
||||
260
src/chtbl.c
Normal file
260
src/chtbl.c
Normal file
|
|
@ -0,0 +1,260 @@
|
|||
/*
|
||||
This File is copied from
|
||||
|
||||
http://www.oreilly.com/catalog/masteralgoc/index.html
|
||||
Mastering Algorithms with C
|
||||
By Kyle Loudon
|
||||
ISBN: 1-56592-453-3
|
||||
Publishd by O'Reilly
|
||||
|
||||
*/
|
||||
|
||||
/*****************************************************************************
|
||||
* *
|
||||
* ------------------------------- chtbl.c -------------------------------- *
|
||||
* *
|
||||
*****************************************************************************/
|
||||
|
||||
#include <stdlib.h>
|
||||
#include <string.h>
|
||||
|
||||
#include <include/list.h>
|
||||
#include <include/chtbl.h>
|
||||
|
||||
/*****************************************************************************
|
||||
* *
|
||||
* ------------------------------ chtbl_init ------------------------------ *
|
||||
* *
|
||||
*****************************************************************************/
|
||||
|
||||
int chtbl_init(CHTbl *htbl, int buckets, int (*h)(const void *key), int
|
||||
(*match)(const void *key1, const void *key2), void (*destroy)(void*data)) {
|
||||
|
||||
int i;
|
||||
|
||||
/*****************************************************************************
|
||||
* *
|
||||
* Allocate space for the hash table. *
|
||||
* *
|
||||
*****************************************************************************/
|
||||
|
||||
if ((htbl->table = (List *)malloc(buckets * sizeof(List))) == NULL)
|
||||
return -1;
|
||||
|
||||
/*****************************************************************************
|
||||
* *
|
||||
* Initialize the buckets. *
|
||||
* *
|
||||
*****************************************************************************/
|
||||
|
||||
htbl->buckets = buckets;
|
||||
|
||||
for (i = 0; i < htbl->buckets; i++)
|
||||
list_init(&htbl->table[i], destroy);
|
||||
|
||||
/*****************************************************************************
|
||||
* *
|
||||
* Encapsulate the functions. *
|
||||
* *
|
||||
*****************************************************************************/
|
||||
|
||||
htbl->h = h;
|
||||
htbl->match = match;
|
||||
htbl->destroy = destroy;
|
||||
|
||||
/*****************************************************************************
|
||||
* *
|
||||
* Initialize the number of elements in the table. *
|
||||
* *
|
||||
*****************************************************************************/
|
||||
|
||||
htbl->size = 0;
|
||||
|
||||
return 0;
|
||||
} /* end chtbl_init () */
|
||||
|
||||
/*****************************************************************************
|
||||
* *
|
||||
* ---------------------------- chtbl_destroy ----------------------------- *
|
||||
* *
|
||||
*****************************************************************************/
|
||||
|
||||
void chtbl_destroy(CHTbl *htbl) {
|
||||
|
||||
int i;
|
||||
|
||||
/*****************************************************************************
|
||||
* *
|
||||
* Destroy each bucket. *
|
||||
* *
|
||||
*****************************************************************************/
|
||||
|
||||
for (i = 0; i < htbl->buckets; i++) {
|
||||
list_destroy(&htbl->table[i]);
|
||||
} /* end for () */
|
||||
|
||||
/*****************************************************************************
|
||||
* *
|
||||
* Free the storage allocated for the hash table. *
|
||||
* *
|
||||
*****************************************************************************/
|
||||
|
||||
free(htbl->table);
|
||||
|
||||
/*****************************************************************************
|
||||
* *
|
||||
* No operations are allowed now, but clear the structure as a precaution. *
|
||||
* *
|
||||
*****************************************************************************/
|
||||
|
||||
memset(htbl, 0, sizeof(CHTbl));
|
||||
|
||||
return;
|
||||
} /* end chtbl_destroy() */
|
||||
|
||||
/*****************************************************************************
|
||||
* *
|
||||
* ----------------------------- chtbl_insert ----------------------------- *
|
||||
* *
|
||||
*****************************************************************************/
|
||||
|
||||
int chtbl_insert(CHTbl *htbl, const void *data) {
|
||||
|
||||
void *temp;
|
||||
int bucket,retval;
|
||||
|
||||
/*****************************************************************************
|
||||
* *
|
||||
* Do nothing if the data is already in the table. *
|
||||
* *
|
||||
*****************************************************************************/
|
||||
|
||||
temp = (void *)data;
|
||||
|
||||
if (chtbl_lookup(htbl, &temp) == 0)
|
||||
return 1;
|
||||
|
||||
/*****************************************************************************
|
||||
* *
|
||||
* Hash the key. *
|
||||
* *
|
||||
*****************************************************************************/
|
||||
|
||||
bucket = htbl->h(data) % htbl->buckets;
|
||||
|
||||
/*****************************************************************************
|
||||
* *
|
||||
* Insert the data into the bucket. *
|
||||
* *
|
||||
*****************************************************************************/
|
||||
|
||||
if ((retval = list_ins_next(&htbl->table[bucket], NULL, data)) == 0)
|
||||
htbl->size++;
|
||||
|
||||
return retval;
|
||||
} /* end chtbl_insert() */
|
||||
|
||||
/*****************************************************************************
|
||||
* *
|
||||
* ----------------------------- chtbl_remove ----------------------------- *
|
||||
* *
|
||||
*****************************************************************************/
|
||||
|
||||
int chtbl_remove(CHTbl *htbl, void **data) {
|
||||
|
||||
ListElmt *element, *prev;
|
||||
int bucket;
|
||||
|
||||
/*****************************************************************************
|
||||
* *
|
||||
* Hash the key. *
|
||||
* *
|
||||
*****************************************************************************/
|
||||
|
||||
bucket = htbl->h(*data) % htbl->buckets;
|
||||
|
||||
/*****************************************************************************
|
||||
* *
|
||||
* Search for the data in the bucket. *
|
||||
* *
|
||||
*****************************************************************************/
|
||||
|
||||
prev = NULL;
|
||||
|
||||
for (element = list_head(&htbl->table[bucket]); element != NULL; element = list_next(element)) {
|
||||
if (htbl->match(*data, list_data(element))) {
|
||||
|
||||
/***********************************************************************
|
||||
* *
|
||||
* Remove the data from the bucket. *
|
||||
* *
|
||||
***********************************************************************/
|
||||
|
||||
if (list_rem_next(&htbl->table[bucket], prev, data) == 0) {
|
||||
htbl->size--;
|
||||
return 0;
|
||||
} /* end if() */
|
||||
else {
|
||||
return -1;
|
||||
}/* end else */
|
||||
}/* end if (htbl->match(*data, list_data(element))) */
|
||||
|
||||
prev = element;
|
||||
}/* end for() */
|
||||
|
||||
/*****************************************************************************
|
||||
* *
|
||||
* Return that the data was not found. *
|
||||
* *
|
||||
*****************************************************************************/
|
||||
|
||||
return -1;
|
||||
} /* end int chtbl_remove(CHTbl *htbl, void **data) */
|
||||
|
||||
/*****************************************************************************
|
||||
* *
|
||||
* ----------------------------- chtbl_lookup ----------------------------- *
|
||||
* *
|
||||
*****************************************************************************/
|
||||
|
||||
int chtbl_lookup(const CHTbl *htbl, void **data) {
|
||||
|
||||
ListElmt *element;
|
||||
int bucket;
|
||||
|
||||
/*****************************************************************************
|
||||
* *
|
||||
* Hash the key. *
|
||||
* *
|
||||
*****************************************************************************/
|
||||
|
||||
bucket = htbl->h(*data) % htbl->buckets;
|
||||
|
||||
/*****************************************************************************
|
||||
* *
|
||||
* Search for the data in the bucket. *
|
||||
* *
|
||||
*****************************************************************************/
|
||||
|
||||
for (element = list_head(&htbl->table[bucket]); element != NULL; element = list_next(element)) {
|
||||
if (htbl->match(*data, list_data(element))) {
|
||||
|
||||
/***********************************************************************
|
||||
* *
|
||||
* Pass back the data from the table. *
|
||||
* *
|
||||
***********************************************************************/
|
||||
|
||||
*data = list_data(element);
|
||||
return 0;
|
||||
}/* end if() */
|
||||
}/* end for() */
|
||||
|
||||
/*****************************************************************************
|
||||
* *
|
||||
* Return that the data was not found. *
|
||||
* *
|
||||
*****************************************************************************/
|
||||
|
||||
return -1;
|
||||
} /* end chtbl_lookup() */
|
||||
62
src/hashpjw.c
Normal file
62
src/hashpjw.c
Normal file
|
|
@ -0,0 +1,62 @@
|
|||
/*
|
||||
This File is copied from
|
||||
|
||||
http://www.oreilly.com/catalog/masteralgoc/index.html
|
||||
Mastering Algorithms with C
|
||||
By Kyle Loudon
|
||||
ISBN: 1-56592-453-3
|
||||
Publishd by O'Reilly
|
||||
|
||||
We have added our own struct to these function.
|
||||
*/
|
||||
|
||||
/*****************************************************************************
|
||||
* *
|
||||
* ------------------------------- hashpjw.c ------------------------------ *
|
||||
* *
|
||||
*****************************************************************************/
|
||||
|
||||
#include <include/hashpjw.h>
|
||||
|
||||
/*****************************************************************************
|
||||
* *
|
||||
* -------------------------------- hashpjw ------------------------------- *
|
||||
* *
|
||||
*****************************************************************************/
|
||||
|
||||
int hashpjw(const void *key) {
|
||||
|
||||
const char *ptr;
|
||||
unsigned int val;
|
||||
AppSess *appsession_temp;
|
||||
|
||||
/*****************************************************************************
|
||||
* *
|
||||
* Hash the key by performing a number of bit operations on it. *
|
||||
* *
|
||||
*****************************************************************************/
|
||||
|
||||
val = 0;
|
||||
appsession_temp = (AppSess *)key;
|
||||
ptr = appsession_temp->sessid;
|
||||
|
||||
while (*ptr != '\0') {
|
||||
|
||||
int tmp;
|
||||
|
||||
val = (val << 4) + (*ptr);
|
||||
|
||||
if((tmp = (val & 0xf0000000))) {
|
||||
val = val ^ (tmp >> 24);
|
||||
val = val ^ tmp;
|
||||
}
|
||||
ptr++;
|
||||
}/* end while */
|
||||
|
||||
/*****************************************************************************
|
||||
* *
|
||||
* In practice, replace PRIME_TBLSIZ with the actual table size. *
|
||||
* *
|
||||
*****************************************************************************/
|
||||
return val % PRIME_TBLSIZ;
|
||||
}/* end hashpjw */
|
||||
228
src/list.c
Normal file
228
src/list.c
Normal file
|
|
@ -0,0 +1,228 @@
|
|||
/*
|
||||
This File is copied from
|
||||
|
||||
http://www.oreilly.com/catalog/masteralgoc/index.html
|
||||
Mastering Algorithms with C
|
||||
By Kyle Loudon
|
||||
ISBN: 1-56592-453-3
|
||||
Publishd by O'Reilly
|
||||
|
||||
*/
|
||||
|
||||
/*****************************************************************************
|
||||
* *
|
||||
* -------------------------------- list.c -------------------------------- *
|
||||
* *
|
||||
*****************************************************************************/
|
||||
|
||||
#include <stdlib.h>
|
||||
#include <string.h>
|
||||
|
||||
#include <include/list.h>
|
||||
|
||||
/*****************************************************************************
|
||||
* *
|
||||
* ------------------------------- list_init ------------------------------ *
|
||||
* *
|
||||
*****************************************************************************/
|
||||
|
||||
void list_init(List *list, void (*destroy)(void *data)) {
|
||||
|
||||
/*****************************************************************************
|
||||
* *
|
||||
* Initialize the list. *
|
||||
* *
|
||||
*****************************************************************************/
|
||||
|
||||
list->size = 0;
|
||||
list->destroy = destroy;
|
||||
list->head = NULL;
|
||||
list->tail = NULL;
|
||||
return;
|
||||
} /* end list_init() */
|
||||
|
||||
/*****************************************************************************
|
||||
* *
|
||||
* ----------------------------- list_destroy ----------------------------- *
|
||||
* *
|
||||
*****************************************************************************/
|
||||
|
||||
void list_destroy(List *list) {
|
||||
|
||||
void *data;
|
||||
int rc;
|
||||
|
||||
/*****************************************************************************
|
||||
* *
|
||||
* Remove each element. *
|
||||
* *
|
||||
*****************************************************************************/
|
||||
|
||||
while (list_size(list) > 0) {
|
||||
|
||||
rc = list_rem_next(list, NULL, (void **)&data);
|
||||
|
||||
if (( rc == 0) && (list->destroy != NULL)) {
|
||||
|
||||
/***********************************************************************
|
||||
* *
|
||||
* Call a user-defined function to free dynamically allocated data. *
|
||||
* *
|
||||
***********************************************************************/
|
||||
|
||||
list->destroy(data);
|
||||
}/* end if() */
|
||||
}/* end while() */
|
||||
|
||||
/*****************************************************************************
|
||||
* *
|
||||
* No operations are allowed now, but clear the structure as a precaution. *
|
||||
* *
|
||||
*****************************************************************************/
|
||||
|
||||
memset(list, 0, sizeof(List));
|
||||
return;
|
||||
} /* void list_destroy(List *list) */
|
||||
|
||||
/*****************************************************************************
|
||||
* *
|
||||
* ----------------------------- list_ins_next ---------------------------- *
|
||||
* *
|
||||
*****************************************************************************/
|
||||
|
||||
int list_ins_next(List *list, ListElmt *element, const void *data) {
|
||||
|
||||
ListElmt *new_element;
|
||||
|
||||
/*****************************************************************************
|
||||
* *
|
||||
* Allocate storage for the element. *
|
||||
* *
|
||||
*****************************************************************************/
|
||||
|
||||
if ((new_element = (ListElmt *)malloc(sizeof(ListElmt))) == NULL)
|
||||
return -1;
|
||||
|
||||
/*****************************************************************************
|
||||
* *
|
||||
* Insert the element into the list. *
|
||||
* *
|
||||
*****************************************************************************/
|
||||
|
||||
new_element->data = (void *)data;
|
||||
|
||||
if (element == NULL) {
|
||||
|
||||
/**************************************************************************
|
||||
* *
|
||||
* Handle insertion at the head of the list. *
|
||||
* *
|
||||
**************************************************************************/
|
||||
|
||||
if (list_size(list) == 0)
|
||||
list->tail = new_element;
|
||||
|
||||
new_element->next = list->head;
|
||||
list->head = new_element;
|
||||
}/* end if (element == NULL) */
|
||||
else {
|
||||
|
||||
/**************************************************************************
|
||||
* *
|
||||
* Handle insertion somewhere other than at the head. *
|
||||
* *
|
||||
**************************************************************************/
|
||||
|
||||
if (element->next == NULL)
|
||||
list->tail = new_element;
|
||||
|
||||
new_element->next = element->next;
|
||||
element->next = new_element;
|
||||
}/* end else */
|
||||
|
||||
/*****************************************************************************
|
||||
* *
|
||||
* Adjust the size of the list to account for the inserted element. *
|
||||
* *
|
||||
*****************************************************************************/
|
||||
|
||||
list->size++;
|
||||
return 0;
|
||||
} /* end list_ins_next() */
|
||||
|
||||
/*****************************************************************************
|
||||
* *
|
||||
* ----------------------------- list_rem_next ---------------------------- *
|
||||
* *
|
||||
*****************************************************************************/
|
||||
|
||||
int list_rem_next(List *list, ListElmt *element, void **data) {
|
||||
|
||||
ListElmt *old_element;
|
||||
|
||||
/*****************************************************************************
|
||||
* *
|
||||
* Do not allow removal from an empty list. *
|
||||
* *
|
||||
*****************************************************************************/
|
||||
|
||||
if (list_size(list) == 0)
|
||||
return -1;
|
||||
|
||||
/*****************************************************************************
|
||||
* *
|
||||
* Remove the element from the list. *
|
||||
* *
|
||||
*****************************************************************************/
|
||||
|
||||
if (element == NULL) {
|
||||
|
||||
/**************************************************************************
|
||||
* *
|
||||
* Handle removal from the head of the list. *
|
||||
* *
|
||||
**************************************************************************/
|
||||
|
||||
*data = list->head->data;
|
||||
old_element = list->head;
|
||||
list->head = list->head->next;
|
||||
|
||||
if (list_size(list) == 1)
|
||||
list->tail = NULL;
|
||||
}/* end if (element == NULL) */
|
||||
else {
|
||||
|
||||
/**************************************************************************
|
||||
* *
|
||||
* Handle removal from somewhere other than the head. *
|
||||
* *
|
||||
**************************************************************************/
|
||||
|
||||
if (element->next == NULL)
|
||||
return -1;
|
||||
|
||||
*data = element->next->data;
|
||||
old_element = element->next;
|
||||
element->next = element->next->next;
|
||||
|
||||
if (element->next == NULL)
|
||||
list->tail = element;
|
||||
}/* end else */
|
||||
|
||||
/*****************************************************************************
|
||||
* *
|
||||
* Free the storage allocated by the abstract data type. *
|
||||
* *
|
||||
*****************************************************************************/
|
||||
|
||||
free(old_element);
|
||||
|
||||
/*****************************************************************************
|
||||
* *
|
||||
* Adjust the size of the list to account for the removed element. *
|
||||
* *
|
||||
*****************************************************************************/
|
||||
|
||||
list->size--;
|
||||
return 0;
|
||||
}
|
||||
Loading…
Reference in a new issue